first commit

.venv/Lib/site-packages/pandas/__init__.py

@@ -0,0 +1,421 @@
+# flake8: noqa
+
+__docformat__ = "restructuredtext"
+
+# Let users know if they're missing any of our hard dependencies
+hard_dependencies = ("numpy", "pytz", "dateutil")
+missing_dependencies = []
+
+for dependency in hard_dependencies:
+    try:
+        __import__(dependency)
+    except ImportError as e:
+        missing_dependencies.append(f"{dependency}: {e}")
+
+if missing_dependencies:
+    raise ImportError(
+        "Unable to import required dependencies:\n" + "\n".join(missing_dependencies)
+    )
+del hard_dependencies, dependency, missing_dependencies
+
+# numpy compat
+from pandas.compat import is_numpy_dev as _is_numpy_dev
+
+try:
+    from pandas._libs import hashtable as _hashtable, lib as _lib, tslib as _tslib
+except ImportError as err:  # pragma: no cover
+    module = err.name
+    raise ImportError(
+        f"C extension: {module} not built. If you want to import "
+        "pandas from the source directory, you may need to run "
+        "'python setup.py build_ext --force' to build the C extensions first."
+    ) from err
+else:
+    del _tslib, _lib, _hashtable
+
+from pandas._config import (
+    get_option,
+    set_option,
+    reset_option,
+    describe_option,
+    option_context,
+    options,
+)
+
+# let init-time option registration happen
+import pandas.core.config_init
+
+from pandas.core.api import (
+    # dtype
+    Int8Dtype,
+    Int16Dtype,
+    Int32Dtype,
+    Int64Dtype,
+    UInt8Dtype,
+    UInt16Dtype,
+    UInt32Dtype,
+    UInt64Dtype,
+    Float32Dtype,
+    Float64Dtype,
+    CategoricalDtype,
+    PeriodDtype,
+    IntervalDtype,
+    DatetimeTZDtype,
+    StringDtype,
+    BooleanDtype,
+    # missing
+    NA,
+    isna,
+    isnull,
+    notna,
+    notnull,
+    # indexes
+    Index,
+    CategoricalIndex,
+    RangeIndex,
+    MultiIndex,
+    IntervalIndex,
+    TimedeltaIndex,
+    DatetimeIndex,
+    PeriodIndex,
+    IndexSlice,
+    # tseries
+    NaT,
+    Period,
+    period_range,
+    Timedelta,
+    timedelta_range,
+    Timestamp,
+    date_range,
+    bdate_range,
+    Interval,
+    interval_range,
+    DateOffset,
+    # conversion
+    to_numeric,
+    to_datetime,
+    to_timedelta,
+    # misc
+    Flags,
+    Grouper,
+    factorize,
+    unique,
+    value_counts,
+    NamedAgg,
+    array,
+    Categorical,
+    set_eng_float_format,
+    Series,
+    DataFrame,
+)
+
+from pandas.core.arrays.sparse import SparseDtype
+
+from pandas.tseries.api import infer_freq
+from pandas.tseries import offsets
+
+from pandas.core.computation.api import eval
+
+from pandas.core.reshape.api import (
+    concat,
+    lreshape,
+    melt,
+    wide_to_long,
+    merge,
+    merge_asof,
+    merge_ordered,
+    crosstab,
+    pivot,
+    pivot_table,
+    get_dummies,
+    cut,
+    qcut,
+)
+
+from pandas import api, arrays, errors, io, plotting, testing, tseries
+from pandas.util._print_versions import show_versions
+
+from pandas.io.api import (
+    # excel
+    ExcelFile,
+    ExcelWriter,
+    read_excel,
+    # parsers
+    read_csv,
+    read_fwf,
+    read_table,
+    # pickle
+    read_pickle,
+    to_pickle,
+    # pytables
+    HDFStore,
+    read_hdf,
+    # sql
+    read_sql,
+    read_sql_query,
+    read_sql_table,
+    # misc
+    read_clipboard,
+    read_parquet,
+    read_orc,
+    read_feather,
+    read_gbq,
+    read_html,
+    read_xml,
+    read_json,
+    read_stata,
+    read_sas,
+    read_spss,
+)
+
+from pandas.io.json import _json_normalize as json_normalize
+
+from pandas.util._tester import test
+
+# use the closest tagged version if possible
+from pandas._version import get_versions
+
+v = get_versions()
+__version__ = v.get("closest-tag", v["version"])
+__git_version__ = v.get("full-revisionid")
+del get_versions, v
+
+# GH 27101
+__deprecated_num_index_names = ["Float64Index", "Int64Index", "UInt64Index"]
+
+
+def __dir__():
+    # GH43028
+    # Int64Index etc. are deprecated, but we still want them to be available in the dir.
+    # Remove in Pandas 2.0, when we remove Int64Index etc. from the code base.
+    return list(globals().keys()) + __deprecated_num_index_names
+
+
+def __getattr__(name):
+    import warnings
+
+    if name in __deprecated_num_index_names:
+        warnings.warn(
+            f"pandas.{name} is deprecated "
+            "and will be removed from pandas in a future version. "
+            "Use pandas.Index with the appropriate dtype instead.",
+            FutureWarning,
+            stacklevel=2,
+        )
+        from pandas.core.api import Float64Index, Int64Index, UInt64Index
+
+        return {
+            "Float64Index": Float64Index,
+            "Int64Index": Int64Index,
+            "UInt64Index": UInt64Index,
+        }[name]
+    elif name == "datetime":
+        warnings.warn(
+            "The pandas.datetime class is deprecated "
+            "and will be removed from pandas in a future version. "
+            "Import from datetime module instead.",
+            FutureWarning,
+            stacklevel=2,
+        )
+
+        from datetime import datetime as dt
+
+        return dt
+
+    elif name == "np":
+
+        warnings.warn(
+            "The pandas.np module is deprecated "
+            "and will be removed from pandas in a future version. "
+            "Import numpy directly instead.",
+            FutureWarning,
+            stacklevel=2,
+        )
+        import numpy as np
+
+        return np
+
+    elif name in {"SparseSeries", "SparseDataFrame"}:
+        warnings.warn(
+            f"The {name} class is removed from pandas. Accessing it from "
+            "the top-level namespace will also be removed in the next version.",
+            FutureWarning,
+            stacklevel=2,
+        )
+
+        return type(name, (), {})
+
+    elif name == "SparseArray":
+
+        warnings.warn(
+            "The pandas.SparseArray class is deprecated "
+            "and will be removed from pandas in a future version. "
+            "Use pandas.arrays.SparseArray instead.",
+            FutureWarning,
+            stacklevel=2,
+        )
+        from pandas.core.arrays.sparse import SparseArray as _SparseArray
+
+        return _SparseArray
+
+    raise AttributeError(f"module 'pandas' has no attribute '{name}'")
+
+
+# module level doc-string
+__doc__ = """
+pandas - a powerful data analysis and manipulation library for Python
+=====================================================================
+
+**pandas** is a Python package providing fast, flexible, and expressive data
+structures designed to make working with "relational" or "labeled" data both
+easy and intuitive. It aims to be the fundamental high-level building block for
+doing practical, **real world** data analysis in Python. Additionally, it has
+the broader goal of becoming **the most powerful and flexible open source data
+analysis / manipulation tool available in any language**. It is already well on
+its way toward this goal.
+
+Main Features
+-------------
+Here are just a few of the things that pandas does well:
+
+  - Easy handling of missing data in floating point as well as non-floating
+    point data.
+  - Size mutability: columns can be inserted and deleted from DataFrame and
+    higher dimensional objects
+  - Automatic and explicit data alignment: objects can be explicitly aligned
+    to a set of labels, or the user can simply ignore the labels and let
+    `Series`, `DataFrame`, etc. automatically align the data for you in
+    computations.
+  - Powerful, flexible group by functionality to perform split-apply-combine
+    operations on data sets, for both aggregating and transforming data.
+  - Make it easy to convert ragged, differently-indexed data in other Python
+    and NumPy data structures into DataFrame objects.
+  - Intelligent label-based slicing, fancy indexing, and subsetting of large
+    data sets.
+  - Intuitive merging and joining data sets.
+  - Flexible reshaping and pivoting of data sets.
+  - Hierarchical labeling of axes (possible to have multiple labels per tick).
+  - Robust IO tools for loading data from flat files (CSV and delimited),
+    Excel files, databases, and saving/loading data from the ultrafast HDF5
+    format.
+  - Time series-specific functionality: date range generation and frequency
+    conversion, moving window statistics, date shifting and lagging.
+"""
+
+# Use __all__ to let type checkers know what is part of the public API.
+# Pandas is not (yet) a py.typed library: the public API is determined
+# based on the documentation.
+__all__ = [
+    "BooleanDtype",
+    "Categorical",
+    "CategoricalDtype",
+    "CategoricalIndex",
+    "DataFrame",
+    "DateOffset",
+    "DatetimeIndex",
+    "DatetimeTZDtype",
+    "ExcelFile",
+    "ExcelWriter",
+    "Flags",
+    "Float32Dtype",
+    "Float64Dtype",
+    "Grouper",
+    "HDFStore",
+    "Index",
+    "IndexSlice",
+    "Int16Dtype",
+    "Int32Dtype",
+    "Int64Dtype",
+    "Int8Dtype",
+    "Interval",
+    "IntervalDtype",
+    "IntervalIndex",
+    "MultiIndex",
+    "NA",
+    "NaT",
+    "NamedAgg",
+    "Period",
+    "PeriodDtype",
+    "PeriodIndex",
+    "RangeIndex",
+    "Series",
+    "SparseDtype",
+    "StringDtype",
+    "Timedelta",
+    "TimedeltaIndex",
+    "Timestamp",
+    "UInt16Dtype",
+    "UInt32Dtype",
+    "UInt64Dtype",
+    "UInt8Dtype",
+    "api",
+    "array",
+    "arrays",
+    "bdate_range",
+    "concat",
+    "crosstab",
+    "cut",
+    "date_range",
+    "describe_option",
+    "errors",
+    "eval",
+    "factorize",
+    "get_dummies",
+    "get_option",
+    "infer_freq",
+    "interval_range",
+    "io",
+    "isna",
+    "isnull",
+    "json_normalize",
+    "lreshape",
+    "melt",
+    "merge",
+    "merge_asof",
+    "merge_ordered",
+    "notna",
+    "notnull",
+    "offsets",
+    "option_context",
+    "options",
+    "period_range",
+    "pivot",
+    "pivot_table",
+    "plotting",
+    "qcut",
+    "read_clipboard",
+    "read_csv",
+    "read_excel",
+    "read_feather",
+    "read_fwf",
+    "read_gbq",
+    "read_hdf",
+    "read_html",
+    "read_json",
+    "read_orc",
+    "read_parquet",
+    "read_pickle",
+    "read_sas",
+    "read_spss",
+    "read_sql",
+    "read_sql_query",
+    "read_sql_table",
+    "read_stata",
+    "read_table",
+    "read_xml",
+    "reset_option",
+    "set_eng_float_format",
+    "set_option",
+    "show_versions",
+    "test",
+    "testing",
+    "timedelta_range",
+    "to_datetime",
+    "to_numeric",
+    "to_pickle",
+    "to_timedelta",
+    "tseries",
+    "unique",
+    "value_counts",
+    "wide_to_long",
+]

.venv/Lib/site-packages/pandas/_config/__init__.py

@@ -0,0 +1,28 @@
+"""
+pandas._config is considered explicitly upstream of everything else in pandas,
+should have no intra-pandas dependencies.
+
+importing `dates` and `display` ensures that keys needed by _libs
+are initialized.
+"""
+__all__ = [
+    "config",
+    "detect_console_encoding",
+    "get_option",
+    "set_option",
+    "reset_option",
+    "describe_option",
+    "option_context",
+    "options",
+]
+from pandas._config import config
+from pandas._config import dates  # noqa:F401
+from pandas._config.config import (
+    describe_option,
+    get_option,
+    option_context,
+    options,
+    reset_option,
+    set_option,
+)
+from pandas._config.display import detect_console_encoding

.venv/Lib/site-packages/pandas/_config/config.py

@@ -0,0 +1,900 @@
+"""
+The config module holds package-wide configurables and provides
+a uniform API for working with them.
+
+Overview
+========
+
+This module supports the following requirements:
+- options are referenced using keys in dot.notation, e.g. "x.y.option - z".
+- keys are case-insensitive.
+- functions should accept partial/regex keys, when unambiguous.
+- options can be registered by modules at import time.
+- options can be registered at init-time (via core.config_init)
+- options have a default value, and (optionally) a description and
+  validation function associated with them.
+- options can be deprecated, in which case referencing them
+  should produce a warning.
+- deprecated options can optionally be rerouted to a replacement
+  so that accessing a deprecated option reroutes to a differently
+  named option.
+- options can be reset to their default value.
+- all option can be reset to their default value at once.
+- all options in a certain sub - namespace can be reset at once.
+- the user can set / get / reset or ask for the description of an option.
+- a developer can register and mark an option as deprecated.
+- you can register a callback to be invoked when the option value
+  is set or reset. Changing the stored value is considered misuse, but
+  is not verboten.
+
+Implementation
+==============
+
+- Data is stored using nested dictionaries, and should be accessed
+  through the provided API.
+
+- "Registered options" and "Deprecated options" have metadata associated
+  with them, which are stored in auxiliary dictionaries keyed on the
+  fully-qualified key, e.g. "x.y.z.option".
+
+- the config_init module is imported by the package's __init__.py file.
+  placing any register_option() calls there will ensure those options
+  are available as soon as pandas is loaded. If you use register_option
+  in a module, it will only be available after that module is imported,
+  which you should be aware of.
+
+- `config_prefix` is a context_manager (for use with the `with` keyword)
+  which can save developers some typing, see the docstring.
+
+"""
+
+from __future__ import annotations
+
+from contextlib import (
+    ContextDecorator,
+    contextmanager,
+)
+import re
+from typing import (
+    Any,
+    Callable,
+    Iterable,
+    NamedTuple,
+    cast,
+)
+import warnings
+
+from pandas._typing import F
+
+
+class DeprecatedOption(NamedTuple):
+    key: str
+    msg: str | None
+    rkey: str | None
+    removal_ver: str | None
+
+
+class RegisteredOption(NamedTuple):
+    key: str
+    defval: object
+    doc: str
+    validator: Callable[[object], Any] | None
+    cb: Callable[[str], Any] | None
+
+
+# holds deprecated option metadata
+_deprecated_options: dict[str, DeprecatedOption] = {}
+
+# holds registered option metadata
+_registered_options: dict[str, RegisteredOption] = {}
+
+# holds the current values for registered options
+_global_config: dict[str, Any] = {}
+
+# keys which have a special meaning
+_reserved_keys: list[str] = ["all"]
+
+
+class OptionError(AttributeError, KeyError):
+    """
+    Exception for pandas.options, backwards compatible with KeyError
+    checks.
+    """
+
+
+#
+# User API
+
+
+def _get_single_key(pat: str, silent: bool) -> str:
+    keys = _select_options(pat)
+    if len(keys) == 0:
+        if not silent:
+            _warn_if_deprecated(pat)
+        raise OptionError(f"No such keys(s): {repr(pat)}")
+    if len(keys) > 1:
+        raise OptionError("Pattern matched multiple keys")
+    key = keys[0]
+
+    if not silent:
+        _warn_if_deprecated(key)
+
+    key = _translate_key(key)
+
+    return key
+
+
+def _get_option(pat: str, silent: bool = False):
+    key = _get_single_key(pat, silent)
+
+    # walk the nested dict
+    root, k = _get_root(key)
+    return root[k]
+
+
+def _set_option(*args, **kwargs) -> None:
+    # must at least 1 arg deal with constraints later
+    nargs = len(args)
+    if not nargs or nargs % 2 != 0:
+        raise ValueError("Must provide an even number of non-keyword arguments")
+
+    # default to false
+    silent = kwargs.pop("silent", False)
+
+    if kwargs:
+        kwarg = list(kwargs.keys())[0]
+        raise TypeError(f'_set_option() got an unexpected keyword argument "{kwarg}"')
+
+    for k, v in zip(args[::2], args[1::2]):
+        key = _get_single_key(k, silent)
+
+        o = _get_registered_option(key)
+        if o and o.validator:
+            o.validator(v)
+
+        # walk the nested dict
+        root, k = _get_root(key)
+        root[k] = v
+
+        if o.cb:
+            if silent:
+                with warnings.catch_warnings(record=True):
+                    o.cb(key)
+            else:
+                o.cb(key)
+
+
+def _describe_option(pat: str = "", _print_desc: bool = True):
+
+    keys = _select_options(pat)
+    if len(keys) == 0:
+        raise OptionError("No such keys(s)")
+
+    s = "\n".join([_build_option_description(k) for k in keys])
+
+    if _print_desc:
+        print(s)
+    else:
+        return s
+
+
+def _reset_option(pat: str, silent: bool = False) -> None:
+
+    keys = _select_options(pat)
+
+    if len(keys) == 0:
+        raise OptionError("No such keys(s)")
+
+    if len(keys) > 1 and len(pat) < 4 and pat != "all":
+        raise ValueError(
+            "You must specify at least 4 characters when "
+            "resetting multiple keys, use the special keyword "
+            '"all" to reset all the options to their default value'
+        )
+
+    for k in keys:
+        _set_option(k, _registered_options[k].defval, silent=silent)
+
+
+def get_default_val(pat: str):
+    key = _get_single_key(pat, silent=True)
+    return _get_registered_option(key).defval
+
+
+class DictWrapper:
+    """provide attribute-style access to a nested dict"""
+
+    def __init__(self, d: dict[str, Any], prefix: str = ""):
+        object.__setattr__(self, "d", d)
+        object.__setattr__(self, "prefix", prefix)
+
+    def __setattr__(self, key: str, val: Any) -> None:
+        prefix = object.__getattribute__(self, "prefix")
+        if prefix:
+            prefix += "."
+        prefix += key
+        # you can't set new keys
+        # can you can't overwrite subtrees
+        if key in self.d and not isinstance(self.d[key], dict):
+            _set_option(prefix, val)
+        else:
+            raise OptionError("You can only set the value of existing options")
+
+    def __getattr__(self, key: str):
+        prefix = object.__getattribute__(self, "prefix")
+        if prefix:
+            prefix += "."
+        prefix += key
+        try:
+            v = object.__getattribute__(self, "d")[key]
+        except KeyError as err:
+            raise OptionError("No such option") from err
+        if isinstance(v, dict):
+            return DictWrapper(v, prefix)
+        else:
+            return _get_option(prefix)
+
+    def __dir__(self) -> Iterable[str]:
+        return list(self.d.keys())
+
+
+# For user convenience,  we'd like to have the available options described
+# in the docstring. For dev convenience we'd like to generate the docstrings
+# dynamically instead of maintaining them by hand. To this, we use the
+# class below which wraps functions inside a callable, and converts
+# __doc__ into a property function. The doctsrings below are templates
+# using the py2.6+ advanced formatting syntax to plug in a concise list
+# of options, and option descriptions.
+
+
+class CallableDynamicDoc:
+    def __init__(self, func, doc_tmpl):
+        self.__doc_tmpl__ = doc_tmpl
+        self.__func__ = func
+
+    def __call__(self, *args, **kwds):
+        return self.__func__(*args, **kwds)
+
+    @property
+    def __doc__(self):
+        opts_desc = _describe_option("all", _print_desc=False)
+        opts_list = pp_options_list(list(_registered_options.keys()))
+        return self.__doc_tmpl__.format(opts_desc=opts_desc, opts_list=opts_list)
+
+
+_get_option_tmpl = """
+get_option(pat)
+
+Retrieves the value of the specified option.
+
+Available options:
+
+{opts_list}
+
+Parameters
+----------
+pat : str
+    Regexp which should match a single option.
+    Note: partial matches are supported for convenience, but unless you use the
+    full option name (e.g. x.y.z.option_name), your code may break in future
+    versions if new options with similar names are introduced.
+
+Returns
+-------
+result : the value of the option
+
+Raises
+------
+OptionError : if no such option exists
+
+Notes
+-----
+Please reference the :ref:`User Guide <options>` for more information.
+
+The available options with its descriptions:
+
+{opts_desc}
+"""
+
+_set_option_tmpl = """
+set_option(pat, value)
+
+Sets the value of the specified option.
+
+Available options:
+
+{opts_list}
+
+Parameters
+----------
+pat : str
+    Regexp which should match a single option.
+    Note: partial matches are supported for convenience, but unless you use the
+    full option name (e.g. x.y.z.option_name), your code may break in future
+    versions if new options with similar names are introduced.
+value : object
+    New value of option.
+
+Returns
+-------
+None
+
+Raises
+------
+OptionError if no such option exists
+
+Notes
+-----
+Please reference the :ref:`User Guide <options>` for more information.
+
+The available options with its descriptions:
+
+{opts_desc}
+"""
+
+_describe_option_tmpl = """
+describe_option(pat, _print_desc=False)
+
+Prints the description for one or more registered options.
+
+Call with no arguments to get a listing for all registered options.
+
+Available options:
+
+{opts_list}
+
+Parameters
+----------
+pat : str
+    Regexp pattern. All matching keys will have their description displayed.
+_print_desc : bool, default True
+    If True (default) the description(s) will be printed to stdout.
+    Otherwise, the description(s) will be returned as a unicode string
+    (for testing).
+
+Returns
+-------
+None by default, the description(s) as a unicode string if _print_desc
+is False
+
+Notes
+-----
+Please reference the :ref:`User Guide <options>` for more information.
+
+The available options with its descriptions:
+
+{opts_desc}
+"""
+
+_reset_option_tmpl = """
+reset_option(pat)
+
+Reset one or more options to their default value.
+
+Pass "all" as argument to reset all options.
+
+Available options:
+
+{opts_list}
+
+Parameters
+----------
+pat : str/regex
+    If specified only options matching `prefix*` will be reset.
+    Note: partial matches are supported for convenience, but unless you
+    use the full option name (e.g. x.y.z.option_name), your code may break
+    in future versions if new options with similar names are introduced.
+
+Returns
+-------
+None
+
+Notes
+-----
+Please reference the :ref:`User Guide <options>` for more information.
+
+The available options with its descriptions:
+
+{opts_desc}
+"""
+
+# bind the functions with their docstrings into a Callable
+# and use that as the functions exposed in pd.api
+get_option = CallableDynamicDoc(_get_option, _get_option_tmpl)
+set_option = CallableDynamicDoc(_set_option, _set_option_tmpl)
+reset_option = CallableDynamicDoc(_reset_option, _reset_option_tmpl)
+describe_option = CallableDynamicDoc(_describe_option, _describe_option_tmpl)
+options = DictWrapper(_global_config)
+
+#
+# Functions for use by pandas developers, in addition to User - api
+
+
+class option_context(ContextDecorator):
+    """
+    Context manager to temporarily set options in the `with` statement context.
+
+    You need to invoke as ``option_context(pat, val, [(pat, val), ...])``.
+
+    Examples
+    --------
+    >>> with option_context('display.max_rows', 10, 'display.max_columns', 5):
+    ...     pass
+    """
+
+    def __init__(self, *args):
+        if len(args) % 2 != 0 or len(args) < 2:
+            raise ValueError(
+                "Need to invoke as option_context(pat, val, [(pat, val), ...])."
+            )
+
+        self.ops = list(zip(args[::2], args[1::2]))
+
+    def __enter__(self):
+        self.undo = [(pat, _get_option(pat, silent=True)) for pat, val in self.ops]
+
+        for pat, val in self.ops:
+            _set_option(pat, val, silent=True)
+
+    def __exit__(self, *args):
+        if self.undo:
+            for pat, val in self.undo:
+                _set_option(pat, val, silent=True)
+
+
+def register_option(
+    key: str,
+    defval: object,
+    doc: str = "",
+    validator: Callable[[object], Any] | None = None,
+    cb: Callable[[str], Any] | None = None,
+) -> None:
+    """
+    Register an option in the package-wide pandas config object
+
+    Parameters
+    ----------
+    key : str
+        Fully-qualified key, e.g. "x.y.option - z".
+    defval : object
+        Default value of the option.
+    doc : str
+        Description of the option.
+    validator : Callable, optional
+        Function of a single argument, should raise `ValueError` if
+        called with a value which is not a legal value for the option.
+    cb
+        a function of a single argument "key", which is called
+        immediately after an option value is set/reset. key is
+        the full name of the option.
+
+    Raises
+    ------
+    ValueError if `validator` is specified and `defval` is not a valid value.
+
+    """
+    import keyword
+    import tokenize
+
+    key = key.lower()
+
+    if key in _registered_options:
+        raise OptionError(f"Option '{key}' has already been registered")
+    if key in _reserved_keys:
+        raise OptionError(f"Option '{key}' is a reserved key")
+
+    # the default value should be legal
+    if validator:
+        validator(defval)
+
+    # walk the nested dict, creating dicts as needed along the path
+    path = key.split(".")
+
+    for k in path:
+        if not re.match("^" + tokenize.Name + "$", k):
+            raise ValueError(f"{k} is not a valid identifier")
+        if keyword.iskeyword(k):
+            raise ValueError(f"{k} is a python keyword")
+
+    cursor = _global_config
+    msg = "Path prefix to option '{option}' is already an option"
+
+    for i, p in enumerate(path[:-1]):
+        if not isinstance(cursor, dict):
+            raise OptionError(msg.format(option=".".join(path[:i])))
+        if p not in cursor:
+            cursor[p] = {}
+        cursor = cursor[p]
+
+    if not isinstance(cursor, dict):
+        raise OptionError(msg.format(option=".".join(path[:-1])))
+
+    cursor[path[-1]] = defval  # initialize
+
+    # save the option metadata
+    _registered_options[key] = RegisteredOption(
+        key=key, defval=defval, doc=doc, validator=validator, cb=cb
+    )
+
+
+def deprecate_option(
+    key: str,
+    msg: str | None = None,
+    rkey: str | None = None,
+    removal_ver: str | None = None,
+) -> None:
+    """
+    Mark option `key` as deprecated, if code attempts to access this option,
+    a warning will be produced, using `msg` if given, or a default message
+    if not.
+    if `rkey` is given, any access to the key will be re-routed to `rkey`.
+
+    Neither the existence of `key` nor that if `rkey` is checked. If they
+    do not exist, any subsequence access will fail as usual, after the
+    deprecation warning is given.
+
+    Parameters
+    ----------
+    key : str
+        Name of the option to be deprecated.
+        must be a fully-qualified option name (e.g "x.y.z.rkey").
+    msg : str, optional
+        Warning message to output when the key is referenced.
+        if no message is given a default message will be emitted.
+    rkey : str, optional
+        Name of an option to reroute access to.
+        If specified, any referenced `key` will be
+        re-routed to `rkey` including set/get/reset.
+        rkey must be a fully-qualified option name (e.g "x.y.z.rkey").
+        used by the default message if no `msg` is specified.
+    removal_ver : str, optional
+        Specifies the version in which this option will
+        be removed. used by the default message if no `msg` is specified.
+
+    Raises
+    ------
+    OptionError
+        If the specified key has already been deprecated.
+    """
+    key = key.lower()
+
+    if key in _deprecated_options:
+        raise OptionError(f"Option '{key}' has already been defined as deprecated.")
+
+    _deprecated_options[key] = DeprecatedOption(key, msg, rkey, removal_ver)
+
+
+#
+# functions internal to the module
+
+
+def _select_options(pat: str) -> list[str]:
+    """
+    returns a list of keys matching `pat`
+
+    if pat=="all", returns all registered options
+    """
+    # short-circuit for exact key
+    if pat in _registered_options:
+        return [pat]
+
+    # else look through all of them
+    keys = sorted(_registered_options.keys())
+    if pat == "all":  # reserved key
+        return keys
+
+    return [k for k in keys if re.search(pat, k, re.I)]
+
+
+def _get_root(key: str) -> tuple[dict[str, Any], str]:
+    path = key.split(".")
+    cursor = _global_config
+    for p in path[:-1]:
+        cursor = cursor[p]
+    return cursor, path[-1]
+
+
+def _is_deprecated(key: str) -> bool:
+    """Returns True if the given option has been deprecated"""
+    key = key.lower()
+    return key in _deprecated_options
+
+
+def _get_deprecated_option(key: str):
+    """
+    Retrieves the metadata for a deprecated option, if `key` is deprecated.
+
+    Returns
+    -------
+    DeprecatedOption (namedtuple) if key is deprecated, None otherwise
+    """
+    try:
+        d = _deprecated_options[key]
+    except KeyError:
+        return None
+    else:
+        return d
+
+
+def _get_registered_option(key: str):
+    """
+    Retrieves the option metadata if `key` is a registered option.
+
+    Returns
+    -------
+    RegisteredOption (namedtuple) if key is deprecated, None otherwise
+    """
+    return _registered_options.get(key)
+
+
+def _translate_key(key: str) -> str:
+    """
+    if key id deprecated and a replacement key defined, will return the
+    replacement key, otherwise returns `key` as - is
+    """
+    d = _get_deprecated_option(key)
+    if d:
+        return d.rkey or key
+    else:
+        return key
+
+
+def _warn_if_deprecated(key: str) -> bool:
+    """
+    Checks if `key` is a deprecated option and if so, prints a warning.
+
+    Returns
+    -------
+    bool - True if `key` is deprecated, False otherwise.
+    """
+    d = _get_deprecated_option(key)
+    if d:
+        if d.msg:
+            warnings.warn(d.msg, FutureWarning)
+        else:
+            msg = f"'{key}' is deprecated"
+            if d.removal_ver:
+                msg += f" and will be removed in {d.removal_ver}"
+            if d.rkey:
+                msg += f", please use '{d.rkey}' instead."
+            else:
+                msg += ", please refrain from using it."
+
+            warnings.warn(msg, FutureWarning)
+        return True
+    return False
+
+
+def _build_option_description(k: str) -> str:
+    """Builds a formatted description of a registered option and prints it"""
+    o = _get_registered_option(k)
+    d = _get_deprecated_option(k)
+
+    s = f"{k} "
+
+    if o.doc:
+        s += "\n".join(o.doc.strip().split("\n"))
+    else:
+        s += "No description available."
+
+    if o:
+        s += f"\n    [default: {o.defval}] [currently: {_get_option(k, True)}]"
+
+    if d:
+        rkey = d.rkey or ""
+        s += "\n    (Deprecated"
+        s += f", use `{rkey}` instead."
+        s += ")"
+
+    return s
+
+
+def pp_options_list(keys: Iterable[str], width=80, _print: bool = False):
+    """Builds a concise listing of available options, grouped by prefix"""
+    from itertools import groupby
+    from textwrap import wrap
+
+    def pp(name: str, ks: Iterable[str]) -> list[str]:
+        pfx = "- " + name + ".[" if name else ""
+        ls = wrap(
+            ", ".join(ks),
+            width,
+            initial_indent=pfx,
+            subsequent_indent="  ",
+            break_long_words=False,
+        )
+        if ls and ls[-1] and name:
+            ls[-1] = ls[-1] + "]"
+        return ls
+
+    ls: list[str] = []
+    singles = [x for x in sorted(keys) if x.find(".") < 0]
+    if singles:
+        ls += pp("", singles)
+    keys = [x for x in keys if x.find(".") >= 0]
+
+    for k, g in groupby(sorted(keys), lambda x: x[: x.rfind(".")]):
+        ks = [x[len(k) + 1 :] for x in list(g)]
+        ls += pp(k, ks)
+    s = "\n".join(ls)
+    if _print:
+        print(s)
+    else:
+        return s
+
+
+#
+# helpers
+
+
+@contextmanager
+def config_prefix(prefix):
+    """
+    contextmanager for multiple invocations of API with a common prefix
+
+    supported API functions: (register / get / set )__option
+
+    Warning: This is not thread - safe, and won't work properly if you import
+    the API functions into your module using the "from x import y" construct.
+
+    Example
+    -------
+    import pandas._config.config as cf
+    with cf.config_prefix("display.font"):
+        cf.register_option("color", "red")
+        cf.register_option("size", " 5 pt")
+        cf.set_option(size, " 6 pt")
+        cf.get_option(size)
+        ...
+
+        etc'
+
+    will register options "display.font.color", "display.font.size", set the
+    value of "display.font.size"... and so on.
+    """
+    # Note: reset_option relies on set_option, and on key directly
+    # it does not fit in to this monkey-patching scheme
+
+    global register_option, get_option, set_option, reset_option
+
+    def wrap(func: F) -> F:
+        def inner(key: str, *args, **kwds):
+            pkey = f"{prefix}.{key}"
+            return func(pkey, *args, **kwds)
+
+        return cast(F, inner)
+
+    _register_option = register_option
+    _get_option = get_option
+    _set_option = set_option
+    set_option = wrap(set_option)
+    get_option = wrap(get_option)
+    register_option = wrap(register_option)
+    try:
+        yield
+    finally:
+        set_option = _set_option
+        get_option = _get_option
+        register_option = _register_option
+
+
+# These factories and methods are handy for use as the validator
+# arg in register_option
+
+
+def is_type_factory(_type: type[Any]) -> Callable[[Any], None]:
+    """
+
+    Parameters
+    ----------
+    `_type` - a type to be compared against (e.g. type(x) == `_type`)
+
+    Returns
+    -------
+    validator - a function of a single argument x , which raises
+                ValueError if type(x) is not equal to `_type`
+
+    """
+
+    def inner(x) -> None:
+        if type(x) != _type:
+            raise ValueError(f"Value must have type '{_type}'")
+
+    return inner
+
+
+def is_instance_factory(_type) -> Callable[[Any], None]:
+    """
+
+    Parameters
+    ----------
+    `_type` - the type to be checked against
+
+    Returns
+    -------
+    validator - a function of a single argument x , which raises
+                ValueError if x is not an instance of `_type`
+
+    """
+    if isinstance(_type, (tuple, list)):
+        _type = tuple(_type)
+        type_repr = "|".join(map(str, _type))
+    else:
+        type_repr = f"'{_type}'"
+
+    def inner(x) -> None:
+        if not isinstance(x, _type):
+            raise ValueError(f"Value must be an instance of {type_repr}")
+
+    return inner
+
+
+def is_one_of_factory(legal_values) -> Callable[[Any], None]:
+
+    callables = [c for c in legal_values if callable(c)]
+    legal_values = [c for c in legal_values if not callable(c)]
+
+    def inner(x) -> None:
+        if x not in legal_values:
+
+            if not any(c(x) for c in callables):
+                uvals = [str(lval) for lval in legal_values]
+                pp_values = "|".join(uvals)
+                msg = f"Value must be one of {pp_values}"
+                if len(callables):
+                    msg += " or a callable"
+                raise ValueError(msg)
+
+    return inner
+
+
+def is_nonnegative_int(value: object) -> None:
+    """
+    Verify that value is None or a positive int.
+
+    Parameters
+    ----------
+    value : None or int
+            The `value` to be checked.
+
+    Raises
+    ------
+    ValueError
+        When the value is not None or is a negative integer
+    """
+    if value is None:
+        return
+
+    elif isinstance(value, int):
+        if value >= 0:
+            return
+
+    msg = "Value must be a nonnegative integer or None"
+    raise ValueError(msg)
+
+
+# common type validators, for convenience
+# usage: register_option(... , validator = is_int)
+is_int = is_type_factory(int)
+is_bool = is_type_factory(bool)
+is_float = is_type_factory(float)
+is_str = is_type_factory(str)
+is_text = is_instance_factory((str, bytes))
+
+
+def is_callable(obj) -> bool:
+    """
+
+    Parameters
+    ----------
+    `obj` - the object to be checked
+
+    Returns
+    -------
+    validator - returns True if object is callable
+        raises ValueError otherwise.
+
+    """
+    if not callable(obj):
+        raise ValueError("Value must be a callable")
+    return True

.venv/Lib/site-packages/pandas/_config/dates.py

@@ -0,0 +1,23 @@
+"""
+config for datetime formatting
+"""
+from pandas._config import config as cf
+
+pc_date_dayfirst_doc = """
+: boolean
+    When True, prints and parses dates with the day first, eg 20/01/2005
+"""
+
+pc_date_yearfirst_doc = """
+: boolean
+    When True, prints and parses dates with the year first, eg 2005/01/20
+"""
+
+with cf.config_prefix("display"):
+    # Needed upstream of `_libs` because these are used in tslibs.parsing
+    cf.register_option(
+        "date_dayfirst", False, pc_date_dayfirst_doc, validator=cf.is_bool
+    )
+    cf.register_option(
+        "date_yearfirst", False, pc_date_yearfirst_doc, validator=cf.is_bool
+    )

.venv/Lib/site-packages/pandas/_config/display.py

@@ -0,0 +1,62 @@
+"""
+Unopinionated display configuration.
+"""
+
+from __future__ import annotations
+
+import locale
+import sys
+
+from pandas._config import config as cf
+
+# -----------------------------------------------------------------------------
+# Global formatting options
+_initial_defencoding: str | None = None
+
+
+def detect_console_encoding() -> str:
+    """
+    Try to find the most capable encoding supported by the console.
+    slightly modified from the way IPython handles the same issue.
+    """
+    global _initial_defencoding
+
+    encoding = None
+    try:
+        encoding = sys.stdout.encoding or sys.stdin.encoding
+    except (AttributeError, OSError):
+        pass
+
+    # try again for something better
+    if not encoding or "ascii" in encoding.lower():
+        try:
+            encoding = locale.getpreferredencoding()
+        except locale.Error:
+            # can be raised by locale.setlocale(), which is
+            #  called by getpreferredencoding
+            #  (on some systems, see stdlib locale docs)
+            pass
+
+    # when all else fails. this will usually be "ascii"
+    if not encoding or "ascii" in encoding.lower():
+        encoding = sys.getdefaultencoding()
+
+    # GH#3360, save the reported defencoding at import time
+    # MPL backends may change it. Make available for debugging.
+    if not _initial_defencoding:
+        _initial_defencoding = sys.getdefaultencoding()
+
+    return encoding
+
+
+pc_encoding_doc = """
+: str/unicode
+    Defaults to the detected encoding of the console.
+    Specifies the encoding to be used for strings returned by to_string,
+    these are generally strings meant to be displayed on the console.
+"""
+
+with cf.config_prefix("display"):
+    cf.register_option(
+        "encoding", detect_console_encoding(), pc_encoding_doc, validator=cf.is_text
+    )

.venv/Lib/site-packages/pandas/_config/localization.py

@@ -0,0 +1,178 @@
+"""
+Helpers for configuring locale settings.
+
+Name `localization` is chosen to avoid overlap with builtin `locale` module.
+"""
+from __future__ import annotations
+
+from contextlib import contextmanager
+import locale
+import re
+import subprocess
+from typing import (
+    Callable,
+    Iterator,
+)
+
+from pandas._config.config import options
+
+
+@contextmanager
+def set_locale(
+    new_locale: str | tuple[str, str], lc_var: int = locale.LC_ALL
+) -> Iterator[str | tuple[str, str]]:
+    """
+    Context manager for temporarily setting a locale.
+
+    Parameters
+    ----------
+    new_locale : str or tuple
+        A string of the form <language_country>.<encoding>. For example to set
+        the current locale to US English with a UTF8 encoding, you would pass
+        "en_US.UTF-8".
+    lc_var : int, default `locale.LC_ALL`
+        The category of the locale being set.
+
+    Notes
+    -----
+    This is useful when you want to run a particular block of code under a
+    particular locale, without globally setting the locale. This probably isn't
+    thread-safe.
+    """
+    current_locale = locale.getlocale()
+
+    try:
+        locale.setlocale(lc_var, new_locale)
+        normalized_locale = locale.getlocale()
+        if all(x is not None for x in normalized_locale):
+            yield ".".join(normalized_locale)
+        else:
+            yield new_locale
+    finally:
+        locale.setlocale(lc_var, current_locale)
+
+
+def can_set_locale(lc: str, lc_var: int = locale.LC_ALL) -> bool:
+    """
+    Check to see if we can set a locale, and subsequently get the locale,
+    without raising an Exception.
+
+    Parameters
+    ----------
+    lc : str
+        The locale to attempt to set.
+    lc_var : int, default `locale.LC_ALL`
+        The category of the locale being set.
+
+    Returns
+    -------
+    bool
+        Whether the passed locale can be set
+    """
+    try:
+        with set_locale(lc, lc_var=lc_var):
+            pass
+    except (ValueError, locale.Error):
+        # horrible name for a Exception subclass
+        return False
+    else:
+        return True
+
+
+def _valid_locales(locales: list[str] | str, normalize: bool) -> list[str]:
+    """
+    Return a list of normalized locales that do not throw an ``Exception``
+    when set.
+
+    Parameters
+    ----------
+    locales : str
+        A string where each locale is separated by a newline.
+    normalize : bool
+        Whether to call ``locale.normalize`` on each locale.
+
+    Returns
+    -------
+    valid_locales : list
+        A list of valid locales.
+    """
+    return [
+        loc
+        for loc in (
+            locale.normalize(loc.strip()) if normalize else loc.strip()
+            for loc in locales
+        )
+        if can_set_locale(loc)
+    ]
+
+
+def _default_locale_getter() -> bytes:
+    return subprocess.check_output(["locale -a"], shell=True)
+
+
+def get_locales(
+    prefix: str | None = None,
+    normalize: bool = True,
+    locale_getter: Callable[[], bytes] = _default_locale_getter,
+) -> list[str] | None:
+    """
+    Get all the locales that are available on the system.
+
+    Parameters
+    ----------
+    prefix : str
+        If not ``None`` then return only those locales with the prefix
+        provided. For example to get all English language locales (those that
+        start with ``"en"``), pass ``prefix="en"``.
+    normalize : bool
+        Call ``locale.normalize`` on the resulting list of available locales.
+        If ``True``, only locales that can be set without throwing an
+        ``Exception`` are returned.
+    locale_getter : callable
+        The function to use to retrieve the current locales. This should return
+        a string with each locale separated by a newline character.
+
+    Returns
+    -------
+    locales : list of strings
+        A list of locale strings that can be set with ``locale.setlocale()``.
+        For example::
+
+            locale.setlocale(locale.LC_ALL, locale_string)
+
+    On error will return None (no locale available, e.g. Windows)
+
+    """
+    try:
+        raw_locales = locale_getter()
+    except subprocess.CalledProcessError:
+        # Raised on (some? all?) Windows platforms because Note: "locale -a"
+        #  is not defined
+        return None
+
+    try:
+        # raw_locales is "\n" separated list of locales
+        # it may contain non-decodable parts, so split
+        # extract what we can and then rejoin.
+        split_raw_locales = raw_locales.split(b"\n")
+        out_locales = []
+        for x in split_raw_locales:
+            try:
+                out_locales.append(str(x, encoding=options.display.encoding))
+            except UnicodeError:
+                # 'locale -a' is used to populated 'raw_locales' and on
+                # Redhat 7 Linux (and maybe others) prints locale names
+                # using windows-1252 encoding.  Bug only triggered by
+                # a few special characters and when there is an
+                # extensive list of installed locales.
+                out_locales.append(str(x, encoding="windows-1252"))
+
+    except TypeError:
+        pass
+
+    if prefix is None:
+        return _valid_locales(out_locales, normalize)
+
+    pattern = re.compile(f"{prefix}.*")
+    found = pattern.findall("\n".join(out_locales))
+    return _valid_locales(found, normalize)

.venv/Lib/site-packages/pandas/_libs/__init__.py

@@ -0,0 +1,22 @@
+__all__ = [
+    "NaT",
+    "NaTType",
+    "OutOfBoundsDatetime",
+    "Period",
+    "Timedelta",
+    "Timestamp",
+    "iNaT",
+    "Interval",
+]
+
+
+from pandas._libs.interval import Interval
+from pandas._libs.tslibs import (
+    NaT,
+    NaTType,
+    OutOfBoundsDatetime,
+    Period,
+    Timedelta,
+    Timestamp,
+    iNaT,
+)

.venv/Lib/site-packages/pandas/_libs/algos.pxd

@@ -0,0 +1,12 @@
+from pandas._libs.dtypes cimport numeric_t
+
+
+cdef numeric_t kth_smallest_c(numeric_t* arr, Py_ssize_t k, Py_ssize_t n) nogil
+
+cdef enum TiebreakEnumType:
+    TIEBREAK_AVERAGE
+    TIEBREAK_MIN,
+    TIEBREAK_MAX
+    TIEBREAK_FIRST
+    TIEBREAK_FIRST_DESCENDING
+    TIEBREAK_DENSE

.venv/Lib/site-packages/pandas/_libs/algos.pyi

@@ -0,0 +1,446 @@
+from __future__ import annotations
+
+from typing import Any
+
+import numpy as np
+
+from pandas._typing import npt
+
+class Infinity:
+    """
+    Provide a positive Infinity comparison method for ranking.
+    """
+
+    def __eq__(self, other) -> bool: ...
+    def __ne__(self, other) -> bool: ...
+    def __lt__(self, other) -> bool: ...
+    def __le__(self, other) -> bool: ...
+    def __gt__(self, other) -> bool: ...
+    def __ge__(self, other) -> bool: ...
+
+class NegInfinity:
+    """
+    Provide a negative Infinity comparison method for ranking.
+    """
+
+    def __eq__(self, other) -> bool: ...
+    def __ne__(self, other) -> bool: ...
+    def __lt__(self, other) -> bool: ...
+    def __le__(self, other) -> bool: ...
+    def __gt__(self, other) -> bool: ...
+    def __ge__(self, other) -> bool: ...
+
+def unique_deltas(
+    arr: np.ndarray,  # const int64_t[:]
+) -> np.ndarray: ...  # np.ndarray[np.int64, ndim=1]
+def is_lexsorted(list_of_arrays: list[npt.NDArray[np.int64]]) -> bool: ...
+def groupsort_indexer(
+    index: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+) -> tuple[
+    np.ndarray,  # ndarray[int64_t, ndim=1]
+    np.ndarray,  # ndarray[int64_t, ndim=1]
+]: ...
+def kth_smallest(
+    a: np.ndarray,  # numeric[:]
+    k: int,
+) -> Any: ...  # numeric
+
+# ----------------------------------------------------------------------
+# Pairwise correlation/covariance
+
+def nancorr(
+    mat: npt.NDArray[np.float64],  # const float64_t[:, :]
+    cov: bool = ...,
+    minp: int | None = ...,
+) -> npt.NDArray[np.float64]: ...  # ndarray[float64_t, ndim=2]
+def nancorr_spearman(
+    mat: npt.NDArray[np.float64],  # ndarray[float64_t, ndim=2]
+    minp: int = ...,
+) -> npt.NDArray[np.float64]: ...  # ndarray[float64_t, ndim=2]
+
+# ----------------------------------------------------------------------
+
+# ctypedef fused algos_t:
+#    float64_t
+#    float32_t
+#    object
+#    int64_t
+#    int32_t
+#    int16_t
+#    int8_t
+#    uint64_t
+#    uint32_t
+#    uint16_t
+#    uint8_t
+
+def validate_limit(nobs: int | None, limit=...) -> int: ...
+def pad(
+    old: np.ndarray,  # ndarray[algos_t]
+    new: np.ndarray,  # ndarray[algos_t]
+    limit=...,
+) -> npt.NDArray[np.intp]: ...  # np.ndarray[np.intp, ndim=1]
+def pad_inplace(
+    values: np.ndarray,  # algos_t[:]
+    mask: np.ndarray,  # uint8_t[:]
+    limit=...,
+) -> None: ...
+def pad_2d_inplace(
+    values: np.ndarray,  # algos_t[:, :]
+    mask: np.ndarray,  # const uint8_t[:, :]
+    limit=...,
+) -> None: ...
+def backfill(
+    old: np.ndarray,  # ndarray[algos_t]
+    new: np.ndarray,  # ndarray[algos_t]
+    limit=...,
+) -> npt.NDArray[np.intp]: ...  # np.ndarray[np.intp, ndim=1]
+def backfill_inplace(
+    values: np.ndarray,  # algos_t[:]
+    mask: np.ndarray,  # uint8_t[:]
+    limit=...,
+) -> None: ...
+def backfill_2d_inplace(
+    values: np.ndarray,  # algos_t[:, :]
+    mask: np.ndarray,  # const uint8_t[:, :]
+    limit=...,
+) -> None: ...
+def is_monotonic(
+    arr: np.ndarray,  # ndarray[algos_t, ndim=1]
+    timelike: bool,
+) -> tuple[bool, bool, bool]: ...
+
+# ----------------------------------------------------------------------
+# rank_1d, rank_2d
+# ----------------------------------------------------------------------
+
+# ctypedef fused rank_t:
+#    object
+#    float64_t
+#    uint64_t
+#    int64_t
+
+def rank_1d(
+    values: np.ndarray,  # ndarray[rank_t, ndim=1]
+    labels: np.ndarray | None = ...,  # const int64_t[:]=None
+    is_datetimelike: bool = ...,
+    ties_method=...,
+    ascending: bool = ...,
+    pct: bool = ...,
+    na_option=...,
+) -> np.ndarray: ...  # np.ndarray[float64_t, ndim=1]
+def rank_2d(
+    in_arr: np.ndarray,  # ndarray[rank_t, ndim=2]
+    axis: int = ...,
+    is_datetimelike: bool = ...,
+    ties_method=...,
+    ascending: bool = ...,
+    na_option=...,
+    pct: bool = ...,
+) -> np.ndarray: ...  # np.ndarray[float64_t, ndim=1]
+def diff_2d(
+    arr: np.ndarray,  # ndarray[diff_t, ndim=2]
+    out: np.ndarray,  # ndarray[out_t, ndim=2]
+    periods: int,
+    axis: int,
+    datetimelike: bool = ...,
+) -> None: ...
+def ensure_platform_int(arr: object) -> npt.NDArray[np.intp]: ...
+def ensure_object(arr: object) -> npt.NDArray[np.object_]: ...
+def ensure_complex64(arr: object, copy=...) -> npt.NDArray[np.complex64]: ...
+def ensure_complex128(arr: object, copy=...) -> npt.NDArray[np.complex128]: ...
+def ensure_float64(arr: object, copy=...) -> npt.NDArray[np.float64]: ...
+def ensure_float32(arr: object, copy=...) -> npt.NDArray[np.float32]: ...
+def ensure_int8(arr: object, copy=...) -> npt.NDArray[np.int8]: ...
+def ensure_int16(arr: object, copy=...) -> npt.NDArray[np.int16]: ...
+def ensure_int32(arr: object, copy=...) -> npt.NDArray[np.int32]: ...
+def ensure_int64(arr: object, copy=...) -> npt.NDArray[np.int64]: ...
+def ensure_uint8(arr: object, copy=...) -> npt.NDArray[np.uint8]: ...
+def ensure_uint16(arr: object, copy=...) -> npt.NDArray[np.uint16]: ...
+def ensure_uint32(arr: object, copy=...) -> npt.NDArray[np.uint32]: ...
+def ensure_uint64(arr: object, copy=...) -> npt.NDArray[np.uint64]: ...
+def take_1d_int8_int8(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int8_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int8_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int8_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int16_int16(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int16_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int16_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int16_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int32_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int32_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int64_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_int64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_float32_float32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_float32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_float64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_object_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_bool_bool(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_1d_bool_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int8_int8(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int8_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int8_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int8_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int16_int16(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int16_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int16_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int16_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int32_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int32_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int64_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_int64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_float32_float32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_float32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_float64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_object_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_bool_bool(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis0_bool_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int8_int8(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int8_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int8_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int8_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int16_int16(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int16_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int16_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int16_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int32_int32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int32_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int64_int64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_int64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_float32_float32(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_float32_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_float64_float64(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_object_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_bool_bool(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_axis1_bool_object(
+    values: np.ndarray, indexer: npt.NDArray[np.intp], out: np.ndarray, fill_value=...
+) -> None: ...
+def take_2d_multi_int8_int8(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int8_int32(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int8_int64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int8_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int16_int16(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int16_int32(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int16_int64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int16_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int32_int32(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int32_int64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int32_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int64_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_float32_float32(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_float32_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_float64_float64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_object_object(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_bool_bool(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_bool_object(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...
+def take_2d_multi_int64_int64(
+    values: np.ndarray,
+    indexer: tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]],
+    out: np.ndarray,
+    fill_value=...,
+) -> None: ...

.venv/Lib/site-packages/pandas/_libs/algos_common_helper.pxi.in

@@ -0,0 +1,72 @@
+"""
+Template for each `dtype` helper function using 1-d template
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+# ----------------------------------------------------------------------
+# ensure_dtype
+# ----------------------------------------------------------------------
+
+
+def ensure_platform_int(object arr):
+    # GH3033, GH1392
+    # platform int is the size of the int pointer, e.g. np.intp
+    if util.is_array(arr):
+        if (<ndarray>arr).descr.type_num == cnp.NPY_INTP:
+            return arr
+        else:
+            # equiv: arr.astype(np.intp)
+            return cnp.PyArray_Cast(<ndarray>arr, cnp.NPY_INTP)
+    else:
+        return np.array(arr, dtype=np.intp)
+
+
+def ensure_object(object arr):
+    if util.is_array(arr):
+        if (<ndarray>arr).descr.type_num == NPY_OBJECT:
+            return arr
+        else:
+            # equiv: arr.astype(object)
+            return cnp.PyArray_Cast(<ndarray>arr, NPY_OBJECT)
+    else:
+        return np.array(arr, dtype=np.object_)
+
+{{py:
+
+# name, c_type, dtype
+dtypes = [('float64', 'FLOAT64', 'float64'),
+          # ('float32', 'FLOAT32', 'float32'),  # disabling bc unused
+          ('int8', 'INT8', 'int8'),
+          ('int16', 'INT16', 'int16'),
+          ('int32', 'INT32', 'int32'),
+          ('int64', 'INT64', 'int64'),
+          # Disabling uint and complex dtypes because we do not use them
+          #  (and compiling them increases wheel size)
+          # ('uint8', 'UINT8', 'uint8'),
+          # ('uint16', 'UINT16', 'uint16'),
+          # ('uint32', 'UINT32', 'uint32'),
+          # ('uint64', 'UINT64', 'uint64'),
+          # ('complex64', 'COMPLEX64', 'complex64'),
+          # ('complex128', 'COMPLEX128', 'complex128')
+]
+
+def get_dispatch(dtypes):
+
+    for name, c_type, dtype in dtypes:
+        yield name, c_type, dtype
+}}
+
+{{for name, c_type, dtype in get_dispatch(dtypes)}}
+
+
+def ensure_{{name}}(object arr, copy=True):
+    if util.is_array(arr):
+        if (<ndarray>arr).descr.type_num == NPY_{{c_type}}:
+            return arr
+        else:
+            return arr.astype(np.{{dtype}}, copy=copy)
+    else:
+        return np.array(arr, dtype=np.{{dtype}})
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/algos_take_helper.pxi.in

@@ -0,0 +1,222 @@
+"""
+Template for each `dtype` helper function for take
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+# ----------------------------------------------------------------------
+# take_1d, take_2d
+# ----------------------------------------------------------------------
+
+
+{{py:
+
+# c_type_in, c_type_out
+dtypes = [
+    ('uint8_t', 'uint8_t'),
+    ('uint8_t', 'object'),
+    ('int8_t', 'int8_t'),
+    ('int8_t', 'int32_t'),
+    ('int8_t', 'int64_t'),
+    ('int8_t', 'float64_t'),
+    ('int16_t', 'int16_t'),
+    ('int16_t', 'int32_t'),
+    ('int16_t', 'int64_t'),
+    ('int16_t', 'float64_t'),
+    ('int32_t', 'int32_t'),
+    ('int32_t', 'int64_t'),
+    ('int32_t', 'float64_t'),
+    ('int64_t', 'int64_t'),
+    ('int64_t', 'float64_t'),
+    ('float32_t', 'float32_t'),
+    ('float32_t', 'float64_t'),
+    ('float64_t', 'float64_t'),
+    ('object', 'object'),
+]
+
+
+def get_dispatch(dtypes):
+
+    for (c_type_in, c_type_out) in dtypes:
+
+        def get_name(dtype_name):
+            if dtype_name == "object":
+                return "object"
+            if dtype_name == "uint8_t":
+                return "bool"
+            return dtype_name[:-2]
+
+        name = get_name(c_type_in)
+        dest = get_name(c_type_out)
+
+        args = dict(name=name, dest=dest, c_type_in=c_type_in,
+                    c_type_out=c_type_out)
+
+        yield (name, dest, c_type_in, c_type_out)
+
+}}
+
+
+{{for name, dest, c_type_in, c_type_out in get_dispatch(dtypes)}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if c_type_in != "object"}}
+def take_1d_{{name}}_{{dest}}(const {{c_type_in}}[:] values,
+{{else}}
+def take_1d_{{name}}_{{dest}}(ndarray[{{c_type_in}}, ndim=1] values,
+{{endif}}
+                              const intp_t[:] indexer,
+                              {{c_type_out}}[:] out,
+                              fill_value=np.nan):
+
+    cdef:
+        Py_ssize_t i, n, idx
+        {{c_type_out}} fv
+
+    n = indexer.shape[0]
+
+    fv = fill_value
+
+    {{if c_type_out != "object"}}
+    with nogil:
+    {{else}}
+    if True:
+    {{endif}}
+        for i in range(n):
+            idx = indexer[i]
+            if idx == -1:
+                out[i] = fv
+            else:
+                {{if c_type_in == "uint8_t" and c_type_out == "object"}}
+                out[i] = True if values[idx] > 0 else False
+                {{else}}
+                out[i] = values[idx]
+                {{endif}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if c_type_in != "object"}}
+def take_2d_axis0_{{name}}_{{dest}}(const {{c_type_in}}[:, :] values,
+{{else}}
+def take_2d_axis0_{{name}}_{{dest}}(ndarray[{{c_type_in}}, ndim=2] values,
+{{endif}}
+                                    ndarray[intp_t, ndim=1] indexer,
+                                    {{c_type_out}}[:, :] out,
+                                    fill_value=np.nan):
+    cdef:
+        Py_ssize_t i, j, k, n, idx
+        {{c_type_out}} fv
+        {{if c_type_in == c_type_out != "object"}}
+        const {{c_type_out}} *v
+        {{c_type_out}} *o
+        {{endif}}
+
+    n = len(indexer)
+    k = values.shape[1]
+
+    fv = fill_value
+
+    {{if c_type_in == c_type_out != "object"}}
+    # GH#3130
+    if (values.strides[1] == out.strides[1] and
+        values.strides[1] == sizeof({{c_type_out}}) and
+        sizeof({{c_type_out}}) * n >= 256):
+
+        for i in range(n):
+            idx = indexer[i]
+            if idx == -1:
+                for j in range(k):
+                    out[i, j] = fv
+            else:
+                v = &values[idx, 0]
+                o = &out[i, 0]
+                memmove(o, v, <size_t>(sizeof({{c_type_out}}) * k))
+        return
+    {{endif}}
+
+    for i in range(n):
+        idx = indexer[i]
+        if idx == -1:
+            for j in range(k):
+                out[i, j] = fv
+        else:
+            for j in range(k):
+                {{if c_type_in == "uint8_t" and c_type_out == "object"}}
+                out[i, j] = True if values[idx, j] > 0 else False
+                {{else}}
+                out[i, j] = values[idx, j]
+                {{endif}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if c_type_in != "object"}}
+def take_2d_axis1_{{name}}_{{dest}}(const {{c_type_in}}[:, :] values,
+{{else}}
+def take_2d_axis1_{{name}}_{{dest}}(ndarray[{{c_type_in}}, ndim=2] values,
+{{endif}}
+                                    ndarray[intp_t, ndim=1] indexer,
+                                    {{c_type_out}}[:, :] out,
+                                    fill_value=np.nan):
+
+    cdef:
+        Py_ssize_t i, j, k, n, idx
+        {{c_type_out}} fv
+
+    n = len(values)
+    k = len(indexer)
+
+    if n == 0 or k == 0:
+        return
+
+    fv = fill_value
+
+    for i in range(n):
+        for j in range(k):
+            idx = indexer[j]
+            if idx == -1:
+                out[i, j] = fv
+            else:
+                {{if c_type_in == "uint8_t" and c_type_out == "object"}}
+                out[i, j] = True if values[i, idx] > 0 else False
+                {{else}}
+                out[i, j] = values[i, idx]
+                {{endif}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def take_2d_multi_{{name}}_{{dest}}(ndarray[{{c_type_in}}, ndim=2] values,
+                                    indexer,
+                                    ndarray[{{c_type_out}}, ndim=2] out,
+                                    fill_value=np.nan):
+    cdef:
+        Py_ssize_t i, j, k, n, idx
+        ndarray[intp_t, ndim=1] idx0 = indexer[0]
+        ndarray[intp_t, ndim=1] idx1 = indexer[1]
+        {{c_type_out}} fv
+
+    n = len(idx0)
+    k = len(idx1)
+
+    fv = fill_value
+    for i in range(n):
+        idx = idx0[i]
+        if idx == -1:
+            for j in range(k):
+                out[i, j] = fv
+        else:
+            for j in range(k):
+                if idx1[j] == -1:
+                    out[i, j] = fv
+                else:
+                    {{if c_type_in == "uint8_t" and c_type_out == "object"}}
+                    out[i, j] = True if values[idx, idx1[j]] > 0 else False
+                    {{else}}
+                    out[i, j] = values[idx, idx1[j]]
+                    {{endif}}
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/arrays.pxd

@@ -0,0 +1,11 @@
+
+from numpy cimport ndarray
+
+
+cdef class NDArrayBacked:
+    cdef:
+        readonly ndarray _ndarray
+        readonly object _dtype
+
+    cpdef NDArrayBacked _from_backing_data(self, ndarray values)
+    cpdef __setstate__(self, state)

.venv/Lib/site-packages/pandas/_libs/arrays.pyi

@@ -0,0 +1,34 @@
+from typing import Sequence
+
+import numpy as np
+
+from pandas._typing import (
+    DtypeObj,
+    Shape,
+)
+
+class NDArrayBacked:
+    _dtype: DtypeObj
+    _ndarray: np.ndarray
+    def __init__(self, values: np.ndarray, dtype: DtypeObj): ...
+    @classmethod
+    def _simple_new(cls, values: np.ndarray, dtype: DtypeObj): ...
+    def _from_backing_data(self, values: np.ndarray): ...
+    def __setstate__(self, state): ...
+    def __len__(self) -> int: ...
+    @property
+    def shape(self) -> Shape: ...
+    @property
+    def ndim(self) -> int: ...
+    @property
+    def size(self) -> int: ...
+    @property
+    def nbytes(self) -> int: ...
+    def copy(self): ...
+    def delete(self, loc, axis=...): ...
+    def swapaxes(self, axis1, axis2): ...
+    def repeat(self, repeats: int | Sequence[int], axis: int | None = ...): ...
+    def reshape(self, *args, **kwargs): ...
+    def ravel(self, order=...): ...
+    @property
+    def T(self): ...

.venv/Lib/site-packages/pandas/_libs/arrays.pyx

@@ -0,0 +1,183 @@
+"""
+Cython implementations for internal ExtensionArrays.
+"""
+cimport cython
+
+import numpy as np
+
+cimport numpy as cnp
+from cpython cimport PyErr_Clear
+from numpy cimport ndarray
+
+cnp.import_array()
+
+
+@cython.freelist(16)
+cdef class NDArrayBacked:
+    """
+    Implementing these methods in cython improves performance quite a bit.
+
+    import pandas as pd
+
+    from pandas._libs.arrays import NDArrayBacked as cls
+
+    dti = pd.date_range("2016-01-01", periods=3)
+    dta = dti._data
+    arr = dta._ndarray
+
+    obj = cls._simple_new(arr, arr.dtype)
+
+    # for foo in [arr, dta, obj]: ...
+
+    %timeit foo.copy()
+    299 ns ± 30 ns per loop     # <-- arr underlying ndarray (for reference)
+    530 ns ± 9.24 ns per loop   # <-- dta with cython NDArrayBacked
+    1.66 µs ± 46.3 ns per loop  # <-- dta without cython NDArrayBacked
+    328 ns ± 5.29 ns per loop   # <-- obj with NDArrayBacked.__cinit__
+    371 ns ± 6.97 ns per loop   # <-- obj with NDArrayBacked._simple_new
+
+    %timeit foo.T
+    125 ns ± 6.27 ns per loop   # <-- arr underlying ndarray (for reference)
+    226 ns ± 7.66 ns per loop   # <-- dta with cython NDArrayBacked
+    911 ns ± 16.6 ns per loop   # <-- dta without cython NDArrayBacked
+    215 ns ± 4.54 ns per loop   # <-- obj with NDArrayBacked._simple_new
+
+    """
+    # TODO: implement take in terms of cnp.PyArray_TakeFrom
+    # TODO: implement concat_same_type in terms of cnp.PyArray_Concatenate
+
+    # cdef:
+    #    readonly ndarray _ndarray
+    #    readonly object _dtype
+
+    def __init__(self, ndarray values, object dtype):
+        self._ndarray = values
+        self._dtype = dtype
+
+    @classmethod
+    def _simple_new(cls, ndarray values, object dtype):
+        cdef:
+            NDArrayBacked obj
+        obj = NDArrayBacked.__new__(cls)
+        obj._ndarray = values
+        obj._dtype = dtype
+        return obj
+
+    cpdef NDArrayBacked _from_backing_data(self, ndarray values):
+        """
+        Construct a new ExtensionArray `new_array` with `arr` as its _ndarray.
+
+        This should round-trip:
+            self == self._from_backing_data(self._ndarray)
+        """
+        # TODO: re-reuse simple_new if/when it can be cpdef
+        cdef:
+            NDArrayBacked obj
+        obj = NDArrayBacked.__new__(type(self))
+        obj._ndarray = values
+        obj._dtype = self._dtype
+        return obj
+
+    cpdef __setstate__(self, state):
+        if isinstance(state, dict):
+            if "_data" in state:
+                data = state.pop("_data")
+            elif "_ndarray" in state:
+                data = state.pop("_ndarray")
+            else:
+                raise ValueError  # pragma: no cover
+            self._ndarray = data
+            self._dtype = state.pop("_dtype")
+
+            for key, val in state.items():
+                setattr(self, key, val)
+        elif isinstance(state, tuple):
+            if len(state) != 3:
+                if len(state) == 1 and isinstance(state[0], dict):
+                    self.__setstate__(state[0])
+                    return
+                raise NotImplementedError(state)  # pragma: no cover
+
+            data, dtype = state[:2]
+            if isinstance(dtype, np.ndarray):
+                dtype, data = data, dtype
+            self._ndarray = data
+            self._dtype = dtype
+
+            if isinstance(state[2], dict):
+                for key, val in state[2].items():
+                    setattr(self, key, val)
+            else:
+                raise NotImplementedError(state)  # pragma: no cover
+        else:
+            raise NotImplementedError(state)  # pragma: no cover
+
+    def __len__(self) -> int:
+        return len(self._ndarray)
+
+    @property
+    def shape(self):
+        # object cast bc _ndarray.shape is npy_intp*
+        return (<object>(self._ndarray)).shape
+
+    @property
+    def ndim(self) -> int:
+        return self._ndarray.ndim
+
+    @property
+    def size(self) -> int:
+        return self._ndarray.size
+
+    @property
+    def nbytes(self) -> int:
+        return self._ndarray.nbytes
+
+    def copy(self, order="C"):
+        cdef:
+            cnp.NPY_ORDER order_code
+            int success
+
+        success = cnp.PyArray_OrderConverter(order, &order_code)
+        if not success:
+            # clear exception so that we don't get a SystemError
+            PyErr_Clear()
+            # same message used by numpy
+            msg = f"order must be one of 'C', 'F', 'A', or 'K' (got '{order}')"
+            raise ValueError(msg)
+
+        res_values = cnp.PyArray_NewCopy(self._ndarray, order_code)
+        return self._from_backing_data(res_values)
+
+    def delete(self, loc, axis=0):
+        res_values = np.delete(self._ndarray, loc, axis=axis)
+        return self._from_backing_data(res_values)
+
+    def swapaxes(self, axis1, axis2):
+        res_values = cnp.PyArray_SwapAxes(self._ndarray, axis1, axis2)
+        return self._from_backing_data(res_values)
+
+    # TODO: pass NPY_MAXDIMS equiv to axis=None?
+    def repeat(self, repeats, axis: int = 0):
+        if axis is None:
+            axis = 0
+        res_values = cnp.PyArray_Repeat(self._ndarray, repeats, <int>axis)
+        return self._from_backing_data(res_values)
+
+    def reshape(self, *args, **kwargs):
+        res_values = self._ndarray.reshape(*args, **kwargs)
+        return self._from_backing_data(res_values)
+
+    def ravel(self, order="C"):
+        # cnp.PyArray_OrderConverter(PyObject* obj, NPY_ORDER* order)
+        # res_values = cnp.PyArray_Ravel(self._ndarray, order)
+        res_values = self._ndarray.ravel(order)
+        return self._from_backing_data(res_values)
+
+    @property
+    def T(self):
+        res_values = self._ndarray.T
+        return self._from_backing_data(res_values)
+
+    def transpose(self, *axes):
+        res_values = self._ndarray.transpose(*axes)
+        return self._from_backing_data(res_values)

.venv/Lib/site-packages/pandas/_libs/dtypes.pxd

@@ -0,0 +1,48 @@
+"""
+Common location for shared fused types
+"""
+
+from numpy cimport (
+    float32_t,
+    float64_t,
+    int8_t,
+    int16_t,
+    int32_t,
+    int64_t,
+    uint8_t,
+    uint16_t,
+    uint32_t,
+    uint64_t,
+)
+
+# All numeric types except complex
+ctypedef fused numeric_t:
+    int8_t
+    int16_t
+    int32_t
+    int64_t
+
+    uint8_t
+    uint16_t
+    uint32_t
+    uint64_t
+
+    float32_t
+    float64_t
+
+# All numeric types + object, doesn't include complex
+ctypedef fused numeric_object_t:
+    numeric_t
+    object
+
+# i64 + u64 + all float types
+ctypedef fused iu_64_floating_t:
+    float64_t
+    float32_t
+    int64_t
+    uint64_t
+
+# i64 + u64 + all float types + object
+ctypedef fused iu_64_floating_obj_t:
+    iu_64_floating_t
+    object

.venv/Lib/site-packages/pandas/_libs/groupby.pyi

@@ -0,0 +1,159 @@
+from typing import Literal
+
+import numpy as np
+
+from pandas._typing import npt
+
+def group_median_float64(
+    out: np.ndarray,  # ndarray[float64_t, ndim=2]
+    counts: npt.NDArray[np.int64],
+    values: np.ndarray,  # ndarray[float64_t, ndim=2]
+    labels: npt.NDArray[np.int64],
+    min_count: int = ...,  # Py_ssize_t
+) -> None: ...
+def group_cumprod_float64(
+    out: np.ndarray,  # float64_t[:, ::1]
+    values: np.ndarray,  # const float64_t[:, :]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    is_datetimelike: bool,
+    skipna: bool = ...,
+) -> None: ...
+def group_cumsum(
+    out: np.ndarray,  # numeric[:, ::1]
+    values: np.ndarray,  # ndarray[numeric, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    is_datetimelike: bool,
+    skipna: bool = ...,
+) -> None: ...
+def group_shift_indexer(
+    out: np.ndarray,  # int64_t[::1]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    periods: int,
+) -> None: ...
+def group_fillna_indexer(
+    out: np.ndarray,  # ndarray[intp_t]
+    labels: np.ndarray,  # ndarray[int64_t]
+    sorted_labels: npt.NDArray[np.intp],
+    mask: npt.NDArray[np.uint8],
+    direction: Literal["ffill", "bfill"],
+    limit: int,  # int64_t
+    dropna: bool,
+) -> None: ...
+def group_any_all(
+    out: np.ndarray,  # uint8_t[::1]
+    values: np.ndarray,  # const uint8_t[::1]
+    labels: np.ndarray,  # const int64_t[:]
+    mask: np.ndarray,  # const uint8_t[::1]
+    val_test: Literal["any", "all"],
+    skipna: bool,
+) -> None: ...
+def group_add(
+    out: np.ndarray,  # complexfloating_t[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[complexfloating_t, ndim=2]
+    labels: np.ndarray,  # const intp_t[:]
+    min_count: int = ...,
+    datetimelike: bool = ...,
+) -> None: ...
+def group_prod(
+    out: np.ndarray,  # floating[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[floating, ndim=2]
+    labels: np.ndarray,  # const intp_t[:]
+    min_count: int = ...,
+) -> None: ...
+def group_var(
+    out: np.ndarray,  # floating[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[floating, ndim=2]
+    labels: np.ndarray,  # const intp_t[:]
+    min_count: int = ...,  # Py_ssize_t
+    ddof: int = ...,  # int64_t
+) -> None: ...
+def group_mean(
+    out: np.ndarray,  # floating[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[floating, ndim=2]
+    labels: np.ndarray,  # const intp_t[:]
+    min_count: int = ...,  # Py_ssize_t
+    is_datetimelike: bool = ...,  # bint
+    mask: np.ndarray | None = ...,
+    result_mask: np.ndarray | None = ...,
+) -> None: ...
+def group_ohlc(
+    out: np.ndarray,  # floating[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[floating, ndim=2]
+    labels: np.ndarray,  # const intp_t[:]
+    min_count: int = ...,
+) -> None: ...
+def group_quantile(
+    out: npt.NDArray[np.float64],
+    values: np.ndarray,  # ndarray[numeric, ndim=1]
+    labels: npt.NDArray[np.intp],
+    mask: npt.NDArray[np.uint8],
+    sort_indexer: npt.NDArray[np.intp],  # const
+    qs: npt.NDArray[np.float64],  # const
+    interpolation: Literal["linear", "lower", "higher", "nearest", "midpoint"],
+) -> None: ...
+def group_last(
+    out: np.ndarray,  # rank_t[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[rank_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    min_count: int = ...,  # Py_ssize_t
+) -> None: ...
+def group_nth(
+    out: np.ndarray,  # rank_t[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[rank_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    min_count: int = ...,  # int64_t
+    rank: int = ...,  # int64_t
+) -> None: ...
+def group_rank(
+    out: np.ndarray,  # float64_t[:, ::1]
+    values: np.ndarray,  # ndarray[rank_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    is_datetimelike: bool,
+    ties_method: Literal["aveage", "min", "max", "first", "dense"] = ...,
+    ascending: bool = ...,
+    pct: bool = ...,
+    na_option: Literal["keep", "top", "bottom"] = ...,
+) -> None: ...
+def group_max(
+    out: np.ndarray,  # groupby_t[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[groupby_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    min_count: int = ...,
+    mask: np.ndarray | None = ...,
+    result_mask: np.ndarray | None = ...,
+) -> None: ...
+def group_min(
+    out: np.ndarray,  # groupby_t[:, ::1]
+    counts: np.ndarray,  # int64_t[::1]
+    values: np.ndarray,  # ndarray[groupby_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    min_count: int = ...,
+    mask: np.ndarray | None = ...,
+    result_mask: np.ndarray | None = ...,
+) -> None: ...
+def group_cummin(
+    out: np.ndarray,  # groupby_t[:, ::1]
+    values: np.ndarray,  # ndarray[groupby_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    is_datetimelike: bool,
+) -> None: ...
+def group_cummax(
+    out: np.ndarray,  # groupby_t[:, ::1]
+    values: np.ndarray,  # ndarray[groupby_t, ndim=2]
+    labels: np.ndarray,  # const int64_t[:]
+    ngroups: int,
+    is_datetimelike: bool,
+) -> None: ...

.venv/Lib/site-packages/pandas/_libs/hashing.pyi

@@ -0,0 +1,9 @@
+import numpy as np
+
+from pandas._typing import npt
+
+def hash_object_array(
+    arr: npt.NDArray[np.object_],
+    key: str,
+    encoding: str = ...,
+) -> npt.NDArray[np.uint64]: ...

.venv/Lib/site-packages/pandas/_libs/hashing.pyx

@@ -0,0 +1,198 @@
+# Translated from the reference implementation
+# at https://github.com/veorq/SipHash
+
+import cython
+
+from libc.stdlib cimport (
+    free,
+    malloc,
+)
+
+import numpy as np
+
+from numpy cimport (
+    import_array,
+    ndarray,
+    uint8_t,
+    uint32_t,
+    uint64_t,
+)
+
+import_array()
+
+from pandas._libs.util cimport is_nan
+
+DEF cROUNDS = 2
+DEF dROUNDS = 4
+
+
+@cython.boundscheck(False)
+def hash_object_array(
+    ndarray[object] arr, str key, str encoding="utf8"
+) -> np.ndarray[np.uint64]:
+    """
+    Parameters
+    ----------
+    arr : 1-d object ndarray of objects
+    key : hash key, must be 16 byte len encoded
+    encoding : encoding for key & arr, default to 'utf8'
+
+    Returns
+    -------
+    1-d uint64 ndarray of hashes.
+
+    Raises
+    ------
+    TypeError
+        If the array contains mixed types.
+
+    Notes
+    -----
+    Allowed values must be strings, or nulls
+    mixed array types will raise TypeError.
+    """
+    cdef:
+        Py_ssize_t i, n
+        uint64_t[:] result
+        bytes data, k
+        uint8_t *kb
+        uint64_t *lens
+        char **vecs
+        char *cdata
+        object val
+        list datas = []
+
+    k = <bytes>key.encode(encoding)
+    kb = <uint8_t *>k
+    if len(k) != 16:
+        raise ValueError(
+            f"key should be a 16-byte string encoded, got {k} (len {len(k)})"
+        )
+
+    n = len(arr)
+
+    # create an array of bytes
+    vecs = <char **>malloc(n * sizeof(char *))
+    lens = <uint64_t*>malloc(n * sizeof(uint64_t))
+
+    for i in range(n):
+        val = arr[i]
+        if isinstance(val, bytes):
+            data = <bytes>val
+        elif isinstance(val, str):
+            data = <bytes>val.encode(encoding)
+        elif val is None or is_nan(val):
+            # null, stringify and encode
+            data = <bytes>str(val).encode(encoding)
+
+        elif isinstance(val, tuple):
+            # GH#28969 we could have a tuple, but need to ensure that
+            #  the tuple entries are themselves hashable before converting
+            #  to str
+            hash(val)
+            data = <bytes>str(val).encode(encoding)
+        else:
+            raise TypeError(
+                f"{val} of type {type(val)} is not a valid type for hashing, "
+                "must be string or null"
+            )
+
+        lens[i] = len(data)
+        cdata = data
+
+        # keep the references alive through the end of the
+        # function
+        datas.append(data)
+        vecs[i] = cdata
+
+    result = np.empty(n, dtype=np.uint64)
+    with nogil:
+        for i in range(n):
+            result[i] = low_level_siphash(<uint8_t *>vecs[i], lens[i], kb)
+
+    free(vecs)
+    free(lens)
+    return result.base  # .base to retrieve underlying np.ndarray
+
+
+cdef inline uint64_t _rotl(uint64_t x, uint64_t b) nogil:
+    return (x << b) | (x >> (64 - b))
+
+
+cdef inline uint64_t u8to64_le(uint8_t* p) nogil:
+    return (<uint64_t>p[0] |
+            <uint64_t>p[1] << 8 |
+            <uint64_t>p[2] << 16 |
+            <uint64_t>p[3] << 24 |
+            <uint64_t>p[4] << 32 |
+            <uint64_t>p[5] << 40 |
+            <uint64_t>p[6] << 48 |
+            <uint64_t>p[7] << 56)
+
+
+cdef inline void _sipround(uint64_t* v0, uint64_t* v1,
+                           uint64_t* v2, uint64_t* v3) nogil:
+    v0[0] += v1[0]
+    v1[0] = _rotl(v1[0], 13)
+    v1[0] ^= v0[0]
+    v0[0] = _rotl(v0[0], 32)
+    v2[0] += v3[0]
+    v3[0] = _rotl(v3[0], 16)
+    v3[0] ^= v2[0]
+    v0[0] += v3[0]
+    v3[0] = _rotl(v3[0], 21)
+    v3[0] ^= v0[0]
+    v2[0] += v1[0]
+    v1[0] = _rotl(v1[0], 17)
+    v1[0] ^= v2[0]
+    v2[0] = _rotl(v2[0], 32)
+
+
+@cython.cdivision(True)
+cdef uint64_t low_level_siphash(uint8_t* data, size_t datalen,
+                                uint8_t* key) nogil:
+    cdef uint64_t v0 = 0x736f6d6570736575ULL
+    cdef uint64_t v1 = 0x646f72616e646f6dULL
+    cdef uint64_t v2 = 0x6c7967656e657261ULL
+    cdef uint64_t v3 = 0x7465646279746573ULL
+    cdef uint64_t b
+    cdef uint64_t k0 = u8to64_le(key)
+    cdef uint64_t k1 = u8to64_le(key + 8)
+    cdef uint64_t m
+    cdef int i
+    cdef uint8_t* end = data + datalen - (datalen % sizeof(uint64_t))
+    cdef int left = datalen & 7
+    cdef int left_byte
+
+    b = (<uint64_t>datalen) << 56
+    v3 ^= k1
+    v2 ^= k0
+    v1 ^= k1
+    v0 ^= k0
+
+    while (data != end):
+        m = u8to64_le(data)
+        v3 ^= m
+        for i in range(cROUNDS):
+            _sipround(&v0, &v1, &v2, &v3)
+        v0 ^= m
+
+        data += sizeof(uint64_t)
+
+    for i in range(left-1, -1, -1):
+        b |= (<uint64_t>data[i]) << (i * 8)
+
+    v3 ^= b
+
+    for i in range(cROUNDS):
+        _sipround(&v0, &v1, &v2, &v3)
+
+    v0 ^= b
+    v2 ^= 0xff
+
+    for i in range(dROUNDS):
+        _sipround(&v0, &v1, &v2, &v3)
+
+    b = v0 ^ v1 ^ v2 ^ v3
+
+    return b

.venv/Lib/site-packages/pandas/_libs/hashtable.pxd

@@ -0,0 +1,141 @@
+from numpy cimport (
+    intp_t,
+    ndarray,
+)
+
+from pandas._libs.khash cimport (
+    complex64_t,
+    complex128_t,
+    float32_t,
+    float64_t,
+    int8_t,
+    int16_t,
+    int32_t,
+    int64_t,
+    kh_complex64_t,
+    kh_complex128_t,
+    kh_float32_t,
+    kh_float64_t,
+    kh_int8_t,
+    kh_int16_t,
+    kh_int32_t,
+    kh_int64_t,
+    kh_pymap_t,
+    kh_str_t,
+    kh_uint8_t,
+    kh_uint16_t,
+    kh_uint32_t,
+    kh_uint64_t,
+    khcomplex64_t,
+    khcomplex128_t,
+    uint8_t,
+    uint16_t,
+    uint32_t,
+    uint64_t,
+)
+
+# prototypes for sharing
+
+cdef class HashTable:
+    pass
+
+cdef class UInt64HashTable(HashTable):
+    cdef kh_uint64_t *table
+
+    cpdef get_item(self, uint64_t val)
+    cpdef set_item(self, uint64_t key, Py_ssize_t val)
+
+cdef class Int64HashTable(HashTable):
+    cdef kh_int64_t *table
+
+    cpdef get_item(self, int64_t val)
+    cpdef set_item(self, int64_t key, Py_ssize_t val)
+
+cdef class UInt32HashTable(HashTable):
+    cdef kh_uint32_t *table
+
+    cpdef get_item(self, uint32_t val)
+    cpdef set_item(self, uint32_t key, Py_ssize_t val)
+
+cdef class Int32HashTable(HashTable):
+    cdef kh_int32_t *table
+
+    cpdef get_item(self, int32_t val)
+    cpdef set_item(self, int32_t key, Py_ssize_t val)
+
+cdef class UInt16HashTable(HashTable):
+    cdef kh_uint16_t *table
+
+    cpdef get_item(self, uint16_t val)
+    cpdef set_item(self, uint16_t key, Py_ssize_t val)
+
+cdef class Int16HashTable(HashTable):
+    cdef kh_int16_t *table
+
+    cpdef get_item(self, int16_t val)
+    cpdef set_item(self, int16_t key, Py_ssize_t val)
+
+cdef class UInt8HashTable(HashTable):
+    cdef kh_uint8_t *table
+
+    cpdef get_item(self, uint8_t val)
+    cpdef set_item(self, uint8_t key, Py_ssize_t val)
+
+cdef class Int8HashTable(HashTable):
+    cdef kh_int8_t *table
+
+    cpdef get_item(self, int8_t val)
+    cpdef set_item(self, int8_t key, Py_ssize_t val)
+
+cdef class Float64HashTable(HashTable):
+    cdef kh_float64_t *table
+
+    cpdef get_item(self, float64_t val)
+    cpdef set_item(self, float64_t key, Py_ssize_t val)
+
+cdef class Float32HashTable(HashTable):
+    cdef kh_float32_t *table
+
+    cpdef get_item(self, float32_t val)
+    cpdef set_item(self, float32_t key, Py_ssize_t val)
+
+cdef class Complex64HashTable(HashTable):
+    cdef kh_complex64_t *table
+
+    cpdef get_item(self, complex64_t val)
+    cpdef set_item(self, complex64_t key, Py_ssize_t val)
+
+cdef class Complex128HashTable(HashTable):
+    cdef kh_complex128_t *table
+
+    cpdef get_item(self, complex128_t val)
+    cpdef set_item(self, complex128_t key, Py_ssize_t val)
+
+cdef class PyObjectHashTable(HashTable):
+    cdef kh_pymap_t *table
+
+    cpdef get_item(self, object val)
+    cpdef set_item(self, object key, Py_ssize_t val)
+
+
+cdef class StringHashTable(HashTable):
+    cdef kh_str_t *table
+
+    cpdef get_item(self, str val)
+    cpdef set_item(self, str key, Py_ssize_t val)
+
+cdef struct Int64VectorData:
+    int64_t *data
+    Py_ssize_t n, m
+
+cdef class Vector:
+    cdef bint external_view_exists
+
+cdef class Int64Vector(Vector):
+    cdef Int64VectorData *data
+    cdef ndarray ao
+
+    cdef resize(self)
+    cpdef ndarray to_array(self)
+    cdef inline void append(self, int64_t x)
+    cdef extend(self, int64_t[:] x)

.venv/Lib/site-packages/pandas/_libs/hashtable.pyi

@@ -0,0 +1,213 @@
+from typing import (
+    Hashable,
+    Literal,
+)
+
+import numpy as np
+
+from pandas._typing import npt
+
+def unique_label_indices(
+    labels: np.ndarray,  # const int64_t[:]
+) -> np.ndarray: ...
+
+class Factorizer:
+    count: int
+    def __init__(self, size_hint: int): ...
+    def get_count(self) -> int: ...
+
+class ObjectFactorizer(Factorizer):
+    table: PyObjectHashTable
+    uniques: ObjectVector
+    def factorize(
+        self,
+        values: npt.NDArray[np.object_],
+        sort: bool = ...,
+        na_sentinel=...,
+        na_value=...,
+    ) -> npt.NDArray[np.intp]: ...
+
+class Int64Factorizer(Factorizer):
+    table: Int64HashTable
+    uniques: Int64Vector
+    def factorize(
+        self,
+        values: np.ndarray,  # const int64_t[:]
+        sort: bool = ...,
+        na_sentinel=...,
+        na_value=...,
+    ) -> npt.NDArray[np.intp]: ...
+
+class Int64Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.int64]: ...
+
+class Int32Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.int32]: ...
+
+class Int16Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.int16]: ...
+
+class Int8Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.int8]: ...
+
+class UInt64Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.uint64]: ...
+
+class UInt32Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.uint32]: ...
+
+class UInt16Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.uint16]: ...
+
+class UInt8Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.uint8]: ...
+
+class Float64Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.float64]: ...
+
+class Float32Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.float32]: ...
+
+class Complex128Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.complex128]: ...
+
+class Complex64Vector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.complex64]: ...
+
+class StringVector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.object_]: ...
+
+class ObjectVector:
+    def __init__(self): ...
+    def __len__(self) -> int: ...
+    def to_array(self) -> npt.NDArray[np.object_]: ...
+
+class HashTable:
+    # NB: The base HashTable class does _not_ actually have these methods;
+    #  we are putting the here for the sake of mypy to avoid
+    #  reproducing them in each subclass below.
+    def __init__(self, size_hint: int = ...): ...
+    def __len__(self) -> int: ...
+    def __contains__(self, key: Hashable) -> bool: ...
+    def sizeof(self, deep: bool = ...) -> int: ...
+    def get_state(self) -> dict[str, int]: ...
+    # TODO: `item` type is subclass-specific
+    def get_item(self, item): ...  # TODO: return type?
+    def set_item(self, item) -> None: ...
+    # FIXME: we don't actually have this for StringHashTable or ObjectHashTable?
+    def map(
+        self,
+        keys: np.ndarray,  # np.ndarray[subclass-specific]
+        values: np.ndarray,  # const int64_t[:]
+    ) -> None: ...
+    def map_locations(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+    ) -> None: ...
+    def lookup(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+    ) -> npt.NDArray[np.intp]: ...
+    def get_labels(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+        uniques,  # SubclassTypeVector
+        count_prior: int = ...,
+        na_sentinel: int = ...,
+        na_value: object = ...,
+    ) -> npt.NDArray[np.intp]: ...
+    def unique(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+        return_inverse: bool = ...,
+    ) -> tuple[
+        np.ndarray,  # np.ndarray[subclass-specific]
+        npt.NDArray[np.intp],
+    ] | np.ndarray: ...  # np.ndarray[subclass-specific]
+    def _unique(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+        uniques,  # FooVector
+        count_prior: int = ...,
+        na_sentinel: int = ...,
+        na_value: object = ...,
+        ignore_na: bool = ...,
+        return_inverse: bool = ...,
+    ) -> tuple[
+        np.ndarray,  # np.ndarray[subclass-specific]
+        npt.NDArray[np.intp],
+    ] | np.ndarray: ...  # np.ndarray[subclass-specific]
+    def factorize(
+        self,
+        values: np.ndarray,  # np.ndarray[subclass-specific]
+        na_sentinel: int = ...,
+        na_value: object = ...,
+        mask=...,
+    ) -> tuple[np.ndarray, npt.NDArray[np.intp],]: ...  # np.ndarray[subclass-specific]
+
+class Complex128HashTable(HashTable): ...
+class Complex64HashTable(HashTable): ...
+class Float64HashTable(HashTable): ...
+class Float32HashTable(HashTable): ...
+
+class Int64HashTable(HashTable):
+    # Only Int64HashTable has get_labels_groupby
+    def get_labels_groupby(
+        self,
+        values: np.ndarray,  # const int64_t[:]
+    ) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.int64],]: ...
+
+class Int32HashTable(HashTable): ...
+class Int16HashTable(HashTable): ...
+class Int8HashTable(HashTable): ...
+class UInt64HashTable(HashTable): ...
+class UInt32HashTable(HashTable): ...
+class UInt16HashTable(HashTable): ...
+class UInt8HashTable(HashTable): ...
+class StringHashTable(HashTable): ...
+class PyObjectHashTable(HashTable): ...
+class IntpHashTable(HashTable): ...
+
+def duplicated(
+    values: np.ndarray,
+    keep: Literal["last", "first", False] = ...,
+) -> npt.NDArray[np.bool_]: ...
+def mode(values: np.ndarray, dropna: bool) -> np.ndarray: ...
+def value_count(
+    values: np.ndarray,
+    dropna: bool,
+) -> tuple[np.ndarray, npt.NDArray[np.int64],]: ...  # np.ndarray[same-as-values]
+
+# arr and values should have same dtype
+def ismember(
+    arr: np.ndarray,
+    values: np.ndarray,
+) -> npt.NDArray[np.bool_]: ...
+def object_hash(obj) -> int: ...
+def objects_are_equal(a, b) -> bool: ...

.venv/Lib/site-packages/pandas/_libs/hashtable.pyx

@@ -0,0 +1,182 @@
+cimport cython
+from cpython.mem cimport (
+    PyMem_Free,
+    PyMem_Malloc,
+)
+from cpython.ref cimport (
+    Py_INCREF,
+    PyObject,
+)
+from libc.stdlib cimport (
+    free,
+    malloc,
+)
+
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    float64_t,
+    ndarray,
+    uint8_t,
+    uint32_t,
+)
+from numpy.math cimport NAN
+
+cnp.import_array()
+
+
+from pandas._libs cimport util
+from pandas._libs.khash cimport (
+    KHASH_TRACE_DOMAIN,
+    are_equivalent_float32_t,
+    are_equivalent_float64_t,
+    are_equivalent_khcomplex64_t,
+    are_equivalent_khcomplex128_t,
+    kh_needed_n_buckets,
+    kh_python_hash_equal,
+    kh_python_hash_func,
+    kh_str_t,
+    khcomplex64_t,
+    khcomplex128_t,
+    khiter_t,
+)
+from pandas._libs.missing cimport checknull
+
+
+def get_hashtable_trace_domain():
+    return KHASH_TRACE_DOMAIN
+
+
+def object_hash(obj):
+    return kh_python_hash_func(obj)
+
+
+def objects_are_equal(a, b):
+    return kh_python_hash_equal(a, b)
+
+
+cdef int64_t NPY_NAT = util.get_nat()
+SIZE_HINT_LIMIT = (1 << 20) + 7
+
+
+cdef Py_ssize_t _INIT_VEC_CAP = 128
+
+include "hashtable_class_helper.pxi"
+include "hashtable_func_helper.pxi"
+
+
+# map derived hash-map types onto basic hash-map types:
+if np.dtype(np.intp) == np.dtype(np.int64):
+    IntpHashTable = Int64HashTable
+    unique_label_indices = _unique_label_indices_int64
+elif np.dtype(np.intp) == np.dtype(np.int32):
+    IntpHashTable = Int32HashTable
+    unique_label_indices = _unique_label_indices_int32
+else:
+    raise ValueError(np.dtype(np.intp))
+
+
+cdef class Factorizer:
+    cdef readonly:
+        Py_ssize_t count
+
+    def __cinit__(self, size_hint: int):
+        self.count = 0
+
+    def get_count(self) -> int:
+        return self.count
+
+
+cdef class ObjectFactorizer(Factorizer):
+    cdef public:
+        PyObjectHashTable table
+        ObjectVector uniques
+
+    def __cinit__(self, size_hint: int):
+        self.table = PyObjectHashTable(size_hint)
+        self.uniques = ObjectVector()
+
+    def factorize(
+        self, ndarray[object] values, sort=False, na_sentinel=-1, na_value=None
+    ) -> np.ndarray:
+        """
+
+        Returns
+        -------
+        np.ndarray[np.intp]
+
+        Examples
+        --------
+        Factorize values with nans replaced by na_sentinel
+
+        >>> fac = ObjectFactorizer(3)
+        >>> fac.factorize(np.array([1,2,np.nan], dtype='O'), na_sentinel=20)
+        array([ 0,  1, 20])
+        """
+        cdef:
+            ndarray[intp_t] labels
+
+        if self.uniques.external_view_exists:
+            uniques = ObjectVector()
+            uniques.extend(self.uniques.to_array())
+            self.uniques = uniques
+        labels = self.table.get_labels(values, self.uniques,
+                                       self.count, na_sentinel, na_value)
+        mask = (labels == na_sentinel)
+        # sort on
+        if sort:
+            sorter = self.uniques.to_array().argsort()
+            reverse_indexer = np.empty(len(sorter), dtype=np.intp)
+            reverse_indexer.put(sorter, np.arange(len(sorter)))
+            labels = reverse_indexer.take(labels, mode='clip')
+            labels[mask] = na_sentinel
+        self.count = len(self.uniques)
+        return labels
+
+
+cdef class Int64Factorizer(Factorizer):
+    cdef public:
+        Int64HashTable table
+        Int64Vector uniques
+
+    def __cinit__(self, size_hint: int):
+        self.table = Int64HashTable(size_hint)
+        self.uniques = Int64Vector()
+
+    def factorize(self, const int64_t[:] values, sort=False,
+                  na_sentinel=-1, na_value=None) -> np.ndarray:
+        """
+        Returns
+        -------
+        ndarray[intp_t]
+
+        Examples
+        --------
+        Factorize values with nans replaced by na_sentinel
+
+        >>> fac = Int64Factorizer(3)
+        >>> fac.factorize(np.array([1,2,3]), na_sentinel=20)
+        array([0, 1, 2])
+        """
+        cdef:
+            ndarray[intp_t] labels
+
+        if self.uniques.external_view_exists:
+            uniques = Int64Vector()
+            uniques.extend(self.uniques.to_array())
+            self.uniques = uniques
+        labels = self.table.get_labels(values, self.uniques,
+                                       self.count, na_sentinel,
+                                       na_value=na_value)
+
+        # sort on
+        if sort:
+            sorter = self.uniques.to_array().argsort()
+            reverse_indexer = np.empty(len(sorter), dtype=np.intp)
+            reverse_indexer.put(sorter, np.arange(len(sorter)))
+
+            labels = reverse_indexer.take(labels)
+
+        self.count = len(self.uniques)
+        return labels

.venv/Lib/site-packages/pandas/_libs/hashtable_func_helper.pxi.in

@@ -0,0 +1,515 @@
+"""
+Template for each `dtype` helper function for hashtable
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+{{py:
+
+# name, dtype, ttype, c_type, to_c_type
+dtypes = [('Complex128', 'complex128', 'complex128',
+                         'khcomplex128_t', 'to_khcomplex128_t'),
+          ('Complex64', 'complex64', 'complex64',
+                        'khcomplex64_t', 'to_khcomplex64_t'),
+          ('Float64', 'float64', 'float64', 'float64_t', ''),
+          ('Float32', 'float32', 'float32', 'float32_t', ''),
+          ('UInt64', 'uint64', 'uint64', 'uint64_t', ''),
+          ('UInt32', 'uint32', 'uint32', 'uint32_t', ''),
+          ('UInt16', 'uint16', 'uint16', 'uint16_t', ''),
+          ('UInt8', 'uint8', 'uint8', 'uint8_t', ''),
+          ('Object', 'object', 'pymap', 'object', ''),
+          ('Int64', 'int64', 'int64', 'int64_t', ''),
+          ('Int32', 'int32', 'int32', 'int32_t', ''),
+          ('Int16', 'int16', 'int16', 'int16_t', ''),
+          ('Int8', 'int8', 'int8', 'int8_t', '')]
+
+}}
+
+{{for name, dtype, ttype, c_type, to_c_type in dtypes}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if dtype == 'object'}}
+cdef value_count_{{dtype}}(ndarray[{{dtype}}] values, bint dropna):
+{{else}}
+cdef value_count_{{dtype}}(const {{dtype}}_t[:] values, bint dropna):
+{{endif}}
+    cdef:
+        Py_ssize_t i = 0
+        Py_ssize_t n = len(values)
+        kh_{{ttype}}_t *table
+
+        # Don't use Py_ssize_t, since table.n_buckets is unsigned
+        khiter_t k
+
+        {{c_type}} val
+
+        int ret = 0
+
+    # we track the order in which keys are first seen (GH39009),
+    # khash-map isn't insertion-ordered, thus:
+    #    table maps keys to counts
+    #    result_keys remembers the original order of keys
+
+    result_keys = {{name}}Vector()
+    table = kh_init_{{ttype}}()
+
+    {{if dtype == 'object'}}
+    kh_resize_{{ttype}}(table, n // 10)
+
+    for i in range(n):
+        val = values[i]
+        if not dropna or not checknull(val):
+            k = kh_get_{{ttype}}(table, <PyObject*>val)
+            if k != table.n_buckets:
+                table.vals[k] += 1
+            else:
+                k = kh_put_{{ttype}}(table, <PyObject*>val, &ret)
+                table.vals[k] = 1
+                result_keys.append(val)
+    {{else}}
+    kh_resize_{{ttype}}(table, n)
+
+    for i in range(n):
+        val = {{to_c_type}}(values[i])
+
+        if not is_nan_{{c_type}}(val) or not dropna:
+            k = kh_get_{{ttype}}(table, val)
+            if k != table.n_buckets:
+                table.vals[k] += 1
+            else:
+                k = kh_put_{{ttype}}(table, val, &ret)
+                table.vals[k] = 1
+                result_keys.append(val)
+    {{endif}}
+
+    # collect counts in the order corresponding to result_keys:
+    cdef int64_t[:] result_counts = np.empty(table.size, dtype=np.int64)
+    for i in range(table.size):
+        {{if dtype == 'object'}}
+        k = kh_get_{{ttype}}(table, result_keys.data[i])
+        {{else}}
+        k = kh_get_{{ttype}}(table, result_keys.data.data[i])
+        {{endif}}
+        result_counts[i] = table.vals[k]
+
+    kh_destroy_{{ttype}}(table)
+
+    return result_keys.to_array(), result_counts.base
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if dtype == 'object'}}
+cdef duplicated_{{dtype}}(ndarray[{{dtype}}] values, object keep='first'):
+{{else}}
+cdef duplicated_{{dtype}}(const {{dtype}}_t[:] values, object keep='first'):
+{{endif}}
+    cdef:
+        int ret = 0
+        {{if dtype != 'object'}}
+        {{c_type}} value
+        {{endif}}
+        Py_ssize_t i, n = len(values)
+        khiter_t k
+        kh_{{ttype}}_t *table = kh_init_{{ttype}}()
+        ndarray[uint8_t, ndim=1, cast=True] out = np.empty(n, dtype='bool')
+
+    kh_resize_{{ttype}}(table, min(kh_needed_n_buckets(n), SIZE_HINT_LIMIT))
+
+    if keep not in ('last', 'first', False):
+        raise ValueError('keep must be either "first", "last" or False')
+
+    if keep == 'last':
+        {{if dtype == 'object'}}
+        for i in range(n - 1, -1, -1):
+            # equivalent: range(n)[::-1], which cython doesn't like in nogil
+            kh_put_{{ttype}}(table, <PyObject*>values[i], &ret)
+            out[i] = ret == 0
+        {{else}}
+        with nogil:
+            for i in range(n - 1, -1, -1):
+                # equivalent: range(n)[::-1], which cython doesn't like in nogil
+                value = {{to_c_type}}(values[i])
+                kh_put_{{ttype}}(table, value, &ret)
+                out[i] = ret == 0
+        {{endif}}
+    elif keep == 'first':
+        {{if dtype == 'object'}}
+        for i in range(n):
+            kh_put_{{ttype}}(table, <PyObject*>values[i], &ret)
+            out[i] = ret == 0
+        {{else}}
+        with nogil:
+            for i in range(n):
+                value = {{to_c_type}}(values[i])
+                kh_put_{{ttype}}(table, value, &ret)
+                out[i] = ret == 0
+        {{endif}}
+    else:
+        {{if dtype == 'object'}}
+        for i in range(n):
+            value = values[i]
+            k = kh_get_{{ttype}}(table, <PyObject*>value)
+            if k != table.n_buckets:
+                out[table.vals[k]] = 1
+                out[i] = 1
+            else:
+                k = kh_put_{{ttype}}(table, <PyObject*>value, &ret)
+                table.vals[k] = i
+                out[i] = 0
+        {{else}}
+        with nogil:
+            for i in range(n):
+                value = {{to_c_type}}(values[i])
+                k = kh_get_{{ttype}}(table, value)
+                if k != table.n_buckets:
+                    out[table.vals[k]] = 1
+                    out[i] = 1
+                else:
+                    k = kh_put_{{ttype}}(table, value, &ret)
+                    table.vals[k] = i
+                    out[i] = 0
+        {{endif}}
+    kh_destroy_{{ttype}}(table)
+    return out
+
+
+# ----------------------------------------------------------------------
+# Membership
+# ----------------------------------------------------------------------
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if dtype == 'object'}}
+cdef ismember_{{dtype}}(ndarray[{{c_type}}] arr, ndarray[{{c_type}}] values):
+{{else}}
+cdef ismember_{{dtype}}(const {{dtype}}_t[:] arr, const {{dtype}}_t[:] values):
+{{endif}}
+    """
+    Return boolean of values in arr on an
+    element by-element basis
+
+    Parameters
+    ----------
+    arr : {{dtype}} ndarray
+    values : {{dtype}} ndarray
+
+    Returns
+    -------
+    boolean ndarry len of (arr)
+    """
+    cdef:
+        Py_ssize_t i, n
+        khiter_t k
+        int ret = 0
+        ndarray[uint8_t] result
+        {{c_type}} val
+        kh_{{ttype}}_t *table = kh_init_{{ttype}}()
+
+    # construct the table
+    n = len(values)
+    kh_resize_{{ttype}}(table, n)
+
+    {{if dtype == 'object'}}
+    for i in range(n):
+        kh_put_{{ttype}}(table, <PyObject*>values[i], &ret)
+    {{else}}
+    with nogil:
+        for i in range(n):
+            val = {{to_c_type}}(values[i])
+            kh_put_{{ttype}}(table, val, &ret)
+    {{endif}}
+
+    # test membership
+    n = len(arr)
+    result = np.empty(n, dtype=np.uint8)
+
+    {{if dtype == 'object'}}
+    for i in range(n):
+        val = arr[i]
+        k = kh_get_{{ttype}}(table, <PyObject*>val)
+        result[i] = (k != table.n_buckets)
+    {{else}}
+    with nogil:
+        for i in range(n):
+            val = {{to_c_type}}(arr[i])
+            k = kh_get_{{ttype}}(table, val)
+            result[i] = (k != table.n_buckets)
+    {{endif}}
+
+    kh_destroy_{{ttype}}(table)
+    return result.view(np.bool_)
+
+# ----------------------------------------------------------------------
+# Mode Computations
+# ----------------------------------------------------------------------
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+{{if dtype == 'object'}}
+cdef mode_{{dtype}}(ndarray[{{dtype}}] values, bint dropna):
+{{else}}
+cdef mode_{{dtype}}(const {{dtype}}_t[:] values, bint dropna):
+{{endif}}
+    cdef:
+        {{if dtype == 'object'}}
+        ndarray[{{dtype}}] keys
+        ndarray[{{dtype}}] modes
+        {{else}}
+        {{dtype}}_t[:] keys
+        ndarray[{{dtype}}_t] modes
+        {{endif}}
+        int64_t[:] counts
+        int64_t count, max_count = -1
+        Py_ssize_t k, j = 0
+
+    keys, counts = value_count_{{dtype}}(values, dropna)
+
+    {{if dtype == 'object'}}
+    modes = np.empty(len(keys), dtype=np.object_)
+    {{else}}
+    modes = np.empty(len(keys), dtype=np.{{dtype}})
+    {{endif}}
+
+    {{if dtype != 'object'}}
+    with nogil:
+        for k in range(len(keys)):
+            count = counts[k]
+            if count == max_count:
+                j += 1
+            elif count > max_count:
+                max_count = count
+                j = 0
+            else:
+                continue
+
+            modes[j] = keys[k]
+    {{else}}
+    for k in range(len(keys)):
+        count = counts[k]
+        if count == max_count:
+            j += 1
+        elif count > max_count:
+            max_count = count
+            j = 0
+        else:
+            continue
+
+        modes[j] = keys[k]
+    {{endif}}
+
+    return modes[:j + 1]
+
+{{endfor}}
+
+
+ctypedef fused htfunc_t:
+    complex128_t
+    complex64_t
+    float64_t
+    float32_t
+    uint64_t
+    uint32_t
+    uint16_t
+    uint8_t
+    int64_t
+    int32_t
+    int16_t
+    int8_t
+    object
+
+
+cpdef value_count(ndarray[htfunc_t] values, bint dropna):
+    if htfunc_t is object:
+        return value_count_object(values, dropna)
+
+    elif htfunc_t is int8_t:
+        return value_count_int8(values, dropna)
+    elif htfunc_t is int16_t:
+        return value_count_int16(values, dropna)
+    elif htfunc_t is int32_t:
+        return value_count_int32(values, dropna)
+    elif htfunc_t is int64_t:
+        return value_count_int64(values, dropna)
+
+    elif htfunc_t is uint8_t:
+        return value_count_uint8(values, dropna)
+    elif htfunc_t is uint16_t:
+        return value_count_uint16(values, dropna)
+    elif htfunc_t is uint32_t:
+        return value_count_uint32(values, dropna)
+    elif htfunc_t is uint64_t:
+        return value_count_uint64(values, dropna)
+
+    elif htfunc_t is float64_t:
+        return value_count_float64(values, dropna)
+    elif htfunc_t is float32_t:
+        return value_count_float32(values, dropna)
+
+    elif htfunc_t is complex128_t:
+        return value_count_complex128(values, dropna)
+    elif htfunc_t is complex64_t:
+        return value_count_complex64(values, dropna)
+
+    else:
+        raise TypeError(values.dtype)
+
+
+cpdef duplicated(ndarray[htfunc_t] values, object keep="first"):
+    if htfunc_t is object:
+        return duplicated_object(values, keep)
+
+    elif htfunc_t is int8_t:
+        return duplicated_int8(values, keep)
+    elif htfunc_t is int16_t:
+        return duplicated_int16(values, keep)
+    elif htfunc_t is int32_t:
+        return duplicated_int32(values, keep)
+    elif htfunc_t is int64_t:
+        return duplicated_int64(values, keep)
+
+    elif htfunc_t is uint8_t:
+        return duplicated_uint8(values, keep)
+    elif htfunc_t is uint16_t:
+        return duplicated_uint16(values, keep)
+    elif htfunc_t is uint32_t:
+        return duplicated_uint32(values, keep)
+    elif htfunc_t is uint64_t:
+        return duplicated_uint64(values, keep)
+
+    elif htfunc_t is float64_t:
+        return duplicated_float64(values, keep)
+    elif htfunc_t is float32_t:
+        return duplicated_float32(values, keep)
+
+    elif htfunc_t is complex128_t:
+        return duplicated_complex128(values, keep)
+    elif htfunc_t is complex64_t:
+        return duplicated_complex64(values, keep)
+
+    else:
+        raise TypeError(values.dtype)
+
+
+cpdef ismember(ndarray[htfunc_t] arr, ndarray[htfunc_t] values):
+    if htfunc_t is object:
+        return ismember_object(arr, values)
+
+    elif htfunc_t is int8_t:
+        return ismember_int8(arr, values)
+    elif htfunc_t is int16_t:
+        return ismember_int16(arr, values)
+    elif htfunc_t is int32_t:
+        return ismember_int32(arr, values)
+    elif htfunc_t is int64_t:
+        return ismember_int64(arr, values)
+
+    elif htfunc_t is uint8_t:
+        return ismember_uint8(arr, values)
+    elif htfunc_t is uint16_t:
+        return ismember_uint16(arr, values)
+    elif htfunc_t is uint32_t:
+        return ismember_uint32(arr, values)
+    elif htfunc_t is uint64_t:
+        return ismember_uint64(arr, values)
+
+    elif htfunc_t is float64_t:
+        return ismember_float64(arr, values)
+    elif htfunc_t is float32_t:
+        return ismember_float32(arr, values)
+
+    elif htfunc_t is complex128_t:
+        return ismember_complex128(arr, values)
+    elif htfunc_t is complex64_t:
+        return ismember_complex64(arr, values)
+
+    else:
+        raise TypeError(values.dtype)
+
+
+cpdef mode(ndarray[htfunc_t] values, bint dropna):
+    if htfunc_t is object:
+        return mode_object(values, dropna)
+
+    elif htfunc_t is int8_t:
+        return mode_int8(values, dropna)
+    elif htfunc_t is int16_t:
+        return mode_int16(values, dropna)
+    elif htfunc_t is int32_t:
+        return mode_int32(values, dropna)
+    elif htfunc_t is int64_t:
+        return mode_int64(values, dropna)
+
+    elif htfunc_t is uint8_t:
+        return mode_uint8(values, dropna)
+    elif htfunc_t is uint16_t:
+        return mode_uint16(values, dropna)
+    elif htfunc_t is uint32_t:
+        return mode_uint32(values, dropna)
+    elif htfunc_t is uint64_t:
+        return mode_uint64(values, dropna)
+
+    elif htfunc_t is float64_t:
+        return mode_float64(values, dropna)
+    elif htfunc_t is float32_t:
+        return mode_float32(values, dropna)
+
+    elif htfunc_t is complex128_t:
+        return mode_complex128(values, dropna)
+    elif htfunc_t is complex64_t:
+        return mode_complex64(values, dropna)
+
+    else:
+        raise TypeError(values.dtype)
+
+
+{{py:
+
+# name, dtype, ttype, c_type
+dtypes = [('Int64', 'int64', 'int64', 'int64_t'),
+          ('Int32', 'int32', 'int32', 'int32_t'), ]
+
+}}
+
+{{for name, dtype, ttype, c_type in dtypes}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def _unique_label_indices_{{dtype}}(const {{c_type}}[:] labels) -> ndarray:
+    """
+    Indices of the first occurrences of the unique labels
+    *excluding* -1. equivalent to:
+        np.unique(labels, return_index=True)[1]
+    """
+    cdef:
+        int ret = 0
+        Py_ssize_t i, n = len(labels)
+        kh_{{ttype}}_t *table = kh_init_{{ttype}}()
+        {{name}}Vector idx = {{name}}Vector()
+        ndarray[{{c_type}}, ndim=1] arr
+        {{name}}VectorData *ud = idx.data
+
+    kh_resize_{{ttype}}(table, min(kh_needed_n_buckets(n), SIZE_HINT_LIMIT))
+
+    with nogil:
+        for i in range(n):
+            kh_put_{{ttype}}(table, labels[i], &ret)
+            if ret != 0:
+                if needs_resize(ud):
+                    with gil:
+                        idx.resize()
+                append_data_{{ttype}}(ud, i)
+
+    kh_destroy_{{ttype}}(table)
+
+    arr = idx.to_array()
+    arr = arr[np.asarray(labels)[arr].argsort()]
+
+    return arr[1:] if arr.size != 0 and labels[arr[0]] == -1 else arr
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/index.pyi

@@ -0,0 +1,65 @@
+import numpy as np
+
+from pandas._typing import npt
+
+from pandas import MultiIndex
+
+class IndexEngine:
+    over_size_threshold: bool
+    def __init__(self, values: np.ndarray): ...
+    def __contains__(self, val: object) -> bool: ...
+    # -> int | slice | np.ndarray[bool]
+    def get_loc(self, val: object) -> int | slice | np.ndarray: ...
+    def sizeof(self, deep: bool = ...) -> int: ...
+    def __sizeof__(self) -> int: ...
+    @property
+    def is_unique(self) -> bool: ...
+    @property
+    def is_monotonic_increasing(self) -> bool: ...
+    @property
+    def is_monotonic_decreasing(self) -> bool: ...
+    @property
+    def is_mapping_populated(self) -> bool: ...
+    def clear_mapping(self): ...
+    def get_indexer(self, values: np.ndarray) -> npt.NDArray[np.intp]: ...
+    def get_indexer_non_unique(
+        self,
+        targets: np.ndarray,
+    ) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+
+class Float64Engine(IndexEngine): ...
+class Float32Engine(IndexEngine): ...
+class Int64Engine(IndexEngine): ...
+class Int32Engine(IndexEngine): ...
+class Int16Engine(IndexEngine): ...
+class Int8Engine(IndexEngine): ...
+class UInt64Engine(IndexEngine): ...
+class UInt32Engine(IndexEngine): ...
+class UInt16Engine(IndexEngine): ...
+class UInt8Engine(IndexEngine): ...
+class ObjectEngine(IndexEngine): ...
+class DatetimeEngine(Int64Engine): ...
+class TimedeltaEngine(DatetimeEngine): ...
+class PeriodEngine(Int64Engine): ...
+
+class BaseMultiIndexCodesEngine:
+    levels: list[np.ndarray]
+    offsets: np.ndarray  # ndarray[uint64_t, ndim=1]
+    def __init__(
+        self,
+        levels: list[np.ndarray],  # all entries hashable
+        labels: list[np.ndarray],  # all entries integer-dtyped
+        offsets: np.ndarray,  # np.ndarray[np.uint64, ndim=1]
+    ): ...
+    def get_indexer(
+        self,
+        target: npt.NDArray[np.object_],
+    ) -> npt.NDArray[np.intp]: ...
+    def _extract_level_codes(self, target: MultiIndex) -> np.ndarray: ...
+    def get_indexer_with_fill(
+        self,
+        target: np.ndarray,  # np.ndarray[object] of tuples
+        values: np.ndarray,  # np.ndarray[object] of tuples
+        method: str,
+        limit: int | None,
+    ) -> npt.NDArray[np.intp]: ...

.venv/Lib/site-packages/pandas/_libs/index.pyx

@@ -0,0 +1,799 @@
+cimport cython
+
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    float32_t,
+    float64_t,
+    int8_t,
+    int16_t,
+    int32_t,
+    int64_t,
+    intp_t,
+    ndarray,
+    uint8_t,
+    uint16_t,
+    uint32_t,
+    uint64_t,
+)
+
+cnp.import_array()
+
+
+from pandas._libs cimport util
+from pandas._libs.hashtable cimport HashTable
+from pandas._libs.tslibs.nattype cimport c_NaT as NaT
+from pandas._libs.tslibs.period cimport is_period_object
+from pandas._libs.tslibs.timedeltas cimport _Timedelta
+from pandas._libs.tslibs.timestamps cimport _Timestamp
+
+from pandas._libs import (
+    algos,
+    hashtable as _hash,
+)
+
+from pandas._libs.lib cimport eq_NA_compat
+from pandas._libs.missing cimport (
+    C_NA as NA,
+    checknull,
+    is_matching_na,
+)
+
+
+cdef inline bint is_definitely_invalid_key(object val):
+    try:
+        hash(val)
+    except TypeError:
+        return True
+    return False
+
+
+cdef ndarray _get_bool_indexer(ndarray values, object val):
+    """
+    Return a ndarray[bool] of locations where val matches self.values.
+
+    If val is not NA, this is equivalent to `self.values == val`
+    """
+    # Caller is responsible for ensuring _check_type has already been called
+    cdef:
+        ndarray[uint8_t, ndim=1, cast=True] indexer
+        Py_ssize_t i
+        object item
+
+    if values.descr.type_num == cnp.NPY_OBJECT:
+        # i.e. values.dtype == object
+        if not checknull(val):
+            indexer = eq_NA_compat(values, val)
+
+        else:
+            # We need to check for _matching_ NA values
+            indexer = np.empty(len(values), dtype=np.uint8)
+
+            for i in range(len(values)):
+                item = values[i]
+                indexer[i] = is_matching_na(item, val)
+
+    else:
+        if util.is_nan(val):
+            indexer = np.isnan(values)
+        else:
+            indexer = values == val
+
+    return indexer.view(bool)
+
+
+# Don't populate hash tables in monotonic indexes larger than this
+_SIZE_CUTOFF = 1_000_000
+
+
+cdef _unpack_bool_indexer(ndarray[uint8_t, ndim=1, cast=True] indexer, object val):
+    """
+    Possibly unpack a boolean mask to a single indexer.
+    """
+    # Returns ndarray[bool] or int
+    cdef:
+        ndarray[intp_t, ndim=1] found
+        int count
+
+    found = np.where(indexer)[0]
+    count = len(found)
+
+    if count > 1:
+        return indexer
+    if count == 1:
+        return int(found[0])
+
+    raise KeyError(val)
+
+
+@cython.freelist(32)
+cdef class IndexEngine:
+
+    cdef readonly:
+        ndarray values
+        HashTable mapping
+        bint over_size_threshold
+
+    cdef:
+        bint unique, monotonic_inc, monotonic_dec
+        bint need_monotonic_check, need_unique_check
+        object _np_type
+
+    def __init__(self, ndarray values):
+        self.values = values
+
+        self.over_size_threshold = len(values) >= _SIZE_CUTOFF
+        self.clear_mapping()
+        self._np_type = values.dtype.type
+
+    def __contains__(self, val: object) -> bool:
+        # We assume before we get here:
+        #  - val is hashable
+        self._ensure_mapping_populated()
+        return val in self.mapping
+
+    cpdef get_loc(self, object val):
+        # -> Py_ssize_t | slice | ndarray[bool]
+        cdef:
+            Py_ssize_t loc
+
+        if is_definitely_invalid_key(val):
+            raise TypeError(f"'{val}' is an invalid key")
+
+        self._check_type(val)
+
+        if self.over_size_threshold and self.is_monotonic_increasing:
+            if not self.is_unique:
+                return self._get_loc_duplicates(val)
+            values = self.values
+
+            loc = self._searchsorted_left(val)
+            if loc >= len(values):
+                raise KeyError(val)
+            if values[loc] != val:
+                raise KeyError(val)
+            return loc
+
+        self._ensure_mapping_populated()
+        if not self.unique:
+            return self._get_loc_duplicates(val)
+
+        try:
+            return self.mapping.get_item(val)
+        except OverflowError as err:
+            # GH#41775 OverflowError e.g. if we are uint64 and val is -1
+            #  or if we are int64 and value is np.iinfo(np.int64).max+1
+            #  (the uint64 with -1 case should actually be excluded by _check_type)
+            raise KeyError(val) from err
+
+    cdef Py_ssize_t _searchsorted_left(self, val) except? -1:
+        """
+        See ObjectEngine._searchsorted_left.__doc__.
+        """
+        # Caller is responsible for ensuring _check_type has already been called
+        loc = self.values.searchsorted(self._np_type(val), side="left")
+        return loc
+
+    cdef inline _get_loc_duplicates(self, object val):
+        # -> Py_ssize_t | slice | ndarray[bool]
+        cdef:
+            Py_ssize_t diff, left, right
+
+        if self.is_monotonic_increasing:
+            values = self.values
+            try:
+                left = values.searchsorted(val, side='left')
+                right = values.searchsorted(val, side='right')
+            except TypeError:
+                # e.g. GH#29189 get_loc(None) with a Float64Index
+                #  2021-09-29 Now only reached for object-dtype
+                raise KeyError(val)
+
+            diff = right - left
+            if diff == 0:
+                raise KeyError(val)
+            elif diff == 1:
+                return left
+            else:
+                return slice(left, right)
+
+        return self._maybe_get_bool_indexer(val)
+
+    cdef _maybe_get_bool_indexer(self, object val):
+        # Returns ndarray[bool] or int
+        cdef:
+            ndarray[uint8_t, ndim=1, cast=True] indexer
+
+        indexer = _get_bool_indexer(self.values, val)
+        return _unpack_bool_indexer(indexer, val)
+
+    def sizeof(self, deep: bool = False) -> int:
+        """ return the sizeof our mapping """
+        if not self.is_mapping_populated:
+            return 0
+        return self.mapping.sizeof(deep=deep)
+
+    def __sizeof__(self) -> int:
+        return self.sizeof()
+
+    @property
+    def is_unique(self) -> bool:
+        if self.need_unique_check:
+            self._do_unique_check()
+
+        return self.unique == 1
+
+    cdef inline _do_unique_check(self):
+
+        # this de-facto the same
+        self._ensure_mapping_populated()
+
+    @property
+    def is_monotonic_increasing(self) -> bool:
+        if self.need_monotonic_check:
+            self._do_monotonic_check()
+
+        return self.monotonic_inc == 1
+
+    @property
+    def is_monotonic_decreasing(self) -> bool:
+        if self.need_monotonic_check:
+            self._do_monotonic_check()
+
+        return self.monotonic_dec == 1
+
+    cdef inline _do_monotonic_check(self):
+        cdef:
+            bint is_unique
+        try:
+            values = self.values
+            self.monotonic_inc, self.monotonic_dec, is_unique = \
+                self._call_monotonic(values)
+        except TypeError:
+            self.monotonic_inc = 0
+            self.monotonic_dec = 0
+            is_unique = 0
+
+        self.need_monotonic_check = 0
+
+        # we can only be sure of uniqueness if is_unique=1
+        if is_unique:
+            self.unique = 1
+            self.need_unique_check = 0
+
+    cdef _call_monotonic(self, values):
+        return algos.is_monotonic(values, timelike=False)
+
+    cdef _make_hash_table(self, Py_ssize_t n):
+        raise NotImplementedError  # pragma: no cover
+
+    cdef _check_type(self, object val):
+        hash(val)
+
+    @property
+    def is_mapping_populated(self) -> bool:
+        return self.mapping is not None
+
+    cdef inline _ensure_mapping_populated(self):
+        # this populates the mapping
+        # if its not already populated
+        # also satisfies the need_unique_check
+
+        if not self.is_mapping_populated:
+
+            values = self.values
+            self.mapping = self._make_hash_table(len(values))
+            self.mapping.map_locations(values)
+
+            if len(self.mapping) == len(values):
+                self.unique = 1
+
+        self.need_unique_check = 0
+
+    def clear_mapping(self):
+        self.mapping = None
+        self.need_monotonic_check = 1
+        self.need_unique_check = 1
+
+        self.unique = 0
+        self.monotonic_inc = 0
+        self.monotonic_dec = 0
+
+    def get_indexer(self, ndarray values) -> np.ndarray:
+        self._ensure_mapping_populated()
+        return self.mapping.lookup(values)
+
+    def get_indexer_non_unique(self, ndarray targets):
+        """
+        Return an indexer suitable for taking from a non unique index
+        return the labels in the same order as the target
+        and a missing indexer into the targets (which correspond
+        to the -1 indices in the results
+
+        Returns
+        -------
+        indexer : np.ndarray[np.intp]
+        missing : np.ndarray[np.intp]
+        """
+        cdef:
+            ndarray values
+            ndarray[intp_t] result, missing
+            set stargets, remaining_stargets, found_nas
+            dict d = {}
+            object val
+            Py_ssize_t count = 0, count_missing = 0
+            Py_ssize_t i, j, n, n_t, n_alloc, start, end
+            bint check_na_values = False
+
+        values = self.values
+        stargets = set(targets)
+
+        n = len(values)
+        n_t = len(targets)
+        if n > 10_000:
+            n_alloc = 10_000
+        else:
+            n_alloc = n
+
+        result = np.empty(n_alloc, dtype=np.intp)
+        missing = np.empty(n_t, dtype=np.intp)
+
+        # map each starget to its position in the index
+        if (
+                stargets and
+                len(stargets) < 5 and
+                not any([checknull(t) for t in stargets]) and
+                self.is_monotonic_increasing
+        ):
+            # if there are few enough stargets and the index is monotonically
+            # increasing, then use binary search for each starget
+            remaining_stargets = set()
+            for starget in stargets:
+                try:
+                    start = values.searchsorted(starget, side='left')
+                    end = values.searchsorted(starget, side='right')
+                except TypeError:  # e.g. if we tried to search for string in int array
+                    remaining_stargets.add(starget)
+                else:
+                    if start != end:
+                        d[starget] = list(range(start, end))
+
+            stargets = remaining_stargets
+
+        if stargets:
+            # otherwise, map by iterating through all items in the index
+
+            # short-circuit na check
+            if values.dtype == object:
+                check_na_values = True
+                # keep track of nas in values
+                found_nas = set()
+
+            for i in range(n):
+                val = values[i]
+
+                # GH#43870
+                # handle lookup for nas
+                # (ie. np.nan, float("NaN"), Decimal("NaN"), dt64nat, td64nat)
+                if check_na_values and checknull(val):
+                    match = [na for na in found_nas if is_matching_na(val, na)]
+
+                    # matching na not found
+                    if not len(match):
+                        found_nas.add(val)
+
+                        # add na to stargets to utilize `in` for stargets/d lookup
+                        match_stargets = [
+                            x for x in stargets if is_matching_na(val, x)
+                        ]
+
+                        if len(match_stargets):
+                            # add our 'standardized' na
+                            stargets.add(val)
+
+                    # matching na found
+                    else:
+                        assert len(match) == 1
+                        val = match[0]
+
+                if val in stargets:
+                    if val not in d:
+                        d[val] = []
+                    d[val].append(i)
+
+        for i in range(n_t):
+            val = targets[i]
+
+            # ensure there are nas in values before looking for a matching na
+            if check_na_values and checknull(val):
+                match = [na for na in found_nas if is_matching_na(val, na)]
+                if len(match):
+                    assert len(match) == 1
+                    val = match[0]
+
+            # found
+            if val in d:
+                key = val
+
+                for j in d[key]:
+
+                    # realloc if needed
+                    if count >= n_alloc:
+                        n_alloc += 10_000
+                        result = np.resize(result, n_alloc)
+
+                    result[count] = j
+                    count += 1
+
+            # value not found
+            else:
+
+                if count >= n_alloc:
+                    n_alloc += 10_000
+                    result = np.resize(result, n_alloc)
+                result[count] = -1
+                count += 1
+                missing[count_missing] = i
+                count_missing += 1
+
+        return result[0:count], missing[0:count_missing]
+
+
+cdef Py_ssize_t _bin_search(ndarray values, object val) except -1:
+    # GH#1757 ndarray.searchsorted is not safe to use with array of tuples
+    #  (treats a tuple `val` as a sequence of keys instead of a single key),
+    #  so we implement something similar.
+    # This is equivalent to the stdlib's bisect.bisect_left
+
+    cdef:
+        Py_ssize_t mid = 0, lo = 0, hi = len(values) - 1
+        object pval
+
+    if hi == 0 or (hi > 0 and val > values[hi]):
+        return len(values)
+
+    while lo < hi:
+        mid = (lo + hi) // 2
+        pval = values[mid]
+        if val < pval:
+            hi = mid
+        elif val > pval:
+            lo = mid + 1
+        else:
+            while mid > 0 and val == values[mid - 1]:
+                mid -= 1
+            return mid
+
+    if val <= values[mid]:
+        return mid
+    else:
+        return mid + 1
+
+
+cdef class ObjectEngine(IndexEngine):
+    """
+    Index Engine for use with object-dtype Index, namely the base class Index.
+    """
+    cdef _make_hash_table(self, Py_ssize_t n):
+        return _hash.PyObjectHashTable(n)
+
+    cdef Py_ssize_t _searchsorted_left(self, val) except? -1:
+        # using values.searchsorted here would treat a tuple `val` as a sequence
+        #  instead of a single key, so we use a different implementation
+        try:
+            loc = _bin_search(self.values, val)
+        except TypeError as err:
+            raise KeyError(val) from err
+        return loc
+
+
+cdef class DatetimeEngine(Int64Engine):
+
+    cdef int64_t _unbox_scalar(self, scalar) except? -1:
+        # NB: caller is responsible for ensuring tzawareness compat
+        #  before we get here
+        if not (isinstance(scalar, _Timestamp) or scalar is NaT):
+            raise TypeError(scalar)
+        return scalar.value
+
+    def __contains__(self, val: object) -> bool:
+        # We assume before we get here:
+        #  - val is hashable
+        self._unbox_scalar(val)
+        try:
+            self.get_loc(val)
+            return True
+        except KeyError:
+            return False
+
+    cdef _call_monotonic(self, values):
+        return algos.is_monotonic(values, timelike=True)
+
+    cpdef get_loc(self, object val):
+        # NB: the caller is responsible for ensuring that we are called
+        #  with either a Timestamp or NaT (Timedelta or NaT for TimedeltaEngine)
+
+        cdef:
+            Py_ssize_t loc
+
+        if is_definitely_invalid_key(val):
+            raise TypeError(f"'{val}' is an invalid key")
+
+        try:
+            conv = self._unbox_scalar(val)
+        except TypeError:
+            raise KeyError(val)
+
+        # Welcome to the spaghetti factory
+        if self.over_size_threshold and self.is_monotonic_increasing:
+            if not self.is_unique:
+                return self._get_loc_duplicates(conv)
+            values = self.values
+
+            loc = values.searchsorted(conv, side='left')
+
+            if loc == len(values) or values[loc] != conv:
+                raise KeyError(val)
+            return loc
+
+        self._ensure_mapping_populated()
+        if not self.unique:
+            return self._get_loc_duplicates(conv)
+
+        try:
+            return self.mapping.get_item(conv)
+        except KeyError:
+            raise KeyError(val)
+
+
+cdef class TimedeltaEngine(DatetimeEngine):
+
+    cdef int64_t _unbox_scalar(self, scalar) except? -1:
+        if not (isinstance(scalar, _Timedelta) or scalar is NaT):
+            raise TypeError(scalar)
+        return scalar.value
+
+
+cdef class PeriodEngine(Int64Engine):
+
+    cdef int64_t _unbox_scalar(self, scalar) except? -1:
+        if scalar is NaT:
+            return scalar.value
+        if is_period_object(scalar):
+            # NB: we assume that we have the correct freq here.
+            return scalar.ordinal
+        raise TypeError(scalar)
+
+    cpdef get_loc(self, object val):
+        # NB: the caller is responsible for ensuring that we are called
+        #  with either a Period or NaT
+        cdef:
+            int64_t conv
+
+        try:
+            conv = self._unbox_scalar(val)
+        except TypeError:
+            raise KeyError(val)
+
+        return Int64Engine.get_loc(self, conv)
+
+    cdef _call_monotonic(self, values):
+        return algos.is_monotonic(values, timelike=True)
+
+
+cdef class BaseMultiIndexCodesEngine:
+    """
+    Base class for MultiIndexUIntEngine and MultiIndexPyIntEngine, which
+    represent each label in a MultiIndex as an integer, by juxtaposing the bits
+    encoding each level, with appropriate offsets.
+
+    For instance: if 3 levels have respectively 3, 6 and 1 possible values,
+    then their labels can be represented using respectively 2, 3 and 1 bits,
+    as follows:
+     _ _ _ _____ _ __ __ __
+    |0|0|0| ... |0| 0|a1|a0| -> offset 0 (first level)
+     — — — ————— — —— —— ——
+    |0|0|0| ... |0|b2|b1|b0| -> offset 2 (bits required for first level)
+     — — — ————— — —— —— ——
+    |0|0|0| ... |0| 0| 0|c0| -> offset 5 (bits required for first two levels)
+     ‾ ‾ ‾ ‾‾‾‾‾ ‾ ‾‾ ‾‾ ‾‾
+    and the resulting unsigned integer representation will be:
+     _ _ _ _____ _ __ __ __ __ __ __
+    |0|0|0| ... |0|c0|b2|b1|b0|a1|a0|
+     ‾ ‾ ‾ ‾‾‾‾‾ ‾ ‾‾ ‾‾ ‾‾ ‾‾ ‾‾ ‾‾
+
+    Offsets are calculated at initialization, labels are transformed by method
+    _codes_to_ints.
+
+    Keys are located by first locating each component against the respective
+    level, then locating (the integer representation of) codes.
+    """
+    def __init__(self, object levels, object labels,
+                 ndarray[uint64_t, ndim=1] offsets):
+        """
+        Parameters
+        ----------
+        levels : list-like of numpy arrays
+            Levels of the MultiIndex.
+        labels : list-like of numpy arrays of integer dtype
+            Labels of the MultiIndex.
+        offsets : numpy array of uint64 dtype
+            Pre-calculated offsets, one for each level of the index.
+        """
+        self.levels = levels
+        self.offsets = offsets
+
+        # Transform labels in a single array, and add 1 so that we are working
+        # with positive integers (-1 for NaN becomes 0):
+        codes = (np.array(labels, dtype='int64').T + 1).astype('uint64',
+                                                               copy=False)
+
+        # Map each codes combination in the index to an integer unambiguously
+        # (no collisions possible), based on the "offsets", which describe the
+        # number of bits to switch labels for each level:
+        lab_ints = self._codes_to_ints(codes)
+
+        # Initialize underlying index (e.g. libindex.UInt64Engine) with
+        # integers representing labels: we will use its get_loc and get_indexer
+        self._base.__init__(self, lab_ints)
+
+    def _codes_to_ints(self, ndarray[uint64_t] codes) -> np.ndarray:
+        raise NotImplementedError("Implemented by subclass")  # pragma: no cover
+
+    def _extract_level_codes(self, target) -> np.ndarray:
+        """
+        Map the requested list of (tuple) keys to their integer representations
+        for searching in the underlying integer index.
+
+        Parameters
+        ----------
+        target : MultiIndex
+
+        Returns
+        ------
+        int_keys : 1-dimensional array of dtype uint64 or object
+            Integers representing one combination each
+        """
+        zt = [target._get_level_values(i) for i in range(target.nlevels)]
+        level_codes = [lev.get_indexer_for(codes) + 1 for lev, codes
+                       in zip(self.levels, zt)]
+        return self._codes_to_ints(np.array(level_codes, dtype='uint64').T)
+
+    def get_indexer(self, target: np.ndarray) -> np.ndarray:
+        """
+        Returns an array giving the positions of each value of `target` in
+        `self.values`, where -1 represents a value in `target` which does not
+        appear in `self.values`
+
+        Parameters
+        ----------
+        target : np.ndarray
+
+        Returns
+        -------
+        np.ndarray[intp_t, ndim=1] of the indexer of `target` into
+        `self.values`
+        """
+        return self._base.get_indexer(self, target)
+
+    def get_indexer_with_fill(self, ndarray target, ndarray values,
+                              str method, object limit) -> np.ndarray:
+        """
+        Returns an array giving the positions of each value of `target` in
+        `values`, where -1 represents a value in `target` which does not
+        appear in `values`
+
+        If `method` is "backfill" then the position for a value in `target`
+        which does not appear in `values` is that of the next greater value
+        in `values` (if one exists), and -1 if there is no such value.
+
+        Similarly, if the method is "pad" then the position for a value in
+        `target` which does not appear in `values` is that of the next smaller
+        value in `values` (if one exists), and -1 if there is no such value.
+
+        Parameters
+        ----------
+        target: ndarray[object] of tuples
+            need not be sorted, but all must have the same length, which must be
+            the same as the length of all tuples in `values`
+        values : ndarray[object] of tuples
+            must be sorted and all have the same length.  Should be the set of
+            the MultiIndex's values.
+        method: string
+            "backfill" or "pad"
+        limit: int or None
+            if provided, limit the number of fills to this value
+
+        Returns
+        -------
+        np.ndarray[intp_t, ndim=1] of the indexer of `target` into `values`,
+        filled with the `method` (and optionally `limit`) specified
+        """
+        assert method in ("backfill", "pad")
+        cdef:
+            int64_t i, j, next_code
+            int64_t num_values, num_target_values
+            ndarray[int64_t, ndim=1] target_order
+            ndarray[object, ndim=1] target_values
+            ndarray[int64_t, ndim=1] new_codes, new_target_codes
+            ndarray[intp_t, ndim=1] sorted_indexer
+
+        target_order = np.argsort(target).astype('int64')
+        target_values = target[target_order]
+        num_values, num_target_values = len(values), len(target_values)
+        new_codes, new_target_codes = (
+            np.empty((num_values,)).astype('int64'),
+            np.empty((num_target_values,)).astype('int64'),
+        )
+
+        # `values` and `target_values` are both sorted, so we walk through them
+        # and memoize the (ordered) set of indices in the (implicit) merged-and
+        # sorted list of the two which belong to each of them
+        # the effect of this is to create a factorization for the (sorted)
+        # merger of the index values, where `new_codes` and `new_target_codes`
+        # are the subset of the factors which appear in `values` and `target`,
+        # respectively
+        i, j, next_code = 0, 0, 0
+        while i < num_values and j < num_target_values:
+            val, target_val = values[i], target_values[j]
+            if val <= target_val:
+                new_codes[i] = next_code
+                i += 1
+            if target_val <= val:
+                new_target_codes[j] = next_code
+                j += 1
+            next_code += 1
+
+        # at this point, at least one should have reached the end
+        # the remaining values of the other should be added to the end
+        assert i == num_values or j == num_target_values
+        while i < num_values:
+            new_codes[i] = next_code
+            i += 1
+            next_code += 1
+        while j < num_target_values:
+            new_target_codes[j] = next_code
+            j += 1
+            next_code += 1
+
+        # get the indexer, and undo the sorting of `target.values`
+        algo = algos.backfill if method == "backfill" else algos.pad
+        sorted_indexer = algo(new_codes, new_target_codes, limit=limit)
+        return sorted_indexer[np.argsort(target_order)]
+
+    def get_loc(self, object key):
+        if is_definitely_invalid_key(key):
+            raise TypeError(f"'{key}' is an invalid key")
+        if not isinstance(key, tuple):
+            raise KeyError(key)
+        try:
+            indices = [0 if checknull(v) else lev.get_loc(v) + 1
+                       for lev, v in zip(self.levels, key)]
+        except KeyError:
+            raise KeyError(key)
+
+        # Transform indices into single integer:
+        lab_int = self._codes_to_ints(np.array(indices, dtype='uint64'))
+
+        return self._base.get_loc(self, lab_int)
+
+    def get_indexer_non_unique(self, target: np.ndarray) -> np.ndarray:
+        indexer = self._base.get_indexer_non_unique(self, target)
+
+        return indexer
+
+    def __contains__(self, val: object) -> bool:
+        # We assume before we get here:
+        #  - val is hashable
+        # Default __contains__ looks in the underlying mapping, which in this
+        # case only contains integer representations.
+        try:
+            self.get_loc(val)
+            return True
+        except (KeyError, TypeError, ValueError):
+            return False
+
+
+# Generated from template.
+include "index_class_helper.pxi"

.venv/Lib/site-packages/pandas/_libs/index_class_helper.pxi.in

@@ -0,0 +1,51 @@
+"""
+Template for functions of IndexEngine subclasses.
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+# ----------------------------------------------------------------------
+# IndexEngine Subclass Methods
+# ----------------------------------------------------------------------
+
+{{py:
+
+# name, dtype
+dtypes = [('Float64', 'float64'),
+          ('Float32', 'float32'),
+          ('Int64', 'int64'),
+          ('Int32', 'int32'),
+          ('Int16', 'int16'),
+          ('Int8', 'int8'),
+          ('UInt64', 'uint64'),
+          ('UInt32', 'uint32'),
+          ('UInt16', 'uint16'),
+          ('UInt8', 'uint8'),
+          ]
+}}
+
+{{for name, dtype in dtypes}}
+
+
+cdef class {{name}}Engine(IndexEngine):
+
+    cdef _make_hash_table(self, Py_ssize_t n):
+        return _hash.{{name}}HashTable(n)
+
+    cdef _check_type(self, object val):
+    {{if name not in {'Float64', 'Float32'} }}
+        if not util.is_integer_object(val):
+            raise KeyError(val)
+        {{if name.startswith("U")}}
+        if val < 0:
+            # cannot have negative values with unsigned int dtype
+            raise KeyError(val)
+        {{endif}}
+    {{else}}
+        if not util.is_integer_object(val) and not util.is_float_object(val):
+            # in particular catch bool and avoid casting True -> 1.0
+            raise KeyError(val)
+    {{endif}}
+
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/indexing.pyx

@@ -0,0 +1,25 @@
+cdef class NDFrameIndexerBase:
+    """
+    A base class for _NDFrameIndexer for fast instantiation and attribute access.
+    """
+    cdef public:
+        str name
+        object obj, _ndim
+
+    def __init__(self, name: str, obj):
+        self.obj = obj
+        self.name = name
+        self._ndim = None
+
+    @property
+    def ndim(self) -> int:
+        # Delay `ndim` instantiation until required as reading it
+        # from `obj` isn't entirely cheap.
+        ndim = self._ndim
+        if ndim is None:
+            ndim = self._ndim = self.obj.ndim
+            if ndim > 2:
+                raise ValueError(  # pragma: no cover
+                    "NDFrameIndexer does not support NDFrame objects with ndim > 2"
+                )
+        return ndim

.venv/Lib/site-packages/pandas/_libs/internals.pyi

@@ -0,0 +1,85 @@
+from typing import (
+    Iterator,
+    Sequence,
+    final,
+    overload,
+)
+
+import numpy as np
+
+from pandas._typing import (
+    ArrayLike,
+    T,
+    npt,
+)
+
+from pandas import Index
+from pandas.core.arrays._mixins import NDArrayBackedExtensionArray
+from pandas.core.internals.blocks import Block as B
+
+def slice_len(slc: slice, objlen: int = ...) -> int: ...
+def get_blkno_indexers(
+    blknos: np.ndarray,  # int64_t[:]
+    group: bool = ...,
+) -> list[tuple[int, slice | np.ndarray]]: ...
+def get_blkno_placements(
+    blknos: np.ndarray,
+    group: bool = ...,
+) -> Iterator[tuple[int, BlockPlacement]]: ...
+def update_blklocs_and_blknos(
+    blklocs: npt.NDArray[np.intp],
+    blknos: npt.NDArray[np.intp],
+    loc: int,
+    nblocks: int,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+
+class BlockPlacement:
+    def __init__(self, val: int | slice | np.ndarray): ...
+    @property
+    def indexer(self) -> np.ndarray | slice: ...
+    @property
+    def as_array(self) -> np.ndarray: ...
+    @property
+    def as_slice(self) -> slice: ...
+    @property
+    def is_slice_like(self) -> bool: ...
+    @overload
+    def __getitem__(self, loc: slice | Sequence[int]) -> BlockPlacement: ...
+    @overload
+    def __getitem__(self, loc: int) -> int: ...
+    def __iter__(self) -> Iterator[int]: ...
+    def __len__(self) -> int: ...
+    def delete(self, loc) -> BlockPlacement: ...
+    def append(self, others: list[BlockPlacement]) -> BlockPlacement: ...
+    def tile_for_unstack(self, factor: int) -> npt.NDArray[np.intp]: ...
+
+class SharedBlock:
+    _mgr_locs: BlockPlacement
+    ndim: int
+    values: ArrayLike
+    def __init__(self, values: ArrayLike, placement: BlockPlacement, ndim: int): ...
+
+class NumpyBlock(SharedBlock):
+    values: np.ndarray
+    @final
+    def getitem_block_index(self: T, slicer: slice) -> T: ...
+
+class NDArrayBackedBlock(SharedBlock):
+    values: NDArrayBackedExtensionArray
+    @final
+    def getitem_block_index(self: T, slicer: slice) -> T: ...
+
+class Block(SharedBlock): ...
+
+class BlockManager:
+    blocks: tuple[B, ...]
+    axes: list[Index]
+    _known_consolidated: bool
+    _is_consolidated: bool
+    _blknos: np.ndarray
+    _blklocs: np.ndarray
+    def __init__(
+        self, blocks: tuple[B, ...], axes: list[Index], verify_integrity=...
+    ): ...
+    def get_slice(self: T, slobj: slice, axis: int = ...) -> T: ...
+    def _rebuild_blknos_and_blklocs(self) -> None: ...

.venv/Lib/site-packages/pandas/_libs/internals.pyx

@@ -0,0 +1,824 @@
+from collections import defaultdict
+
+import cython
+from cython import Py_ssize_t
+
+from cpython.slice cimport PySlice_GetIndicesEx
+
+
+cdef extern from "Python.h":
+    Py_ssize_t PY_SSIZE_T_MAX
+
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    NPY_INTP,
+    int64_t,
+    intp_t,
+    ndarray,
+)
+
+cnp.import_array()
+
+from pandas._libs.algos import ensure_int64
+
+from pandas._libs.arrays cimport NDArrayBacked
+from pandas._libs.util cimport (
+    is_array,
+    is_integer_object,
+)
+
+
+@cython.final
+@cython.freelist(32)
+cdef class BlockPlacement:
+    # __slots__ = '_as_slice', '_as_array', '_len'
+    cdef:
+        slice _as_slice
+        ndarray _as_array  # Note: this still allows `None`; will be intp_t
+        bint _has_slice, _has_array, _is_known_slice_like
+
+    def __cinit__(self, val):
+        cdef:
+            slice slc
+
+        self._as_slice = None
+        self._as_array = None
+        self._has_slice = False
+        self._has_array = False
+
+        if is_integer_object(val):
+            slc = slice(val, val + 1, 1)
+            self._as_slice = slc
+            self._has_slice = True
+        elif isinstance(val, slice):
+            slc = slice_canonize(val)
+
+            if slc.start != slc.stop:
+                self._as_slice = slc
+                self._has_slice = True
+            else:
+                arr = np.empty(0, dtype=np.intp)
+                self._as_array = arr
+                self._has_array = True
+        else:
+            # Cython memoryview interface requires ndarray to be writeable.
+            if (
+                not is_array(val)
+                or not cnp.PyArray_ISWRITEABLE(val)
+                or (<ndarray>val).descr.type_num != cnp.NPY_INTP
+            ):
+                arr = np.require(val, dtype=np.intp, requirements='W')
+            else:
+                arr = val
+            # Caller is responsible for ensuring arr.ndim == 1
+            self._as_array = arr
+            self._has_array = True
+
+    def __str__(self) -> str:
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        if s is not None:
+            v = self._as_slice
+        else:
+            v = self._as_array
+
+        return f"{type(self).__name__}({v})"
+
+    def __repr__(self) -> str:
+        return str(self)
+
+    def __len__(self) -> int:
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        if s is not None:
+            return slice_len(s)
+        else:
+            return len(self._as_array)
+
+    def __iter__(self):
+        cdef:
+            slice s = self._ensure_has_slice()
+            Py_ssize_t start, stop, step, _
+
+        if s is not None:
+            start, stop, step, _ = slice_get_indices_ex(s)
+            return iter(range(start, stop, step))
+        else:
+            return iter(self._as_array)
+
+    @property
+    def as_slice(self) -> slice:
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        if s is not None:
+            return s
+        else:
+            raise TypeError("Not slice-like")
+
+    @property
+    def indexer(self):
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        if s is not None:
+            return s
+        else:
+            return self._as_array
+
+    @property
+    def as_array(self) -> np.ndarray:
+        cdef:
+            Py_ssize_t start, stop, end, _
+
+        if not self._has_array:
+            start, stop, step, _ = slice_get_indices_ex(self._as_slice)
+            # NOTE: this is the C-optimized equivalent of
+            #  `np.arange(start, stop, step, dtype=np.intp)`
+            self._as_array = cnp.PyArray_Arange(start, stop, step, NPY_INTP)
+            self._has_array = True
+
+        return self._as_array
+
+    @property
+    def is_slice_like(self) -> bool:
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        return s is not None
+
+    def __getitem__(self, loc):
+        cdef:
+            slice s = self._ensure_has_slice()
+
+        if s is not None:
+            val = slice_getitem(s, loc)
+        else:
+            val = self._as_array[loc]
+
+        if not isinstance(val, slice) and val.ndim == 0:
+            return val
+
+        return BlockPlacement(val)
+
+    def delete(self, loc) -> BlockPlacement:
+        return BlockPlacement(np.delete(self.as_array, loc, axis=0))
+
+    def append(self, others) -> BlockPlacement:
+        if not len(others):
+            return self
+
+        return BlockPlacement(
+            np.concatenate([self.as_array] + [o.as_array for o in others])
+        )
+
+    cdef BlockPlacement iadd(self, other):
+        cdef:
+            slice s = self._ensure_has_slice()
+            Py_ssize_t other_int, start, stop, step
+
+        if is_integer_object(other) and s is not None:
+            other_int = <Py_ssize_t>other
+
+            if other_int == 0:
+                # BlockPlacement is treated as immutable
+                return self
+
+            start, stop, step, _ = slice_get_indices_ex(s)
+            start += other_int
+            stop += other_int
+
+            if (step > 0 and start < 0) or (step < 0 and stop < step):
+                raise ValueError("iadd causes length change")
+
+            if stop < 0:
+                val = slice(start, None, step)
+            else:
+                val = slice(start, stop, step)
+
+            return BlockPlacement(val)
+        else:
+            newarr = self.as_array + other
+            if (newarr < 0).any():
+                raise ValueError("iadd causes length change")
+
+            val = newarr
+            return BlockPlacement(val)
+
+    def add(self, other) -> BlockPlacement:
+        # We can get here with int or ndarray
+        return self.iadd(other)
+
+    cdef slice _ensure_has_slice(self):
+        if not self._has_slice:
+            self._as_slice = indexer_as_slice(self._as_array)
+            self._has_slice = True
+
+        return self._as_slice
+
+    cpdef BlockPlacement increment_above(self, Py_ssize_t loc):
+        """
+        Increment any entries of 'loc' or above by one.
+        """
+        cdef:
+            slice nv, s = self._ensure_has_slice()
+            Py_ssize_t other_int, start, stop, step
+            ndarray[intp_t, ndim=1] newarr
+
+        if s is not None:
+            # see if we are either all-above or all-below, each of which
+            #  have fastpaths available.
+
+            start, stop, step, _ = slice_get_indices_ex(s)
+
+            if start < loc and stop <= loc:
+                # We are entirely below, nothing to increment
+                return self
+
+            if start >= loc and stop >= loc:
+                # We are entirely above, we can efficiently increment out slice
+                nv = slice(start + 1, stop + 1, step)
+                return BlockPlacement(nv)
+
+        if loc == 0:
+            # fastpath where we know everything is >= 0
+            newarr = self.as_array + 1
+            return BlockPlacement(newarr)
+
+        newarr = self.as_array.copy()
+        newarr[newarr >= loc] += 1
+        return BlockPlacement(newarr)
+
+    def tile_for_unstack(self, factor: int) -> np.ndarray:
+        """
+        Find the new mgr_locs for the un-stacked version of a Block.
+        """
+        cdef:
+            slice slc = self._ensure_has_slice()
+            slice new_slice
+            ndarray[intp_t, ndim=1] new_placement
+
+        if slc is not None and slc.step == 1:
+            new_slc = slice(slc.start * factor, slc.stop * factor, 1)
+            # equiv: np.arange(new_slc.start, new_slc.stop, dtype=np.intp)
+            new_placement = cnp.PyArray_Arange(new_slc.start, new_slc.stop, 1, NPY_INTP)
+        else:
+            # Note: test_pivot_table_empty_aggfunc gets here with `slc is not None`
+            mapped = [
+                # equiv: np.arange(x * factor, (x + 1) * factor, dtype=np.intp)
+                cnp.PyArray_Arange(x * factor, (x + 1) * factor, 1, NPY_INTP)
+                for x in self
+            ]
+            new_placement = np.concatenate(mapped)
+        return new_placement
+
+
+cdef slice slice_canonize(slice s):
+    """
+    Convert slice to canonical bounded form.
+    """
+    cdef:
+        Py_ssize_t start = 0, stop = 0, step = 1
+
+    if s.step is None:
+        step = 1
+    else:
+        step = <Py_ssize_t>s.step
+        if step == 0:
+            raise ValueError("slice step cannot be zero")
+
+    if step > 0:
+        if s.stop is None:
+            raise ValueError("unbounded slice")
+
+        stop = <Py_ssize_t>s.stop
+        if s.start is None:
+            start = 0
+        else:
+            start = <Py_ssize_t>s.start
+            if start > stop:
+                start = stop
+    elif step < 0:
+        if s.start is None:
+            raise ValueError("unbounded slice")
+
+        start = <Py_ssize_t>s.start
+        if s.stop is None:
+            stop = -1
+        else:
+            stop = <Py_ssize_t>s.stop
+            if stop > start:
+                stop = start
+
+    if start < 0 or (stop < 0 and s.stop is not None and step > 0):
+        raise ValueError("unbounded slice")
+
+    if stop < 0:
+        return slice(start, None, step)
+    else:
+        return slice(start, stop, step)
+
+
+cpdef Py_ssize_t slice_len(slice slc, Py_ssize_t objlen=PY_SSIZE_T_MAX) except -1:
+    """
+    Get length of a bounded slice.
+
+    The slice must not have any "open" bounds that would create dependency on
+    container size, i.e.:
+    - if ``s.step is None or s.step > 0``, ``s.stop`` is not ``None``
+    - if ``s.step < 0``, ``s.start`` is not ``None``
+
+    Otherwise, the result is unreliable.
+    """
+    cdef:
+        Py_ssize_t start, stop, step, length
+
+    if slc is None:
+        raise TypeError("slc must be slice")  # pragma: no cover
+
+    PySlice_GetIndicesEx(slc, objlen, &start, &stop, &step, &length)
+
+    return length
+
+
+cdef (Py_ssize_t, Py_ssize_t, Py_ssize_t, Py_ssize_t) slice_get_indices_ex(
+    slice slc, Py_ssize_t objlen=PY_SSIZE_T_MAX
+):
+    """
+    Get (start, stop, step, length) tuple for a slice.
+
+    If `objlen` is not specified, slice must be bounded, otherwise the result
+    will be wrong.
+    """
+    cdef:
+        Py_ssize_t start, stop, step, length
+
+    if slc is None:
+        raise TypeError("slc should be a slice")  # pragma: no cover
+
+    PySlice_GetIndicesEx(slc, objlen, &start, &stop, &step, &length)
+
+    return start, stop, step, length
+
+
+cdef slice_getitem(slice slc, ind):
+    cdef:
+        Py_ssize_t s_start, s_stop, s_step, s_len
+        Py_ssize_t ind_start, ind_stop, ind_step, ind_len
+
+    s_start, s_stop, s_step, s_len = slice_get_indices_ex(slc)
+
+    if isinstance(ind, slice):
+        ind_start, ind_stop, ind_step, ind_len = slice_get_indices_ex(ind, s_len)
+
+        if ind_step > 0 and ind_len == s_len:
+            # short-cut for no-op slice
+            if ind_len == s_len:
+                return slc
+
+        if ind_step < 0:
+            s_start = s_stop - s_step
+            ind_step = -ind_step
+
+        s_step *= ind_step
+        s_stop = s_start + ind_stop * s_step
+        s_start = s_start + ind_start * s_step
+
+        if s_step < 0 and s_stop < 0:
+            return slice(s_start, None, s_step)
+        else:
+            return slice(s_start, s_stop, s_step)
+
+    else:
+        # NOTE:
+        # this is the C-optimized equivalent of
+        # `np.arange(s_start, s_stop, s_step, dtype=np.intp)[ind]`
+        return cnp.PyArray_Arange(s_start, s_stop, s_step, NPY_INTP)[ind]
+
+
+@cython.boundscheck(False)
+@cython.wraparound(False)
+cdef slice indexer_as_slice(intp_t[:] vals):
+    cdef:
+        Py_ssize_t i, n, start, stop
+        int64_t d
+
+    if vals is None:
+        raise TypeError("vals must be ndarray")  # pragma: no cover
+
+    n = vals.shape[0]
+
+    if n == 0 or vals[0] < 0:
+        return None
+
+    if n == 1:
+        return slice(vals[0], vals[0] + 1, 1)
+
+    if vals[1] < 0:
+        return None
+
+    # n > 2
+    d = vals[1] - vals[0]
+
+    if d == 0:
+        return None
+
+    for i in range(2, n):
+        if vals[i] < 0 or vals[i] - vals[i - 1] != d:
+            return None
+
+    start = vals[0]
+    stop = start + n * d
+    if stop < 0 and d < 0:
+        return slice(start, None, d)
+    else:
+        return slice(start, stop, d)
+
+
+@cython.boundscheck(False)
+@cython.wraparound(False)
+def get_blkno_indexers(
+    int64_t[:] blknos, bint group=True
+) -> list[tuple[int, slice | np.ndarray]]:
+    """
+    Enumerate contiguous runs of integers in ndarray.
+
+    Iterate over elements of `blknos` yielding ``(blkno, slice(start, stop))``
+    pairs for each contiguous run found.
+
+    If `group` is True and there is more than one run for a certain blkno,
+    ``(blkno, array)`` with an array containing positions of all elements equal
+    to blkno.
+
+    Returns
+    -------
+    list[tuple[int, slice | np.ndarray]]
+    """
+    # There's blkno in this function's name because it's used in block &
+    # blockno handling.
+    cdef:
+        int64_t cur_blkno
+        Py_ssize_t i, start, stop, n, diff
+        cnp.npy_intp tot_len
+        int64_t blkno
+        object group_dict = defaultdict(list)
+        ndarray[int64_t, ndim=1] arr
+
+    n = blknos.shape[0]
+    result = list()
+    start = 0
+    cur_blkno = blknos[start]
+
+    if n == 0:
+        pass
+    elif group is False:
+        for i in range(1, n):
+            if blknos[i] != cur_blkno:
+                result.append((cur_blkno, slice(start, i)))
+
+                start = i
+                cur_blkno = blknos[i]
+
+        result.append((cur_blkno, slice(start, n)))
+    else:
+        for i in range(1, n):
+            if blknos[i] != cur_blkno:
+                group_dict[cur_blkno].append((start, i))
+
+                start = i
+                cur_blkno = blknos[i]
+
+        group_dict[cur_blkno].append((start, n))
+
+        for blkno, slices in group_dict.items():
+            if len(slices) == 1:
+                result.append((blkno, slice(slices[0][0], slices[0][1])))
+            else:
+                tot_len = sum(stop - start for start, stop in slices)
+                # equiv np.empty(tot_len, dtype=np.int64)
+                arr = cnp.PyArray_EMPTY(1, &tot_len, cnp.NPY_INT64, 0)
+
+                i = 0
+                for start, stop in slices:
+                    for diff in range(start, stop):
+                        arr[i] = diff
+                        i += 1
+
+                result.append((blkno, arr))
+
+    return result
+
+
+def get_blkno_placements(blknos, group: bool = True):
+    """
+    Parameters
+    ----------
+    blknos : np.ndarray[int64]
+    group : bool, default True
+
+    Returns
+    -------
+    iterator
+        yield (blkno, BlockPlacement)
+    """
+    blknos = ensure_int64(blknos)
+
+    for blkno, indexer in get_blkno_indexers(blknos, group):
+        yield blkno, BlockPlacement(indexer)
+
+
+@cython.boundscheck(False)
+@cython.wraparound(False)
+cpdef update_blklocs_and_blknos(
+    ndarray[intp_t, ndim=1] blklocs,
+    ndarray[intp_t, ndim=1] blknos,
+    Py_ssize_t loc,
+    intp_t nblocks,
+):
+    """
+    Update blklocs and blknos when a new column is inserted at 'loc'.
+    """
+    cdef:
+        Py_ssize_t i
+        cnp.npy_intp length = len(blklocs) + 1
+        ndarray[intp_t, ndim=1] new_blklocs, new_blknos
+
+    # equiv: new_blklocs = np.empty(length, dtype=np.intp)
+    new_blklocs = cnp.PyArray_EMPTY(1, &length, cnp.NPY_INTP, 0)
+    new_blknos = cnp.PyArray_EMPTY(1, &length, cnp.NPY_INTP, 0)
+
+    for i in range(loc):
+        new_blklocs[i] = blklocs[i]
+        new_blknos[i] = blknos[i]
+
+    new_blklocs[loc] = 0
+    new_blknos[loc] = nblocks
+
+    for i in range(loc, length - 1):
+        new_blklocs[i + 1] = blklocs[i]
+        new_blknos[i + 1] = blknos[i]
+
+    return new_blklocs, new_blknos
+
+
+def _unpickle_block(values, placement, ndim):
+    # We have to do some gymnastics b/c "ndim" is keyword-only
+
+    from pandas.core.internals.blocks import new_block
+
+    return new_block(values, placement, ndim=ndim)
+
+
+@cython.freelist(64)
+cdef class SharedBlock:
+    """
+    Defining __init__ in a cython class significantly improves performance.
+    """
+    cdef:
+        public BlockPlacement _mgr_locs
+        readonly int ndim
+
+    def __cinit__(self, values, placement: BlockPlacement, ndim: int):
+        """
+        Parameters
+        ----------
+        values : np.ndarray or ExtensionArray
+            We assume maybe_coerce_values has already been called.
+        placement : BlockPlacement
+        ndim : int
+            1 for SingleBlockManager/Series, 2 for BlockManager/DataFrame
+        """
+        self._mgr_locs = placement
+        self.ndim = ndim
+
+    cpdef __reduce__(self):
+        args = (self.values, self.mgr_locs.indexer, self.ndim)
+        return _unpickle_block, args
+
+    cpdef __setstate__(self, state):
+        from pandas.core.construction import extract_array
+
+        self.mgr_locs = BlockPlacement(state[0])
+        self.values = extract_array(state[1], extract_numpy=True)
+        if len(state) > 2:
+            # we stored ndim
+            self.ndim = state[2]
+        else:
+            # older pickle
+            from pandas.core.internals.api import maybe_infer_ndim
+
+            ndim = maybe_infer_ndim(self.values, self.mgr_locs)
+            self.ndim = ndim
+
+
+cdef class NumpyBlock(SharedBlock):
+    cdef:
+        public ndarray values
+
+    def __cinit__(self, ndarray values, BlockPlacement placement, int ndim):
+        # set values here the (implicit) call to SharedBlock.__cinit__ will
+        #  set placement and ndim
+        self.values = values
+
+    cpdef NumpyBlock getitem_block_index(self, slice slicer):
+        """
+        Perform __getitem__-like specialized to slicing along index.
+
+        Assumes self.ndim == 2
+        """
+        new_values = self.values[..., slicer]
+        return type(self)(new_values, self._mgr_locs, ndim=self.ndim)
+
+
+cdef class NDArrayBackedBlock(SharedBlock):
+    """
+    Block backed by NDArrayBackedExtensionArray
+    """
+    cdef public:
+        NDArrayBacked values
+
+    def __cinit__(self, NDArrayBacked values, BlockPlacement placement, int ndim):
+        # set values here the (implicit) call to SharedBlock.__cinit__ will
+        #  set placement and ndim
+        self.values = values
+
+    cpdef NDArrayBackedBlock getitem_block_index(self, slice slicer):
+        """
+        Perform __getitem__-like specialized to slicing along index.
+
+        Assumes self.ndim == 2
+        """
+        new_values = self.values[..., slicer]
+        return type(self)(new_values, self._mgr_locs, ndim=self.ndim)
+
+
+cdef class Block(SharedBlock):
+    cdef:
+        public object values
+
+    def __cinit__(self, object values, BlockPlacement placement, int ndim):
+        # set values here the (implicit) call to SharedBlock.__cinit__ will
+        #  set placement and ndim
+        self.values = values
+
+
+@cython.freelist(64)
+cdef class BlockManager:
+    cdef:
+        public tuple blocks
+        public list axes
+        public bint _known_consolidated, _is_consolidated
+        public ndarray _blknos, _blklocs
+
+    def __cinit__(self, blocks=None, axes=None, verify_integrity=True):
+        # None as defaults for unpickling GH#42345
+        if blocks is None:
+            # This adds 1-2 microseconds to DataFrame(np.array([]))
+            return
+
+        if isinstance(blocks, list):
+            # Backward compat for e.g. pyarrow
+            blocks = tuple(blocks)
+
+        self.blocks = blocks
+        self.axes = axes.copy()  # copy to make sure we are not remotely-mutable
+
+        # Populate known_consolidate, blknos, and blklocs lazily
+        self._known_consolidated = False
+        self._is_consolidated = False
+        self._blknos = None
+        self._blklocs = None
+
+    # -------------------------------------------------------------------
+    # Block Placement
+
+    def _rebuild_blknos_and_blklocs(self) -> None:
+        """
+        Update mgr._blknos / mgr._blklocs.
+        """
+        cdef:
+            intp_t blkno, i, j
+            cnp.npy_intp length = self.shape[0]
+            SharedBlock blk
+            BlockPlacement bp
+            ndarray[intp_t, ndim=1] new_blknos, new_blklocs
+
+        # equiv: np.empty(length, dtype=np.intp)
+        new_blknos = cnp.PyArray_EMPTY(1, &length, cnp.NPY_INTP, 0)
+        new_blklocs = cnp.PyArray_EMPTY(1, &length, cnp.NPY_INTP, 0)
+        # equiv: new_blknos.fill(-1)
+        cnp.PyArray_FILLWBYTE(new_blknos, -1)
+        cnp.PyArray_FILLWBYTE(new_blklocs, -1)
+
+        for blkno, blk in enumerate(self.blocks):
+            bp = blk._mgr_locs
+            # Iterating over `bp` is a faster equivalent to
+            #  new_blknos[bp.indexer] = blkno
+            #  new_blklocs[bp.indexer] = np.arange(len(bp))
+            for i, j in enumerate(bp):
+                new_blknos[j] = blkno
+                new_blklocs[j] = i
+
+        for i in range(length):
+            # faster than `for blkno in new_blknos`
+            #  https://github.com/cython/cython/issues/4393
+            blkno = new_blknos[i]
+
+            # If there are any -1s remaining, this indicates that our mgr_locs
+            #  are invalid.
+            if blkno == -1:
+                raise AssertionError("Gaps in blk ref_locs")
+
+        self._blknos = new_blknos
+        self._blklocs = new_blklocs
+
+    # -------------------------------------------------------------------
+    # Pickle
+
+    cpdef __reduce__(self):
+        if len(self.axes) == 1:
+            # SingleBlockManager, __init__ expects Block, axis
+            args = (self.blocks[0], self.axes[0])
+        else:
+            args = (self.blocks, self.axes)
+        return type(self), args
+
+    cpdef __setstate__(self, state):
+        from pandas.core.construction import extract_array
+        from pandas.core.internals.blocks import (
+            ensure_block_shape,
+            new_block,
+        )
+        from pandas.core.internals.managers import ensure_index
+
+        if isinstance(state, tuple) and len(state) >= 4 and "0.14.1" in state[3]:
+            state = state[3]["0.14.1"]
+            axes = [ensure_index(ax) for ax in state["axes"]]
+            ndim = len(axes)
+
+            for blk in state["blocks"]:
+                vals = blk["values"]
+                # older versions may hold e.g. DatetimeIndex instead of DTA
+                vals = extract_array(vals, extract_numpy=True)
+                blk["values"] = ensure_block_shape(vals, ndim=ndim)
+
+            nbs = [
+                new_block(blk["values"], blk["mgr_locs"], ndim=ndim)
+                for blk in state["blocks"]
+            ]
+            blocks = tuple(nbs)
+            self.blocks = blocks
+            self.axes = axes
+
+        else:  # pragma: no cover
+            raise NotImplementedError("pre-0.14.1 pickles are no longer supported")
+
+        self._post_setstate()
+
+    def _post_setstate(self) -> None:
+        self._is_consolidated = False
+        self._known_consolidated = False
+        self._rebuild_blknos_and_blklocs()
+
+    # -------------------------------------------------------------------
+    # Indexing
+
+    cdef BlockManager _get_index_slice(self, slobj):
+        cdef:
+            SharedBlock blk, nb
+            BlockManager mgr
+            ndarray blknos, blklocs
+
+        nbs = []
+        for blk in self.blocks:
+            nb = blk.getitem_block_index(slobj)
+            nbs.append(nb)
+
+        new_axes = [self.axes[0], self.axes[1]._getitem_slice(slobj)]
+        mgr = type(self)(tuple(nbs), new_axes, verify_integrity=False)
+
+        # We can avoid having to rebuild blklocs/blknos
+        blklocs = self._blklocs
+        blknos = self._blknos
+        if blknos is not None:
+            mgr._blknos = blknos.copy()
+            mgr._blklocs = blklocs.copy()
+        return mgr
+
+    def get_slice(self, slobj: slice, axis: int = 0) -> BlockManager:
+
+        if axis == 0:
+            new_blocks = self._slice_take_blocks_ax0(slobj)
+        elif axis == 1:
+            return self._get_index_slice(slobj)
+        else:
+            raise IndexError("Requested axis not found in manager")
+
+        new_axes = list(self.axes)
+        new_axes[axis] = new_axes[axis]._getitem_slice(slobj)
+
+        return type(self)(tuple(new_blocks), new_axes, verify_integrity=False)

.venv/Lib/site-packages/pandas/_libs/interval.pyx

@@ -0,0 +1,557 @@
+import numbers
+from operator import (
+    le,
+    lt,
+)
+
+from cpython.datetime cimport (
+    PyDateTime_IMPORT,
+    PyDelta_Check,
+)
+
+PyDateTime_IMPORT
+
+from cpython.object cimport (
+    Py_EQ,
+    Py_GE,
+    Py_GT,
+    Py_LE,
+    Py_LT,
+    Py_NE,
+    PyObject_RichCompare,
+)
+
+import cython
+from cython import Py_ssize_t
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    NPY_QUICKSORT,
+    PyArray_ArgSort,
+    PyArray_Take,
+    float32_t,
+    float64_t,
+    int32_t,
+    int64_t,
+    ndarray,
+    uint64_t,
+)
+
+cnp.import_array()
+
+
+from pandas._libs cimport util
+from pandas._libs.hashtable cimport Int64Vector
+from pandas._libs.tslibs.timedeltas cimport _Timedelta
+from pandas._libs.tslibs.timestamps cimport _Timestamp
+from pandas._libs.tslibs.timezones cimport tz_compare
+from pandas._libs.tslibs.util cimport (
+    is_float_object,
+    is_integer_object,
+    is_timedelta64_object,
+)
+
+VALID_CLOSED = frozenset(['left', 'right', 'both', 'neither'])
+
+
+cdef class IntervalMixin:
+
+    @property
+    def closed_left(self):
+        """
+        Check if the interval is closed on the left side.
+
+        For the meaning of `closed` and `open` see :class:`~pandas.Interval`.
+
+        Returns
+        -------
+        bool
+            True if the Interval is closed on the left-side.
+        """
+        return self.closed in ('left', 'both')
+
+    @property
+    def closed_right(self):
+        """
+        Check if the interval is closed on the right side.
+
+        For the meaning of `closed` and `open` see :class:`~pandas.Interval`.
+
+        Returns
+        -------
+        bool
+            True if the Interval is closed on the left-side.
+        """
+        return self.closed in ('right', 'both')
+
+    @property
+    def open_left(self):
+        """
+        Check if the interval is open on the left side.
+
+        For the meaning of `closed` and `open` see :class:`~pandas.Interval`.
+
+        Returns
+        -------
+        bool
+            True if the Interval is closed on the left-side.
+        """
+        return not self.closed_left
+
+    @property
+    def open_right(self):
+        """
+        Check if the interval is open on the right side.
+
+        For the meaning of `closed` and `open` see :class:`~pandas.Interval`.
+
+        Returns
+        -------
+        bool
+            True if the Interval is closed on the left-side.
+        """
+        return not self.closed_right
+
+    @property
+    def mid(self):
+        """
+        Return the midpoint of the Interval.
+        """
+        try:
+            return 0.5 * (self.left + self.right)
+        except TypeError:
+            # datetime safe version
+            return self.left + 0.5 * self.length
+
+    @property
+    def length(self):
+        """
+        Return the length of the Interval.
+        """
+        return self.right - self.left
+
+    @property
+    def is_empty(self):
+        """
+        Indicates if an interval is empty, meaning it contains no points.
+
+        .. versionadded:: 0.25.0
+
+        Returns
+        -------
+        bool or ndarray
+            A boolean indicating if a scalar :class:`Interval` is empty, or a
+            boolean ``ndarray`` positionally indicating if an ``Interval`` in
+            an :class:`~arrays.IntervalArray` or :class:`IntervalIndex` is
+            empty.
+
+        Examples
+        --------
+        An :class:`Interval` that contains points is not empty:
+
+        >>> pd.Interval(0, 1, closed='right').is_empty
+        False
+
+        An ``Interval`` that does not contain any points is empty:
+
+        >>> pd.Interval(0, 0, closed='right').is_empty
+        True
+        >>> pd.Interval(0, 0, closed='left').is_empty
+        True
+        >>> pd.Interval(0, 0, closed='neither').is_empty
+        True
+
+        An ``Interval`` that contains a single point is not empty:
+
+        >>> pd.Interval(0, 0, closed='both').is_empty
+        False
+
+        An :class:`~arrays.IntervalArray` or :class:`IntervalIndex` returns a
+        boolean ``ndarray`` positionally indicating if an ``Interval`` is
+        empty:
+
+        >>> ivs = [pd.Interval(0, 0, closed='neither'),
+        ...        pd.Interval(1, 2, closed='neither')]
+        >>> pd.arrays.IntervalArray(ivs).is_empty
+        array([ True, False])
+
+        Missing values are not considered empty:
+
+        >>> ivs = [pd.Interval(0, 0, closed='neither'), np.nan]
+        >>> pd.IntervalIndex(ivs).is_empty
+        array([ True, False])
+        """
+        return (self.right == self.left) & (self.closed != 'both')
+
+    def _check_closed_matches(self, other, name='other'):
+        """
+        Check if the closed attribute of `other` matches.
+
+        Note that 'left' and 'right' are considered different from 'both'.
+
+        Parameters
+        ----------
+        other : Interval, IntervalIndex, IntervalArray
+        name : str
+            Name to use for 'other' in the error message.
+
+        Raises
+        ------
+        ValueError
+            When `other` is not closed exactly the same as self.
+        """
+        if self.closed != other.closed:
+            raise ValueError(f"'{name}.closed' is {repr(other.closed)}, "
+                             f"expected {repr(self.closed)}.")
+
+
+cdef bint _interval_like(other):
+    return (hasattr(other, 'left')
+            and hasattr(other, 'right')
+            and hasattr(other, 'closed'))
+
+
+cdef class Interval(IntervalMixin):
+    """
+    Immutable object implementing an Interval, a bounded slice-like interval.
+
+    Parameters
+    ----------
+    left : orderable scalar
+        Left bound for the interval.
+    right : orderable scalar
+        Right bound for the interval.
+    closed : {'right', 'left', 'both', 'neither'}, default 'right'
+        Whether the interval is closed on the left-side, right-side, both or
+        neither. See the Notes for more detailed explanation.
+
+    See Also
+    --------
+    IntervalIndex : An Index of Interval objects that are all closed on the
+        same side.
+    cut : Convert continuous data into discrete bins (Categorical
+        of Interval objects).
+    qcut : Convert continuous data into bins (Categorical of Interval objects)
+        based on quantiles.
+    Period : Represents a period of time.
+
+    Notes
+    -----
+    The parameters `left` and `right` must be from the same type, you must be
+    able to compare them and they must satisfy ``left <= right``.
+
+    A closed interval (in mathematics denoted by square brackets) contains
+    its endpoints, i.e. the closed interval ``[0, 5]`` is characterized by the
+    conditions ``0 <= x <= 5``. This is what ``closed='both'`` stands for.
+    An open interval (in mathematics denoted by parentheses) does not contain
+    its endpoints, i.e. the open interval ``(0, 5)`` is characterized by the
+    conditions ``0 < x < 5``. This is what ``closed='neither'`` stands for.
+    Intervals can also be half-open or half-closed, i.e. ``[0, 5)`` is
+    described by ``0 <= x < 5`` (``closed='left'``) and ``(0, 5]`` is
+    described by ``0 < x <= 5`` (``closed='right'``).
+
+    Examples
+    --------
+    It is possible to build Intervals of different types, like numeric ones:
+
+    >>> iv = pd.Interval(left=0, right=5)
+    >>> iv
+    Interval(0, 5, closed='right')
+
+    You can check if an element belongs to it
+
+    >>> 2.5 in iv
+    True
+
+    You can test the bounds (``closed='right'``, so ``0 < x <= 5``):
+
+    >>> 0 in iv
+    False
+    >>> 5 in iv
+    True
+    >>> 0.0001 in iv
+    True
+
+    Calculate its length
+
+    >>> iv.length
+    5
+
+    You can operate with `+` and `*` over an Interval and the operation
+    is applied to each of its bounds, so the result depends on the type
+    of the bound elements
+
+    >>> shifted_iv = iv + 3
+    >>> shifted_iv
+    Interval(3, 8, closed='right')
+    >>> extended_iv = iv * 10.0
+    >>> extended_iv
+    Interval(0.0, 50.0, closed='right')
+
+    To create a time interval you can use Timestamps as the bounds
+
+    >>> year_2017 = pd.Interval(pd.Timestamp('2017-01-01 00:00:00'),
+    ...                         pd.Timestamp('2018-01-01 00:00:00'),
+    ...                         closed='left')
+    >>> pd.Timestamp('2017-01-01 00:00') in year_2017
+    True
+    >>> year_2017.length
+    Timedelta('365 days 00:00:00')
+    """
+    _typ = "interval"
+    __array_priority__ = 1000
+
+    cdef readonly object left
+    """
+    Left bound for the interval.
+    """
+
+    cdef readonly object right
+    """
+    Right bound for the interval.
+    """
+
+    cdef readonly str closed
+    """
+    Whether the interval is closed on the left-side, right-side, both or
+    neither.
+    """
+
+    def __init__(self, left, right, str closed='right'):
+        # note: it is faster to just do these checks than to use a special
+        # constructor (__cinit__/__new__) to avoid them
+
+        self._validate_endpoint(left)
+        self._validate_endpoint(right)
+
+        if closed not in VALID_CLOSED:
+            raise ValueError(f"invalid option for 'closed': {closed}")
+        if not left <= right:
+            raise ValueError("left side of interval must be <= right side")
+        if (isinstance(left, _Timestamp) and
+                not tz_compare(left.tzinfo, right.tzinfo)):
+            # GH 18538
+            raise ValueError("left and right must have the same time zone, got "
+                             f"{repr(left.tzinfo)}' and {repr(right.tzinfo)}")
+        self.left = left
+        self.right = right
+        self.closed = closed
+
+    def _validate_endpoint(self, endpoint):
+        # GH 23013
+        if not (is_integer_object(endpoint) or is_float_object(endpoint) or
+                isinstance(endpoint, (_Timestamp, _Timedelta))):
+            raise ValueError("Only numeric, Timestamp and Timedelta endpoints "
+                             "are allowed when constructing an Interval.")
+
+    def __hash__(self):
+        return hash((self.left, self.right, self.closed))
+
+    def __contains__(self, key) -> bool:
+        if _interval_like(key):
+            raise TypeError("__contains__ not defined for two intervals")
+        return ((self.left < key if self.open_left else self.left <= key) and
+                (key < self.right if self.open_right else key <= self.right))
+
+    def __richcmp__(self, other, op: int):
+        if isinstance(other, Interval):
+            self_tuple = (self.left, self.right, self.closed)
+            other_tuple = (other.left, other.right, other.closed)
+            return PyObject_RichCompare(self_tuple, other_tuple, op)
+        elif util.is_array(other):
+            return np.array(
+                [PyObject_RichCompare(self, x, op) for x in other],
+                dtype=bool,
+            )
+
+        return NotImplemented
+
+    def __reduce__(self):
+        args = (self.left, self.right, self.closed)
+        return (type(self), args)
+
+    def _repr_base(self):
+        left = self.left
+        right = self.right
+
+        # TODO: need more general formatting methodology here
+        if isinstance(left, _Timestamp) and isinstance(right, _Timestamp):
+            left = left._short_repr
+            right = right._short_repr
+
+        return left, right
+
+    def __repr__(self) -> str:
+
+        left, right = self._repr_base()
+        name = type(self).__name__
+        repr_str = f'{name}({repr(left)}, {repr(right)}, closed={repr(self.closed)})'
+        return repr_str
+
+    def __str__(self) -> str:
+
+        left, right = self._repr_base()
+        start_symbol = '[' if self.closed_left else '('
+        end_symbol = ']' if self.closed_right else ')'
+        return f'{start_symbol}{left}, {right}{end_symbol}'
+
+    def __add__(self, y):
+        if (
+            isinstance(y, numbers.Number)
+            or PyDelta_Check(y)
+            or is_timedelta64_object(y)
+        ):
+            return Interval(self.left + y, self.right + y, closed=self.closed)
+        elif (
+            isinstance(y, Interval)
+            and (
+                isinstance(self, numbers.Number)
+                or PyDelta_Check(self)
+                or is_timedelta64_object(self)
+            )
+        ):
+            return Interval(y.left + self, y.right + self, closed=y.closed)
+        return NotImplemented
+
+    def __sub__(self, y):
+        if (
+            isinstance(y, numbers.Number)
+            or PyDelta_Check(y)
+            or is_timedelta64_object(y)
+        ):
+            return Interval(self.left - y, self.right - y, closed=self.closed)
+        return NotImplemented
+
+    def __mul__(self, y):
+        if isinstance(y, numbers.Number):
+            return Interval(self.left * y, self.right * y, closed=self.closed)
+        elif isinstance(y, Interval) and isinstance(self, numbers.Number):
+            return Interval(y.left * self, y.right * self, closed=y.closed)
+        return NotImplemented
+
+    def __truediv__(self, y):
+        if isinstance(y, numbers.Number):
+            return Interval(self.left / y, self.right / y, closed=self.closed)
+        return NotImplemented
+
+    def __floordiv__(self, y):
+        if isinstance(y, numbers.Number):
+            return Interval(
+                self.left // y, self.right // y, closed=self.closed)
+        return NotImplemented
+
+    def overlaps(self, other):
+        """
+        Check whether two Interval objects overlap.
+
+        Two intervals overlap if they share a common point, including closed
+        endpoints. Intervals that only have an open endpoint in common do not
+        overlap.
+
+        Parameters
+        ----------
+        other : Interval
+            Interval to check against for an overlap.
+
+        Returns
+        -------
+        bool
+            True if the two intervals overlap.
+
+        See Also
+        --------
+        IntervalArray.overlaps : The corresponding method for IntervalArray.
+        IntervalIndex.overlaps : The corresponding method for IntervalIndex.
+
+        Examples
+        --------
+        >>> i1 = pd.Interval(0, 2)
+        >>> i2 = pd.Interval(1, 3)
+        >>> i1.overlaps(i2)
+        True
+        >>> i3 = pd.Interval(4, 5)
+        >>> i1.overlaps(i3)
+        False
+
+        Intervals that share closed endpoints overlap:
+
+        >>> i4 = pd.Interval(0, 1, closed='both')
+        >>> i5 = pd.Interval(1, 2, closed='both')
+        >>> i4.overlaps(i5)
+        True
+
+        Intervals that only have an open endpoint in common do not overlap:
+
+        >>> i6 = pd.Interval(1, 2, closed='neither')
+        >>> i4.overlaps(i6)
+        False
+        """
+        if not isinstance(other, Interval):
+            raise TypeError("`other` must be an Interval, "
+                            f"got {type(other).__name__}")
+
+        # equality is okay if both endpoints are closed (overlap at a point)
+        op1 = le if (self.closed_left and other.closed_right) else lt
+        op2 = le if (other.closed_left and self.closed_right) else lt
+
+        # overlaps is equivalent negation of two interval being disjoint:
+        # disjoint = (A.left > B.right) or (B.left > A.right)
+        # (simplifying the negation allows this to be done in less operations)
+        return op1(self.left, other.right) and op2(other.left, self.right)
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def intervals_to_interval_bounds(ndarray intervals, bint validate_closed=True):
+    """
+    Parameters
+    ----------
+    intervals : ndarray
+        Object array of Intervals / nulls.
+
+    validate_closed: bool, default True
+        Boolean indicating if all intervals must be closed on the same side.
+        Mismatching closed will raise if True, else return None for closed.
+
+    Returns
+    -------
+    tuple of
+        left : ndarray
+        right : ndarray
+        closed: str
+    """
+    cdef:
+        object closed = None, interval
+        Py_ssize_t i, n = len(intervals)
+        ndarray left, right
+        bint seen_closed = False
+
+    left = np.empty(n, dtype=intervals.dtype)
+    right = np.empty(n, dtype=intervals.dtype)
+
+    for i in range(n):
+        interval = intervals[i]
+        if interval is None or util.is_nan(interval):
+            left[i] = np.nan
+            right[i] = np.nan
+            continue
+
+        if not isinstance(interval, Interval):
+            raise TypeError(f"type {type(interval)} with value "
+                            f"{interval} is not an interval")
+
+        left[i] = interval.left
+        right[i] = interval.right
+        if not seen_closed:
+            seen_closed = True
+            closed = interval.closed
+        elif closed != interval.closed:
+            closed = None
+            if validate_closed:
+                raise ValueError("intervals must all be closed on the same side")
+
+    return left, right, closed
+
+
+include "intervaltree.pxi"

.venv/Lib/site-packages/pandas/_libs/intervaltree.pxi.in

@@ -0,0 +1,427 @@
+"""
+Template for intervaltree
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+from pandas._libs.algos import is_monotonic
+
+ctypedef fused int_scalar_t:
+    int64_t
+    float64_t
+
+ctypedef fused uint_scalar_t:
+    uint64_t
+    float64_t
+
+ctypedef fused scalar_t:
+    int_scalar_t
+    uint_scalar_t
+
+# ----------------------------------------------------------------------
+# IntervalTree
+# ----------------------------------------------------------------------
+
+cdef class IntervalTree(IntervalMixin):
+    """A centered interval tree
+
+    Based off the algorithm described on Wikipedia:
+    https://en.wikipedia.org/wiki/Interval_tree
+
+    we are emulating the IndexEngine interface
+    """
+    cdef readonly:
+        ndarray left, right
+        IntervalNode root
+        object dtype
+        str closed
+        object _is_overlapping, _left_sorter, _right_sorter
+        Py_ssize_t _na_count
+
+    def __init__(self, left, right, closed='right', leaf_size=100):
+        """
+        Parameters
+        ----------
+        left, right : np.ndarray[ndim=1]
+            Left and right bounds for each interval. Assumed to contain no
+            NaNs.
+        closed : {'left', 'right', 'both', 'neither'}, optional
+            Whether the intervals are closed on the left-side, right-side, both
+            or neither. Defaults to 'right'.
+        leaf_size : int, optional
+            Parameter that controls when the tree switches from creating nodes
+            to brute-force search. Tune this parameter to optimize query
+            performance.
+        """
+        if closed not in ['left', 'right', 'both', 'neither']:
+            raise ValueError("invalid option for 'closed': %s" % closed)
+
+        left = np.asarray(left)
+        right = np.asarray(right)
+        self.dtype = np.result_type(left, right)
+        self.left = np.asarray(left, dtype=self.dtype)
+        self.right = np.asarray(right, dtype=self.dtype)
+
+        indices = np.arange(len(left), dtype='int64')
+
+        self.closed = closed
+
+        # GH 23352: ensure no nan in nodes
+        mask = ~np.isnan(self.left)
+        self._na_count = len(mask) - mask.sum()
+        self.left = self.left[mask]
+        self.right = self.right[mask]
+        indices = indices[mask]
+
+        node_cls = NODE_CLASSES[str(self.dtype), closed]
+        self.root = node_cls(self.left, self.right, indices, leaf_size)
+
+    @property
+    def left_sorter(self) -> np.ndarray:
+        """How to sort the left labels; this is used for binary search
+        """
+        if self._left_sorter is None:
+            self._left_sorter = np.argsort(self.left)
+        return self._left_sorter
+
+    @property
+    def right_sorter(self) -> np.ndarray:
+        """How to sort the right labels
+        """
+        if self._right_sorter is None:
+            self._right_sorter = np.argsort(self.right)
+        return self._right_sorter
+
+    @property
+    def is_overlapping(self) -> bool:
+        """
+        Determine if the IntervalTree contains overlapping intervals.
+        Cached as self._is_overlapping.
+        """
+        if self._is_overlapping is not None:
+            return self._is_overlapping
+
+        # <= when both sides closed since endpoints can overlap
+        op = le if self.closed == 'both' else lt
+
+        # overlap if start of current interval < end of previous interval
+        # (current and previous in terms of sorted order by left/start side)
+        current = self.left[self.left_sorter[1:]]
+        previous = self.right[self.left_sorter[:-1]]
+        self._is_overlapping = bool(op(current, previous).any())
+
+        return self._is_overlapping
+
+    @property
+    def is_monotonic_increasing(self) -> bool:
+        """
+        Return True if the IntervalTree is monotonic increasing (only equal or
+        increasing values), else False
+        """
+        if self._na_count > 0:
+            return False
+        values = [self.right, self.left]
+
+        sort_order = np.lexsort(values)
+        return is_monotonic(sort_order, False)[0]
+
+    def get_indexer(self, scalar_t[:] target) -> np.ndarray:
+        """Return the positions corresponding to unique intervals that overlap
+        with the given array of scalar targets.
+        """
+
+        # TODO: write get_indexer_intervals
+        cdef:
+            Py_ssize_t old_len
+            Py_ssize_t i
+            Int64Vector result
+
+        result = Int64Vector()
+        old_len = 0
+        for i in range(len(target)):
+            try:
+                self.root.query(result, target[i])
+            except OverflowError:
+                # overflow -> no match, which is already handled below
+                pass
+
+            if result.data.n == old_len:
+                result.append(-1)
+            elif result.data.n > old_len + 1:
+                raise KeyError(
+                    'indexer does not intersect a unique set of intervals')
+            old_len = result.data.n
+        return result.to_array().astype('intp')
+
+    def get_indexer_non_unique(self, scalar_t[:] target):
+        """Return the positions corresponding to intervals that overlap with
+        the given array of scalar targets. Non-unique positions are repeated.
+        """
+        cdef:
+            Py_ssize_t old_len
+            Py_ssize_t i
+            Int64Vector result, missing
+
+        result = Int64Vector()
+        missing = Int64Vector()
+        old_len = 0
+        for i in range(len(target)):
+            try:
+                self.root.query(result, target[i])
+            except OverflowError:
+                # overflow -> no match, which is already handled below
+                pass
+
+            if result.data.n == old_len:
+                result.append(-1)
+                missing.append(i)
+            old_len = result.data.n
+        return (result.to_array().astype('intp'),
+                missing.to_array().astype('intp'))
+
+    def __repr__(self) -> str:
+        return ('<IntervalTree[{dtype},{closed}]: '
+                '{n_elements} elements>'.format(
+                    dtype=self.dtype, closed=self.closed,
+                    n_elements=self.root.n_elements))
+
+    # compat with IndexEngine interface
+    def clear_mapping(self) -> None:
+        pass
+
+
+cdef take(ndarray source, ndarray indices):
+    """Take the given positions from a 1D ndarray
+    """
+    return PyArray_Take(source, indices, 0)
+
+
+cdef sort_values_and_indices(all_values, all_indices, subset):
+    indices = take(all_indices, subset)
+    values = take(all_values, subset)
+    sorter = PyArray_ArgSort(values, 0, NPY_QUICKSORT)
+    sorted_values = take(values, sorter)
+    sorted_indices = take(indices, sorter)
+    return sorted_values, sorted_indices
+
+
+# ----------------------------------------------------------------------
+# Nodes
+# ----------------------------------------------------------------------
+
+@cython.internal
+cdef class IntervalNode:
+    cdef readonly:
+        int64_t n_elements, n_center, leaf_size
+        bint is_leaf_node
+
+    def __repr__(self) -> str:
+        if self.is_leaf_node:
+            return (
+                f"<{type(self).__name__}: {self.n_elements} elements (terminal)>"
+            )
+        else:
+            n_left = self.left_node.n_elements
+            n_right = self.right_node.n_elements
+            n_center = self.n_elements - n_left - n_right
+            return (
+                f"<{type(self).__name__}: "
+                f"pivot {self.pivot}, {self.n_elements} elements "
+                f"({n_left} left, {n_right} right, {n_center} overlapping)>"
+            )
+
+    def counts(self):
+        """
+        Inspect counts on this node
+        useful for debugging purposes
+        """
+        if self.is_leaf_node:
+            return self.n_elements
+        else:
+            m = len(self.center_left_values)
+            l = self.left_node.counts()
+            r = self.right_node.counts()
+            return (m, (l, r))
+
+
+# we need specialized nodes and leaves to optimize for different dtype and
+# closed values
+
+{{py:
+
+nodes = []
+for dtype in ['float64', 'int64', 'uint64']:
+    for closed, cmp_left, cmp_right in [
+        ('left', '<=', '<'),
+        ('right', '<', '<='),
+        ('both', '<=', '<='),
+        ('neither', '<', '<')]:
+        cmp_left_converse = '<' if cmp_left == '<=' else '<='
+        cmp_right_converse = '<' if cmp_right == '<=' else '<='
+        if dtype.startswith('int'):
+            fused_prefix = 'int_'
+        elif dtype.startswith('uint'):
+            fused_prefix = 'uint_'
+        elif dtype.startswith('float'):
+            fused_prefix = ''
+        nodes.append((dtype, dtype.title(),
+                      closed, closed.title(),
+                      cmp_left,
+                      cmp_right,
+                      cmp_left_converse,
+                      cmp_right_converse,
+                      fused_prefix))
+
+}}
+
+NODE_CLASSES = {}
+
+{{for dtype, dtype_title, closed, closed_title, cmp_left, cmp_right,
+      cmp_left_converse, cmp_right_converse, fused_prefix in nodes}}
+
+
+@cython.internal
+cdef class {{dtype_title}}Closed{{closed_title}}IntervalNode(IntervalNode):
+    """Non-terminal node for an IntervalTree
+
+    Categorizes intervals by those that fall to the left, those that fall to
+    the right, and those that overlap with the pivot.
+    """
+    cdef readonly:
+        {{dtype_title}}Closed{{closed_title}}IntervalNode left_node, right_node
+        {{dtype}}_t[:] center_left_values, center_right_values, left, right
+        int64_t[:] center_left_indices, center_right_indices, indices
+        {{dtype}}_t min_left, max_right
+        {{dtype}}_t pivot
+
+    def __init__(self,
+                 ndarray[{{dtype}}_t, ndim=1] left,
+                 ndarray[{{dtype}}_t, ndim=1] right,
+                 ndarray[int64_t, ndim=1] indices,
+                 int64_t leaf_size):
+
+        self.n_elements = len(left)
+        self.leaf_size = leaf_size
+
+        # min_left and min_right are used to speed-up query by skipping
+        # query on sub-nodes. If this node has size 0, query is cheap,
+        # so these values don't matter.
+        if left.size > 0:
+            self.min_left = left.min()
+            self.max_right = right.max()
+        else:
+            self.min_left = 0
+            self.max_right = 0
+
+        if self.n_elements <= leaf_size:
+            # make this a terminal (leaf) node
+            self.is_leaf_node = True
+            self.left = left
+            self.right = right
+            self.indices = indices
+            self.n_center = 0
+        else:
+            # calculate a pivot so we can create child nodes
+            self.is_leaf_node = False
+            self.pivot = np.median(left / 2 + right / 2)
+            left_set, right_set, center_set = self.classify_intervals(
+                left, right)
+
+            self.left_node = self.new_child_node(left, right,
+                                                 indices, left_set)
+            self.right_node = self.new_child_node(left, right,
+                                                  indices, right_set)
+
+            self.center_left_values, self.center_left_indices = \
+                sort_values_and_indices(left, indices, center_set)
+            self.center_right_values, self.center_right_indices = \
+                sort_values_and_indices(right, indices, center_set)
+            self.n_center = len(self.center_left_indices)
+
+    @cython.wraparound(False)
+    @cython.boundscheck(False)
+    cdef classify_intervals(self, {{dtype}}_t[:] left, {{dtype}}_t[:] right):
+        """Classify the given intervals based upon whether they fall to the
+        left, right, or overlap with this node's pivot.
+        """
+        cdef:
+            Int64Vector left_ind, right_ind, overlapping_ind
+            Py_ssize_t i
+
+        left_ind = Int64Vector()
+        right_ind = Int64Vector()
+        overlapping_ind = Int64Vector()
+
+        for i in range(self.n_elements):
+            if right[i] {{cmp_right_converse}} self.pivot:
+                left_ind.append(i)
+            elif self.pivot {{cmp_left_converse}} left[i]:
+                right_ind.append(i)
+            else:
+                overlapping_ind.append(i)
+
+        return (left_ind.to_array(),
+                right_ind.to_array(),
+                overlapping_ind.to_array())
+
+    cdef new_child_node(self,
+                        ndarray[{{dtype}}_t, ndim=1] left,
+                        ndarray[{{dtype}}_t, ndim=1] right,
+                        ndarray[int64_t, ndim=1] indices,
+                        ndarray[int64_t, ndim=1] subset):
+        """Create a new child node.
+        """
+        left = take(left, subset)
+        right = take(right, subset)
+        indices = take(indices, subset)
+        return {{dtype_title}}Closed{{closed_title}}IntervalNode(
+            left, right, indices, self.leaf_size)
+
+    @cython.wraparound(False)
+    @cython.boundscheck(False)
+    @cython.initializedcheck(False)
+    cpdef query(self, Int64Vector result, {{fused_prefix}}scalar_t point):
+        """Recursively query this node and its sub-nodes for intervals that
+        overlap with the query point.
+        """
+        cdef:
+            int64_t[:] indices
+            {{dtype}}_t[:] values
+            Py_ssize_t i
+
+        if self.is_leaf_node:
+            # Once we get down to a certain size, it doesn't make sense to
+            # continue the binary tree structure. Instead, we use linear
+            # search.
+            for i in range(self.n_elements):
+                if self.left[i] {{cmp_left}} point {{cmp_right}} self.right[i]:
+                    result.append(self.indices[i])
+        else:
+            # There are child nodes. Based on comparing our query to the pivot,
+            # look at the center values, then go to the relevant child.
+            if point < self.pivot:
+                values = self.center_left_values
+                indices = self.center_left_indices
+                for i in range(self.n_center):
+                    if not values[i] {{cmp_left}} point:
+                        break
+                    result.append(indices[i])
+                if point {{cmp_right}} self.left_node.max_right:
+                    self.left_node.query(result, point)
+            elif point > self.pivot:
+                values = self.center_right_values
+                indices = self.center_right_indices
+                for i in range(self.n_center - 1, -1, -1):
+                    if not point {{cmp_right}} values[i]:
+                        break
+                    result.append(indices[i])
+                if self.right_node.min_left {{cmp_left}} point:
+                    self.right_node.query(result, point)
+            else:
+                result.extend(self.center_left_indices)
+
+
+NODE_CLASSES['{{dtype}}',
+             '{{closed}}'] = {{dtype_title}}Closed{{closed_title}}IntervalNode
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/join.pyi

@@ -0,0 +1,93 @@
+import numpy as np
+
+from pandas._typing import npt
+
+def inner_join(
+    left: np.ndarray,  # const intp_t[:]
+    right: np.ndarray,  # const intp_t[:]
+    max_groups: int,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def left_outer_join(
+    left: np.ndarray,  # const intp_t[:]
+    right: np.ndarray,  # const intp_t[:]
+    max_groups: int,
+    sort: bool = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def full_outer_join(
+    left: np.ndarray,  # const intp_t[:]
+    right: np.ndarray,  # const intp_t[:]
+    max_groups: int,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def ffill_indexer(
+    indexer: np.ndarray,  # const intp_t[:]
+) -> npt.NDArray[np.intp]: ...
+def left_join_indexer_unique(
+    left: np.ndarray,  # ndarray[join_t]
+    right: np.ndarray,  # ndarray[join_t]
+) -> npt.NDArray[np.intp]: ...
+def left_join_indexer(
+    left: np.ndarray,  # ndarray[join_t]
+    right: np.ndarray,  # ndarray[join_t]
+) -> tuple[
+    np.ndarray,  # np.ndarray[join_t]
+    npt.NDArray[np.intp],
+    npt.NDArray[np.intp],
+]: ...
+def inner_join_indexer(
+    left: np.ndarray,  # ndarray[join_t]
+    right: np.ndarray,  # ndarray[join_t]
+) -> tuple[
+    np.ndarray,  # np.ndarray[join_t]
+    npt.NDArray[np.intp],
+    npt.NDArray[np.intp],
+]: ...
+def outer_join_indexer(
+    left: np.ndarray,  # ndarray[join_t]
+    right: np.ndarray,  # ndarray[join_t]
+) -> tuple[
+    np.ndarray,  # np.ndarray[join_t]
+    npt.NDArray[np.intp],
+    npt.NDArray[np.intp],
+]: ...
+def asof_join_backward_on_X_by_Y(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    left_by_values: np.ndarray,  # by_t[:]
+    right_by_values: np.ndarray,  # by_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def asof_join_forward_on_X_by_Y(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    left_by_values: np.ndarray,  # by_t[:]
+    right_by_values: np.ndarray,  # by_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def asof_join_nearest_on_X_by_Y(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    left_by_values: np.ndarray,  # by_t[:]
+    right_by_values: np.ndarray,  # by_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def asof_join_backward(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def asof_join_forward(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...
+def asof_join_nearest(
+    left_values: np.ndarray,  # asof_t[:]
+    right_values: np.ndarray,  # asof_t[:]
+    allow_exact_matches: bool = ...,
+    tolerance: np.number | int | float | None = ...,
+) -> tuple[npt.NDArray[np.intp], npt.NDArray[np.intp]]: ...

.venv/Lib/site-packages/pandas/_libs/khash.pxd

@@ -0,0 +1,129 @@
+from cpython.object cimport PyObject
+from numpy cimport (
+    complex64_t,
+    complex128_t,
+    float32_t,
+    float64_t,
+    int8_t,
+    int16_t,
+    int32_t,
+    int64_t,
+    uint8_t,
+    uint16_t,
+    uint32_t,
+    uint64_t,
+)
+
+
+cdef extern from "khash_python.h":
+    const int KHASH_TRACE_DOMAIN
+
+    ctypedef uint32_t khuint_t
+    ctypedef khuint_t khiter_t
+
+    ctypedef struct khcomplex128_t:
+        double real
+        double imag
+
+    bint are_equivalent_khcomplex128_t \
+        "kh_complex_hash_equal" (khcomplex128_t a, khcomplex128_t b) nogil
+
+    ctypedef struct khcomplex64_t:
+        float real
+        float imag
+
+    bint are_equivalent_khcomplex64_t \
+        "kh_complex_hash_equal" (khcomplex64_t a, khcomplex64_t b) nogil
+
+    bint are_equivalent_float64_t \
+        "kh_floats_hash_equal" (float64_t a, float64_t b) nogil
+
+    bint are_equivalent_float32_t \
+        "kh_floats_hash_equal" (float32_t a, float32_t b) nogil
+
+    uint32_t kh_python_hash_func(object key)
+    bint kh_python_hash_equal(object a, object b)
+
+    ctypedef struct kh_pymap_t:
+        khuint_t n_buckets, size, n_occupied, upper_bound
+        uint32_t *flags
+        PyObject **keys
+        size_t *vals
+
+    kh_pymap_t* kh_init_pymap()
+    void kh_destroy_pymap(kh_pymap_t*)
+    void kh_clear_pymap(kh_pymap_t*)
+    khuint_t kh_get_pymap(kh_pymap_t*, PyObject*)
+    void kh_resize_pymap(kh_pymap_t*, khuint_t)
+    khuint_t kh_put_pymap(kh_pymap_t*, PyObject*, int*)
+    void kh_del_pymap(kh_pymap_t*, khuint_t)
+
+    bint kh_exist_pymap(kh_pymap_t*, khiter_t)
+
+    ctypedef struct kh_pyset_t:
+        khuint_t n_buckets, size, n_occupied, upper_bound
+        uint32_t *flags
+        PyObject **keys
+        size_t *vals
+
+    kh_pyset_t* kh_init_pyset()
+    void kh_destroy_pyset(kh_pyset_t*)
+    void kh_clear_pyset(kh_pyset_t*)
+    khuint_t kh_get_pyset(kh_pyset_t*, PyObject*)
+    void kh_resize_pyset(kh_pyset_t*, khuint_t)
+    khuint_t kh_put_pyset(kh_pyset_t*, PyObject*, int*)
+    void kh_del_pyset(kh_pyset_t*, khuint_t)
+
+    bint kh_exist_pyset(kh_pyset_t*, khiter_t)
+
+    ctypedef char* kh_cstr_t
+
+    ctypedef struct kh_str_t:
+        khuint_t n_buckets, size, n_occupied, upper_bound
+        uint32_t *flags
+        kh_cstr_t *keys
+        size_t *vals
+
+    kh_str_t* kh_init_str() nogil
+    void kh_destroy_str(kh_str_t*) nogil
+    void kh_clear_str(kh_str_t*) nogil
+    khuint_t kh_get_str(kh_str_t*, kh_cstr_t) nogil
+    void kh_resize_str(kh_str_t*, khuint_t) nogil
+    khuint_t kh_put_str(kh_str_t*, kh_cstr_t, int*) nogil
+    void kh_del_str(kh_str_t*, khuint_t) nogil
+
+    bint kh_exist_str(kh_str_t*, khiter_t) nogil
+
+    ctypedef struct kh_str_starts_t:
+        kh_str_t *table
+        int starts[256]
+
+    kh_str_starts_t* kh_init_str_starts() nogil
+    khuint_t kh_put_str_starts_item(kh_str_starts_t* table, char* key,
+                                    int* ret) nogil
+    khuint_t kh_get_str_starts_item(kh_str_starts_t* table, char* key) nogil
+    void kh_destroy_str_starts(kh_str_starts_t*) nogil
+    void kh_resize_str_starts(kh_str_starts_t*, khuint_t) nogil
+
+    # sweep factorize
+
+    ctypedef struct kh_strbox_t:
+        khuint_t n_buckets, size, n_occupied, upper_bound
+        uint32_t *flags
+        kh_cstr_t *keys
+        PyObject **vals
+
+    kh_strbox_t* kh_init_strbox() nogil
+    void kh_destroy_strbox(kh_strbox_t*) nogil
+    void kh_clear_strbox(kh_strbox_t*) nogil
+    khuint_t kh_get_strbox(kh_strbox_t*, kh_cstr_t) nogil
+    void kh_resize_strbox(kh_strbox_t*, khuint_t) nogil
+    khuint_t kh_put_strbox(kh_strbox_t*, kh_cstr_t, int*) nogil
+    void kh_del_strbox(kh_strbox_t*, khuint_t) nogil
+
+    bint kh_exist_strbox(kh_strbox_t*, khiter_t) nogil
+
+    khuint_t kh_needed_n_buckets(khuint_t element_n) nogil
+
+
+include "khash_for_primitive_helper.pxi"

.venv/Lib/site-packages/pandas/_libs/khash_for_primitive_helper.pxi.in

@@ -0,0 +1,44 @@
+"""
+Template for wrapping khash-tables for each primitive `dtype`
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+{{py:
+
+# name, c_type
+primitive_types = [('int64', 'int64_t'),
+                   ('uint64', 'uint64_t'),
+                   ('float64', 'float64_t'),
+                   ('int32', 'int32_t'),
+                   ('uint32', 'uint32_t'),
+                   ('float32', 'float32_t'),
+                   ('int16', 'int16_t'),
+                   ('uint16', 'uint16_t'),
+                   ('int8', 'int8_t'),
+                   ('uint8', 'uint8_t'),
+                   ('complex64', 'khcomplex64_t'),
+                   ('complex128', 'khcomplex128_t'),
+                  ]
+}}
+
+{{for name, c_type in primitive_types}}
+
+cdef extern from "khash_python.h":
+    ctypedef struct kh_{{name}}_t:
+        khuint_t n_buckets, size, n_occupied, upper_bound
+        uint32_t *flags
+        {{c_type}} *keys
+        size_t *vals
+
+    kh_{{name}}_t* kh_init_{{name}}() nogil
+    void kh_destroy_{{name}}(kh_{{name}}_t*) nogil
+    void kh_clear_{{name}}(kh_{{name}}_t*) nogil
+    khuint_t kh_get_{{name}}(kh_{{name}}_t*, {{c_type}}) nogil
+    void kh_resize_{{name}}(kh_{{name}}_t*, khuint_t) nogil
+    khuint_t kh_put_{{name}}(kh_{{name}}_t*, {{c_type}}, int*) nogil
+    void kh_del_{{name}}(kh_{{name}}_t*, khuint_t) nogil
+
+    bint kh_exist_{{name}}(kh_{{name}}_t*, khiter_t) nogil
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/lib.pxd

@@ -0,0 +1,6 @@
+from numpy cimport ndarray
+
+
+cdef bint c_is_list_like(object, bint) except -1
+
+cpdef ndarray eq_NA_compat(ndarray[object] arr, object key)

.venv/Lib/site-packages/pandas/_libs/lib.pyi

@@ -0,0 +1,231 @@
+# TODO(npdtypes): Many types specified here can be made more specific/accurate;
+#  the more specific versions are specified in comments
+
+from typing import (
+    Any,
+    Callable,
+    Generator,
+    Hashable,
+    Literal,
+    overload,
+)
+
+import numpy as np
+
+from pandas._typing import (
+    ArrayLike,
+    DtypeObj,
+    npt,
+)
+
+# placeholder until we can specify np.ndarray[object, ndim=2]
+ndarray_obj_2d = np.ndarray
+
+from enum import Enum
+
+class NoDefault(Enum): ...
+
+no_default: NoDefault
+
+i8max: int
+u8max: int
+
+def item_from_zerodim(val: object) -> object: ...
+def infer_dtype(value: object, skipna: bool = ...) -> str: ...
+def is_iterator(obj: object) -> bool: ...
+def is_scalar(val: object) -> bool: ...
+def is_list_like(obj: object, allow_sets: bool = ...) -> bool: ...
+def is_period(val: object) -> bool: ...
+def is_interval(val: object) -> bool: ...
+def is_decimal(val: object) -> bool: ...
+def is_complex(val: object) -> bool: ...
+def is_bool(val: object) -> bool: ...
+def is_integer(val: object) -> bool: ...
+def is_float(val: object) -> bool: ...
+def is_interval_array(values: np.ndarray) -> bool: ...
+def is_datetime64_array(values: np.ndarray) -> bool: ...
+def is_timedelta_or_timedelta64_array(values: np.ndarray) -> bool: ...
+def is_datetime_with_singletz_array(values: np.ndarray) -> bool: ...
+def is_time_array(values: np.ndarray, skipna: bool = ...): ...
+def is_date_array(values: np.ndarray, skipna: bool = ...): ...
+def is_datetime_array(values: np.ndarray, skipna: bool = ...): ...
+def is_string_array(values: np.ndarray, skipna: bool = ...): ...
+def is_float_array(values: np.ndarray, skipna: bool = ...): ...
+def is_integer_array(values: np.ndarray, skipna: bool = ...): ...
+def is_bool_array(values: np.ndarray, skipna: bool = ...): ...
+def fast_multiget(mapping: dict, keys: np.ndarray, default=...) -> np.ndarray: ...
+def fast_unique_multiple_list_gen(gen: Generator, sort: bool = ...) -> list: ...
+def fast_unique_multiple_list(lists: list, sort: bool | None = ...) -> list: ...
+def fast_unique_multiple(arrays: list, sort: bool = ...) -> list: ...
+def map_infer(
+    arr: np.ndarray,
+    f: Callable[[Any], Any],
+    convert: bool = ...,
+    ignore_na: bool = ...,
+) -> np.ndarray: ...
+@overload  # both convert_datetime and convert_to_nullable_integer False -> np.ndarray
+def maybe_convert_objects(
+    objects: npt.NDArray[np.object_],
+    *,
+    try_float: bool = ...,
+    safe: bool = ...,
+    convert_datetime: Literal[False] = ...,
+    convert_timedelta: bool = ...,
+    convert_period: Literal[False] = ...,
+    convert_interval: Literal[False] = ...,
+    convert_to_nullable_integer: Literal[False] = ...,
+    dtype_if_all_nat: DtypeObj | None = ...,
+) -> np.ndarray: ...
+@overload
+def maybe_convert_objects(
+    objects: npt.NDArray[np.object_],
+    *,
+    try_float: bool = ...,
+    safe: bool = ...,
+    convert_datetime: bool = ...,
+    convert_timedelta: bool = ...,
+    convert_period: bool = ...,
+    convert_interval: bool = ...,
+    convert_to_nullable_integer: Literal[True] = ...,
+    dtype_if_all_nat: DtypeObj | None = ...,
+) -> ArrayLike: ...
+@overload
+def maybe_convert_objects(
+    objects: npt.NDArray[np.object_],
+    *,
+    try_float: bool = ...,
+    safe: bool = ...,
+    convert_datetime: Literal[True] = ...,
+    convert_timedelta: bool = ...,
+    convert_period: bool = ...,
+    convert_interval: bool = ...,
+    convert_to_nullable_integer: bool = ...,
+    dtype_if_all_nat: DtypeObj | None = ...,
+) -> ArrayLike: ...
+@overload
+def maybe_convert_objects(
+    objects: npt.NDArray[np.object_],
+    *,
+    try_float: bool = ...,
+    safe: bool = ...,
+    convert_datetime: bool = ...,
+    convert_timedelta: bool = ...,
+    convert_period: Literal[True] = ...,
+    convert_interval: bool = ...,
+    convert_to_nullable_integer: bool = ...,
+    dtype_if_all_nat: DtypeObj | None = ...,
+) -> ArrayLike: ...
+@overload
+def maybe_convert_objects(
+    objects: npt.NDArray[np.object_],
+    *,
+    try_float: bool = ...,
+    safe: bool = ...,
+    convert_datetime: bool = ...,
+    convert_timedelta: bool = ...,
+    convert_period: bool = ...,
+    convert_interval: bool = ...,
+    convert_to_nullable_integer: bool = ...,
+    dtype_if_all_nat: DtypeObj | None = ...,
+) -> ArrayLike: ...
+@overload
+def maybe_convert_numeric(
+    values: npt.NDArray[np.object_],
+    na_values: set,
+    convert_empty: bool = ...,
+    coerce_numeric: bool = ...,
+    convert_to_masked_nullable: Literal[False] = ...,
+) -> tuple[np.ndarray, None]: ...
+@overload
+def maybe_convert_numeric(
+    values: npt.NDArray[np.object_],
+    na_values: set,
+    convert_empty: bool = ...,
+    coerce_numeric: bool = ...,
+    *,
+    convert_to_masked_nullable: Literal[True],
+) -> tuple[np.ndarray, np.ndarray]: ...
+
+# TODO: restrict `arr`?
+def ensure_string_array(
+    arr,
+    na_value: object = ...,
+    convert_na_value: bool = ...,
+    copy: bool = ...,
+    skipna: bool = ...,
+) -> npt.NDArray[np.object_]: ...
+def infer_datetimelike_array(
+    arr: npt.NDArray[np.object_],
+) -> tuple[str, bool]: ...
+def astype_intsafe(
+    arr: npt.NDArray[np.object_],
+    new_dtype: np.dtype,
+) -> np.ndarray: ...
+def fast_zip(ndarrays: list) -> npt.NDArray[np.object_]: ...
+
+# TODO: can we be more specific about rows?
+def to_object_array_tuples(rows: object) -> ndarray_obj_2d: ...
+def tuples_to_object_array(
+    tuples: npt.NDArray[np.object_],
+) -> ndarray_obj_2d: ...
+
+# TODO: can we be more specific about rows?
+def to_object_array(rows: object, min_width: int = ...) -> ndarray_obj_2d: ...
+def dicts_to_array(dicts: list, columns: list) -> ndarray_obj_2d: ...
+def maybe_booleans_to_slice(
+    mask: npt.NDArray[np.uint8],
+) -> slice | npt.NDArray[np.uint8]: ...
+def maybe_indices_to_slice(
+    indices: npt.NDArray[np.intp],
+    max_len: int,
+) -> slice | npt.NDArray[np.intp]: ...
+def is_all_arraylike(obj: list) -> bool: ...
+
+# -----------------------------------------------------------------
+# Functions which in reality take memoryviews
+
+def memory_usage_of_objects(arr: np.ndarray) -> int: ...  # object[:]  # np.int64
+def map_infer_mask(
+    arr: np.ndarray,
+    f: Callable[[Any], Any],
+    mask: np.ndarray,  # const uint8_t[:]
+    convert: bool = ...,
+    na_value: Any = ...,
+    dtype: np.dtype = ...,
+) -> np.ndarray: ...
+def indices_fast(
+    index: npt.NDArray[np.intp],
+    labels: np.ndarray,  # const int64_t[:]
+    keys: list,
+    sorted_labels: list[npt.NDArray[np.int64]],
+) -> dict[Hashable, npt.NDArray[np.intp]]: ...
+def generate_slices(
+    labels: np.ndarray, ngroups: int  # const intp_t[:]
+) -> tuple[npt.NDArray[np.int64], npt.NDArray[np.int64]]: ...
+def count_level_2d(
+    mask: np.ndarray,  # ndarray[uint8_t, ndim=2, cast=True],
+    labels: np.ndarray,  # const intp_t[:]
+    max_bin: int,
+    axis: int,
+) -> np.ndarray: ...  # np.ndarray[np.int64, ndim=2]
+def get_level_sorter(
+    label: np.ndarray,  # const int64_t[:]
+    starts: np.ndarray,  # const intp_t[:]
+) -> np.ndarray: ...  #  np.ndarray[np.intp, ndim=1]
+def generate_bins_dt64(
+    values: npt.NDArray[np.int64],
+    binner: np.ndarray,  # const int64_t[:]
+    closed: object = ...,
+    hasnans: bool = ...,
+) -> np.ndarray: ...  # np.ndarray[np.int64, ndim=1]
+def array_equivalent_object(
+    left: np.ndarray,  # object[:]
+    right: np.ndarray,  # object[:]
+) -> bool: ...
+def has_infs(arr: np.ndarray) -> bool: ...  # const floating[:]
+def get_reverse_indexer(
+    indexer: np.ndarray,  # const intp_t[:]
+    length: int,
+) -> npt.NDArray[np.intp]: ...
+def is_bool_list(obj: list) -> bool: ...
+def dtypes_all_equal(types: list[DtypeObj]) -> bool: ...

.venv/Lib/site-packages/pandas/_libs/missing.pxd

@@ -0,0 +1,19 @@
+from numpy cimport (
+    ndarray,
+    uint8_t,
+)
+
+
+cpdef bint is_matching_na(object left, object right, bint nan_matches_none=*)
+
+cpdef bint checknull(object val, bint inf_as_na=*)
+cpdef ndarray[uint8_t] isnaobj(ndarray arr, bint inf_as_na=*)
+
+cdef bint is_null_datetime64(v)
+cdef bint is_null_timedelta64(v)
+cdef bint checknull_with_nat_and_na(object obj)
+
+cdef class C_NAType:
+    pass
+
+cdef C_NAType C_NA

.venv/Lib/site-packages/pandas/_libs/missing.pyi

@@ -0,0 +1,17 @@
+import numpy as np
+from numpy import typing as npt
+
+class NAType: ...
+
+NA: NAType
+
+def is_matching_na(
+    left: object, right: object, nan_matches_none: bool = ...
+) -> bool: ...
+def isposinf_scalar(val: object) -> bool: ...
+def isneginf_scalar(val: object) -> bool: ...
+def checknull(val: object, inf_as_na: bool = ...) -> bool: ...
+def isnaobj(arr: np.ndarray, inf_as_na: bool = ...) -> npt.NDArray[np.bool_]: ...
+def isnaobj2d(arr: np.ndarray, inf_as_na: bool = ...) -> npt.NDArray[np.bool_]: ...
+def is_numeric_na(values: np.ndarray) -> npt.NDArray[np.bool_]: ...
+def is_float_nan(values: np.ndarray) -> npt.NDArray[np.bool_]: ...

.venv/Lib/site-packages/pandas/_libs/missing.pyx

@@ -0,0 +1,507 @@
+from decimal import Decimal
+import numbers
+from sys import maxsize
+
+import cython
+from cython import Py_ssize_t
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    float64_t,
+    int64_t,
+    ndarray,
+    uint8_t,
+)
+
+cnp.import_array()
+
+from pandas._libs cimport util
+from pandas._libs.tslibs.nattype cimport (
+    c_NaT as NaT,
+    checknull_with_nat,
+    is_dt64nat,
+    is_td64nat,
+)
+from pandas._libs.tslibs.np_datetime cimport (
+    get_datetime64_unit,
+    get_datetime64_value,
+    get_timedelta64_value,
+)
+
+from pandas._libs.ops_dispatch import maybe_dispatch_ufunc_to_dunder_op
+
+cdef:
+    float64_t INF = <float64_t>np.inf
+    float64_t NEGINF = -INF
+
+    int64_t NPY_NAT = util.get_nat()
+
+    bint is_32bit = maxsize <= 2 ** 32
+
+    type cDecimal = Decimal  # for faster isinstance checks
+
+
+cpdef bint is_matching_na(object left, object right, bint nan_matches_none=False):
+    """
+    Check if two scalars are both NA of matching types.
+
+    Parameters
+    ----------
+    left : Any
+    right : Any
+    nan_matches_none : bool, default False
+        For backwards compatibility, consider NaN as matching None.
+
+    Returns
+    -------
+    bool
+    """
+    if left is None:
+        if nan_matches_none and util.is_nan(right):
+            return True
+        return right is None
+    elif left is C_NA:
+        return right is C_NA
+    elif left is NaT:
+        return right is NaT
+    elif util.is_float_object(left):
+        if nan_matches_none and right is None and util.is_nan(left):
+            return True
+        return (
+            util.is_nan(left)
+            and util.is_float_object(right)
+            and util.is_nan(right)
+        )
+    elif util.is_complex_object(left):
+        return (
+            util.is_nan(left)
+            and util.is_complex_object(right)
+            and util.is_nan(right)
+        )
+    elif util.is_datetime64_object(left):
+        return (
+            get_datetime64_value(left) == NPY_NAT
+            and util.is_datetime64_object(right)
+            and get_datetime64_value(right) == NPY_NAT
+            and get_datetime64_unit(left) == get_datetime64_unit(right)
+        )
+    elif util.is_timedelta64_object(left):
+        return (
+            get_timedelta64_value(left) == NPY_NAT
+            and util.is_timedelta64_object(right)
+            and get_timedelta64_value(right) == NPY_NAT
+            and get_datetime64_unit(left) == get_datetime64_unit(right)
+        )
+    elif is_decimal_na(left):
+        return is_decimal_na(right)
+    return False
+
+
+cpdef bint checknull(object val, bint inf_as_na=False):
+    """
+    Return boolean describing of the input is NA-like, defined here as any
+    of:
+     - None
+     - nan
+     - NaT
+     - np.datetime64 representation of NaT
+     - np.timedelta64 representation of NaT
+     - NA
+     - Decimal("NaN")
+
+    Parameters
+    ----------
+    val : object
+    inf_as_na : bool, default False
+        Whether to treat INF and -INF as NA values.
+
+    Returns
+    -------
+    bool
+    """
+    if val is None or val is NaT or val is C_NA:
+        return True
+    elif util.is_float_object(val) or util.is_complex_object(val):
+        if val != val:
+            return True
+        elif inf_as_na:
+            return val == INF or val == NEGINF
+        return False
+    elif util.is_timedelta64_object(val):
+        return get_timedelta64_value(val) == NPY_NAT
+    elif util.is_datetime64_object(val):
+        return get_datetime64_value(val) == NPY_NAT
+    else:
+        return is_decimal_na(val)
+
+
+cdef inline bint is_decimal_na(object val):
+    """
+    Is this a decimal.Decimal object Decimal("NAN").
+    """
+    return isinstance(val, cDecimal) and val != val
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+cpdef ndarray[uint8_t] isnaobj(ndarray arr, bint inf_as_na=False):
+    """
+    Return boolean mask denoting which elements of a 1-D array are na-like,
+    according to the criteria defined in `checknull`:
+     - None
+     - nan
+     - NaT
+     - np.datetime64 representation of NaT
+     - np.timedelta64 representation of NaT
+     - NA
+     - Decimal("NaN")
+
+    Parameters
+    ----------
+    arr : ndarray
+
+    Returns
+    -------
+    result : ndarray (dtype=np.bool_)
+    """
+    cdef:
+        Py_ssize_t i, n
+        object val
+        ndarray[uint8_t] result
+
+    assert arr.ndim == 1, "'arr' must be 1-D."
+
+    n = len(arr)
+    result = np.empty(n, dtype=np.uint8)
+    for i in range(n):
+        val = arr[i]
+        result[i] = checknull(val, inf_as_na=inf_as_na)
+    return result.view(np.bool_)
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def isnaobj2d(arr: ndarray, inf_as_na: bool = False) -> ndarray:
+    """
+    Return boolean mask denoting which elements of a 2-D array are na-like,
+    according to the criteria defined in `checknull`:
+     - None
+     - nan
+     - NaT
+     - np.datetime64 representation of NaT
+     - np.timedelta64 representation of NaT
+     - NA
+     - Decimal("NaN")
+
+    Parameters
+    ----------
+    arr : ndarray
+
+    Returns
+    -------
+    result : ndarray (dtype=np.bool_)
+    """
+    cdef:
+        Py_ssize_t i, j, n, m
+        object val
+        ndarray[uint8_t, ndim=2] result
+
+    assert arr.ndim == 2, "'arr' must be 2-D."
+
+    n, m = (<object>arr).shape
+    result = np.zeros((n, m), dtype=np.uint8)
+    for i in range(n):
+        for j in range(m):
+            val = arr[i, j]
+            if checknull(val, inf_as_na=inf_as_na):
+                result[i, j] = 1
+    return result.view(np.bool_)
+
+
+def isposinf_scalar(val: object) -> bool:
+    return util.is_float_object(val) and val == INF
+
+
+def isneginf_scalar(val: object) -> bool:
+    return util.is_float_object(val) and val == NEGINF
+
+
+cdef inline bint is_null_datetime64(v):
+    # determine if we have a null for a datetime (or integer versions),
+    # excluding np.timedelta64('nat')
+    if checknull_with_nat(v) or is_dt64nat(v):
+        return True
+    return False
+
+
+cdef inline bint is_null_timedelta64(v):
+    # determine if we have a null for a timedelta (or integer versions),
+    # excluding np.datetime64('nat')
+    if checknull_with_nat(v) or is_td64nat(v):
+        return True
+    return False
+
+
+cdef bint checknull_with_nat_and_na(object obj):
+    # See GH#32214
+    return checknull_with_nat(obj) or obj is C_NA
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def is_float_nan(values: ndarray) -> ndarray:
+    """
+    True for elements which correspond to a float nan
+
+    Returns
+    -------
+    ndarray[bool]
+    """
+    cdef:
+        ndarray[uint8_t] result
+        Py_ssize_t i, N
+        object val
+
+    N = len(values)
+    result = np.zeros(N, dtype=np.uint8)
+
+    for i in range(N):
+        val = values[i]
+        if util.is_nan(val):
+            result[i] = True
+    return result.view(bool)
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def is_numeric_na(values: ndarray) -> ndarray:
+    """
+    Check for NA values consistent with IntegerArray/FloatingArray.
+
+    Similar to a vectorized is_valid_na_for_dtype restricted to numeric dtypes.
+
+    Returns
+    -------
+    ndarray[bool]
+    """
+    cdef:
+        ndarray[uint8_t] result
+        Py_ssize_t i, N
+        object val
+
+    N = len(values)
+    result = np.zeros(N, dtype=np.uint8)
+
+    for i in range(N):
+        val = values[i]
+        if checknull(val):
+            if val is None or val is C_NA or util.is_nan(val) or is_decimal_na(val):
+                result[i] = True
+            else:
+                raise TypeError(f"'values' contains non-numeric NA {val}")
+    return result.view(bool)
+
+
+# -----------------------------------------------------------------------------
+# Implementation of NA singleton
+
+
+def _create_binary_propagating_op(name, is_divmod=False):
+
+    def method(self, other):
+        if (other is C_NA or isinstance(other, str)
+                or isinstance(other, (numbers.Number, np.bool_))
+                or isinstance(other, np.ndarray) and not other.shape):
+            # Need the other.shape clause to handle NumPy scalars,
+            # since we do a setitem on `out` below, which
+            # won't work for NumPy scalars.
+            if is_divmod:
+                return NA, NA
+            else:
+                return NA
+
+        elif isinstance(other, np.ndarray):
+            out = np.empty(other.shape, dtype=object)
+            out[:] = NA
+
+            if is_divmod:
+                return out, out.copy()
+            else:
+                return out
+
+        return NotImplemented
+
+    method.__name__ = name
+    return method
+
+
+def _create_unary_propagating_op(name: str):
+    def method(self):
+        return NA
+
+    method.__name__ = name
+    return method
+
+
+cdef class C_NAType:
+    pass
+
+
+class NAType(C_NAType):
+    """
+    NA ("not available") missing value indicator.
+
+    .. warning::
+
+       Experimental: the behaviour of NA can still change without warning.
+
+    .. versionadded:: 1.0.0
+
+    The NA singleton is a missing value indicator defined by pandas. It is
+    used in certain new extension dtypes (currently the "string" dtype).
+    """
+
+    _instance = None
+
+    def __new__(cls, *args, **kwargs):
+        if NAType._instance is None:
+            NAType._instance = C_NAType.__new__(cls, *args, **kwargs)
+        return NAType._instance
+
+    def __repr__(self) -> str:
+        return "<NA>"
+
+    def __format__(self, format_spec) -> str:
+        try:
+            return self.__repr__().__format__(format_spec)
+        except ValueError:
+            return self.__repr__()
+
+    def __bool__(self):
+        raise TypeError("boolean value of NA is ambiguous")
+
+    def __hash__(self):
+        # GH 30013: Ensure hash is large enough to avoid hash collisions with integers
+        exponent = 31 if is_32bit else 61
+        return 2 ** exponent - 1
+
+    def __reduce__(self):
+        return "NA"
+
+    # Binary arithmetic and comparison ops -> propagate
+
+    __add__ = _create_binary_propagating_op("__add__")
+    __radd__ = _create_binary_propagating_op("__radd__")
+    __sub__ = _create_binary_propagating_op("__sub__")
+    __rsub__ = _create_binary_propagating_op("__rsub__")
+    __mul__ = _create_binary_propagating_op("__mul__")
+    __rmul__ = _create_binary_propagating_op("__rmul__")
+    __matmul__ = _create_binary_propagating_op("__matmul__")
+    __rmatmul__ = _create_binary_propagating_op("__rmatmul__")
+    __truediv__ = _create_binary_propagating_op("__truediv__")
+    __rtruediv__ = _create_binary_propagating_op("__rtruediv__")
+    __floordiv__ = _create_binary_propagating_op("__floordiv__")
+    __rfloordiv__ = _create_binary_propagating_op("__rfloordiv__")
+    __mod__ = _create_binary_propagating_op("__mod__")
+    __rmod__ = _create_binary_propagating_op("__rmod__")
+    __divmod__ = _create_binary_propagating_op("__divmod__", is_divmod=True)
+    __rdivmod__ = _create_binary_propagating_op("__rdivmod__", is_divmod=True)
+    # __lshift__ and __rshift__ are not implemented
+
+    __eq__ = _create_binary_propagating_op("__eq__")
+    __ne__ = _create_binary_propagating_op("__ne__")
+    __le__ = _create_binary_propagating_op("__le__")
+    __lt__ = _create_binary_propagating_op("__lt__")
+    __gt__ = _create_binary_propagating_op("__gt__")
+    __ge__ = _create_binary_propagating_op("__ge__")
+
+    # Unary ops
+
+    __neg__ = _create_unary_propagating_op("__neg__")
+    __pos__ = _create_unary_propagating_op("__pos__")
+    __abs__ = _create_unary_propagating_op("__abs__")
+    __invert__ = _create_unary_propagating_op("__invert__")
+
+    # pow has special
+    def __pow__(self, other):
+        if other is C_NA:
+            return NA
+        elif isinstance(other, (numbers.Number, np.bool_)):
+            if other == 0:
+                # returning positive is correct for +/- 0.
+                return type(other)(1)
+            else:
+                return NA
+        elif isinstance(other, np.ndarray):
+            return np.where(other == 0, other.dtype.type(1), NA)
+
+        return NotImplemented
+
+    def __rpow__(self, other):
+        if other is C_NA:
+            return NA
+        elif isinstance(other, (numbers.Number, np.bool_)):
+            if other == 1:
+                return other
+            else:
+                return NA
+        elif isinstance(other, np.ndarray):
+            return np.where(other == 1, other, NA)
+        return NotImplemented
+
+    # Logical ops using Kleene logic
+
+    def __and__(self, other):
+        if other is False:
+            return False
+        elif other is True or other is C_NA:
+            return NA
+        return NotImplemented
+
+    __rand__ = __and__
+
+    def __or__(self, other):
+        if other is True:
+            return True
+        elif other is False or other is C_NA:
+            return NA
+        return NotImplemented
+
+    __ror__ = __or__
+
+    def __xor__(self, other):
+        if other is False or other is True or other is C_NA:
+            return NA
+        return NotImplemented
+
+    __rxor__ = __xor__
+
+    __array_priority__ = 1000
+    _HANDLED_TYPES = (np.ndarray, numbers.Number, str, np.bool_)
+
+    def __array_ufunc__(self, ufunc, method, *inputs, **kwargs):
+        types = self._HANDLED_TYPES + (NAType,)
+        for x in inputs:
+            if not isinstance(x, types):
+                return NotImplemented
+
+        if method != "__call__":
+            raise ValueError(f"ufunc method '{method}' not supported for NA")
+        result = maybe_dispatch_ufunc_to_dunder_op(
+            self, ufunc, method, *inputs, **kwargs
+        )
+        if result is NotImplemented:
+            # For a NumPy ufunc that's not a binop, like np.logaddexp
+            index = [i for i, x in enumerate(inputs) if x is NA][0]
+            result = np.broadcast_arrays(*inputs)[index]
+            if result.ndim == 0:
+                result = result.item()
+            if ufunc.nout > 1:
+                result = (NA,) * ufunc.nout
+
+        return result
+
+
+C_NA = NAType()   # C-visible
+NA = C_NA         # Python-visible

.venv/Lib/site-packages/pandas/_libs/ops.pyi

@@ -0,0 +1,50 @@
+from typing import (
+    Any,
+    Callable,
+    Iterable,
+    Literal,
+    overload,
+)
+
+import numpy as np
+
+from pandas._typing import npt
+
+_BinOp = Callable[[Any, Any], Any]
+_BoolOp = Callable[[Any, Any], bool]
+
+def scalar_compare(
+    values: np.ndarray,  # object[:]
+    val: object,
+    op: _BoolOp,  # {operator.eq, operator.ne, ...}
+) -> npt.NDArray[np.bool_]: ...
+def vec_compare(
+    left: npt.NDArray[np.object_],
+    right: npt.NDArray[np.object_],
+    op: _BoolOp,  # {operator.eq, operator.ne, ...}
+) -> npt.NDArray[np.bool_]: ...
+def scalar_binop(
+    values: np.ndarray,  # object[:]
+    val: object,
+    op: _BinOp,  # binary operator
+) -> np.ndarray: ...
+def vec_binop(
+    left: np.ndarray,  # object[:]
+    right: np.ndarray,  # object[:]
+    op: _BinOp,  # binary operator
+) -> np.ndarray: ...
+@overload
+def maybe_convert_bool(
+    arr: npt.NDArray[np.object_],
+    true_values: Iterable = ...,
+    false_values: Iterable = ...,
+    convert_to_masked_nullable: Literal[False] = ...,
+) -> tuple[np.ndarray, None]: ...
+@overload
+def maybe_convert_bool(
+    arr: npt.NDArray[np.object_],
+    true_values: Iterable = ...,
+    false_values: Iterable = ...,
+    *,
+    convert_to_masked_nullable: Literal[True],
+) -> tuple[np.ndarray, np.ndarray]: ...

.venv/Lib/site-packages/pandas/_libs/ops.pyx

@@ -0,0 +1,310 @@
+import operator
+
+from cpython.object cimport (
+    Py_EQ,
+    Py_GE,
+    Py_GT,
+    Py_LE,
+    Py_LT,
+    Py_NE,
+    PyObject_RichCompareBool,
+)
+
+import cython
+from cython import Py_ssize_t
+import numpy as np
+
+from numpy cimport (
+    import_array,
+    ndarray,
+    uint8_t,
+)
+
+import_array()
+
+
+from pandas._libs.missing cimport checknull
+from pandas._libs.util cimport is_nan
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def scalar_compare(object[:] values, object val, object op) -> ndarray:
+    """
+    Compare each element of `values` array with the scalar `val`, with
+    the comparison operation described by `op`.
+
+    Parameters
+    ----------
+    values : ndarray[object]
+    val : object
+    op : {operator.eq, operator.ne,
+          operator.le, operator.lt,
+          operator.ge, operator.gt}
+
+    Returns
+    -------
+    result : ndarray[bool]
+    """
+    cdef:
+        Py_ssize_t i, n = len(values)
+        ndarray[uint8_t, cast=True] result
+        bint isnull_val
+        int flag
+        object x
+
+    if op is operator.lt:
+        flag = Py_LT
+    elif op is operator.le:
+        flag = Py_LE
+    elif op is operator.gt:
+        flag = Py_GT
+    elif op is operator.ge:
+        flag = Py_GE
+    elif op is operator.eq:
+        flag = Py_EQ
+    elif op is operator.ne:
+        flag = Py_NE
+    else:
+        raise ValueError('Unrecognized operator')
+
+    result = np.empty(n, dtype=bool).view(np.uint8)
+    isnull_val = checknull(val)
+
+    if flag == Py_NE:
+        for i in range(n):
+            x = values[i]
+            if checknull(x):
+                result[i] = True
+            elif isnull_val:
+                result[i] = True
+            else:
+                try:
+                    result[i] = PyObject_RichCompareBool(x, val, flag)
+                except TypeError:
+                    result[i] = True
+    elif flag == Py_EQ:
+        for i in range(n):
+            x = values[i]
+            if checknull(x):
+                result[i] = False
+            elif isnull_val:
+                result[i] = False
+            else:
+                try:
+                    result[i] = PyObject_RichCompareBool(x, val, flag)
+                except TypeError:
+                    result[i] = False
+
+    else:
+        for i in range(n):
+            x = values[i]
+            if checknull(x):
+                result[i] = False
+            elif isnull_val:
+                result[i] = False
+            else:
+                result[i] = PyObject_RichCompareBool(x, val, flag)
+
+    return result.view(bool)
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def vec_compare(ndarray[object] left, ndarray[object] right, object op) -> ndarray:
+    """
+    Compare the elements of `left` with the elements of `right` pointwise,
+    with the comparison operation described by `op`.
+
+    Parameters
+    ----------
+    left : ndarray[object]
+    right : ndarray[object]
+    op : {operator.eq, operator.ne,
+          operator.le, operator.lt,
+          operator.ge, operator.gt}
+
+    Returns
+    -------
+    result : ndarray[bool]
+    """
+    cdef:
+        Py_ssize_t i, n = len(left)
+        ndarray[uint8_t, cast=True] result
+        int flag
+
+    if n != <Py_ssize_t>len(right):
+        raise ValueError(f'Arrays were different lengths: {n} vs {len(right)}')
+
+    if op is operator.lt:
+        flag = Py_LT
+    elif op is operator.le:
+        flag = Py_LE
+    elif op is operator.gt:
+        flag = Py_GT
+    elif op is operator.ge:
+        flag = Py_GE
+    elif op is operator.eq:
+        flag = Py_EQ
+    elif op is operator.ne:
+        flag = Py_NE
+    else:
+        raise ValueError('Unrecognized operator')
+
+    result = np.empty(n, dtype=bool).view(np.uint8)
+
+    if flag == Py_NE:
+        for i in range(n):
+            x = left[i]
+            y = right[i]
+
+            if checknull(x) or checknull(y):
+                result[i] = True
+            else:
+                result[i] = PyObject_RichCompareBool(x, y, flag)
+    else:
+        for i in range(n):
+            x = left[i]
+            y = right[i]
+
+            if checknull(x) or checknull(y):
+                result[i] = False
+            else:
+                result[i] = PyObject_RichCompareBool(x, y, flag)
+
+    return result.view(bool)
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def scalar_binop(object[:] values, object val, object op) -> ndarray:
+    """
+    Apply the given binary operator `op` between each element of the array
+    `values` and the scalar `val`.
+
+    Parameters
+    ----------
+    values : ndarray[object]
+    val : object
+    op : binary operator
+
+    Returns
+    -------
+    result : ndarray[object]
+    """
+    cdef:
+        Py_ssize_t i, n = len(values)
+        object[:] result
+        object x
+
+    result = np.empty(n, dtype=object)
+    if val is None or is_nan(val):
+        result[:] = val
+        return result.base  # `.base` to access underlying np.ndarray
+
+    for i in range(n):
+        x = values[i]
+        if x is None or is_nan(x):
+            result[i] = x
+        else:
+            result[i] = op(x, val)
+
+    return maybe_convert_bool(result.base)[0]
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def vec_binop(object[:] left, object[:] right, object op) -> ndarray:
+    """
+    Apply the given binary operator `op` pointwise to the elements of
+    arrays `left` and `right`.
+
+    Parameters
+    ----------
+    left : ndarray[object]
+    right : ndarray[object]
+    op : binary operator
+
+    Returns
+    -------
+    result : ndarray[object]
+    """
+    cdef:
+        Py_ssize_t i, n = len(left)
+        object[:] result
+
+    if n != <Py_ssize_t>len(right):
+        raise ValueError(f'Arrays were different lengths: {n} vs {len(right)}')
+
+    result = np.empty(n, dtype=object)
+
+    for i in range(n):
+        x = left[i]
+        y = right[i]
+        try:
+            result[i] = op(x, y)
+        except TypeError:
+            if x is None or is_nan(x):
+                result[i] = x
+            elif y is None or is_nan(y):
+                result[i] = y
+            else:
+                raise
+
+    return maybe_convert_bool(result.base)[0]  # `.base` to access np.ndarray
+
+
+def maybe_convert_bool(ndarray[object] arr,
+                       true_values=None,
+                       false_values=None,
+                       convert_to_masked_nullable=False
+                       ) -> tuple[np.ndarray, np.ndarray | None]:
+    cdef:
+        Py_ssize_t i, n
+        ndarray[uint8_t] result
+        ndarray[uint8_t] mask
+        object val
+        set true_vals, false_vals
+        bint has_na = False
+
+    n = len(arr)
+    result = np.empty(n, dtype=np.uint8)
+    mask = np.zeros(n, dtype=np.uint8)
+    # the defaults
+    true_vals = {'True', 'TRUE', 'true'}
+    false_vals = {'False', 'FALSE', 'false'}
+
+    if true_values is not None:
+        true_vals = true_vals | set(true_values)
+
+    if false_values is not None:
+        false_vals = false_vals | set(false_values)
+
+    for i in range(n):
+        val = arr[i]
+
+        if isinstance(val, bool):
+            if val is True:
+                result[i] = 1
+            else:
+                result[i] = 0
+        elif val in true_vals:
+            result[i] = 1
+        elif val in false_vals:
+            result[i] = 0
+        elif is_nan(val):
+            mask[i] = 1
+            result[i] = 0  # Value here doesn't matter, will be replaced w/ nan
+            has_na = True
+        else:
+            return (arr, None)
+
+    if has_na:
+        if convert_to_masked_nullable:
+            return (result.view(np.bool_), mask.view(np.bool_))
+        else:
+            arr = result.view(np.bool_).astype(object)
+            np.putmask(arr, mask, np.nan)
+            return (arr, None)
+    else:
+        return (result.view(np.bool_), None)

.venv/Lib/site-packages/pandas/_libs/ops_dispatch.pyi

@@ -0,0 +1,5 @@
+import numpy as np
+
+def maybe_dispatch_ufunc_to_dunder_op(
+    self, ufunc: np.ufunc, method: str, *inputs, **kwargs
+): ...

.venv/Lib/site-packages/pandas/_libs/ops_dispatch.pyx

@@ -0,0 +1,121 @@
+DISPATCHED_UFUNCS = {
+    "add",
+    "sub",
+    "mul",
+    "pow",
+    "mod",
+    "floordiv",
+    "truediv",
+    "divmod",
+    "eq",
+    "ne",
+    "lt",
+    "gt",
+    "le",
+    "ge",
+    "remainder",
+    "matmul",
+    "or",
+    "xor",
+    "and",
+    "neg",
+    "pos",
+    "abs",
+}
+UNARY_UFUNCS = {
+    "neg",
+    "pos",
+    "abs",
+}
+UFUNC_ALIASES = {
+    "subtract": "sub",
+    "multiply": "mul",
+    "floor_divide": "floordiv",
+    "true_divide": "truediv",
+    "power": "pow",
+    "remainder": "mod",
+    "divide": "truediv",
+    "equal": "eq",
+    "not_equal": "ne",
+    "less": "lt",
+    "less_equal": "le",
+    "greater": "gt",
+    "greater_equal": "ge",
+    "bitwise_or": "or",
+    "bitwise_and": "and",
+    "bitwise_xor": "xor",
+    "negative": "neg",
+    "absolute": "abs",
+    "positive": "pos",
+}
+
+# For op(., Array) -> Array.__r{op}__
+REVERSED_NAMES = {
+    "lt": "__gt__",
+    "le": "__ge__",
+    "gt": "__lt__",
+    "ge": "__le__",
+    "eq": "__eq__",
+    "ne": "__ne__",
+}
+
+
+def maybe_dispatch_ufunc_to_dunder_op(
+    object self, object ufunc, str method, *inputs, **kwargs
+):
+    """
+    Dispatch a ufunc to the equivalent dunder method.
+
+    Parameters
+    ----------
+    self : ArrayLike
+        The array whose dunder method we dispatch to
+    ufunc : Callable
+        A NumPy ufunc
+    method : {'reduce', 'accumulate', 'reduceat', 'outer', 'at', '__call__'}
+    inputs : ArrayLike
+        The input arrays.
+    kwargs : Any
+        The additional keyword arguments, e.g. ``out``.
+
+    Returns
+    -------
+    result : Any
+        The result of applying the ufunc
+    """
+    # special has the ufuncs we dispatch to the dunder op on
+
+    op_name = ufunc.__name__
+    op_name = UFUNC_ALIASES.get(op_name, op_name)
+
+    def not_implemented(*args, **kwargs):
+        return NotImplemented
+
+    if kwargs or ufunc.nin > 2:
+        return NotImplemented
+
+    if method == "__call__" and op_name in DISPATCHED_UFUNCS:
+
+        if inputs[0] is self:
+            name = f"__{op_name}__"
+            meth = getattr(self, name, not_implemented)
+
+            if op_name in UNARY_UFUNCS:
+                assert len(inputs) == 1
+                return meth()
+
+            return meth(inputs[1])
+
+        elif inputs[1] is self:
+            name = REVERSED_NAMES.get(op_name, f"__r{op_name}__")
+
+            meth = getattr(self, name, not_implemented)
+            result = meth(inputs[0])
+            return result
+
+        else:
+            # should not be reached, but covering our bases
+            return NotImplemented
+
+    else:
+        return NotImplemented

.venv/Lib/site-packages/pandas/_libs/parsers.pyi

@@ -0,0 +1,71 @@
+from typing import (
+    Hashable,
+    Literal,
+)
+
+import numpy as np
+
+from pandas._typing import (
+    ArrayLike,
+    Dtype,
+    npt,
+)
+
+STR_NA_VALUES: set[str]
+
+def sanitize_objects(
+    values: npt.NDArray[np.object_],
+    na_values: set,
+) -> int: ...
+
+class TextReader:
+    unnamed_cols: set[str]
+    table_width: int  # int64_t
+    leading_cols: int  # int64_t
+    header: list[list[int]]  # non-negative integers
+    def __init__(
+        self,
+        source,
+        delimiter: bytes | str = ...,  # single-character only
+        header=...,
+        header_start: int = ...,  # int64_t
+        header_end: int = ...,  # uint64_t
+        index_col=...,
+        names=...,
+        tokenize_chunksize: int = ...,  # int64_t
+        delim_whitespace: bool = ...,
+        converters=...,
+        skipinitialspace: bool = ...,
+        escapechar: bytes | str | None = ...,  # single-character only
+        doublequote: bool = ...,
+        quotechar: str | bytes | None = ...,  # at most 1 character
+        quoting: int = ...,
+        lineterminator: bytes | str | None = ...,  # at most 1 character
+        comment=...,
+        decimal: bytes | str = ...,  # single-character only
+        thousands: bytes | str | None = ...,  # single-character only
+        dtype: Dtype | dict[Hashable, Dtype] = ...,
+        usecols=...,
+        error_bad_lines: bool = ...,
+        warn_bad_lines: bool = ...,
+        na_filter: bool = ...,
+        na_values=...,
+        na_fvalues=...,
+        keep_default_na: bool = ...,
+        true_values=...,
+        false_values=...,
+        allow_leading_cols: bool = ...,
+        skiprows=...,
+        skipfooter: int = ...,  # int64_t
+        verbose: bool = ...,
+        mangle_dupe_cols: bool = ...,
+        float_precision: Literal["round_trip", "legacy", "high"] | None = ...,
+        skip_blank_lines: bool = ...,
+        encoding_errors: bytes | str = ...,
+    ): ...
+    def set_error_bad_lines(self, status: int) -> None: ...
+    def set_noconvert(self, i: int) -> None: ...
+    def remove_noconvert(self, i: int) -> None: ...
+    def close(self) -> None: ...
+    def read(self, rows: int | None = ...) -> dict[int, ArrayLike]: ...
+    def read_low_memory(self, rows: int | None) -> list[dict[int, ArrayLike]]: ...

.venv/Lib/site-packages/pandas/_libs/properties.pyi

@@ -0,0 +1,9 @@
+# pyright: reportIncompleteStub = false
+from typing import Any
+
+# note: this is a lie to make type checkers happy (they special
+# case property). cache_readonly uses attribute names similar to
+# property (fget) but it does not provide fset and fdel.
+cache_readonly = property
+
+def __getattr__(name: str) -> Any: ...  # incomplete

.venv/Lib/site-packages/pandas/_libs/properties.pyx

@@ -0,0 +1,70 @@
+from cython import Py_ssize_t
+
+from cpython.dict cimport (
+    PyDict_Contains,
+    PyDict_GetItem,
+    PyDict_SetItem,
+)
+
+
+cdef class CachedProperty:
+
+    cdef readonly:
+        object fget, name, __doc__
+
+    def __init__(self, fget):
+        self.fget = fget
+        self.name = fget.__name__
+        self.__doc__ = getattr(fget, '__doc__', None)
+
+    def __get__(self, obj, typ):
+        if obj is None:
+            # accessed on the class, not the instance
+            return self
+
+        # Get the cache or set a default one if needed
+        cache = getattr(obj, '_cache', None)
+        if cache is None:
+            try:
+                cache = obj._cache = {}
+            except (AttributeError):
+                return self
+
+        if PyDict_Contains(cache, self.name):
+            # not necessary to Py_INCREF
+            val = <object>PyDict_GetItem(cache, self.name)
+        else:
+            val = self.fget(obj)
+            PyDict_SetItem(cache, self.name, val)
+        return val
+
+    def __set__(self, obj, value):
+        raise AttributeError("Can't set attribute")
+
+
+cache_readonly = CachedProperty
+
+
+cdef class AxisProperty:
+
+    cdef readonly:
+        Py_ssize_t axis
+        object __doc__
+
+    def __init__(self, axis=0, doc=""):
+        self.axis = axis
+        self.__doc__ = doc
+
+    def __get__(self, obj, type):
+        cdef:
+            list axes
+
+        if obj is None:
+            # Only instances have _mgr, not classes
+            return self
+        else:
+            axes = obj._mgr.axes
+        return axes[self.axis]
+
+    def __set__(self, obj, value):
+        obj._set_axis(self.axis, value)

.venv/Lib/site-packages/pandas/_libs/reduction.pyx

@@ -0,0 +1,33 @@
+import numpy as np
+
+cimport numpy as cnp
+
+cnp.import_array()
+
+from pandas._libs.util cimport is_array
+
+
+cdef cnp.dtype _dtype_obj = np.dtype("object")
+
+
+cpdef check_result_array(object obj, object dtype):
+    # Our operation is supposed to be an aggregation/reduction. If
+    #  it returns an ndarray, this likely means an invalid operation has
+    #  been passed. See test_apply_without_aggregation, test_agg_must_agg
+    if is_array(obj):
+        if dtype != _dtype_obj:
+            # If it is object dtype, the function can be a reduction/aggregation
+            #  and still return an ndarray e.g. test_agg_over_numpy_arrays
+            raise ValueError("Must produce aggregated value")
+
+
+cpdef inline extract_result(object res):
+    """ extract the result object, it might be a 0-dim ndarray
+        or a len-1 0-dim, or a scalar """
+    if hasattr(res, "_values"):
+        # Preserve EA
+        res = res._values
+        if res.ndim == 1 and len(res) == 1:
+            # see test_agg_lambda_with_timezone, test_resampler_grouper.py::test_apply
+            res = res[0]
+    return res

.venv/Lib/site-packages/pandas/_libs/reshape.pyi

@@ -0,0 +1,16 @@
+import numpy as np
+
+from pandas._typing import npt
+
+def unstack(
+    values: np.ndarray,  # reshape_t[:, :]
+    mask: np.ndarray,  # const uint8_t[:]
+    stride: int,
+    length: int,
+    width: int,
+    new_values: np.ndarray,  # reshape_t[:, :]
+    new_mask: np.ndarray,  # uint8_t[:, :]
+) -> None: ...
+def explode(
+    values: npt.NDArray[np.object_],
+) -> tuple[npt.NDArray[np.object_], npt.NDArray[np.int64]]: ...

.venv/Lib/site-packages/pandas/_libs/reshape.pyx

@@ -0,0 +1,139 @@
+import cython
+from cython import Py_ssize_t
+
+from numpy cimport (
+    int64_t,
+    ndarray,
+    uint8_t,
+)
+
+import numpy as np
+
+cimport numpy as cnp
+
+cnp.import_array()
+
+from pandas._libs.dtypes cimport numeric_object_t
+from pandas._libs.lib cimport c_is_list_like
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def unstack(numeric_object_t[:, :] values, const uint8_t[:] mask,
+            Py_ssize_t stride, Py_ssize_t length, Py_ssize_t width,
+            numeric_object_t[:, :] new_values, uint8_t[:, :] new_mask) -> None:
+    """
+    Transform long values to wide new_values.
+
+    Parameters
+    ----------
+    values : typed ndarray
+    mask : np.ndarray[bool]
+    stride : int
+    length : int
+    width : int
+    new_values : np.ndarray[bool]
+        result array
+    new_mask : np.ndarray[bool]
+        result mask
+    """
+    cdef:
+        Py_ssize_t i, j, w, nulls, s, offset
+
+    if numeric_object_t is not object:
+        # evaluated at compile-time
+        with nogil:
+            for i in range(stride):
+
+                nulls = 0
+                for j in range(length):
+
+                    for w in range(width):
+
+                        offset = j * width + w
+
+                        if mask[offset]:
+                            s = i * width + w
+                            new_values[j, s] = values[offset - nulls, i]
+                            new_mask[j, s] = 1
+                        else:
+                            nulls += 1
+
+    else:
+        # object-dtype, identical to above but we cannot use nogil
+        for i in range(stride):
+
+            nulls = 0
+            for j in range(length):
+
+                for w in range(width):
+
+                    offset = j * width + w
+
+                    if mask[offset]:
+                        s = i * width + w
+                        new_values[j, s] = values[offset - nulls, i]
+                        new_mask[j, s] = 1
+                    else:
+                        nulls += 1
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+def explode(ndarray[object] values):
+    """
+    transform array list-likes to long form
+    preserve non-list entries
+
+    Parameters
+    ----------
+    values : ndarray[object]
+
+    Returns
+    -------
+    ndarray[object]
+        result
+    ndarray[int64_t]
+        counts
+    """
+    cdef:
+        Py_ssize_t i, j, count, n
+        object v
+        ndarray[object] result
+        ndarray[int64_t] counts
+
+    # find the resulting len
+    n = len(values)
+    counts = np.zeros(n, dtype='int64')
+    for i in range(n):
+        v = values[i]
+
+        if c_is_list_like(v, True):
+            if len(v):
+                counts[i] += len(v)
+            else:
+                # empty list-like, use a nan marker
+                counts[i] += 1
+        else:
+            counts[i] += 1
+
+    result = np.empty(counts.sum(), dtype='object')
+    count = 0
+    for i in range(n):
+        v = values[i]
+
+        if c_is_list_like(v, True):
+            if len(v):
+                v = list(v)
+                for j in range(len(v)):
+                    result[count] = v[j]
+                    count += 1
+            else:
+                # empty list-like, use a nan marker
+                result[count] = np.nan
+                count += 1
+        else:
+            # replace with the existing scalar
+            result[count] = v
+            count += 1
+    return result, counts

.venv/Lib/site-packages/pandas/_libs/sparse.pyi

@@ -0,0 +1,47 @@
+from typing import (
+    Sequence,
+    TypeVar,
+)
+
+import numpy as np
+
+from pandas._typing import npt
+
+SparseIndexT = TypeVar("SparseIndexT", bound="SparseIndex")
+
+class SparseIndex:
+    length: int
+    npoints: int
+    def __init__(self): ...
+    @property
+    def ngaps(self) -> int: ...
+    @property
+    def nbytes(self) -> int: ...
+    @property
+    def indices(self) -> npt.NDArray[np.int32]: ...
+    def equals(self, other) -> bool: ...
+    def lookup(self, index: int) -> np.int32: ...
+    def lookup_array(self, indexer: npt.NDArray[np.int32]) -> npt.NDArray[np.int32]: ...
+    def to_int_index(self) -> IntIndex: ...
+    def to_block_index(self) -> BlockIndex: ...
+    def intersect(self: SparseIndexT, y_: SparseIndex) -> SparseIndexT: ...
+    def make_union(self: SparseIndexT, y_: SparseIndex) -> SparseIndexT: ...
+
+class IntIndex(SparseIndex):
+    indices: npt.NDArray[np.int32]
+    def __init__(
+        self, length: int, indices: Sequence[int], check_integrity: bool = ...
+    ): ...
+
+class BlockIndex(SparseIndex):
+    nblocks: int
+    blocs: np.ndarray
+    blengths: np.ndarray
+    def __init__(self, length: int, blocs: np.ndarray, blengths: np.ndarray): ...
+
+def make_mask_object_ndarray(
+    arr: npt.NDArray[np.object_], fill_value
+) -> npt.NDArray[np.bool_]: ...
+def get_blocks(
+    indices: npt.NDArray[np.int32],
+) -> tuple[npt.NDArray[np.int32], npt.NDArray[np.int32]]: ...

.venv/Lib/site-packages/pandas/_libs/sparse.pyx

@@ -0,0 +1,738 @@
+import cython
+import numpy as np
+
+cimport numpy as cnp
+from numpy cimport (
+    float32_t,
+    float64_t,
+    int8_t,
+    int16_t,
+    int32_t,
+    int64_t,
+    ndarray,
+    uint8_t,
+)
+
+cnp.import_array()
+
+
+# -----------------------------------------------------------------------------
+# Preamble stuff
+
+cdef float64_t NaN = <float64_t>np.NaN
+cdef float64_t INF = <float64_t>np.inf
+
+# -----------------------------------------------------------------------------
+
+
+cdef class SparseIndex:
+    """
+    Abstract superclass for sparse index types.
+    """
+
+    def __init__(self):
+        raise NotImplementedError
+
+
+cdef class IntIndex(SparseIndex):
+    """
+    Object for holding exact integer sparse indexing information
+
+    Parameters
+    ----------
+    length : integer
+    indices : array-like
+        Contains integers corresponding to the indices.
+    check_integrity : bool, default=True
+        Check integrity of the input.
+    """
+
+    cdef readonly:
+        Py_ssize_t length, npoints
+        ndarray indices
+
+    def __init__(self, Py_ssize_t length, indices, bint check_integrity=True):
+        self.length = length
+        self.indices = np.ascontiguousarray(indices, dtype=np.int32)
+        self.npoints = len(self.indices)
+
+        if check_integrity:
+            self.check_integrity()
+
+    def __reduce__(self):
+        args = (self.length, self.indices)
+        return IntIndex, args
+
+    def __repr__(self) -> str:
+        output = 'IntIndex\n'
+        output += f'Indices: {repr(self.indices)}\n'
+        return output
+
+    @property
+    def nbytes(self) -> int:
+        return self.indices.nbytes
+
+    cdef check_integrity(self):
+        """
+        Checks the following:
+
+        - Indices are strictly ascending
+        - Number of indices is at most self.length
+        - Indices are at least 0 and at most the total length less one
+
+        A ValueError is raised if any of these conditions is violated.
+        """
+
+        if self.npoints > self.length:
+            raise ValueError(
+                f"Too many indices. Expected {self.length} but found {self.npoints}"
+            )
+
+        # Indices are vacuously ordered and non-negative
+        # if the sequence of indices is empty.
+        if self.npoints == 0:
+            return
+
+        if self.indices.min() < 0:
+            raise ValueError("No index can be less than zero")
+
+        if self.indices.max() >= self.length:
+            raise ValueError("All indices must be less than the length")
+
+        monotonic = np.all(self.indices[:-1] < self.indices[1:])
+        if not monotonic:
+            raise ValueError("Indices must be strictly increasing")
+
+    def equals(self, other: object) -> bool:
+        if not isinstance(other, IntIndex):
+            return False
+
+        if self is other:
+            return True
+
+        same_length = self.length == other.length
+        same_indices = np.array_equal(self.indices, other.indices)
+        return same_length and same_indices
+
+    @property
+    def ngaps(self) -> int:
+        return self.length - self.npoints
+
+    cpdef to_int_index(self):
+        return self
+
+    def to_block_index(self):
+        locs, lens = get_blocks(self.indices)
+        return BlockIndex(self.length, locs, lens)
+
+    cpdef IntIndex intersect(self, SparseIndex y_):
+        cdef:
+            Py_ssize_t out_length, xi, yi = 0, result_indexer = 0
+            int32_t xind
+            ndarray[int32_t, ndim=1] xindices, yindices, new_indices
+            IntIndex y
+
+        # if is one already, returns self
+        y = y_.to_int_index()
+
+        if self.length != y.length:
+            raise Exception('Indices must reference same underlying length')
+
+        xindices = self.indices
+        yindices = y.indices
+        new_indices = np.empty(min(
+            len(xindices), len(yindices)), dtype=np.int32)
+
+        for xi in range(self.npoints):
+            xind = xindices[xi]
+
+            while yi < y.npoints and yindices[yi] < xind:
+                yi += 1
+
+            if yi >= y.npoints:
+                break
+
+            # TODO: would a two-pass algorithm be faster?
+            if yindices[yi] == xind:
+                new_indices[result_indexer] = xind
+                result_indexer += 1
+
+        new_indices = new_indices[:result_indexer]
+        return IntIndex(self.length, new_indices)
+
+    cpdef IntIndex make_union(self, SparseIndex y_):
+
+        cdef:
+            ndarray[int32_t, ndim=1] new_indices
+            IntIndex y
+
+        # if is one already, returns self
+        y = y_.to_int_index()
+
+        if self.length != y.length:
+            raise ValueError('Indices must reference same underlying length')
+
+        new_indices = np.union1d(self.indices, y.indices)
+        return IntIndex(self.length, new_indices)
+
+    @cython.wraparound(False)
+    cpdef int32_t lookup(self, Py_ssize_t index):
+        """
+        Return the internal location if value exists on given index.
+        Return -1 otherwise.
+        """
+        cdef:
+            int32_t res
+            ndarray[int32_t, ndim=1] inds
+
+        inds = self.indices
+        if self.npoints == 0:
+            return -1
+        elif index < 0 or self.length <= index:
+            return -1
+
+        res = inds.searchsorted(index)
+        if res == self.npoints:
+            return -1
+        elif inds[res] == index:
+            return res
+        else:
+            return -1
+
+    @cython.wraparound(False)
+    cpdef ndarray[int32_t] lookup_array(self, ndarray[int32_t, ndim=1] indexer):
+        """
+        Vectorized lookup, returns ndarray[int32_t]
+        """
+        cdef:
+            Py_ssize_t n, i, ind_val
+            ndarray[int32_t, ndim=1] inds
+            ndarray[uint8_t, ndim=1, cast=True] mask
+            ndarray[int32_t, ndim=1] masked
+            ndarray[int32_t, ndim=1] res
+            ndarray[int32_t, ndim=1] results
+
+        n = len(indexer)
+        results = np.empty(n, dtype=np.int32)
+        results[:] = -1
+
+        if self.npoints == 0:
+            return results
+
+        inds = self.indices
+        mask = (inds[0] <= indexer) & (indexer <= inds[len(inds) - 1])
+
+        masked = indexer[mask]
+        res = inds.searchsorted(masked).astype(np.int32)
+
+        res[inds[res] != masked] = -1
+        results[mask] = res
+        return results
+
+
+cpdef get_blocks(ndarray[int32_t, ndim=1] indices):
+    cdef:
+        Py_ssize_t init_len, i, npoints, result_indexer = 0
+        int32_t block, length = 1, cur, prev
+        ndarray[int32_t, ndim=1] locs, lens
+
+    npoints = len(indices)
+
+    # just handle the special empty case separately
+    if npoints == 0:
+        return np.array([], dtype=np.int32), np.array([], dtype=np.int32)
+
+    # block size can't be longer than npoints
+    locs = np.empty(npoints, dtype=np.int32)
+    lens = np.empty(npoints, dtype=np.int32)
+
+    # TODO: two-pass algorithm faster?
+    prev = block = indices[0]
+    for i in range(1, npoints):
+        cur = indices[i]
+        if cur - prev > 1:
+            # new block
+            locs[result_indexer] = block
+            lens[result_indexer] = length
+            block = cur
+            length = 1
+            result_indexer += 1
+        else:
+            # same block, increment length
+            length += 1
+
+        prev = cur
+
+    locs[result_indexer] = block
+    lens[result_indexer] = length
+    result_indexer += 1
+    locs = locs[:result_indexer]
+    lens = lens[:result_indexer]
+    return locs, lens
+
+
+# -----------------------------------------------------------------------------
+# BlockIndex
+
+cdef class BlockIndex(SparseIndex):
+    """
+    Object for holding block-based sparse indexing information
+
+    Parameters
+    ----------
+    """
+    cdef readonly:
+        int32_t nblocks, npoints, length
+        ndarray blocs, blengths
+
+    cdef:
+        object __weakref__  # need to be picklable
+        int32_t *locbuf
+        int32_t *lenbuf
+
+    def __init__(self, length, blocs, blengths):
+
+        self.blocs = np.ascontiguousarray(blocs, dtype=np.int32)
+        self.blengths = np.ascontiguousarray(blengths, dtype=np.int32)
+
+        # in case we need
+        self.locbuf = <int32_t*>self.blocs.data
+        self.lenbuf = <int32_t*>self.blengths.data
+
+        self.length = length
+        self.nblocks = np.int32(len(self.blocs))
+        self.npoints = self.blengths.sum()
+
+        # self.block_start = blocs
+        # self.block_end = blocs + blengths
+
+        self.check_integrity()
+
+    def __reduce__(self):
+        args = (self.length, self.blocs, self.blengths)
+        return BlockIndex, args
+
+    def __repr__(self) -> str:
+        output = 'BlockIndex\n'
+        output += f'Block locations: {repr(self.blocs)}\n'
+        output += f'Block lengths: {repr(self.blengths)}'
+
+        return output
+
+    @property
+    def nbytes(self) -> int:
+        return self.blocs.nbytes + self.blengths.nbytes
+
+    @property
+    def ngaps(self) -> int:
+        return self.length - self.npoints
+
+    cdef check_integrity(self):
+        """
+        Check:
+        - Locations are in ascending order
+        - No overlapping blocks
+        - Blocks to not start after end of index, nor extend beyond end
+        """
+        cdef:
+            Py_ssize_t i
+            ndarray[int32_t, ndim=1] blocs, blengths
+
+        blocs = self.blocs
+        blengths = self.blengths
+
+        if len(blocs) != len(blengths):
+            raise ValueError('block bound arrays must be same length')
+
+        for i in range(self.nblocks):
+            if i > 0:
+                if blocs[i] <= blocs[i - 1]:
+                    raise ValueError('Locations not in ascending order')
+
+            if i < self.nblocks - 1:
+                if blocs[i] + blengths[i] > blocs[i + 1]:
+                    raise ValueError(f'Block {i} overlaps')
+            else:
+                if blocs[i] + blengths[i] > self.length:
+                    raise ValueError(f'Block {i} extends beyond end')
+
+            # no zero-length blocks
+            if blengths[i] == 0:
+                raise ValueError(f'Zero-length block {i}')
+
+    def equals(self, other: object) -> bool:
+        if not isinstance(other, BlockIndex):
+            return False
+
+        if self is other:
+            return True
+
+        same_length = self.length == other.length
+        same_blocks = (np.array_equal(self.blocs, other.blocs) and
+                       np.array_equal(self.blengths, other.blengths))
+        return same_length and same_blocks
+
+    def to_block_index(self):
+        return self
+
+    cpdef to_int_index(self):
+        cdef:
+            int32_t i = 0, j, b
+            int32_t offset
+            ndarray[int32_t, ndim=1] indices
+
+        indices = np.empty(self.npoints, dtype=np.int32)
+
+        for b in range(self.nblocks):
+            offset = self.locbuf[b]
+
+            for j in range(self.lenbuf[b]):
+                indices[i] = offset + j
+                i += 1
+
+        return IntIndex(self.length, indices)
+
+    @property
+    def indices(self):
+        return self.to_int_index().indices
+
+    cpdef BlockIndex intersect(self, SparseIndex other):
+        """
+        Intersect two BlockIndex objects
+
+        Returns
+        -------
+        BlockIndex
+        """
+        cdef:
+            BlockIndex y
+            ndarray[int32_t, ndim=1] xloc, xlen, yloc, ylen, out_bloc, out_blen
+            Py_ssize_t xi = 0, yi = 0, max_len, result_indexer = 0
+            int32_t cur_loc, cur_length, diff
+
+        y = other.to_block_index()
+
+        if self.length != y.length:
+            raise Exception('Indices must reference same underlying length')
+
+        xloc = self.blocs
+        xlen = self.blengths
+        yloc = y.blocs
+        ylen = y.blengths
+
+        # block may be split, but can't exceed original len / 2 + 1
+        max_len = min(self.length, y.length) // 2 + 1
+        out_bloc = np.empty(max_len, dtype=np.int32)
+        out_blen = np.empty(max_len, dtype=np.int32)
+
+        while True:
+            # we are done (or possibly never began)
+            if xi >= self.nblocks or yi >= y.nblocks:
+                break
+
+            # completely symmetric...would like to avoid code dup but oh well
+            if xloc[xi] >= yloc[yi]:
+                cur_loc = xloc[xi]
+                diff = xloc[xi] - yloc[yi]
+
+                if ylen[yi] <= diff:
+                    # have to skip this block
+                    yi += 1
+                    continue
+
+                if ylen[yi] - diff < xlen[xi]:
+                    # take end of y block, move onward
+                    cur_length = ylen[yi] - diff
+                    yi += 1
+                else:
+                    # take end of x block
+                    cur_length = xlen[xi]
+                    xi += 1
+
+            else:  # xloc[xi] < yloc[yi]
+                cur_loc = yloc[yi]
+                diff = yloc[yi] - xloc[xi]
+
+                if xlen[xi] <= diff:
+                    # have to skip this block
+                    xi += 1
+                    continue
+
+                if xlen[xi] - diff < ylen[yi]:
+                    # take end of x block, move onward
+                    cur_length = xlen[xi] - diff
+                    xi += 1
+                else:
+                    # take end of y block
+                    cur_length = ylen[yi]
+                    yi += 1
+
+            out_bloc[result_indexer] = cur_loc
+            out_blen[result_indexer] = cur_length
+            result_indexer += 1
+
+        out_bloc = out_bloc[:result_indexer]
+        out_blen = out_blen[:result_indexer]
+
+        return BlockIndex(self.length, out_bloc, out_blen)
+
+    cpdef BlockIndex make_union(self, SparseIndex y):
+        """
+        Combine together two BlockIndex objects, accepting indices if contained
+        in one or the other
+
+        Parameters
+        ----------
+        other : SparseIndex
+
+        Notes
+        -----
+        union is a protected keyword in Cython, hence make_union
+
+        Returns
+        -------
+        BlockIndex
+        """
+        return BlockUnion(self, y.to_block_index()).result
+
+    cpdef Py_ssize_t lookup(self, Py_ssize_t index):
+        """
+        Return the internal location if value exists on given index.
+        Return -1 otherwise.
+        """
+        cdef:
+            Py_ssize_t i, cum_len
+            ndarray[int32_t, ndim=1] locs, lens
+
+        locs = self.blocs
+        lens = self.blengths
+
+        if self.nblocks == 0:
+            return -1
+        elif index < locs[0]:
+            return -1
+
+        cum_len = 0
+        for i in range(self.nblocks):
+            if index >= locs[i] and index < locs[i] + lens[i]:
+                return cum_len + index - locs[i]
+            cum_len += lens[i]
+
+        return -1
+
+    @cython.wraparound(False)
+    cpdef ndarray[int32_t] lookup_array(self, ndarray[int32_t, ndim=1] indexer):
+        """
+        Vectorized lookup, returns ndarray[int32_t]
+        """
+        cdef:
+            Py_ssize_t n, i, j, ind_val
+            ndarray[int32_t, ndim=1] locs, lens
+            ndarray[int32_t, ndim=1] results
+
+        locs = self.blocs
+        lens = self.blengths
+
+        n = len(indexer)
+        results = np.empty(n, dtype=np.int32)
+        results[:] = -1
+
+        if self.npoints == 0:
+            return results
+
+        for i in range(n):
+            ind_val = indexer[i]
+            if not (ind_val < 0 or self.length <= ind_val):
+                cum_len = 0
+                for j in range(self.nblocks):
+                    if ind_val >= locs[j] and ind_val < locs[j] + lens[j]:
+                        results[i] = cum_len + ind_val - locs[j]
+                    cum_len += lens[j]
+        return results
+
+
+@cython.internal
+cdef class BlockMerge:
+    """
+    Object-oriented approach makes sharing state between recursive functions a
+    lot easier and reduces code duplication
+    """
+    cdef:
+        BlockIndex x, y, result
+        ndarray xstart, xlen, xend, ystart, ylen, yend
+        int32_t xi, yi  # block indices
+
+    def __init__(self, BlockIndex x, BlockIndex y):
+        self.x = x
+        self.y = y
+
+        if x.length != y.length:
+            raise Exception('Indices must reference same underlying length')
+
+        self.xstart = self.x.blocs
+        self.ystart = self.y.blocs
+
+        self.xend = self.x.blocs + self.x.blengths
+        self.yend = self.y.blocs + self.y.blengths
+
+        # self.xlen = self.x.blengths
+        # self.ylen = self.y.blengths
+
+        self.xi = 0
+        self.yi = 0
+
+        self.result = self._make_merged_blocks()
+
+    cdef _make_merged_blocks(self):
+        raise NotImplementedError
+
+    cdef _set_current_indices(self, int32_t xi, int32_t yi, bint mode):
+        if mode == 0:
+            self.xi = xi
+            self.yi = yi
+        else:
+            self.xi = yi
+            self.yi = xi
+
+
+@cython.internal
+cdef class BlockUnion(BlockMerge):
+    """
+    Object-oriented approach makes sharing state between recursive functions a
+    lot easier and reduces code duplication
+    """
+
+    cdef _make_merged_blocks(self):
+        cdef:
+            ndarray[int32_t, ndim=1] xstart, xend, ystart
+            ndarray[int32_t, ndim=1] yend, out_bloc, out_blen
+            int32_t nstart, nend, diff
+            Py_ssize_t max_len, result_indexer = 0
+
+        xstart = self.xstart
+        xend = self.xend
+        ystart = self.ystart
+        yend = self.yend
+
+        max_len = min(self.x.length, self.y.length) // 2 + 1
+        out_bloc = np.empty(max_len, dtype=np.int32)
+        out_blen = np.empty(max_len, dtype=np.int32)
+
+        while True:
+            # we are done (or possibly never began)
+            if self.xi >= self.x.nblocks and self.yi >= self.y.nblocks:
+                break
+            elif self.yi >= self.y.nblocks:
+                # through with y, just pass through x blocks
+                nstart = xstart[self.xi]
+                nend = xend[self.xi]
+                self.xi += 1
+            elif self.xi >= self.x.nblocks:
+                # through with x, just pass through y blocks
+                nstart = ystart[self.yi]
+                nend = yend[self.yi]
+                self.yi += 1
+            else:
+                # find end of new block
+                if xstart[self.xi] < ystart[self.yi]:
+                    nstart = xstart[self.xi]
+                    nend = self._find_next_block_end(0)
+                else:
+                    nstart = ystart[self.yi]
+                    nend = self._find_next_block_end(1)
+
+            out_bloc[result_indexer] = nstart
+            out_blen[result_indexer] = nend - nstart
+            result_indexer += 1
+
+        out_bloc = out_bloc[:result_indexer]
+        out_blen = out_blen[:result_indexer]
+
+        return BlockIndex(self.x.length, out_bloc, out_blen)
+
+    cdef int32_t _find_next_block_end(self, bint mode) except -1:
+        """
+        Wow, this got complicated in a hurry
+
+        mode 0: block started in index x
+        mode 1: block started in index y
+        """
+        cdef:
+            ndarray[int32_t, ndim=1] xstart, xend, ystart, yend
+            int32_t xi, yi, xnblocks, ynblocks, nend
+
+        if mode != 0 and mode != 1:
+            raise Exception('Mode must be 0 or 1')
+
+        # so symmetric code will work
+        if mode == 0:
+            xstart = self.xstart
+            xend = self.xend
+            xi = self.xi
+
+            ystart = self.ystart
+            yend = self.yend
+            yi = self.yi
+            ynblocks = self.y.nblocks
+        else:
+            xstart = self.ystart
+            xend = self.yend
+            xi = self.yi
+
+            ystart = self.xstart
+            yend = self.xend
+            yi = self.xi
+            ynblocks = self.x.nblocks
+
+        nend = xend[xi]
+
+        # done with y?
+        if yi == ynblocks:
+            self._set_current_indices(xi + 1, yi, mode)
+            return nend
+        elif nend < ystart[yi]:
+            # block ends before y block
+            self._set_current_indices(xi + 1, yi, mode)
+            return nend
+        else:
+            while yi < ynblocks and nend > yend[yi]:
+                yi += 1
+
+            self._set_current_indices(xi + 1, yi, mode)
+
+            if yi == ynblocks:
+                return nend
+
+            if nend < ystart[yi]:
+                # we're done, return the block end
+                return nend
+            else:
+                # merge blocks, continue searching
+                # this also catches the case where blocks
+                return self._find_next_block_end(1 - mode)
+
+
+# -----------------------------------------------------------------------------
+# Sparse arithmetic
+
+include "sparse_op_helper.pxi"
+
+
+# -----------------------------------------------------------------------------
+# SparseArray mask create operations
+
+def make_mask_object_ndarray(ndarray[object, ndim=1] arr, object fill_value):
+    cdef:
+        object value
+        Py_ssize_t i
+        Py_ssize_t new_length = len(arr)
+        ndarray[int8_t, ndim=1] mask
+
+    mask = np.ones(new_length, dtype=np.int8)
+
+    for i in range(new_length):
+        value = arr[i]
+        if value == fill_value and type(value) == type(fill_value):
+            mask[i] = 0
+
+    return mask.view(dtype=bool)

.venv/Lib/site-packages/pandas/_libs/sparse_op_helper.pxi.in

@@ -0,0 +1,309 @@
+"""
+Template for each `dtype` helper function for sparse ops
+
+WARNING: DO NOT edit .pxi FILE directly, .pxi is generated from .pxi.in
+"""
+
+# ----------------------------------------------------------------------
+# Sparse op
+# ----------------------------------------------------------------------
+
+ctypedef fused sparse_t:
+    float64_t
+    int64_t
+
+
+cdef inline float64_t __div__(sparse_t a, sparse_t b):
+    if b == 0:
+        if a > 0:
+            return INF
+        elif a < 0:
+            return -INF
+        else:
+            return NaN
+    else:
+        return float(a) / b
+
+
+cdef inline float64_t __truediv__(sparse_t a, sparse_t b):
+    return __div__(a, b)
+
+
+cdef inline sparse_t __mod__(sparse_t a, sparse_t b):
+    if b == 0:
+        if sparse_t is float64_t:
+            return NaN
+        else:
+            return 0
+    else:
+        return a % b
+
+
+cdef inline sparse_t __floordiv__(sparse_t a, sparse_t b):
+    if b == 0:
+        if sparse_t is float64_t:
+            # Match non-sparse Series behavior implemented in mask_zero_div_zero
+            if a > 0:
+                return INF
+            elif a < 0:
+                return -INF
+            return NaN
+        else:
+            return 0
+    else:
+        return a // b
+
+
+# ----------------------------------------------------------------------
+# sparse array op
+# ----------------------------------------------------------------------
+
+{{py:
+
+# dtype, arith_comp_group, logical_group
+dtypes = [('float64', True, False),
+          ('int64', True, True),
+          ('uint8', False, True)]
+# do not generate arithmetic / comparison template for uint8,
+# it should be done in fused types
+
+def get_op(tup):
+    assert isinstance(tup, tuple)
+    assert len(tup) == 4
+
+    opname, lval, rval, dtype = tup
+
+    ops_dict = {'add': '{0} + {1}',
+                'sub': '{0} - {1}',
+                'mul': '{0} * {1}',
+                'div': '__div__({0}, {1})',
+                'mod': '__mod__({0}, {1})',
+                'truediv': '__truediv__({0}, {1})',
+                'floordiv': '__floordiv__({0}, {1})',
+                'pow': '{0} ** {1}',
+                'eq': '{0} == {1}',
+                'ne': '{0} != {1}',
+                'lt': '{0} < {1}',
+                'gt': '{0} > {1}',
+                'le': '{0} <= {1}',
+                'ge': '{0} >= {1}',
+
+                'and': '{0} & {1}',     # logical op
+                'or': '{0} | {1}',
+                'xor': '{0} ^ {1}'}
+
+    return ops_dict[opname].format(lval, rval)
+
+
+def get_dispatch(dtypes):
+
+    ops_list = ['add', 'sub', 'mul', 'div', 'mod', 'truediv',
+                'floordiv', 'pow',
+                'eq', 'ne', 'lt', 'gt', 'le', 'ge',
+                'and', 'or', 'xor']
+
+    for opname in ops_list:
+        for dtype, arith_comp_group, logical_group in dtypes:
+
+            if opname in ('div', 'truediv'):
+                rdtype = 'float64'
+            elif opname in ('eq', 'ne', 'lt', 'gt', 'le', 'ge'):
+                # comparison op
+                rdtype = 'uint8'
+            elif opname in ('and', 'or', 'xor'):
+                # logical op
+                rdtype = 'uint8'
+            else:
+                rdtype = dtype
+
+            if opname in ('and', 'or', 'xor'):
+                if logical_group:
+                    yield opname, dtype, rdtype
+            else:
+                if arith_comp_group:
+                    yield opname, dtype, rdtype
+
+}}
+
+
+{{for opname, dtype, rdtype in get_dispatch(dtypes)}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+cdef inline tuple block_op_{{opname}}_{{dtype}}({{dtype}}_t[:] x_,
+                                                BlockIndex xindex,
+                                                {{dtype}}_t xfill,
+                                                {{dtype}}_t[:] y_,
+                                                BlockIndex yindex,
+                                                {{dtype}}_t yfill):
+    '''
+    Binary operator on BlockIndex objects with fill values
+    '''
+
+    cdef:
+        BlockIndex out_index
+        Py_ssize_t xi = 0, yi = 0, out_i = 0 # fp buf indices
+        int32_t xbp = 0, ybp = 0 # block positions
+        int32_t xloc, yloc
+        Py_ssize_t xblock = 0, yblock = 0 # block numbers
+
+        {{dtype}}_t[:] x, y
+        ndarray[{{rdtype}}_t, ndim=1] out
+
+    # to suppress Cython warning
+    x = x_
+    y = y_
+
+    out_index = xindex.make_union(yindex)
+    out = np.empty(out_index.npoints, dtype=np.{{rdtype}})
+
+    # Wow, what a hack job. Need to do something about this
+
+    # walk the two SparseVectors, adding matched locations...
+    for out_i in range(out_index.npoints):
+        if yblock == yindex.nblocks:
+            # use y fill value
+            out[out_i] = {{(opname, 'x[xi]', 'yfill', dtype) | get_op}}
+            xi += 1
+
+            # advance x location
+            xbp += 1
+            if xbp == xindex.lenbuf[xblock]:
+                xblock += 1
+                xbp = 0
+            continue
+
+        if xblock == xindex.nblocks:
+            # use x fill value
+            out[out_i] = {{(opname, 'xfill', 'y[yi]', dtype) | get_op}}
+            yi += 1
+
+            # advance y location
+            ybp += 1
+            if ybp == yindex.lenbuf[yblock]:
+                yblock += 1
+                ybp = 0
+            continue
+
+        yloc = yindex.locbuf[yblock] + ybp
+        xloc = xindex.locbuf[xblock] + xbp
+
+        # each index in the out_index had to come from either x, y, or both
+        if xloc == yloc:
+            out[out_i] = {{(opname, 'x[xi]', 'y[yi]', dtype) | get_op}}
+            xi += 1
+            yi += 1
+
+            # advance both locations
+            xbp += 1
+            if xbp == xindex.lenbuf[xblock]:
+                xblock += 1
+                xbp = 0
+
+            ybp += 1
+            if ybp == yindex.lenbuf[yblock]:
+                yblock += 1
+                ybp = 0
+
+        elif xloc < yloc:
+            # use y fill value
+            out[out_i] = {{(opname, 'x[xi]', 'yfill', dtype) | get_op}}
+            xi += 1
+
+            # advance x location
+            xbp += 1
+            if xbp == xindex.lenbuf[xblock]:
+                xblock += 1
+                xbp = 0
+        else:
+            # use x fill value
+            out[out_i] = {{(opname, 'xfill', 'y[yi]', dtype) | get_op}}
+            yi += 1
+
+            # advance y location
+            ybp += 1
+            if ybp == yindex.lenbuf[yblock]:
+                yblock += 1
+                ybp = 0
+
+    return out, out_index, {{(opname, 'xfill', 'yfill', dtype) | get_op}}
+
+
+@cython.wraparound(False)
+@cython.boundscheck(False)
+cdef inline tuple int_op_{{opname}}_{{dtype}}({{dtype}}_t[:] x_,
+                                              IntIndex xindex,
+                                              {{dtype}}_t xfill,
+                                              {{dtype}}_t[:] y_,
+                                              IntIndex yindex,
+                                              {{dtype}}_t yfill):
+    cdef:
+        IntIndex out_index
+        Py_ssize_t xi = 0, yi = 0, out_i = 0  # fp buf indices
+        int32_t xloc, yloc
+        int32_t[:] xindices, yindices, out_indices
+        {{dtype}}_t[:] x, y
+        ndarray[{{rdtype}}_t, ndim=1] out
+
+    # suppress Cython compiler warnings due to inlining
+    x = x_
+    y = y_
+
+    # need to do this first to know size of result array
+    out_index = xindex.make_union(yindex)
+    out = np.empty(out_index.npoints, dtype=np.{{rdtype}})
+
+    xindices = xindex.indices
+    yindices = yindex.indices
+    out_indices = out_index.indices
+
+    # walk the two SparseVectors, adding matched locations...
+    for out_i in range(out_index.npoints):
+        if xi == xindex.npoints:
+            # use x fill value
+            out[out_i] = {{(opname, 'xfill', 'y[yi]', dtype) | get_op}}
+            yi += 1
+            continue
+
+        if yi == yindex.npoints:
+            # use y fill value
+            out[out_i] = {{(opname, 'x[xi]', 'yfill', dtype) | get_op}}
+            xi += 1
+            continue
+
+        xloc = xindices[xi]
+        yloc = yindices[yi]
+
+        # each index in the out_index had to come from either x, y, or both
+        if xloc == yloc:
+            out[out_i] = {{(opname, 'x[xi]', 'y[yi]', dtype) | get_op}}
+            xi += 1
+            yi += 1
+        elif xloc < yloc:
+            # use y fill value
+            out[out_i] = {{(opname, 'x[xi]', 'yfill', dtype) | get_op}}
+            xi += 1
+        else:
+            # use x fill value
+            out[out_i] = {{(opname, 'xfill', 'y[yi]', dtype) | get_op}}
+            yi += 1
+
+    return out, out_index, {{(opname, 'xfill', 'yfill', dtype) | get_op}}
+
+
+cpdef sparse_{{opname}}_{{dtype}}({{dtype}}_t[:] x,
+                                  SparseIndex xindex, {{dtype}}_t xfill,
+                                  {{dtype}}_t[:] y,
+                                  SparseIndex yindex, {{dtype}}_t yfill):
+
+    if isinstance(xindex, BlockIndex):
+        return block_op_{{opname}}_{{dtype}}(x, xindex.to_block_index(), xfill,
+                                             y, yindex.to_block_index(), yfill)
+    elif isinstance(xindex, IntIndex):
+        return int_op_{{opname}}_{{dtype}}(x, xindex.to_int_index(), xfill,
+                                           y, yindex.to_int_index(), yfill)
+    else:
+        raise NotImplementedError
+
+{{endfor}}

.venv/Lib/site-packages/pandas/_libs/src/headers/cmath

@@ -0,0 +1,48 @@
+#ifndef _PANDAS_MATH_H_
+#define _PANDAS_MATH_H_
+
+// MSVC 2017 has a bug where `x == x` can be true for NaNs.
+// MSC_VER from https://stackoverflow.com/a/70630/1889400
+// Place upper bound on this check once a fixed MSVC is released.
+#if defined(_MSC_VER) && (_MSC_VER < 1800)
+#include <cmath>
+// In older versions of Visual Studio there wasn't a std::signbit defined
+// This defines it using _copysign
+namespace std {
+   __inline int isnan(double x) { return _isnan(x); }
+   __inline int signbit(double num) { return _copysign(1.0, num) < 0; }
+   __inline int notnan(double x) { return !isnan(x); }
+}
+#elif defined(_MSC_VER) && (_MSC_VER >= 1900)
+#include <cmath>
+namespace std {
+  __inline int isnan(double x) { return _isnan(x); }
+  __inline int notnan(double x) { return !isnan(x); }
+}
+#elif defined(_MSC_VER)
+#include <cmath>
+namespace std {
+  __inline int isnan(double x) { return _isnan(x); }
+  __inline int notnan(double x) { return x == x; }
+}
+#elif defined(__MVS__)
+#include <cmath>
+
+#define _signbit signbit
+#undef signbit
+#undef isnan
+
+namespace std {
+  __inline int notnan(double x) { return x == x; }
+  __inline int signbit(double num) { return _signbit(num); }
+  __inline int isnan(double x) { return isnan(x); }
+}
+#else
+#include <cmath>
+
+namespace std {
+  __inline int notnan(double x) { return x == x; }
+}
+
+#endif
+#endif

.venv/Lib/site-packages/pandas/_libs/src/headers/ms_inttypes.h

@@ -0,0 +1,305 @@
+// ISO C9x  compliant inttypes.h for Microsoft Visual Studio
+// Based on ISO/IEC 9899:TC2 Committee draft (May 6, 2005) WG14/N1124
+//
+//  Copyright (c) 2006 Alexander Chemeris
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions are met:
+//
+//   1. Redistributions of source code must retain the above copyright notice,
+//      this list of conditions and the following disclaimer.
+//
+//   2. Redistributions in binary form must reproduce the above copyright
+//      notice, this list of conditions and the following disclaimer in the
+//      documentation and/or other materials provided with the distribution.
+//
+//   3. The name of the author may be used to endorse or promote products
+//      derived from this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED
+// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO
+// EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+// PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS;
+// OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+// WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR
+// OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF
+// ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+//
+///////////////////////////////////////////////////////////////////////////////
+
+#ifndef _MSC_VER // [
+#error "Use this header only with Microsoft Visual C++ compilers!"
+#endif // _MSC_VER ]
+
+#ifndef _MSC_INTTYPES_H_ // [
+#define _MSC_INTTYPES_H_
+
+#if _MSC_VER > 1000
+#pragma once
+#endif
+
+#include "ms_stdint.h"
+
+// 7.8 Format conversion of integer types
+
+typedef struct {
+   intmax_t quot;
+   intmax_t rem;
+} imaxdiv_t;
+
+// 7.8.1 Macros for format specifiers
+
+#if !defined(__cplusplus) || defined(__STDC_FORMAT_MACROS) // [   See footnote 185 at page 198
+
+// The fprintf macros for signed integers are:
+#define PRId8       "d"
+#define PRIi8       "i"
+#define PRIdLEAST8  "d"
+#define PRIiLEAST8  "i"
+#define PRIdFAST8   "d"
+#define PRIiFAST8   "i"
+
+#define PRId16       "hd"
+#define PRIi16       "hi"
+#define PRIdLEAST16  "hd"
+#define PRIiLEAST16  "hi"
+#define PRIdFAST16   "hd"
+#define PRIiFAST16   "hi"
+
+#define PRId32       "I32d"
+#define PRIi32       "I32i"
+#define PRIdLEAST32  "I32d"
+#define PRIiLEAST32  "I32i"
+#define PRIdFAST32   "I32d"
+#define PRIiFAST32   "I32i"
+
+#define PRId64       "I64d"
+#define PRIi64       "I64i"
+#define PRIdLEAST64  "I64d"
+#define PRIiLEAST64  "I64i"
+#define PRIdFAST64   "I64d"
+#define PRIiFAST64   "I64i"
+
+#define PRIdMAX     "I64d"
+#define PRIiMAX     "I64i"
+
+#define PRIdPTR     "Id"
+#define PRIiPTR     "Ii"
+
+// The fprintf macros for unsigned integers are:
+#define PRIo8       "o"
+#define PRIu8       "u"
+#define PRIx8       "x"
+#define PRIX8       "X"
+#define PRIoLEAST8  "o"
+#define PRIuLEAST8  "u"
+#define PRIxLEAST8  "x"
+#define PRIXLEAST8  "X"
+#define PRIoFAST8   "o"
+#define PRIuFAST8   "u"
+#define PRIxFAST8   "x"
+#define PRIXFAST8   "X"
+
+#define PRIo16       "ho"
+#define PRIu16       "hu"
+#define PRIx16       "hx"
+#define PRIX16       "hX"
+#define PRIoLEAST16  "ho"
+#define PRIuLEAST16  "hu"
+#define PRIxLEAST16  "hx"
+#define PRIXLEAST16  "hX"
+#define PRIoFAST16   "ho"
+#define PRIuFAST16   "hu"
+#define PRIxFAST16   "hx"
+#define PRIXFAST16   "hX"
+
+#define PRIo32       "I32o"
+#define PRIu32       "I32u"
+#define PRIx32       "I32x"
+#define PRIX32       "I32X"
+#define PRIoLEAST32  "I32o"
+#define PRIuLEAST32  "I32u"
+#define PRIxLEAST32  "I32x"
+#define PRIXLEAST32  "I32X"
+#define PRIoFAST32   "I32o"
+#define PRIuFAST32   "I32u"
+#define PRIxFAST32   "I32x"
+#define PRIXFAST32   "I32X"
+
+#define PRIo64       "I64o"
+#define PRIu64       "I64u"
+#define PRIx64       "I64x"
+#define PRIX64       "I64X"
+#define PRIoLEAST64  "I64o"
+#define PRIuLEAST64  "I64u"
+#define PRIxLEAST64  "I64x"
+#define PRIXLEAST64  "I64X"
+#define PRIoFAST64   "I64o"
+#define PRIuFAST64   "I64u"
+#define PRIxFAST64   "I64x"
+#define PRIXFAST64   "I64X"
+
+#define PRIoMAX     "I64o"
+#define PRIuMAX     "I64u"
+#define PRIxMAX     "I64x"
+#define PRIXMAX     "I64X"
+
+#define PRIoPTR     "Io"
+#define PRIuPTR     "Iu"
+#define PRIxPTR     "Ix"
+#define PRIXPTR     "IX"
+
+// The fscanf macros for signed integers are:
+#define SCNd8       "d"
+#define SCNi8       "i"
+#define SCNdLEAST8  "d"
+#define SCNiLEAST8  "i"
+#define SCNdFAST8   "d"
+#define SCNiFAST8   "i"
+
+#define SCNd16       "hd"
+#define SCNi16       "hi"
+#define SCNdLEAST16  "hd"
+#define SCNiLEAST16  "hi"
+#define SCNdFAST16   "hd"
+#define SCNiFAST16   "hi"
+
+#define SCNd32       "ld"
+#define SCNi32       "li"
+#define SCNdLEAST32  "ld"
+#define SCNiLEAST32  "li"
+#define SCNdFAST32   "ld"
+#define SCNiFAST32   "li"
+
+#define SCNd64       "I64d"
+#define SCNi64       "I64i"
+#define SCNdLEAST64  "I64d"
+#define SCNiLEAST64  "I64i"
+#define SCNdFAST64   "I64d"
+#define SCNiFAST64   "I64i"
+
+#define SCNdMAX     "I64d"
+#define SCNiMAX     "I64i"
+
+#ifdef _WIN64 // [
+#  define SCNdPTR     "I64d"
+#  define SCNiPTR     "I64i"
+#else  // _WIN64 ][
+#  define SCNdPTR     "ld"
+#  define SCNiPTR     "li"
+#endif  // _WIN64 ]
+
+// The fscanf macros for unsigned integers are:
+#define SCNo8       "o"
+#define SCNu8       "u"
+#define SCNx8       "x"
+#define SCNX8       "X"
+#define SCNoLEAST8  "o"
+#define SCNuLEAST8  "u"
+#define SCNxLEAST8  "x"
+#define SCNXLEAST8  "X"
+#define SCNoFAST8   "o"
+#define SCNuFAST8   "u"
+#define SCNxFAST8   "x"
+#define SCNXFAST8   "X"
+
+#define SCNo16       "ho"
+#define SCNu16       "hu"
+#define SCNx16       "hx"
+#define SCNX16       "hX"
+#define SCNoLEAST16  "ho"
+#define SCNuLEAST16  "hu"
+#define SCNxLEAST16  "hx"
+#define SCNXLEAST16  "hX"
+#define SCNoFAST16   "ho"
+#define SCNuFAST16   "hu"
+#define SCNxFAST16   "hx"
+#define SCNXFAST16   "hX"
+
+#define SCNo32       "lo"
+#define SCNu32       "lu"
+#define SCNx32       "lx"
+#define SCNX32       "lX"
+#define SCNoLEAST32  "lo"
+#define SCNuLEAST32  "lu"
+#define SCNxLEAST32  "lx"
+#define SCNXLEAST32  "lX"
+#define SCNoFAST32   "lo"
+#define SCNuFAST32   "lu"
+#define SCNxFAST32   "lx"
+#define SCNXFAST32   "lX"
+
+#define SCNo64       "I64o"
+#define SCNu64       "I64u"
+#define SCNx64       "I64x"
+#define SCNX64       "I64X"
+#define SCNoLEAST64  "I64o"
+#define SCNuLEAST64  "I64u"
+#define SCNxLEAST64  "I64x"
+#define SCNXLEAST64  "I64X"
+#define SCNoFAST64   "I64o"
+#define SCNuFAST64   "I64u"
+#define SCNxFAST64   "I64x"
+#define SCNXFAST64   "I64X"
+
+#define SCNoMAX     "I64o"
+#define SCNuMAX     "I64u"
+#define SCNxMAX     "I64x"
+#define SCNXMAX     "I64X"
+
+#ifdef _WIN64 // [
+#  define SCNoPTR     "I64o"
+#  define SCNuPTR     "I64u"
+#  define SCNxPTR     "I64x"
+#  define SCNXPTR     "I64X"
+#else  // _WIN64 ][
+#  define SCNoPTR     "lo"
+#  define SCNuPTR     "lu"
+#  define SCNxPTR     "lx"
+#  define SCNXPTR     "lX"
+#endif  // _WIN64 ]
+
+#endif // __STDC_FORMAT_MACROS ]
+
+// 7.8.2 Functions for greatest-width integer types
+
+// 7.8.2.1 The imaxabs function
+#define imaxabs _abs64
+
+// 7.8.2.2 The imaxdiv function
+
+// This is modified version of div() function from Microsoft's div.c found
+// in %MSVC.NET%\crt\src\div.c
+#ifdef STATIC_IMAXDIV // [
+static
+#else // STATIC_IMAXDIV ][
+_inline
+#endif // STATIC_IMAXDIV ]
+imaxdiv_t __cdecl imaxdiv(intmax_t numer, intmax_t denom)
+{
+   imaxdiv_t result;
+
+   result.quot = numer / denom;
+   result.rem = numer % denom;
+
+   if (numer < 0 && result.rem > 0) {
+      // did division wrong; must fix up
+      ++result.quot;
+      result.rem -= denom;
+   }
+
+   return result;
+}
+
+// 7.8.2.3 The strtoimax and strtoumax functions
+#define strtoimax _strtoi64
+#define strtoumax _strtoui64
+
+// 7.8.2.4 The wcstoimax and wcstoumax functions
+#define wcstoimax _wcstoi64
+#define wcstoumax _wcstoui64
+
+
+#endif // _MSC_INTTYPES_H_ ]

.venv/Lib/site-packages/pandas/_libs/src/headers/ms_stdint.h

@@ -0,0 +1,247 @@
+// ISO C9x  compliant stdint.h for Microsoft Visual Studio
+// Based on ISO/IEC 9899:TC2 Committee draft (May 6, 2005) WG14/N1124
+//
+//  Copyright (c) 2006-2008 Alexander Chemeris
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions are met:
+//
+//   1. Redistributions of source code must retain the above copyright notice,
+//      this list of conditions and the following disclaimer.
+//
+//   2. Redistributions in binary form must reproduce the above copyright
+//      notice, this list of conditions and the following disclaimer in the
+//      documentation and/or other materials provided with the distribution.
+//
+//   3. The name of the author may be used to endorse or promote products
+//      derived from this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED
+// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO
+// EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+// PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS;
+// OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+// WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR
+// OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF
+// ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+//
+///////////////////////////////////////////////////////////////////////////////
+
+#ifndef _MSC_VER // [
+#error "Use this header only with Microsoft Visual C++ compilers!"
+#endif // _MSC_VER ]
+
+#ifndef _MSC_STDINT_H_ // [
+#define _MSC_STDINT_H_
+
+#if _MSC_VER > 1000
+#pragma once
+#endif
+
+#include <limits.h>
+
+// For Visual Studio 6 in C++ mode and for many Visual Studio versions when
+// compiling for ARM we should wrap <wchar.h> include with 'extern "C++" {}'
+// or compiler give many errors like this:
+//   error C2733: second C linkage of overloaded function 'wmemchr' not allowed
+#ifdef __cplusplus
+extern "C" {
+#endif
+#  include <wchar.h>
+#ifdef __cplusplus
+}
+#endif
+
+// Define _W64 macros to mark types changing their size, like intptr_t.
+#ifndef _W64
+#  if !defined(__midl) && (defined(_X86_) || defined(_M_IX86)) && _MSC_VER >= 1300
+#     define _W64 __w64
+#  else
+#     define _W64
+#  endif
+#endif
+
+
+// 7.18.1 Integer types
+
+// 7.18.1.1 Exact-width integer types
+
+// Visual Studio 6 and Embedded Visual C++ 4 doesn't
+// realize that, e.g. char has the same size as __int8
+// so we give up on __intX for them.
+#if (_MSC_VER < 1300)
+   typedef signed char       int8_t;
+   typedef signed short      int16_t;
+   typedef signed int        int32_t;
+   typedef unsigned char     uint8_t;
+   typedef unsigned short    uint16_t;
+   typedef unsigned int      uint32_t;
+#else
+   typedef signed __int8     int8_t;
+   typedef signed __int16    int16_t;
+   typedef signed __int32    int32_t;
+   typedef unsigned __int8   uint8_t;
+   typedef unsigned __int16  uint16_t;
+   typedef unsigned __int32  uint32_t;
+#endif
+typedef signed __int64       int64_t;
+typedef unsigned __int64     uint64_t;
+
+
+// 7.18.1.2 Minimum-width integer types
+typedef int8_t    int_least8_t;
+typedef int16_t   int_least16_t;
+typedef int32_t   int_least32_t;
+typedef int64_t   int_least64_t;
+typedef uint8_t   uint_least8_t;
+typedef uint16_t  uint_least16_t;
+typedef uint32_t  uint_least32_t;
+typedef uint64_t  uint_least64_t;
+
+// 7.18.1.3 Fastest minimum-width integer types
+typedef int8_t    int_fast8_t;
+typedef int16_t   int_fast16_t;
+typedef int32_t   int_fast32_t;
+typedef int64_t   int_fast64_t;
+typedef uint8_t   uint_fast8_t;
+typedef uint16_t  uint_fast16_t;
+typedef uint32_t  uint_fast32_t;
+typedef uint64_t  uint_fast64_t;
+
+// 7.18.1.4 Integer types capable of holding object pointers
+#ifdef _WIN64 // [
+   typedef signed __int64    intptr_t;
+   typedef unsigned __int64  uintptr_t;
+#else // _WIN64 ][
+   typedef _W64 signed int   intptr_t;
+   typedef _W64 unsigned int uintptr_t;
+#endif // _WIN64 ]
+
+// 7.18.1.5 Greatest-width integer types
+typedef int64_t   intmax_t;
+typedef uint64_t  uintmax_t;
+
+
+// 7.18.2 Limits of specified-width integer types
+
+#if !defined(__cplusplus) || defined(__STDC_LIMIT_MACROS) // [   See footnote 220 at page 257 and footnote 221 at page 259
+
+// 7.18.2.1 Limits of exact-width integer types
+#define INT8_MIN     ((int8_t)_I8_MIN)
+#define INT8_MAX     _I8_MAX
+#define INT16_MIN    ((int16_t)_I16_MIN)
+#define INT16_MAX    _I16_MAX
+#define INT32_MIN    ((int32_t)_I32_MIN)
+#define INT32_MAX    _I32_MAX
+#define INT64_MIN    ((int64_t)_I64_MIN)
+#define INT64_MAX    _I64_MAX
+#define UINT8_MAX    _UI8_MAX
+#define UINT16_MAX   _UI16_MAX
+#define UINT32_MAX   _UI32_MAX
+#define UINT64_MAX   _UI64_MAX
+
+// 7.18.2.2 Limits of minimum-width integer types
+#define INT_LEAST8_MIN    INT8_MIN
+#define INT_LEAST8_MAX    INT8_MAX
+#define INT_LEAST16_MIN   INT16_MIN
+#define INT_LEAST16_MAX   INT16_MAX
+#define INT_LEAST32_MIN   INT32_MIN
+#define INT_LEAST32_MAX   INT32_MAX
+#define INT_LEAST64_MIN   INT64_MIN
+#define INT_LEAST64_MAX   INT64_MAX
+#define UINT_LEAST8_MAX   UINT8_MAX
+#define UINT_LEAST16_MAX  UINT16_MAX
+#define UINT_LEAST32_MAX  UINT32_MAX
+#define UINT_LEAST64_MAX  UINT64_MAX
+
+// 7.18.2.3 Limits of fastest minimum-width integer types
+#define INT_FAST8_MIN    INT8_MIN
+#define INT_FAST8_MAX    INT8_MAX
+#define INT_FAST16_MIN   INT16_MIN
+#define INT_FAST16_MAX   INT16_MAX
+#define INT_FAST32_MIN   INT32_MIN
+#define INT_FAST32_MAX   INT32_MAX
+#define INT_FAST64_MIN   INT64_MIN
+#define INT_FAST64_MAX   INT64_MAX
+#define UINT_FAST8_MAX   UINT8_MAX
+#define UINT_FAST16_MAX  UINT16_MAX
+#define UINT_FAST32_MAX  UINT32_MAX
+#define UINT_FAST64_MAX  UINT64_MAX
+
+// 7.18.2.4 Limits of integer types capable of holding object pointers
+#ifdef _WIN64 // [
+#  define INTPTR_MIN   INT64_MIN
+#  define INTPTR_MAX   INT64_MAX
+#  define UINTPTR_MAX  UINT64_MAX
+#else // _WIN64 ][
+#  define INTPTR_MIN   INT32_MIN
+#  define INTPTR_MAX   INT32_MAX
+#  define UINTPTR_MAX  UINT32_MAX
+#endif // _WIN64 ]
+
+// 7.18.2.5 Limits of greatest-width integer types
+#define INTMAX_MIN   INT64_MIN
+#define INTMAX_MAX   INT64_MAX
+#define UINTMAX_MAX  UINT64_MAX
+
+// 7.18.3 Limits of other integer types
+
+#ifdef _WIN64 // [
+#  define PTRDIFF_MIN  _I64_MIN
+#  define PTRDIFF_MAX  _I64_MAX
+#else  // _WIN64 ][
+#  define PTRDIFF_MIN  _I32_MIN
+#  define PTRDIFF_MAX  _I32_MAX
+#endif  // _WIN64 ]
+
+#define SIG_ATOMIC_MIN  INT_MIN
+#define SIG_ATOMIC_MAX  INT_MAX
+
+#ifndef SIZE_MAX // [
+#  ifdef _WIN64 // [
+#     define SIZE_MAX  _UI64_MAX
+#  else // _WIN64 ][
+#     define SIZE_MAX  _UI32_MAX
+#  endif // _WIN64 ]
+#endif // SIZE_MAX ]
+
+// WCHAR_MIN and WCHAR_MAX are also defined in <wchar.h>
+#ifndef WCHAR_MIN // [
+#  define WCHAR_MIN  0
+#endif  // WCHAR_MIN ]
+#ifndef WCHAR_MAX // [
+#  define WCHAR_MAX  _UI16_MAX
+#endif  // WCHAR_MAX ]
+
+#define WINT_MIN  0
+#define WINT_MAX  _UI16_MAX
+
+#endif // __STDC_LIMIT_MACROS ]
+
+
+// 7.18.4 Limits of other integer types
+
+#if !defined(__cplusplus) || defined(__STDC_CONSTANT_MACROS) // [   See footnote 224 at page 260
+
+// 7.18.4.1 Macros for minimum-width integer constants
+
+#define INT8_C(val)  val##i8
+#define INT16_C(val) val##i16
+#define INT32_C(val) val##i32
+#define INT64_C(val) val##i64
+
+#define UINT8_C(val)  val##ui8
+#define UINT16_C(val) val##ui16
+#define UINT32_C(val) val##ui32
+#define UINT64_C(val) val##ui64
+
+// 7.18.4.2 Macros for greatest-width integer constants
+#define INTMAX_C   INT64_C
+#define UINTMAX_C  UINT64_C
+
+#endif // __STDC_CONSTANT_MACROS ]
+
+
+#endif // _MSC_STDINT_H_ ]

.venv/Lib/site-packages/pandas/_libs/src/headers/portable.h

@@ -0,0 +1,16 @@
+#ifndef _PANDAS_PORTABLE_H_
+#define _PANDAS_PORTABLE_H_
+
+#if defined(_MSC_VER)
+#define strcasecmp( s1, s2 ) _stricmp( s1, s2 )
+#endif
+
+// GH-23516 - works around locale perf issues
+// from MUSL libc, MIT Licensed - see LICENSES
+#define isdigit_ascii(c) (((unsigned)(c) - '0') < 10u)
+#define getdigit_ascii(c, default) (isdigit_ascii(c) ? ((int)((c) - '0')) : default)
+#define isspace_ascii(c) (((c) == ' ') || (((unsigned)(c) - '\t') < 5))
+#define toupper_ascii(c) ((((unsigned)(c) - 'a') < 26) ? ((c) & 0x5f) : (c))
+#define tolower_ascii(c) ((((unsigned)(c) - 'A') < 26) ? ((c) | 0x20) : (c))
+
+#endif

.venv/Lib/site-packages/pandas/_libs/src/headers/stdint.h

@@ -0,0 +1,10 @@
+#ifndef _PANDAS_STDINT_H_
+#define _PANDAS_STDINT_H_
+
+#if defined(_MSC_VER) && (_MSC_VER < 1900)
+#include "ms_stdint.h"
+#else
+#include <stdint.h>
+#endif
+
+#endif

.venv/Lib/site-packages/pandas/_libs/src/inline_helper.h

@@ -0,0 +1,27 @@
+/*
+Copyright (c) 2016, PyData Development Team
+All rights reserved.
+
+Distributed under the terms of the BSD Simplified License.
+
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+#ifndef PANDAS__LIBS_SRC_INLINE_HELPER_H_
+#define PANDAS__LIBS_SRC_INLINE_HELPER_H_
+
+#ifndef PANDAS_INLINE
+  #if defined(__clang__)
+    #define PANDAS_INLINE static __inline__ __attribute__ ((__unused__))
+  #elif defined(__GNUC__)
+    #define PANDAS_INLINE static __inline__
+  #elif defined(_MSC_VER)
+    #define PANDAS_INLINE static __inline
+  #elif defined(__STDC_VERSION__) && __STDC_VERSION__ >= 199901L
+    #define PANDAS_INLINE static inline
+  #else
+    #define PANDAS_INLINE
+  #endif  // __GNUC__
+#endif  // PANDAS_INLINE
+
+#endif  // PANDAS__LIBS_SRC_INLINE_HELPER_H_

.venv/Lib/site-packages/pandas/_libs/src/klib/khash.h

@@ -0,0 +1,719 @@
+/* The MIT License
+
+   Copyright (c) 2008, 2009, 2011 by Attractive Chaos <attractor@live.co.uk>
+
+   Permission is hereby granted, free of charge, to any person obtaining
+   a copy of this software and associated documentation files (the
+   "Software"), to deal in the Software without restriction, including
+   without limitation the rights to use, copy, modify, merge, publish,
+   distribute, sublicense, and/or sell copies of the Software, and to
+   permit persons to whom the Software is furnished to do so, subject to
+   the following conditions:
+
+   The above copyright notice and this permission notice shall be
+   included in all copies or substantial portions of the Software.
+
+   THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+   EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+   MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+   NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS
+   BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN
+   ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+   CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+   SOFTWARE.
+*/
+
+/*
+  An example:
+
+#include "khash.h"
+KHASH_MAP_INIT_INT(32, char)
+int main() {
+	int ret, is_missing;
+	khiter_t k;
+	khash_t(32) *h = kh_init(32);
+	k = kh_put(32, h, 5, &ret);
+	if (!ret) kh_del(32, h, k);
+	kh_value(h, k) = 10;
+	k = kh_get(32, h, 10);
+	is_missing = (k == kh_end(h));
+	k = kh_get(32, h, 5);
+	kh_del(32, h, k);
+	for (k = kh_begin(h); k != kh_end(h); ++k)
+		if (kh_exist(h, k)) kh_value(h, k) = 1;
+	kh_destroy(32, h);
+	return 0;
+}
+*/
+
+/*
+  2011-09-16 (0.2.6):
+
+	* The capacity is a power of 2. This seems to dramatically improve the
+	  speed for simple keys. Thank Zilong Tan for the suggestion. Reference:
+
+	   - https://github.com/stefanocasazza/ULib
+	   - https://nothings.org/computer/judy/
+
+	* Allow to optionally use linear probing which usually has better
+	  performance for random input. Double hashing is still the default as it
+	  is more robust to certain non-random input.
+
+	* Added Wang's integer hash function (not used by default). This hash
+	  function is more robust to certain non-random input.
+
+  2011-02-14 (0.2.5):
+
+    * Allow to declare global functions.
+
+  2009-09-26 (0.2.4):
+
+    * Improve portability
+
+  2008-09-19 (0.2.3):
+
+	* Corrected the example
+	* Improved interfaces
+
+  2008-09-11 (0.2.2):
+
+	* Improved speed a little in kh_put()
+
+  2008-09-10 (0.2.1):
+
+	* Added kh_clear()
+	* Fixed a compiling error
+
+  2008-09-02 (0.2.0):
+
+	* Changed to token concatenation which increases flexibility.
+
+  2008-08-31 (0.1.2):
+
+	* Fixed a bug in kh_get(), which has not been tested previously.
+
+  2008-08-31 (0.1.1):
+
+	* Added destructor
+*/
+
+
+#ifndef __AC_KHASH_H
+#define __AC_KHASH_H
+
+/*!
+  @header
+
+  Generic hash table library.
+ */
+
+#define AC_VERSION_KHASH_H "0.2.6"
+
+#include <stdlib.h>
+#include <string.h>
+#include <limits.h>
+#include "../inline_helper.h"
+
+
+// hooks for memory allocator, C-runtime allocator used per default
+#ifndef KHASH_MALLOC
+#define KHASH_MALLOC malloc
+#endif
+
+#ifndef KHASH_REALLOC
+#define KHASH_REALLOC realloc
+#endif
+
+#ifndef KHASH_CALLOC
+#define KHASH_CALLOC calloc
+#endif
+
+#ifndef KHASH_FREE
+#define KHASH_FREE free
+#endif
+
+
+#if UINT_MAX == 0xffffffffu
+typedef unsigned int khuint32_t;
+typedef signed int khint32_t;
+#elif ULONG_MAX == 0xffffffffu
+typedef unsigned long khuint32_t;
+typedef signed long khint32_t;
+#endif
+
+#if ULONG_MAX == ULLONG_MAX
+typedef unsigned long khuint64_t;
+typedef signed long khint64_t;
+#else
+typedef unsigned long long khuint64_t;
+typedef signed long long khint64_t;
+#endif
+
+#if UINT_MAX == 0xffffu
+typedef unsigned int khuint16_t;
+typedef signed int khint16_t;
+#elif USHRT_MAX == 0xffffu
+typedef unsigned short khuint16_t;
+typedef signed short khint16_t;
+#endif
+
+#if UCHAR_MAX == 0xffu
+typedef unsigned char khuint8_t;
+typedef signed char khint8_t;
+#endif
+
+typedef double khfloat64_t;
+typedef float khfloat32_t;
+
+typedef khuint32_t khuint_t;
+typedef khuint_t khiter_t;
+
+#define __ac_isempty(flag, i) ((flag[i>>5]>>(i&0x1fU))&1)
+#define __ac_isdel(flag, i) (0)
+#define __ac_iseither(flag, i) __ac_isempty(flag, i)
+#define __ac_set_isdel_false(flag, i) (0)
+#define __ac_set_isempty_false(flag, i) (flag[i>>5]&=~(1ul<<(i&0x1fU)))
+#define __ac_set_isempty_true(flag, i) (flag[i>>5]|=(1ul<<(i&0x1fU)))
+#define __ac_set_isboth_false(flag, i) __ac_set_isempty_false(flag, i)
+#define __ac_set_isdel_true(flag, i) ((void)0)
+
+
+// specializations of https://github.com/aappleby/smhasher/blob/master/src/MurmurHash2.cpp
+khuint32_t PANDAS_INLINE murmur2_32to32(khuint32_t k){
+    const khuint32_t SEED = 0xc70f6907UL;
+    // 'm' and 'r' are mixing constants generated offline.
+    // They're not really 'magic', they just happen to work well.
+    const khuint32_t M_32 = 0x5bd1e995;
+    const int R_32 = 24;
+
+    // Initialize the hash to a 'random' value
+    khuint32_t h = SEED ^ 4;
+
+    //handle 4 bytes:
+    k *= M_32;
+    k ^= k >> R_32;
+    k *= M_32;
+
+    h *= M_32;
+    h ^= k;
+
+    // Do a few final mixes of the hash to ensure the "last few
+    // bytes" are well-incorporated. (Really needed here?)
+    h ^= h >> 13;
+    h *= M_32;
+    h ^= h >> 15;
+    return h;
+}
+
+// it is possible to have a special x64-version, which would need less operations, but
+// using 32bit version always has also some benefits:
+//    - one code for 32bit and 64bit builds
+//    - the same case for 32bit and 64bit builds
+//    - no performance difference could be measured compared to a possible x64-version
+
+khuint32_t PANDAS_INLINE murmur2_32_32to32(khuint32_t k1, khuint32_t k2){
+    const khuint32_t SEED = 0xc70f6907UL;
+    // 'm' and 'r' are mixing constants generated offline.
+    // They're not really 'magic', they just happen to work well.
+    const khuint32_t M_32 = 0x5bd1e995;
+    const int R_32 = 24;
+
+    // Initialize the hash to a 'random' value
+    khuint32_t h = SEED ^ 4;
+
+    //handle first 4 bytes:
+    k1 *= M_32;
+    k1 ^= k1 >> R_32;
+    k1 *= M_32;
+
+    h *= M_32;
+    h ^= k1;
+
+    //handle second 4 bytes:
+    k2 *= M_32;
+    k2 ^= k2 >> R_32;
+    k2 *= M_32;
+
+    h *= M_32;
+    h ^= k2;
+
+    // Do a few final mixes of the hash to ensure the "last few
+    // bytes" are well-incorporated.
+    h ^= h >> 13;
+    h *= M_32;
+    h ^= h >> 15;
+    return h;
+}
+
+khuint32_t PANDAS_INLINE murmur2_64to32(khuint64_t k){
+    khuint32_t k1 = (khuint32_t)k;
+    khuint32_t k2 = (khuint32_t)(k >> 32);
+
+    return murmur2_32_32to32(k1, k2);
+}
+
+
+#ifdef KHASH_LINEAR
+#define __ac_inc(k, m) 1
+#else
+#define __ac_inc(k, m) (murmur2_32to32(k) | 1) & (m)
+#endif
+
+#define __ac_fsize(m) ((m) < 32? 1 : (m)>>5)
+
+#ifndef kroundup32
+#define kroundup32(x) (--(x), (x)|=(x)>>1, (x)|=(x)>>2, (x)|=(x)>>4, (x)|=(x)>>8, (x)|=(x)>>16, ++(x))
+#endif
+
+static const double __ac_HASH_UPPER = 0.77;
+
+#define KHASH_DECLARE(name, khkey_t, khval_t)		 					\
+	typedef struct {													\
+		khuint_t n_buckets, size, n_occupied, upper_bound;				\
+		khuint32_t *flags;												\
+		khkey_t *keys;													\
+		khval_t *vals;													\
+	} kh_##name##_t;													\
+	extern kh_##name##_t *kh_init_##name();								\
+	extern void kh_destroy_##name(kh_##name##_t *h);					\
+	extern void kh_clear_##name(kh_##name##_t *h);						\
+	extern khuint_t kh_get_##name(const kh_##name##_t *h, khkey_t key); 	\
+	extern void kh_resize_##name(kh_##name##_t *h, khuint_t new_n_buckets); \
+	extern khuint_t kh_put_##name(kh_##name##_t *h, khkey_t key, int *ret); \
+	extern void kh_del_##name(kh_##name##_t *h, khuint_t x);
+
+#define KHASH_INIT2(name, SCOPE, khkey_t, khval_t, kh_is_map, __hash_func, __hash_equal) \
+	typedef struct {													\
+		khuint_t n_buckets, size, n_occupied, upper_bound;				\
+		khuint32_t *flags;												\
+		khkey_t *keys;													\
+		khval_t *vals;													\
+	} kh_##name##_t;													\
+	SCOPE kh_##name##_t *kh_init_##name(void) {								\
+		return (kh_##name##_t*)KHASH_CALLOC(1, sizeof(kh_##name##_t));		\
+	}																	\
+	SCOPE void kh_destroy_##name(kh_##name##_t *h)						\
+	{																	\
+		if (h) {														\
+			KHASH_FREE(h->keys); KHASH_FREE(h->flags);								\
+			KHASH_FREE(h->vals);												\
+			KHASH_FREE(h);													\
+		}																\
+	}																	\
+	SCOPE void kh_clear_##name(kh_##name##_t *h)						\
+	{																	\
+		if (h && h->flags) {											\
+			memset(h->flags, 0xaa, __ac_fsize(h->n_buckets) * sizeof(khuint32_t)); \
+			h->size = h->n_occupied = 0;								\
+		}																\
+	}																	\
+	SCOPE khuint_t kh_get_##name(const kh_##name##_t *h, khkey_t key) 	\
+	{																	\
+		if (h->n_buckets) {												\
+			khuint_t inc, k, i, last, mask;								\
+			mask = h->n_buckets - 1;									\
+			k = __hash_func(key); i = k & mask;							\
+			inc = __ac_inc(k, mask); last = i; /* inc==1 for linear probing */ \
+			while (!__ac_isempty(h->flags, i) && (__ac_isdel(h->flags, i) || !__hash_equal(h->keys[i], key))) { \
+				i = (i + inc) & mask; 									\
+				if (i == last) return h->n_buckets;						\
+			}															\
+			return __ac_iseither(h->flags, i)? h->n_buckets : i;		\
+		} else return 0;												\
+	}																	\
+	SCOPE void kh_resize_##name(kh_##name##_t *h, khuint_t new_n_buckets) \
+	{ /* This function uses 0.25*n_bucktes bytes of working space instead of [sizeof(key_t+val_t)+.25]*n_buckets. */ \
+		khuint32_t *new_flags = 0;										\
+		khuint_t j = 1;													\
+		{																\
+			kroundup32(new_n_buckets); 									\
+			if (new_n_buckets < 4) new_n_buckets = 4;					\
+			if (h->size >= (khuint_t)(new_n_buckets * __ac_HASH_UPPER + 0.5)) j = 0;	/* requested size is too small */ \
+			else { /* hash table size to be changed (shrink or expand); rehash */ \
+				new_flags = (khuint32_t*)KHASH_MALLOC(__ac_fsize(new_n_buckets) * sizeof(khuint32_t));	\
+				memset(new_flags, 0xff, __ac_fsize(new_n_buckets) * sizeof(khuint32_t)); \
+				if (h->n_buckets < new_n_buckets) {	/* expand */		\
+					h->keys = (khkey_t*)KHASH_REALLOC(h->keys, new_n_buckets * sizeof(khkey_t)); \
+					if (kh_is_map) h->vals = (khval_t*)KHASH_REALLOC(h->vals, new_n_buckets * sizeof(khval_t)); \
+				} /* otherwise shrink */								\
+			}															\
+		}																\
+		if (j) { /* rehashing is needed */								\
+			for (j = 0; j != h->n_buckets; ++j) {						\
+				if (__ac_iseither(h->flags, j) == 0) {					\
+					khkey_t key = h->keys[j];							\
+					khval_t val;										\
+					khuint_t new_mask;									\
+					new_mask = new_n_buckets - 1; 						\
+					if (kh_is_map) val = h->vals[j];					\
+					__ac_set_isempty_true(h->flags, j);					\
+					while (1) { /* kick-out process; sort of like in Cuckoo hashing */ \
+						khuint_t inc, k, i;								\
+						k = __hash_func(key);							\
+						i = k & new_mask;								\
+						inc = __ac_inc(k, new_mask);					\
+						while (!__ac_isempty(new_flags, i)) i = (i + inc) & new_mask; \
+						__ac_set_isempty_false(new_flags, i);			\
+						if (i < h->n_buckets && __ac_iseither(h->flags, i) == 0) { /* kick out the existing element */ \
+							{ khkey_t tmp = h->keys[i]; h->keys[i] = key; key = tmp; } \
+							if (kh_is_map) { khval_t tmp = h->vals[i]; h->vals[i] = val; val = tmp; } \
+							__ac_set_isempty_true(h->flags, i); /* mark it as deleted in the old hash table */ \
+						} else { /* write the element and jump out of the loop */ \
+							h->keys[i] = key;							\
+							if (kh_is_map) h->vals[i] = val;			\
+							break;										\
+						}												\
+					}													\
+				}														\
+			}															\
+			if (h->n_buckets > new_n_buckets) { /* shrink the hash table */ \
+				h->keys = (khkey_t*)KHASH_REALLOC(h->keys, new_n_buckets * sizeof(khkey_t)); \
+				if (kh_is_map) h->vals = (khval_t*)KHASH_REALLOC(h->vals, new_n_buckets * sizeof(khval_t)); \
+			}															\
+			KHASH_FREE(h->flags); /* free the working space */				\
+			h->flags = new_flags;										\
+			h->n_buckets = new_n_buckets;								\
+			h->n_occupied = h->size;									\
+			h->upper_bound = (khuint_t)(h->n_buckets * __ac_HASH_UPPER + 0.5); \
+		}																\
+	}																	\
+	SCOPE khuint_t kh_put_##name(kh_##name##_t *h, khkey_t key, int *ret) \
+	{																	\
+		khuint_t x;														\
+		if (h->n_occupied >= h->upper_bound) { /* update the hash table */ \
+			if (h->n_buckets > (h->size<<1)) kh_resize_##name(h, h->n_buckets - 1); /* clear "deleted" elements */ \
+			else kh_resize_##name(h, h->n_buckets + 1); /* expand the hash table */ \
+		} /* TODO: to implement automatically shrinking; resize() already support shrinking */ \
+		{																\
+			khuint_t inc, k, i, site, last, mask = h->n_buckets - 1;		\
+			x = site = h->n_buckets; k = __hash_func(key); i = k & mask; \
+			if (__ac_isempty(h->flags, i)) x = i; /* for speed up */	\
+			else {														\
+				inc = __ac_inc(k, mask); last = i;						\
+				while (!__ac_isempty(h->flags, i) && (__ac_isdel(h->flags, i) || !__hash_equal(h->keys[i], key))) { \
+					if (__ac_isdel(h->flags, i)) site = i;				\
+					i = (i + inc) & mask; 								\
+					if (i == last) { x = site; break; }					\
+				}														\
+				if (x == h->n_buckets) {								\
+					if (__ac_isempty(h->flags, i) && site != h->n_buckets) x = site; \
+					else x = i;											\
+				}														\
+			}															\
+		}																\
+		if (__ac_isempty(h->flags, x)) { /* not present at all */		\
+			h->keys[x] = key;											\
+			__ac_set_isboth_false(h->flags, x);							\
+			++h->size; ++h->n_occupied;									\
+			*ret = 1;													\
+		} else if (__ac_isdel(h->flags, x)) { /* deleted */				\
+			h->keys[x] = key;											\
+			__ac_set_isboth_false(h->flags, x);							\
+			++h->size;													\
+			*ret = 2;													\
+		} else *ret = 0; /* Don't touch h->keys[x] if present and not deleted */ \
+		return x;														\
+	}																	\
+	SCOPE void kh_del_##name(kh_##name##_t *h, khuint_t x)				\
+	{																	\
+		if (x != h->n_buckets && !__ac_iseither(h->flags, x)) {			\
+			__ac_set_isdel_true(h->flags, x);							\
+			--h->size;													\
+		}																\
+	}
+
+#define KHASH_INIT(name, khkey_t, khval_t, kh_is_map, __hash_func, __hash_equal) \
+	KHASH_INIT2(name, PANDAS_INLINE, khkey_t, khval_t, kh_is_map, __hash_func, __hash_equal)
+
+/* --- BEGIN OF HASH FUNCTIONS --- */
+
+/*! @function
+  @abstract     Integer hash function
+  @param  key   The integer [khuint32_t]
+  @return       The hash value [khuint_t]
+ */
+#define kh_int_hash_func(key) (khuint32_t)(key)
+/*! @function
+  @abstract     Integer comparison function
+ */
+#define kh_int_hash_equal(a, b) ((a) == (b))
+/*! @function
+  @abstract     64-bit integer hash function
+  @param  key   The integer [khuint64_t]
+  @return       The hash value [khuint_t]
+ */
+PANDAS_INLINE khuint_t kh_int64_hash_func(khuint64_t key)
+{
+    return (khuint_t)((key)>>33^(key)^(key)<<11);
+}
+/*! @function
+  @abstract     64-bit integer comparison function
+ */
+#define kh_int64_hash_equal(a, b) ((a) == (b))
+
+/*! @function
+  @abstract     const char* hash function
+  @param  s     Pointer to a null terminated string
+  @return       The hash value
+ */
+PANDAS_INLINE khuint_t __ac_X31_hash_string(const char *s)
+{
+	khuint_t h = *s;
+	if (h) for (++s ; *s; ++s) h = (h << 5) - h + *s;
+	return h;
+}
+/*! @function
+  @abstract     Another interface to const char* hash function
+  @param  key   Pointer to a null terminated string [const char*]
+  @return       The hash value [khuint_t]
+ */
+#define kh_str_hash_func(key) __ac_X31_hash_string(key)
+/*! @function
+  @abstract     Const char* comparison function
+ */
+#define kh_str_hash_equal(a, b) (strcmp(a, b) == 0)
+
+PANDAS_INLINE khuint_t __ac_Wang_hash(khuint_t key)
+{
+    key += ~(key << 15);
+    key ^=  (key >> 10);
+    key +=  (key << 3);
+    key ^=  (key >> 6);
+    key += ~(key << 11);
+    key ^=  (key >> 16);
+    return key;
+}
+#define kh_int_hash_func2(k) __ac_Wang_hash((khuint_t)key)
+
+/* --- END OF HASH FUNCTIONS --- */
+
+/* Other convenient macros... */
+
+/*!
+  @abstract Type of the hash table.
+  @param  name  Name of the hash table [symbol]
+ */
+#define khash_t(name) kh_##name##_t
+
+/*! @function
+  @abstract     Initiate a hash table.
+  @param  name  Name of the hash table [symbol]
+  @return       Pointer to the hash table [khash_t(name)*]
+ */
+#define kh_init(name) kh_init_##name(void)
+
+/*! @function
+  @abstract     Destroy a hash table.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+ */
+#define kh_destroy(name, h) kh_destroy_##name(h)
+
+/*! @function
+  @abstract     Reset a hash table without deallocating memory.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+ */
+#define kh_clear(name, h) kh_clear_##name(h)
+
+/*! @function
+  @abstract     Resize a hash table.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  s     New size [khuint_t]
+ */
+#define kh_resize(name, h, s) kh_resize_##name(h, s)
+
+/*! @function
+  @abstract     Insert a key to the hash table.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  k     Key [type of keys]
+  @param  r     Extra return code: 0 if the key is present in the hash table;
+                1 if the bucket is empty (never used); 2 if the element in
+				the bucket has been deleted [int*]
+  @return       Iterator to the inserted element [khuint_t]
+ */
+#define kh_put(name, h, k, r) kh_put_##name(h, k, r)
+
+/*! @function
+  @abstract     Retrieve a key from the hash table.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  k     Key [type of keys]
+  @return       Iterator to the found element, or kh_end(h) is the element is absent [khuint_t]
+ */
+#define kh_get(name, h, k) kh_get_##name(h, k)
+
+/*! @function
+  @abstract     Remove a key from the hash table.
+  @param  name  Name of the hash table [symbol]
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  k     Iterator to the element to be deleted [khuint_t]
+ */
+#define kh_del(name, h, k) kh_del_##name(h, k)
+
+/*! @function
+  @abstract     Test whether a bucket contains data.
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  x     Iterator to the bucket [khuint_t]
+  @return       1 if containing data; 0 otherwise [int]
+ */
+#define kh_exist(h, x) (!__ac_iseither((h)->flags, (x)))
+
+/*! @function
+  @abstract     Get key given an iterator
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  x     Iterator to the bucket [khuint_t]
+  @return       Key [type of keys]
+ */
+#define kh_key(h, x) ((h)->keys[x])
+
+/*! @function
+  @abstract     Get value given an iterator
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @param  x     Iterator to the bucket [khuint_t]
+  @return       Value [type of values]
+  @discussion   For hash sets, calling this results in segfault.
+ */
+#define kh_val(h, x) ((h)->vals[x])
+
+/*! @function
+  @abstract     Alias of kh_val()
+ */
+#define kh_value(h, x) ((h)->vals[x])
+
+/*! @function
+  @abstract     Get the start iterator
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @return       The start iterator [khuint_t]
+ */
+#define kh_begin(h) (khuint_t)(0)
+
+/*! @function
+  @abstract     Get the end iterator
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @return       The end iterator [khuint_t]
+ */
+#define kh_end(h) ((h)->n_buckets)
+
+/*! @function
+  @abstract     Get the number of elements in the hash table
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @return       Number of elements in the hash table [khuint_t]
+ */
+#define kh_size(h) ((h)->size)
+
+/*! @function
+  @abstract     Get the number of buckets in the hash table
+  @param  h     Pointer to the hash table [khash_t(name)*]
+  @return       Number of buckets in the hash table [khuint_t]
+ */
+#define kh_n_buckets(h) ((h)->n_buckets)
+
+/* More convenient interfaces */
+
+/*! @function
+  @abstract     Instantiate a hash set containing integer keys
+  @param  name  Name of the hash table [symbol]
+ */
+#define KHASH_SET_INIT_INT(name)										\
+	KHASH_INIT(name, khint32_t, char, 0, kh_int_hash_func, kh_int_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing integer keys
+  @param  name  Name of the hash table [symbol]
+  @param  khval_t  Type of values [type]
+ */
+#define KHASH_MAP_INIT_INT(name, khval_t)								\
+	KHASH_INIT(name, khint32_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+#define KHASH_MAP_INIT_UINT(name, khval_t)								\
+	KHASH_INIT(name, khuint32_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing 64-bit integer keys
+  @param  name  Name of the hash table [symbol]
+ */
+#define KHASH_SET_INIT_UINT64(name)										\
+	KHASH_INIT(name, khuint64_t, char, 0, kh_int64_hash_func, kh_int64_hash_equal)
+
+#define KHASH_SET_INIT_INT64(name)										\
+	KHASH_INIT(name, khint64_t, char, 0, kh_int64_hash_func, kh_int64_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing 64-bit integer keys
+  @param  name  Name of the hash table [symbol]
+  @param  khval_t  Type of values [type]
+ */
+#define KHASH_MAP_INIT_UINT64(name, khval_t)								\
+	KHASH_INIT(name, khuint64_t, khval_t, 1, kh_int64_hash_func, kh_int64_hash_equal)
+
+#define KHASH_MAP_INIT_INT64(name, khval_t)								\
+	KHASH_INIT(name, khint64_t, khval_t, 1, kh_int64_hash_func, kh_int64_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing 16bit-integer keys
+  @param  name  Name of the hash table [symbol]
+  @param  khval_t  Type of values [type]
+ */
+#define KHASH_MAP_INIT_INT16(name, khval_t)								\
+	KHASH_INIT(name, khint16_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+#define KHASH_MAP_INIT_UINT16(name, khval_t)								\
+	KHASH_INIT(name, khuint16_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing 8bit-integer keys
+  @param  name  Name of the hash table [symbol]
+  @param  khval_t  Type of values [type]
+ */
+#define KHASH_MAP_INIT_INT8(name, khval_t)								\
+	KHASH_INIT(name, khint8_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+#define KHASH_MAP_INIT_UINT8(name, khval_t)								\
+	KHASH_INIT(name, khuint8_t, khval_t, 1, kh_int_hash_func, kh_int_hash_equal)
+
+
+
+typedef const char *kh_cstr_t;
+/*! @function
+  @abstract     Instantiate a hash map containing const char* keys
+  @param  name  Name of the hash table [symbol]
+ */
+#define KHASH_SET_INIT_STR(name)										\
+	KHASH_INIT(name, kh_cstr_t, char, 0, kh_str_hash_func, kh_str_hash_equal)
+
+/*! @function
+  @abstract     Instantiate a hash map containing const char* keys
+  @param  name  Name of the hash table [symbol]
+  @param  khval_t  Type of values [type]
+ */
+#define KHASH_MAP_INIT_STR(name, khval_t)								\
+	KHASH_INIT(name, kh_cstr_t, khval_t, 1, kh_str_hash_func, kh_str_hash_equal)
+
+
+#define kh_exist_str(h, k) (kh_exist(h, k))
+#define kh_exist_float64(h, k) (kh_exist(h, k))
+#define kh_exist_uint64(h, k) (kh_exist(h, k))
+#define kh_exist_int64(h, k) (kh_exist(h, k))
+#define kh_exist_float32(h, k) (kh_exist(h, k))
+#define kh_exist_int32(h, k) (kh_exist(h, k))
+#define kh_exist_uint32(h, k) (kh_exist(h, k))
+#define kh_exist_int16(h, k) (kh_exist(h, k))
+#define kh_exist_uint16(h, k) (kh_exist(h, k))
+#define kh_exist_int8(h, k) (kh_exist(h, k))
+#define kh_exist_uint8(h, k) (kh_exist(h, k))
+
+KHASH_MAP_INIT_STR(str, size_t)
+KHASH_MAP_INIT_INT(int32, size_t)
+KHASH_MAP_INIT_UINT(uint32, size_t)
+KHASH_MAP_INIT_INT64(int64, size_t)
+KHASH_MAP_INIT_UINT64(uint64, size_t)
+KHASH_MAP_INIT_INT16(int16, size_t)
+KHASH_MAP_INIT_UINT16(uint16, size_t)
+KHASH_MAP_INIT_INT8(int8, size_t)
+KHASH_MAP_INIT_UINT8(uint8, size_t)
+
+
+#endif /* __AC_KHASH_H */

.venv/Lib/site-packages/pandas/_libs/src/klib/khash_python.h

@@ -0,0 +1,446 @@
+#include <string.h>
+#include <Python.h>
+
+
+// use numpy's definitions for complex
+#include <numpy/arrayobject.h>
+typedef npy_complex64 khcomplex64_t;
+typedef npy_complex128 khcomplex128_t;
+
+
+
+// khash should report usage to tracemalloc
+#if PY_VERSION_HEX >= 0x03060000
+#include <pymem.h>
+#if PY_VERSION_HEX < 0x03070000
+#define PyTraceMalloc_Track _PyTraceMalloc_Track
+#define PyTraceMalloc_Untrack _PyTraceMalloc_Untrack
+#endif
+#else
+#define PyTraceMalloc_Track(...)
+#define PyTraceMalloc_Untrack(...)
+#endif
+
+
+static const int KHASH_TRACE_DOMAIN = 424242;
+void *traced_malloc(size_t size){
+    void * ptr = malloc(size);
+    if(ptr!=NULL){
+        PyTraceMalloc_Track(KHASH_TRACE_DOMAIN, (uintptr_t)ptr, size);
+    }
+    return ptr;
+}
+
+void *traced_calloc(size_t num, size_t size){
+    void * ptr = calloc(num, size);
+    if(ptr!=NULL){
+        PyTraceMalloc_Track(KHASH_TRACE_DOMAIN, (uintptr_t)ptr, num*size);
+    }
+    return ptr;
+}
+
+void *traced_realloc(void* old_ptr, size_t size){
+    void * ptr = realloc(old_ptr, size);
+    if(ptr!=NULL){
+        if(old_ptr != ptr){
+            PyTraceMalloc_Untrack(KHASH_TRACE_DOMAIN, (uintptr_t)old_ptr);
+        }
+        PyTraceMalloc_Track(KHASH_TRACE_DOMAIN, (uintptr_t)ptr, size);
+    }
+    return ptr;
+}
+
+void traced_free(void* ptr){
+    if(ptr!=NULL){
+        PyTraceMalloc_Untrack(KHASH_TRACE_DOMAIN, (uintptr_t)ptr);
+    }
+    free(ptr);
+}
+
+
+#define KHASH_MALLOC traced_malloc
+#define KHASH_REALLOC traced_realloc
+#define KHASH_CALLOC traced_calloc
+#define KHASH_FREE traced_free
+#include "khash.h"
+
+// Previously we were using the built in cpython hash function for doubles
+// python 2.7 https://github.com/python/cpython/blob/2.7/Objects/object.c#L1021
+// python 3.5 https://github.com/python/cpython/blob/3.5/Python/pyhash.c#L85
+
+// The python 3 hash function has the invariant hash(x) == hash(int(x)) == hash(decimal(x))
+// and the size of hash may be different by platform / version (long in py2, Py_ssize_t in py3).
+// We don't need those invariants because types will be cast before hashing, and if Py_ssize_t
+// is 64 bits the truncation causes collision issues.  Given all that, we use our own
+// simple hash, viewing the double bytes as an int64 and using khash's default
+// hash for 64 bit integers.
+// GH 13436 showed that _Py_HashDouble doesn't work well with khash
+// GH 28303 showed, that the simple xoring-version isn't good enough
+// See GH 36729 for evaluation of the currently used murmur2-hash version
+// An interesting alternative to expensive murmur2-hash would be to change
+// the probing strategy and use e.g. the probing strategy from CPython's
+// implementation of dicts, which shines for smaller sizes but is more
+// predisposed to superlinear running times (see GH 36729 for comparison)
+
+
+khuint64_t PANDAS_INLINE asuint64(double key) {
+    khuint64_t val;
+    memcpy(&val, &key, sizeof(double));
+    return val;
+}
+
+khuint32_t PANDAS_INLINE asuint32(float key) {
+    khuint32_t val;
+    memcpy(&val, &key, sizeof(float));
+    return val;
+}
+
+#define ZERO_HASH 0
+#define NAN_HASH  0
+
+khuint32_t PANDAS_INLINE kh_float64_hash_func(double val){
+    // 0.0 and -0.0 should have the same hash:
+    if (val == 0.0){
+        return ZERO_HASH;
+    }
+    // all nans should have the same hash:
+    if ( val!=val ){
+        return NAN_HASH;
+    }
+    khuint64_t as_int = asuint64(val);
+    return murmur2_64to32(as_int);
+}
+
+khuint32_t PANDAS_INLINE kh_float32_hash_func(float val){
+    // 0.0 and -0.0 should have the same hash:
+    if (val == 0.0f){
+        return ZERO_HASH;
+    }
+    // all nans should have the same hash:
+    if ( val!=val ){
+        return NAN_HASH;
+    }
+    khuint32_t as_int = asuint32(val);
+    return murmur2_32to32(as_int);
+}
+
+#define kh_floats_hash_equal(a, b) ((a) == (b) || ((b) != (b) && (a) != (a)))
+
+#define KHASH_MAP_INIT_FLOAT64(name, khval_t)								\
+	KHASH_INIT(name, khfloat64_t, khval_t, 1, kh_float64_hash_func, kh_floats_hash_equal)
+
+KHASH_MAP_INIT_FLOAT64(float64, size_t)
+
+#define KHASH_MAP_INIT_FLOAT32(name, khval_t)								\
+	KHASH_INIT(name, khfloat32_t, khval_t, 1, kh_float32_hash_func, kh_floats_hash_equal)
+
+KHASH_MAP_INIT_FLOAT32(float32, size_t)
+
+khint32_t PANDAS_INLINE kh_complex128_hash_func(khcomplex128_t val){
+    return kh_float64_hash_func(val.real)^kh_float64_hash_func(val.imag);
+}
+khint32_t PANDAS_INLINE kh_complex64_hash_func(khcomplex64_t val){
+    return kh_float32_hash_func(val.real)^kh_float32_hash_func(val.imag);
+}
+
+#define kh_complex_hash_equal(a, b) \
+  (kh_floats_hash_equal(a.real, b.real) && kh_floats_hash_equal(a.imag, b.imag))
+
+
+#define KHASH_MAP_INIT_COMPLEX64(name, khval_t)								\
+	KHASH_INIT(name, khcomplex64_t, khval_t, 1, kh_complex64_hash_func, kh_complex_hash_equal)
+
+KHASH_MAP_INIT_COMPLEX64(complex64, size_t)
+
+
+#define KHASH_MAP_INIT_COMPLEX128(name, khval_t)								\
+	KHASH_INIT(name, khcomplex128_t, khval_t, 1, kh_complex128_hash_func, kh_complex_hash_equal)
+
+KHASH_MAP_INIT_COMPLEX128(complex128, size_t)
+
+
+#define kh_exist_complex64(h, k) (kh_exist(h, k))
+#define kh_exist_complex128(h, k) (kh_exist(h, k))
+
+
+// NaN-floats should be in the same equivalency class, see GH 22119
+int PANDAS_INLINE floatobject_cmp(PyFloatObject* a, PyFloatObject* b){
+    return (
+             Py_IS_NAN(PyFloat_AS_DOUBLE(a)) &&
+             Py_IS_NAN(PyFloat_AS_DOUBLE(b))
+           )
+           ||
+           ( PyFloat_AS_DOUBLE(a) == PyFloat_AS_DOUBLE(b) );
+}
+
+
+// NaNs should be in the same equivalency class, see GH 41836
+// PyObject_RichCompareBool for complexobjects has a different behavior
+// needs to be replaced
+int PANDAS_INLINE complexobject_cmp(PyComplexObject* a, PyComplexObject* b){
+    return (
+                Py_IS_NAN(a->cval.real) &&
+                Py_IS_NAN(b->cval.real) &&
+                Py_IS_NAN(a->cval.imag) &&
+                Py_IS_NAN(b->cval.imag)
+           )
+           ||
+           (
+                Py_IS_NAN(a->cval.real) &&
+                Py_IS_NAN(b->cval.real) &&
+                a->cval.imag == b->cval.imag
+           )
+           ||
+           (
+                a->cval.real == b->cval.real &&
+                Py_IS_NAN(a->cval.imag) &&
+                Py_IS_NAN(b->cval.imag)
+           )
+           ||
+           (
+                a->cval.real == b->cval.real &&
+                a->cval.imag == b->cval.imag
+           );
+}
+
+int PANDAS_INLINE pyobject_cmp(PyObject* a, PyObject* b);
+
+
+// replacing PyObject_RichCompareBool (NaN!=NaN) with pyobject_cmp (NaN==NaN),
+// which treats NaNs as equivalent
+// see GH 41836
+int PANDAS_INLINE tupleobject_cmp(PyTupleObject* a, PyTupleObject* b){
+    Py_ssize_t i;
+
+    if (Py_SIZE(a) != Py_SIZE(b)) {
+        return 0;
+    }
+
+    for (i = 0; i < Py_SIZE(a); ++i) {
+        if (!pyobject_cmp(PyTuple_GET_ITEM(a, i), PyTuple_GET_ITEM(b, i))) {
+            return 0;
+        }
+    }
+    return 1;
+}
+
+
+int PANDAS_INLINE pyobject_cmp(PyObject* a, PyObject* b) {
+    if (a == b) {
+        return 1;
+    }
+    if (Py_TYPE(a) == Py_TYPE(b)) {
+        // special handling for some built-in types which could have NaNs
+        // as we would like to have them equivalent, but the usual
+        // PyObject_RichCompareBool would return False
+        if (PyFloat_CheckExact(a)) {
+            return floatobject_cmp((PyFloatObject*)a, (PyFloatObject*)b);
+        }
+        if (PyComplex_CheckExact(a)) {
+            return complexobject_cmp((PyComplexObject*)a, (PyComplexObject*)b);
+        }
+        if (PyTuple_CheckExact(a)) {
+            return tupleobject_cmp((PyTupleObject*)a, (PyTupleObject*)b);
+        }
+        // frozenset isn't yet supported
+    }
+
+	int result = PyObject_RichCompareBool(a, b, Py_EQ);
+	if (result < 0) {
+		PyErr_Clear();
+		return 0;
+	}
+	return result;
+}
+
+
+Py_hash_t PANDAS_INLINE _Pandas_HashDouble(double val) {
+    //Since Python3.10, nan is no longer has hash 0
+    if (Py_IS_NAN(val)) {
+        return 0;
+    }
+#if PY_VERSION_HEX < 0x030A0000
+    return _Py_HashDouble(val);
+#else
+    return _Py_HashDouble(NULL, val);
+#endif
+}
+
+
+Py_hash_t PANDAS_INLINE floatobject_hash(PyFloatObject* key) {
+    return _Pandas_HashDouble(PyFloat_AS_DOUBLE(key));
+}
+
+
+#define _PandasHASH_IMAG 1000003UL
+
+// replaces _Py_HashDouble with _Pandas_HashDouble
+Py_hash_t PANDAS_INLINE complexobject_hash(PyComplexObject* key) {
+    Py_uhash_t realhash = (Py_uhash_t)_Pandas_HashDouble(key->cval.real);
+    Py_uhash_t imaghash = (Py_uhash_t)_Pandas_HashDouble(key->cval.imag);
+    if (realhash == (Py_uhash_t)-1 || imaghash == (Py_uhash_t)-1) {
+        return -1;
+    }
+    Py_uhash_t combined = realhash + _PandasHASH_IMAG * imaghash;
+    if (combined == (Py_uhash_t)-1) {
+        return -2;
+    }
+    return (Py_hash_t)combined;
+}
+
+
+khuint32_t PANDAS_INLINE kh_python_hash_func(PyObject* key);
+
+//we could use any hashing algorithm, this is the original CPython's for tuples
+
+#if SIZEOF_PY_UHASH_T > 4
+#define _PandasHASH_XXPRIME_1 ((Py_uhash_t)11400714785074694791ULL)
+#define _PandasHASH_XXPRIME_2 ((Py_uhash_t)14029467366897019727ULL)
+#define _PandasHASH_XXPRIME_5 ((Py_uhash_t)2870177450012600261ULL)
+#define _PandasHASH_XXROTATE(x) ((x << 31) | (x >> 33))  /* Rotate left 31 bits */
+#else
+#define _PandasHASH_XXPRIME_1 ((Py_uhash_t)2654435761UL)
+#define _PandasHASH_XXPRIME_2 ((Py_uhash_t)2246822519UL)
+#define _PandasHASH_XXPRIME_5 ((Py_uhash_t)374761393UL)
+#define _PandasHASH_XXROTATE(x) ((x << 13) | (x >> 19))  /* Rotate left 13 bits */
+#endif
+
+Py_hash_t PANDAS_INLINE tupleobject_hash(PyTupleObject* key) {
+    Py_ssize_t i, len = Py_SIZE(key);
+    PyObject **item = key->ob_item;
+
+    Py_uhash_t acc = _PandasHASH_XXPRIME_5;
+    for (i = 0; i < len; i++) {
+        Py_uhash_t lane = kh_python_hash_func(item[i]);
+        if (lane == (Py_uhash_t)-1) {
+            return -1;
+        }
+        acc += lane * _PandasHASH_XXPRIME_2;
+        acc = _PandasHASH_XXROTATE(acc);
+        acc *= _PandasHASH_XXPRIME_1;
+    }
+
+    /* Add input length, mangled to keep the historical value of hash(()). */
+    acc += len ^ (_PandasHASH_XXPRIME_5 ^ 3527539UL);
+
+    if (acc == (Py_uhash_t)-1) {
+        return 1546275796;
+    }
+    return acc;
+}
+
+
+khuint32_t PANDAS_INLINE kh_python_hash_func(PyObject* key) {
+    Py_hash_t hash;
+    // For PyObject_Hash holds:
+    //    hash(0.0) == 0 == hash(-0.0)
+    //    yet for different nan-objects different hash-values
+    //    are possible
+    if (PyFloat_CheckExact(key)) {
+        // we cannot use kh_float64_hash_func
+        // because float(k) == k holds for any int-object k
+        // and kh_float64_hash_func doesn't respect it
+        hash = floatobject_hash((PyFloatObject*)key);
+    }
+    else if (PyComplex_CheckExact(key)) {
+        // we cannot use kh_complex128_hash_func
+        // because complex(k,0) == k holds for any int-object k
+        // and kh_complex128_hash_func doesn't respect it
+        hash = complexobject_hash((PyComplexObject*)key);
+    }
+    else if (PyTuple_CheckExact(key)) {
+        hash = tupleobject_hash((PyTupleObject*)key);
+    }
+    else {
+        hash = PyObject_Hash(key);
+    }
+
+	if (hash == -1) {
+		PyErr_Clear();
+		return 0;
+	}
+    #if SIZEOF_PY_HASH_T == 4
+        // it is already 32bit value
+        return hash;
+    #else
+        // for 64bit builds,
+        // we need information of the upper 32bits as well
+        // see GH 37615
+        khuint64_t as_uint = (khuint64_t) hash;
+        // uints avoid undefined behavior of signed ints
+        return (as_uint>>32)^as_uint;
+    #endif
+}
+
+
+#define kh_python_hash_equal(a, b) (pyobject_cmp(a, b))
+
+
+// Python object
+
+typedef PyObject* kh_pyobject_t;
+
+#define KHASH_MAP_INIT_PYOBJECT(name, khval_t)							\
+	KHASH_INIT(name, kh_pyobject_t, khval_t, 1,						\
+			   kh_python_hash_func, kh_python_hash_equal)
+
+KHASH_MAP_INIT_PYOBJECT(pymap, Py_ssize_t)
+
+#define KHASH_SET_INIT_PYOBJECT(name)                                  \
+	KHASH_INIT(name, kh_pyobject_t, char, 0,     \
+			   kh_python_hash_func, kh_python_hash_equal)
+
+KHASH_SET_INIT_PYOBJECT(pyset)
+
+#define kh_exist_pymap(h, k) (kh_exist(h, k))
+#define kh_exist_pyset(h, k) (kh_exist(h, k))
+
+KHASH_MAP_INIT_STR(strbox, kh_pyobject_t)
+
+typedef struct {
+	kh_str_t *table;
+	int starts[256];
+} kh_str_starts_t;
+
+typedef kh_str_starts_t* p_kh_str_starts_t;
+
+p_kh_str_starts_t PANDAS_INLINE kh_init_str_starts(void) {
+	kh_str_starts_t *result = (kh_str_starts_t*)KHASH_CALLOC(1, sizeof(kh_str_starts_t));
+	result->table = kh_init_str();
+	return result;
+}
+
+khuint_t PANDAS_INLINE kh_put_str_starts_item(kh_str_starts_t* table, char* key, int* ret) {
+    khuint_t result = kh_put_str(table->table, key, ret);
+	if (*ret != 0) {
+		table->starts[(unsigned char)key[0]] = 1;
+	}
+    return result;
+}
+
+khuint_t PANDAS_INLINE kh_get_str_starts_item(const kh_str_starts_t* table, const char* key) {
+    unsigned char ch = *key;
+	if (table->starts[ch]) {
+		if (ch == '\0' || kh_get_str(table->table, key) != table->table->n_buckets) return 1;
+	}
+    return 0;
+}
+
+void PANDAS_INLINE kh_destroy_str_starts(kh_str_starts_t* table) {
+	kh_destroy_str(table->table);
+	KHASH_FREE(table);
+}
+
+void PANDAS_INLINE kh_resize_str_starts(kh_str_starts_t* table, khuint_t val) {
+	kh_resize_str(table->table, val);
+}
+
+// utility function: given the number of elements
+// returns number of necessary buckets
+khuint_t PANDAS_INLINE kh_needed_n_buckets(khuint_t n_elements){
+    khuint_t candidate = n_elements;
+    kroundup32(candidate);
+    khuint_t upper_bound = (khuint_t)(candidate * __ac_HASH_UPPER + 0.5);
+    return (upper_bound < n_elements) ? 2*candidate : candidate;
+
+}

.venv/Lib/site-packages/pandas/_libs/src/parse_helper.h

@@ -0,0 +1,100 @@
+/*
+Copyright (c) 2016, PyData Development Team
+All rights reserved.
+
+Distributed under the terms of the BSD Simplified License.
+
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+#ifndef PANDAS__LIBS_SRC_PARSE_HELPER_H_
+#define PANDAS__LIBS_SRC_PARSE_HELPER_H_
+
+#include <float.h>
+#include "parser/tokenizer.h"
+
+int to_double(char *item, double *p_value, char sci, char decimal,
+              int *maybe_int) {
+    char *p_end = NULL;
+    int error = 0;
+
+    /* Switch to precise xstrtod GH 31364 */
+    *p_value = precise_xstrtod(item, &p_end, decimal, sci, '\0', 1,
+                               &error, maybe_int);
+
+    return (error == 0) && (!*p_end);
+}
+
+int floatify(PyObject *str, double *result, int *maybe_int) {
+    int status;
+    char *data;
+    PyObject *tmp = NULL;
+    const char sci = 'E';
+    const char dec = '.';
+
+    if (PyBytes_Check(str)) {
+        data = PyBytes_AS_STRING(str);
+    } else if (PyUnicode_Check(str)) {
+        tmp = PyUnicode_AsUTF8String(str);
+        if (tmp == NULL) {
+            return -1;
+        }
+        data = PyBytes_AS_STRING(tmp);
+    } else {
+        PyErr_SetString(PyExc_TypeError, "Invalid object type");
+        return -1;
+    }
+
+    status = to_double(data, result, sci, dec, maybe_int);
+
+    if (!status) {
+        /* handle inf/-inf infinity/-infinity */
+        if (strlen(data) == 3) {
+            if (0 == strcasecmp(data, "inf")) {
+                *result = HUGE_VAL;
+                *maybe_int = 0;
+            } else {
+                goto parsingerror;
+            }
+        } else if (strlen(data) == 4) {
+            if (0 == strcasecmp(data, "-inf")) {
+                *result = -HUGE_VAL;
+                *maybe_int = 0;
+            } else if (0 == strcasecmp(data, "+inf")) {
+                *result = HUGE_VAL;
+                *maybe_int = 0;
+            } else {
+                goto parsingerror;
+            }
+        } else if (strlen(data) == 8) {
+            if (0 == strcasecmp(data, "infinity")) {
+                *result = HUGE_VAL;
+                *maybe_int = 0;
+            } else {
+                goto parsingerror;
+            }
+        } else if (strlen(data) == 9) {
+            if (0 == strcasecmp(data, "-infinity")) {
+                *result = -HUGE_VAL;
+                *maybe_int = 0;
+            } else if (0 == strcasecmp(data, "+infinity")) {
+                *result = HUGE_VAL;
+                *maybe_int = 0;
+            } else {
+                goto parsingerror;
+            }
+        } else {
+            goto parsingerror;
+        }
+    }
+
+    Py_XDECREF(tmp);
+    return 0;
+
+parsingerror:
+    PyErr_Format(PyExc_ValueError, "Unable to parse string \"%s\"", data);
+    Py_XDECREF(tmp);
+    return -1;
+}
+
+#endif  // PANDAS__LIBS_SRC_PARSE_HELPER_H_

.venv/Lib/site-packages/pandas/_libs/src/parser/io.c

@@ -0,0 +1,107 @@
+/*
+Copyright (c) 2016, PyData Development Team
+All rights reserved.
+
+Distributed under the terms of the BSD Simplified License.
+
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+#include "io.h"
+
+/*
+  On-disk FILE, uncompressed
+*/
+
+void *new_rd_source(PyObject *obj) {
+    rd_source *rds = (rd_source *)malloc(sizeof(rd_source));
+
+    if (rds == NULL) {
+        PyErr_NoMemory();
+        return NULL;
+    }
+    /* hold on to this object */
+    Py_INCREF(obj);
+    rds->obj = obj;
+    rds->buffer = NULL;
+    rds->position = 0;
+
+    return (void *)rds;
+}
+
+/*
+
+  Cleanup callbacks
+
+ */
+
+int del_rd_source(void *rds) {
+    Py_XDECREF(RDS(rds)->obj);
+    Py_XDECREF(RDS(rds)->buffer);
+    free(rds);
+
+    return 0;
+}
+
+/*
+
+  IO callbacks
+
+ */
+
+void *buffer_rd_bytes(void *source, size_t nbytes, size_t *bytes_read,
+                      int *status, const char *encoding_errors) {
+    PyGILState_STATE state;
+    PyObject *result, *func, *args, *tmp;
+
+    void *retval;
+
+    size_t length;
+    rd_source *src = RDS(source);
+    state = PyGILState_Ensure();
+
+    /* delete old object */
+    Py_XDECREF(src->buffer);
+    src->buffer = NULL;
+    args = Py_BuildValue("(i)", nbytes);
+
+    func = PyObject_GetAttrString(src->obj, "read");
+
+    /* TODO: does this release the GIL? */
+    result = PyObject_CallObject(func, args);
+    Py_XDECREF(args);
+    Py_XDECREF(func);
+
+    if (result == NULL) {
+        PyGILState_Release(state);
+        *bytes_read = 0;
+        *status = CALLING_READ_FAILED;
+        return NULL;
+    } else if (!PyBytes_Check(result)) {
+        tmp = PyUnicode_AsEncodedString(result, "utf-8", encoding_errors);
+        Py_DECREF(result);
+        if (tmp == NULL) {
+            PyGILState_Release(state);
+            return NULL;
+        }
+        result = tmp;
+    }
+
+    length = PySequence_Length(result);
+
+    if (length == 0)
+        *status = REACHED_EOF;
+    else
+        *status = 0;
+
+    /* hang on to the Python object */
+    src->buffer = result;
+    retval = (void *)PyBytes_AsString(result);
+
+    PyGILState_Release(state);
+
+    /* TODO: more error handling */
+    *bytes_read = length;
+
+    return retval;
+}

.venv/Lib/site-packages/pandas/_libs/src/parser/io.h

@@ -0,0 +1,34 @@
+/*
+Copyright (c) 2016, PyData Development Team
+All rights reserved.
+
+Distributed under the terms of the BSD Simplified License.
+
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+#ifndef PANDAS__LIBS_SRC_PARSER_IO_H_
+#define PANDAS__LIBS_SRC_PARSER_IO_H_
+
+#define PY_SSIZE_T_CLEAN
+#include <Python.h>
+#include "tokenizer.h"
+
+#define FS(source) ((file_source *)source)
+
+typedef struct _rd_source {
+    PyObject *obj;
+    PyObject *buffer;
+    size_t position;
+} rd_source;
+
+#define RDS(source) ((rd_source *)source)
+
+void *new_rd_source(PyObject *obj);
+
+int del_rd_source(void *src);
+
+void *buffer_rd_bytes(void *source, size_t nbytes, size_t *bytes_read,
+                      int *status, const char *encoding_errors);
+
+#endif  // PANDAS__LIBS_SRC_PARSER_IO_H_

.venv/Lib/site-packages/pandas/_libs/src/parser/tokenizer.h

@@ -0,0 +1,236 @@
+/*
+
+Copyright (c) 2012, Lambda Foundry, Inc., except where noted
+
+Incorporates components of WarrenWeckesser/textreader, licensed under 3-clause
+BSD
+
+See LICENSE for the license
+
+*/
+
+#ifndef PANDAS__LIBS_SRC_PARSER_TOKENIZER_H_
+#define PANDAS__LIBS_SRC_PARSER_TOKENIZER_H_
+
+#define PY_SSIZE_T_CLEAN
+#include <Python.h>
+
+#define ERROR_NO_DIGITS 1
+#define ERROR_OVERFLOW 2
+#define ERROR_INVALID_CHARS 3
+
+#include "../headers/stdint.h"
+#include "../inline_helper.h"
+#include "../headers/portable.h"
+
+#include "khash.h"
+
+#define STREAM_INIT_SIZE 32
+
+#define REACHED_EOF 1
+#define CALLING_READ_FAILED 2
+
+
+/*
+
+  C flat file parsing low level code for pandas / NumPy
+
+ */
+
+/*
+ *  Common set of error types for the read_rows() and tokenize()
+ *  functions.
+ */
+
+// #define VERBOSE
+#if defined(VERBOSE)
+#define TRACE(X) printf X;
+#else
+#define TRACE(X)
+#endif  // VERBOSE
+
+#define PARSER_OUT_OF_MEMORY -1
+
+/*
+ *  TODO: Might want to couple count_rows() with read_rows() to avoid
+ *        duplication of some file I/O.
+ */
+
+typedef enum {
+    START_RECORD,
+    START_FIELD,
+    ESCAPED_CHAR,
+    IN_FIELD,
+    IN_QUOTED_FIELD,
+    ESCAPE_IN_QUOTED_FIELD,
+    QUOTE_IN_QUOTED_FIELD,
+    EAT_CRNL,
+    EAT_CRNL_NOP,
+    EAT_WHITESPACE,
+    EAT_COMMENT,
+    EAT_LINE_COMMENT,
+    WHITESPACE_LINE,
+    START_FIELD_IN_SKIP_LINE,
+    IN_FIELD_IN_SKIP_LINE,
+    IN_QUOTED_FIELD_IN_SKIP_LINE,
+    QUOTE_IN_QUOTED_FIELD_IN_SKIP_LINE,
+    FINISHED
+} ParserState;
+
+typedef enum {
+    QUOTE_MINIMAL,
+    QUOTE_ALL,
+    QUOTE_NONNUMERIC,
+    QUOTE_NONE
+} QuoteStyle;
+
+typedef enum {
+    ERROR,
+    WARN,
+    SKIP
+} BadLineHandleMethod;
+
+typedef void *(*io_callback)(void *src, size_t nbytes, size_t *bytes_read,
+                             int *status, const char *encoding_errors);
+typedef int (*io_cleanup)(void *src);
+
+typedef struct parser_t {
+    void *source;
+    io_callback cb_io;
+    io_cleanup cb_cleanup;
+
+    int64_t chunksize;      // Number of bytes to prepare for each chunk
+    char *data;             // pointer to data to be processed
+    int64_t datalen;        // amount of data available
+    int64_t datapos;
+
+    // where to write out tokenized data
+    char *stream;
+    uint64_t stream_len;
+    uint64_t stream_cap;
+
+    // Store words in (potentially ragged) matrix for now, hmm
+    char **words;
+    int64_t *word_starts;   // where we are in the stream
+    uint64_t words_len;
+    uint64_t words_cap;
+    uint64_t max_words_cap;  // maximum word cap encountered
+
+    char *pword_start;      // pointer to stream start of current field
+    int64_t word_start;     // position start of current field
+
+    int64_t *line_start;    // position in words for start of line
+    int64_t *line_fields;   // Number of fields in each line
+    uint64_t lines;         // Number of (good) lines observed
+    uint64_t file_lines;    // Number of lines (including bad or skipped)
+    uint64_t lines_cap;     // Vector capacity
+
+    // Tokenizing stuff
+    ParserState state;
+    int doublequote;      /* is " represented by ""? */
+    char delimiter;       /* field separator */
+    int delim_whitespace; /* delimit by consuming space/tabs instead */
+    char quotechar;       /* quote character */
+    char escapechar;      /* escape character */
+    char lineterminator;
+    int skipinitialspace; /* ignore spaces following delimiter? */
+    int quoting;          /* style of quoting to write */
+
+    char commentchar;
+    int allow_embedded_newline;
+
+    int usecols;  // Boolean: 1: usecols provided, 0: none provided
+
+    Py_ssize_t expected_fields;
+    BadLineHandleMethod on_bad_lines;
+
+    // floating point options
+    char decimal;
+    char sci;
+
+    // thousands separator (comma, period)
+    char thousands;
+
+    int header;            // Boolean: 1: has header, 0: no header
+    int64_t header_start;  // header row start
+    uint64_t header_end;   // header row end
+
+    void *skipset;
+    PyObject *skipfunc;
+    int64_t skip_first_N_rows;
+    int64_t skip_footer;
+    double (*double_converter)(const char *, char **,
+                               char, char, char, int, int *, int *);
+
+    // error handling
+    char *warn_msg;
+    char *error_msg;
+
+    int skip_empty_lines;
+} parser_t;
+
+typedef struct coliter_t {
+    char **words;
+    int64_t *line_start;
+    int64_t col;
+} coliter_t;
+
+void coliter_setup(coliter_t *self, parser_t *parser, int64_t i, int64_t start);
+
+#define COLITER_NEXT(iter, word)                           \
+    do {                                                   \
+        const int64_t i = *iter.line_start++ + iter.col;   \
+        word = i >= *iter.line_start ? "" : iter.words[i]; \
+    } while (0)
+
+parser_t *parser_new(void);
+
+int parser_init(parser_t *self);
+
+int parser_consume_rows(parser_t *self, size_t nrows);
+
+int parser_trim_buffers(parser_t *self);
+
+int parser_add_skiprow(parser_t *self, int64_t row);
+
+int parser_set_skipfirstnrows(parser_t *self, int64_t nrows);
+
+void parser_free(parser_t *self);
+
+void parser_del(parser_t *self);
+
+void parser_set_default_options(parser_t *self);
+
+int tokenize_nrows(parser_t *self, size_t nrows, const char *encoding_errors);
+
+int tokenize_all_rows(parser_t *self, const char *encoding_errors);
+
+// Have parsed / type-converted a chunk of data
+// and want to free memory from the token stream
+
+typedef struct uint_state {
+    int seen_sint;
+    int seen_uint;
+    int seen_null;
+} uint_state;
+
+void uint_state_init(uint_state *self);
+
+int uint64_conflict(uint_state *self);
+
+uint64_t str_to_uint64(uint_state *state, const char *p_item, int64_t int_max,
+                       uint64_t uint_max, int *error, char tsep);
+int64_t str_to_int64(const char *p_item, int64_t int_min, int64_t int_max,
+                     int *error, char tsep);
+double xstrtod(const char *p, char **q, char decimal, char sci, char tsep,
+               int skip_trailing, int *error, int *maybe_int);
+double precise_xstrtod(const char *p, char **q, char decimal,
+                       char sci, char tsep, int skip_trailing,
+                       int *error, int *maybe_int);
+
+// GH-15140 - round_trip requires and acquires the GIL on its own
+double round_trip(const char *p, char **q, char decimal, char sci, char tsep,
+                  int skip_trailing, int *error, int *maybe_int);
+int to_boolean(const char *item, uint8_t *val);
+
+#endif  // PANDAS__LIBS_SRC_PARSER_TOKENIZER_H_

.venv/Lib/site-packages/pandas/_libs/src/skiplist.h

@@ -0,0 +1,300 @@
+/*
+Copyright (c) 2016, PyData Development Team
+All rights reserved.
+
+Distributed under the terms of the BSD Simplified License.
+
+The full license is in the LICENSE file, distributed with this software.
+
+Flexibly-sized, index-able skiplist data structure for maintaining a sorted
+list of values
+
+Port of Wes McKinney's Cython version of Raymond Hettinger's original pure
+Python recipe (https://rhettinger.wordpress.com/2010/02/06/lost-knowledge/)
+*/
+
+#ifndef PANDAS__LIBS_SRC_SKIPLIST_H_
+#define PANDAS__LIBS_SRC_SKIPLIST_H_
+
+#include <math.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include "inline_helper.h"
+
+PANDAS_INLINE float __skiplist_nanf(void) {
+    const union {
+        int __i;
+        float __f;
+    } __bint = {0x7fc00000UL};
+    return __bint.__f;
+}
+#define PANDAS_NAN ((double)__skiplist_nanf())
+
+PANDAS_INLINE double Log2(double val) { return log(val) / log(2.); }
+
+typedef struct node_t node_t;
+
+struct node_t {
+    node_t **next;
+    int *width;
+    double value;
+    int is_nil;
+    int levels;
+    int ref_count;
+};
+
+typedef struct {
+    node_t *head;
+    node_t **tmp_chain;
+    int *tmp_steps;
+    int size;
+    int maxlevels;
+} skiplist_t;
+
+PANDAS_INLINE double urand(void) {
+    return ((double)rand() + 1) / ((double)RAND_MAX + 2);
+}
+
+PANDAS_INLINE int int_min(int a, int b) { return a < b ? a : b; }
+
+PANDAS_INLINE node_t *node_init(double value, int levels) {
+    node_t *result;
+    result = (node_t *)malloc(sizeof(node_t));
+    if (result) {
+        result->value = value;
+        result->levels = levels;
+        result->is_nil = 0;
+        result->ref_count = 0;
+        result->next = (node_t **)malloc(levels * sizeof(node_t *));
+        result->width = (int *)malloc(levels * sizeof(int));
+        if (!(result->next && result->width) && (levels != 0)) {
+            free(result->next);
+            free(result->width);
+            free(result);
+            return NULL;
+        }
+    }
+    return result;
+}
+
+// do this ourselves
+PANDAS_INLINE void node_incref(node_t *node) { ++(node->ref_count); }
+
+PANDAS_INLINE void node_decref(node_t *node) { --(node->ref_count); }
+
+static void node_destroy(node_t *node) {
+    int i;
+    if (node) {
+        if (node->ref_count <= 1) {
+            for (i = 0; i < node->levels; ++i) {
+                node_destroy(node->next[i]);
+            }
+            free(node->next);
+            free(node->width);
+            // printf("Reference count was 1, freeing\n");
+            free(node);
+        } else {
+            node_decref(node);
+        }
+        // pretty sure that freeing the struct above will be enough
+    }
+}
+
+PANDAS_INLINE void skiplist_destroy(skiplist_t *skp) {
+    if (skp) {
+        node_destroy(skp->head);
+        free(skp->tmp_steps);
+        free(skp->tmp_chain);
+        free(skp);
+    }
+}
+
+PANDAS_INLINE skiplist_t *skiplist_init(int expected_size) {
+    skiplist_t *result;
+    node_t *NIL, *head;
+    int maxlevels, i;
+
+    maxlevels = 1 + Log2((double)expected_size);
+    result = (skiplist_t *)malloc(sizeof(skiplist_t));
+    if (!result) {
+        return NULL;
+    }
+    result->tmp_chain = (node_t **)malloc(maxlevels * sizeof(node_t *));
+    result->tmp_steps = (int *)malloc(maxlevels * sizeof(int));
+    result->maxlevels = maxlevels;
+    result->size = 0;
+
+    head = result->head = node_init(PANDAS_NAN, maxlevels);
+    NIL = node_init(0.0, 0);
+
+    if (!(result->tmp_chain && result->tmp_steps && result->head && NIL)) {
+        skiplist_destroy(result);
+        node_destroy(NIL);
+        return NULL;
+    }
+
+    node_incref(head);
+
+    NIL->is_nil = 1;
+
+    for (i = 0; i < maxlevels; ++i) {
+        head->next[i] = NIL;
+        head->width[i] = 1;
+        node_incref(NIL);
+    }
+
+    return result;
+}
+
+// 1 if left < right, 0 if left == right, -1 if left > right
+PANDAS_INLINE int _node_cmp(node_t *node, double value) {
+    if (node->is_nil || node->value > value) {
+        return -1;
+    } else if (node->value < value) {
+        return 1;
+    } else {
+        return 0;
+    }
+}
+
+PANDAS_INLINE double skiplist_get(skiplist_t *skp, int i, int *ret) {
+    node_t *node;
+    int level;
+
+    if (i < 0 || i >= skp->size) {
+        *ret = 0;
+        return 0;
+    }
+
+    node = skp->head;
+    ++i;
+    for (level = skp->maxlevels - 1; level >= 0; --level) {
+        while (node->width[level] <= i) {
+            i -= node->width[level];
+            node = node->next[level];
+        }
+    }
+
+    *ret = 1;
+    return node->value;
+}
+
+// Returns the lowest rank of all elements with value `value`, as opposed to the
+// highest rank returned by `skiplist_insert`.
+PANDAS_INLINE int skiplist_min_rank(skiplist_t *skp, double value) {
+    node_t *node;
+    int level, rank = 0;
+
+    node = skp->head;
+    for (level = skp->maxlevels - 1; level >= 0; --level) {
+        while (_node_cmp(node->next[level], value) > 0) {
+            rank += node->width[level];
+            node = node->next[level];
+        }
+    }
+
+    return rank + 1;
+}
+
+// Returns the rank of the inserted element. When there are duplicates,
+// `rank` is the highest of the group, i.e. the 'max' method of
+// https://pandas.pydata.org/docs/reference/api/pandas.DataFrame.rank.html
+PANDAS_INLINE int skiplist_insert(skiplist_t *skp, double value) {
+    node_t *node, *prevnode, *newnode, *next_at_level;
+    int *steps_at_level;
+    int size, steps, level, rank = 0;
+    node_t **chain;
+
+    chain = skp->tmp_chain;
+
+    steps_at_level = skp->tmp_steps;
+    memset(steps_at_level, 0, skp->maxlevels * sizeof(int));
+
+    node = skp->head;
+
+    for (level = skp->maxlevels - 1; level >= 0; --level) {
+        next_at_level = node->next[level];
+        while (_node_cmp(next_at_level, value) >= 0) {
+            steps_at_level[level] += node->width[level];
+            rank += node->width[level];
+            node = next_at_level;
+            next_at_level = node->next[level];
+        }
+        chain[level] = node;
+    }
+
+    size = int_min(skp->maxlevels, 1 - ((int)Log2(urand())));
+
+    newnode = node_init(value, size);
+    if (!newnode) {
+        return -1;
+    }
+    steps = 0;
+
+    for (level = 0; level < size; ++level) {
+        prevnode = chain[level];
+        newnode->next[level] = prevnode->next[level];
+
+        prevnode->next[level] = newnode;
+        node_incref(newnode);  // increment the reference count
+
+        newnode->width[level] = prevnode->width[level] - steps;
+        prevnode->width[level] = steps + 1;
+
+        steps += steps_at_level[level];
+    }
+
+    for (level = size; level < skp->maxlevels; ++level) {
+        chain[level]->width[level] += 1;
+    }
+
+    ++(skp->size);
+
+    return rank + 1;
+}
+
+PANDAS_INLINE int skiplist_remove(skiplist_t *skp, double value) {
+    int level, size;
+    node_t *node, *prevnode, *tmpnode, *next_at_level;
+    node_t **chain;
+
+    chain = skp->tmp_chain;
+    node = skp->head;
+
+    for (level = skp->maxlevels - 1; level >= 0; --level) {
+        next_at_level = node->next[level];
+        while (_node_cmp(next_at_level, value) > 0) {
+            node = next_at_level;
+            next_at_level = node->next[level];
+        }
+        chain[level] = node;
+    }
+
+    if (value != chain[0]->next[0]->value) {
+        return 0;
+    }
+
+    size = chain[0]->next[0]->levels;
+
+    for (level = 0; level < size; ++level) {
+        prevnode = chain[level];
+
+        tmpnode = prevnode->next[level];
+
+        prevnode->width[level] += tmpnode->width[level] - 1;
+        prevnode->next[level] = tmpnode->next[level];
+
+        tmpnode->next[level] = NULL;
+        node_destroy(tmpnode);  // decrement refcount or free
+    }
+
+    for (level = size; level < skp->maxlevels; ++level) {
+        --(chain[level]->width[level]);
+    }
+
+    --(skp->size);
+    return 1;
+}
+
+#endif  // PANDAS__LIBS_SRC_SKIPLIST_H_

.venv/Lib/site-packages/pandas/_libs/src/ujson/lib/ultrajson.h

@@ -0,0 +1,316 @@
+/*
+Copyright (c) 2011-2013, ESN Social Software AB and Jonas Tarnstrom
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+    * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+    * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+    * Neither the name of the ESN Social Software AB nor the
+      names of its contributors may be used to endorse or promote products
+      derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL ESN SOCIAL SOFTWARE AB OR JONAS TARNSTROM BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+Portions of code from MODP_ASCII - Ascii transformations (upper/lower, etc)
+https://github.com/client9/stringencoders
+Copyright (c) 2007  Nick Galbreath -- nickg [at] modp [dot] com. All rights reserved.
+
+Numeric decoder derived from from TCL library
+https://www.opensource.apple.com/source/tcl/tcl-14/tcl/license.terms
+ * Copyright (c) 1988-1993 The Regents of the University of California.
+ * Copyright (c) 1994 Sun Microsystems, Inc.
+*/
+
+/*
+Ultra fast JSON encoder and decoder
+Developed by Jonas Tarnstrom (jonas@esn.me).
+
+Encoder notes:
+------------------
+
+:: Cyclic references ::
+Cyclic referenced objects are not detected.
+Set JSONObjectEncoder.recursionMax to suitable value or make sure input object
+tree doesn't have cyclic references.
+
+*/
+
+#ifndef PANDAS__LIBS_SRC_UJSON_LIB_ULTRAJSON_H_
+#define PANDAS__LIBS_SRC_UJSON_LIB_ULTRAJSON_H_
+
+#include <stdio.h>
+#include <wchar.h>
+
+// Don't output any extra whitespaces when encoding
+#define JSON_NO_EXTRA_WHITESPACE
+
+// Max decimals to encode double floating point numbers with
+#ifndef JSON_DOUBLE_MAX_DECIMALS
+#define JSON_DOUBLE_MAX_DECIMALS 15
+#endif
+
+// Max recursion depth, default for encoder
+#ifndef JSON_MAX_RECURSION_DEPTH
+#define JSON_MAX_RECURSION_DEPTH 1024
+#endif
+
+// Max recursion depth, default for decoder
+#ifndef JSON_MAX_OBJECT_DEPTH
+#define JSON_MAX_OBJECT_DEPTH 1024
+#endif
+
+/*
+Dictates and limits how much stack space for buffers UltraJSON will use before resorting to provided heap functions */
+#ifndef JSON_MAX_STACK_BUFFER_SIZE
+#define JSON_MAX_STACK_BUFFER_SIZE 131072
+#endif
+
+#ifdef _WIN32
+
+typedef __int64 JSINT64;
+typedef unsigned __int64 JSUINT64;
+
+typedef __int32 JSINT32;
+typedef unsigned __int32 JSUINT32;
+typedef unsigned __int8 JSUINT8;
+typedef unsigned __int16 JSUTF16;
+typedef unsigned __int32 JSUTF32;
+typedef __int64 JSLONG;
+
+#define EXPORTFUNCTION __declspec(dllexport)
+
+#define FASTCALL_MSVC __fastcall
+
+#define INLINE_PREFIX static __inline
+
+#else
+
+#include <stdint.h>
+typedef int64_t JSINT64;
+typedef uint64_t JSUINT64;
+
+typedef int32_t JSINT32;
+typedef uint32_t JSUINT32;
+
+#define FASTCALL_MSVC
+
+#define INLINE_PREFIX static inline
+
+typedef uint8_t JSUINT8;
+typedef uint16_t JSUTF16;
+typedef uint32_t JSUTF32;
+
+typedef int64_t JSLONG;
+
+#define EXPORTFUNCTION
+#endif
+
+#if !(defined(__LITTLE_ENDIAN__) || defined(__BIG_ENDIAN__))
+
+#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__
+#define __LITTLE_ENDIAN__
+#else
+
+#if __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__
+#define __BIG_ENDIAN__
+#endif
+
+#endif
+
+#endif
+
+#if !defined(__LITTLE_ENDIAN__) && !defined(__BIG_ENDIAN__)
+#error "Endianness not supported"
+#endif
+
+enum JSTYPES {
+  JT_NULL,     // NULL
+  JT_TRUE,     // boolean true
+  JT_FALSE,    // boolean false
+  JT_INT,      // (JSINT32 (signed 32-bit))
+  JT_LONG,     // (JSINT64 (signed 64-bit))
+  JT_DOUBLE,   // (double)
+  JT_BIGNUM,   // integer larger than sys.maxsize
+  JT_UTF8,     // (char 8-bit)
+  JT_ARRAY,    // Array structure
+  JT_OBJECT,   // Key/Value structure
+  JT_INVALID,  // Internal, do not return nor expect
+  JT_POS_INF,  // Positive infinity
+  JT_NEG_INF,  // Negative infinity
+};
+
+typedef void * JSOBJ;
+typedef void * JSITER;
+
+typedef struct __JSONTypeContext {
+  int type;
+  void *encoder;
+  void *prv;
+} JSONTypeContext;
+
+/*
+Function pointer declarations, suitable for implementing UltraJSON */
+typedef void (*JSPFN_ITERBEGIN)(JSOBJ obj, JSONTypeContext *tc);
+typedef int (*JSPFN_ITERNEXT)(JSOBJ obj, JSONTypeContext *tc);
+typedef void (*JSPFN_ITEREND)(JSOBJ obj, JSONTypeContext *tc);
+typedef JSOBJ (*JSPFN_ITERGETVALUE)(JSOBJ obj, JSONTypeContext *tc);
+typedef char *(*JSPFN_ITERGETNAME)(JSOBJ obj, JSONTypeContext *tc,
+                                   size_t *outLen);
+typedef void *(*JSPFN_MALLOC)(size_t size);
+typedef void (*JSPFN_FREE)(void *pptr);
+typedef void *(*JSPFN_REALLOC)(void *base, size_t size);
+
+typedef struct __JSONObjectEncoder {
+  void (*beginTypeContext)(JSOBJ obj, JSONTypeContext *tc);
+  void (*endTypeContext)(JSOBJ obj, JSONTypeContext *tc);
+  const char *(*getStringValue)(JSOBJ obj, JSONTypeContext *tc,
+                                size_t *_outLen);
+  JSINT64 (*getLongValue)(JSOBJ obj, JSONTypeContext *tc);
+  JSINT32 (*getIntValue)(JSOBJ obj, JSONTypeContext *tc);
+  double (*getDoubleValue)(JSOBJ obj, JSONTypeContext *tc);
+  const char *(*getBigNumStringValue)(JSOBJ obj, JSONTypeContext *tc,
+                                size_t *_outLen);
+
+  /*
+  Begin iteration of an iteratable object (JS_ARRAY or JS_OBJECT)
+  Implementor should setup iteration state in ti->prv
+  */
+  JSPFN_ITERBEGIN iterBegin;
+
+  /*
+  Retrieve next object in an iteration. Should return 0 to indicate iteration has reached end or 1 if there are more items.
+  Implementor is responsible for keeping state of the iteration. Use ti->prv fields for this
+  */
+  JSPFN_ITERNEXT iterNext;
+
+  /*
+  Ends the iteration of an iteratable object.
+  Any iteration state stored in ti->prv can be freed here
+  */
+  JSPFN_ITEREND iterEnd;
+
+  /*
+  Returns a reference to the value object of an iterator
+  The is responsible for the life-cycle of the returned string. Use iterNext/iterEnd and ti->prv to keep track of current object
+  */
+  JSPFN_ITERGETVALUE iterGetValue;
+
+  /*
+  Return name of iterator.
+  The is responsible for the life-cycle of the returned string. Use iterNext/iterEnd and ti->prv to keep track of current object
+  */
+  JSPFN_ITERGETNAME iterGetName;
+
+  /*
+  Release a value as indicated by setting ti->release = 1 in the previous getValue call.
+  The ti->prv array should contain the necessary context to release the value
+  */
+  void (*releaseObject)(JSOBJ obj);
+
+  /* Library functions
+  Set to NULL to use STDLIB malloc,realloc,free */
+  JSPFN_MALLOC malloc;
+  JSPFN_REALLOC realloc;
+  JSPFN_FREE free;
+
+  /*
+  Configuration for max recursion, set to 0 to use default (see JSON_MAX_RECURSION_DEPTH)*/
+  int recursionMax;
+
+  /*
+  Configuration for max decimals of double floating point numbers to encode (0-9) */
+  int doublePrecision;
+
+  /*
+  If true output will be ASCII with all characters above 127 encoded as \uXXXX. If false output will be UTF-8 or what ever charset strings are brought as */
+  int forceASCII;
+
+  /*
+  If true, '<', '>', and '&' characters will be encoded as \u003c, \u003e, and \u0026, respectively. If false, no special encoding will be used. */
+  int encodeHTMLChars;
+
+  /*
+  Configuration for spaces of indent */
+  int indent;
+
+  /*
+  Set to an error message if error occurred */
+  const char *errorMsg;
+  JSOBJ errorObj;
+
+  /* Buffer stuff */
+  char *start;
+  char *offset;
+  char *end;
+  int heap;
+  int level;
+} JSONObjectEncoder;
+
+/*
+Encode an object structure into JSON.
+
+Arguments:
+obj - An anonymous type representing the object
+enc - Function definitions for querying JSOBJ type
+buffer - Preallocated buffer to store result in. If NULL function allocates own buffer
+cbBuffer - Length of buffer (ignored if buffer is NULL)
+
+Returns:
+Encoded JSON object as a null terminated char string.
+
+NOTE:
+If the supplied buffer wasn't enough to hold the result the function will allocate a new buffer.
+Life cycle of the provided buffer must still be handled by caller.
+
+If the return value doesn't equal the specified buffer caller must release the memory using
+JSONObjectEncoder.free or free() as specified when calling this function.
+*/
+EXPORTFUNCTION char *JSON_EncodeObject(JSOBJ obj, JSONObjectEncoder *enc,
+                                       char *buffer, size_t cbBuffer);
+
+typedef struct __JSONObjectDecoder {
+  JSOBJ (*newString)(void *prv, wchar_t *start, wchar_t *end);
+  int (*objectAddKey)(void *prv, JSOBJ obj, JSOBJ name, JSOBJ value);
+  int (*arrayAddItem)(void *prv, JSOBJ obj, JSOBJ value);
+  JSOBJ (*newTrue)(void *prv);
+  JSOBJ (*newFalse)(void *prv);
+  JSOBJ (*newNull)(void *prv);
+  JSOBJ (*newPosInf)(void *prv);
+  JSOBJ (*newNegInf)(void *prv);
+  JSOBJ (*newObject)(void *prv, void *decoder);
+  JSOBJ (*endObject)(void *prv, JSOBJ obj);
+  JSOBJ (*newArray)(void *prv, void *decoder);
+  JSOBJ (*endArray)(void *prv, JSOBJ obj);
+  JSOBJ (*newInt)(void *prv, JSINT32 value);
+  JSOBJ (*newLong)(void *prv, JSINT64 value);
+  JSOBJ (*newUnsignedLong)(void *prv, JSUINT64 value);
+  JSOBJ (*newDouble)(void *prv, double value);
+  void (*releaseObject)(void *prv, JSOBJ obj, void *decoder);
+  JSPFN_MALLOC malloc;
+  JSPFN_FREE free;
+  JSPFN_REALLOC realloc;
+  char *errorStr;
+  char *errorOffset;
+  int preciseFloat;
+  void *prv;
+} JSONObjectDecoder;
+
+EXPORTFUNCTION JSOBJ JSON_DecodeObject(JSONObjectDecoder *dec,
+                                       const char *buffer, size_t cbBuffer);
+EXPORTFUNCTION void encode(JSOBJ, JSONObjectEncoder *, const char *, size_t);
+
+#endif  // PANDAS__LIBS_SRC_UJSON_LIB_ULTRAJSON_H_

.venv/Lib/site-packages/pandas/_libs/src/ujson/python/JSONtoObj.c

@@ -0,0 +1,601 @@
+/*
+Copyright (c) 2011-2013, ESN Social Software AB and Jonas Tarnstrom
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+    * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+    * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+    * Neither the name of the ESN Social Software AB nor the
+      names of its contributors may be used to endorse or promote products
+      derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL ESN SOCIAL SOFTWARE AB OR JONAS TARNSTROM BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+Portions of code from MODP_ASCII - Ascii transformations (upper/lower, etc)
+https://github.com/client9/stringencoders
+Copyright (c) 2007  Nick Galbreath -- nickg [at] modp [dot] com. All rights reserved.
+
+Numeric decoder derived from from TCL library
+https://www.opensource.apple.com/source/tcl/tcl-14/tcl/license.terms
+ * Copyright (c) 1988-1993 The Regents of the University of California.
+ * Copyright (c) 1994 Sun Microsystems, Inc.
+*/
+
+#define PY_ARRAY_UNIQUE_SYMBOL UJSON_NUMPY
+#define NO_IMPORT_ARRAY
+#define PY_SSIZE_T_CLEAN
+#include <Python.h>
+#include <numpy/arrayobject.h>
+#include <ultrajson.h>
+
+#define PRINTMARK()
+
+typedef struct __PyObjectDecoder {
+    JSONObjectDecoder dec;
+
+    void *npyarr;       // Numpy context buffer
+    void *npyarr_addr;  // Ref to npyarr ptr to track DECREF calls
+    npy_intp curdim;    // Current array dimension
+
+    PyArray_Descr *dtype;
+} PyObjectDecoder;
+
+typedef struct __NpyArrContext {
+    PyObject *ret;
+    PyObject *labels[2];
+    PyArray_Dims shape;
+
+    PyObjectDecoder *dec;
+
+    npy_intp i;
+    npy_intp elsize;
+    npy_intp elcount;
+} NpyArrContext;
+
+// Numpy handling based on numpy internal code, specifically the function
+// PyArray_FromIter.
+
+// numpy related functions are inter-dependent so declare them all here,
+// to ensure the compiler catches any errors
+
+// standard numpy array handling
+JSOBJ Object_npyNewArray(void *prv, void *decoder);
+JSOBJ Object_npyEndArray(void *prv, JSOBJ obj);
+int Object_npyArrayAddItem(void *prv, JSOBJ obj, JSOBJ value);
+
+// for more complex dtypes (object and string) fill a standard Python list
+// and convert to a numpy array when done.
+JSOBJ Object_npyNewArrayList(void *prv, void *decoder);
+JSOBJ Object_npyEndArrayList(void *prv, JSOBJ obj);
+int Object_npyArrayListAddItem(void *prv, JSOBJ obj, JSOBJ value);
+
+// labelled support, encode keys and values of JS object into separate numpy
+// arrays
+JSOBJ Object_npyNewObject(void *prv, void *decoder);
+JSOBJ Object_npyEndObject(void *prv, JSOBJ obj);
+int Object_npyObjectAddKey(void *prv, JSOBJ obj, JSOBJ name, JSOBJ value);
+
+// free the numpy context buffer
+void Npy_releaseContext(NpyArrContext *npyarr) {
+    PRINTMARK();
+    if (npyarr) {
+        if (npyarr->shape.ptr) {
+            PyObject_Free(npyarr->shape.ptr);
+        }
+        if (npyarr->dec) {
+            npyarr->dec->npyarr = NULL;
+            npyarr->dec->curdim = 0;
+        }
+        Py_XDECREF(npyarr->labels[0]);
+        Py_XDECREF(npyarr->labels[1]);
+        Py_XDECREF(npyarr->ret);
+        PyObject_Free(npyarr);
+    }
+}
+
+JSOBJ Object_npyNewArray(void *prv, void *_decoder) {
+    NpyArrContext *npyarr;
+    PyObjectDecoder *decoder = (PyObjectDecoder *)_decoder;
+    PRINTMARK();
+    if (decoder->curdim <= 0) {
+        // start of array - initialise the context buffer
+        npyarr = decoder->npyarr = PyObject_Malloc(sizeof(NpyArrContext));
+        decoder->npyarr_addr = npyarr;
+
+        if (!npyarr) {
+            PyErr_NoMemory();
+            return NULL;
+        }
+
+        npyarr->dec = decoder;
+        npyarr->labels[0] = npyarr->labels[1] = NULL;
+
+        npyarr->shape.ptr = PyObject_Malloc(sizeof(npy_intp) * NPY_MAXDIMS);
+        npyarr->shape.len = 1;
+        npyarr->ret = NULL;
+
+        npyarr->elsize = 0;
+        npyarr->elcount = 4;
+        npyarr->i = 0;
+    } else {
+        // starting a new dimension continue the current array (and reshape
+        // after)
+        npyarr = (NpyArrContext *)decoder->npyarr;
+        if (decoder->curdim >= npyarr->shape.len) {
+            npyarr->shape.len++;
+        }
+    }
+
+    npyarr->shape.ptr[decoder->curdim] = 0;
+    decoder->curdim++;
+    return npyarr;
+}
+
+PyObject *Npy_returnLabelled(NpyArrContext *npyarr) {
+    PyObject *ret = npyarr->ret;
+    npy_intp i;
+
+    if (npyarr->labels[0] || npyarr->labels[1]) {
+        // finished decoding, build tuple with values and labels
+        ret = PyTuple_New(npyarr->shape.len + 1);
+        for (i = 0; i < npyarr->shape.len; i++) {
+            if (npyarr->labels[i]) {
+                PyTuple_SET_ITEM(ret, i + 1, npyarr->labels[i]);
+                npyarr->labels[i] = NULL;
+            } else {
+                Py_INCREF(Py_None);
+                PyTuple_SET_ITEM(ret, i + 1, Py_None);
+            }
+        }
+        PyTuple_SET_ITEM(ret, 0, npyarr->ret);
+    }
+
+    return ret;
+}
+
+JSOBJ Object_npyEndArray(void *prv, JSOBJ obj) {
+    PyObject *ret;
+    char *new_data;
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    int emptyType = NPY_DEFAULT_TYPE;
+    npy_intp i;
+    PRINTMARK();
+    if (!npyarr) {
+        return NULL;
+    }
+
+    ret = npyarr->ret;
+    i = npyarr->i;
+
+    npyarr->dec->curdim--;
+
+    if (i == 0 || !npyarr->ret) {
+        // empty array would not have been initialised so do it now.
+        if (npyarr->dec->dtype) {
+            emptyType = npyarr->dec->dtype->type_num;
+        }
+        npyarr->ret = ret =
+            PyArray_EMPTY(npyarr->shape.len, npyarr->shape.ptr, emptyType, 0);
+    } else if (npyarr->dec->curdim <= 0) {
+        // realloc to final size
+        new_data = PyDataMem_RENEW(PyArray_DATA(ret), i * npyarr->elsize);
+        if (new_data == NULL) {
+            PyErr_NoMemory();
+            Npy_releaseContext(npyarr);
+            return NULL;
+        }
+        ((PyArrayObject *)ret)->data = (void *)new_data;
+        // PyArray_BYTES(ret) = new_data;
+    }
+
+    if (npyarr->dec->curdim <= 0) {
+        // finished decoding array, reshape if necessary
+        if (npyarr->shape.len > 1) {
+            npyarr->ret = PyArray_Newshape((PyArrayObject *)ret, &npyarr->shape,
+                                           NPY_ANYORDER);
+            Py_DECREF(ret);
+        }
+
+        ret = Npy_returnLabelled(npyarr);
+
+        npyarr->ret = NULL;
+        Npy_releaseContext(npyarr);
+    }
+
+    return ret;
+}
+
+int Object_npyArrayAddItem(void *prv, JSOBJ obj, JSOBJ value) {
+    PyObject *type;
+    PyArray_Descr *dtype;
+    npy_intp i;
+    char *new_data, *item;
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    PRINTMARK();
+    if (!npyarr) {
+        return 0;
+    }
+
+    i = npyarr->i;
+
+    npyarr->shape.ptr[npyarr->dec->curdim - 1]++;
+
+    if (PyArray_Check((PyObject *)value)) {
+        // multidimensional array, keep decoding values.
+        return 1;
+    }
+
+    if (!npyarr->ret) {
+        // Array not initialised yet.
+        // We do it here so we can 'sniff' the data type if none was provided
+        if (!npyarr->dec->dtype) {
+            type = PyObject_Type(value);
+            if (!PyArray_DescrConverter(type, &dtype)) {
+                Py_DECREF(type);
+                goto fail;
+            }
+            Py_INCREF(dtype);
+            Py_DECREF(type);
+        } else {
+            dtype = PyArray_DescrNew(npyarr->dec->dtype);
+        }
+
+        // If it's an object or string then fill a Python list and subsequently
+        // convert. Otherwise we would need to somehow mess about with
+        // reference counts when renewing memory.
+        npyarr->elsize = dtype->elsize;
+        if (PyDataType_REFCHK(dtype) || npyarr->elsize == 0) {
+            Py_XDECREF(dtype);
+
+            if (npyarr->dec->curdim > 1) {
+                PyErr_SetString(PyExc_ValueError,
+                                "Cannot decode multidimensional arrays with "
+                                "variable length elements to numpy");
+                goto fail;
+            }
+            npyarr->elcount = 0;
+            npyarr->ret = PyList_New(0);
+            if (!npyarr->ret) {
+                goto fail;
+            }
+            ((JSONObjectDecoder *)npyarr->dec)->newArray =
+                Object_npyNewArrayList;
+            ((JSONObjectDecoder *)npyarr->dec)->arrayAddItem =
+                Object_npyArrayListAddItem;
+            ((JSONObjectDecoder *)npyarr->dec)->endArray =
+                Object_npyEndArrayList;
+            return Object_npyArrayListAddItem(prv, obj, value);
+        }
+
+        npyarr->ret = PyArray_NewFromDescr(
+            &PyArray_Type, dtype, 1, &npyarr->elcount, NULL, NULL, 0, NULL);
+
+        if (!npyarr->ret) {
+            goto fail;
+        }
+    }
+
+    if (i >= npyarr->elcount) {
+        // Grow PyArray_DATA(ret):
+        // this is similar for the strategy for PyListObject, but we use
+        // 50% overallocation => 0, 4, 8, 14, 23, 36, 56, 86 ...
+        if (npyarr->elsize == 0) {
+            PyErr_SetString(PyExc_ValueError,
+                            "Cannot decode multidimensional arrays with "
+                            "variable length elements to numpy");
+            goto fail;
+        }
+
+        npyarr->elcount = (i >> 1) + (i < 4 ? 4 : 2) + i;
+        if (npyarr->elcount <= NPY_MAX_INTP / npyarr->elsize) {
+            new_data = PyDataMem_RENEW(PyArray_DATA(npyarr->ret),
+                                       npyarr->elcount * npyarr->elsize);
+        } else {
+            PyErr_NoMemory();
+            goto fail;
+        }
+        ((PyArrayObject *)npyarr->ret)->data = (void *)new_data;
+
+        // PyArray_BYTES(npyarr->ret) = new_data;
+    }
+
+    PyArray_DIMS(npyarr->ret)[0] = i + 1;
+
+    if ((item = PyArray_GETPTR1(npyarr->ret, i)) == NULL ||
+        PyArray_SETITEM(npyarr->ret, item, value) == -1) {
+        goto fail;
+    }
+
+    Py_DECREF((PyObject *)value);
+    npyarr->i++;
+    return 1;
+
+fail:
+
+    Npy_releaseContext(npyarr);
+    return 0;
+}
+
+JSOBJ Object_npyNewArrayList(void *prv, void *_decoder) {
+    PyObjectDecoder *decoder = (PyObjectDecoder *)_decoder;
+    PRINTMARK();
+    PyErr_SetString(
+        PyExc_ValueError,
+        "nesting not supported for object or variable length dtypes");
+    Npy_releaseContext(decoder->npyarr);
+    return NULL;
+}
+
+JSOBJ Object_npyEndArrayList(void *prv, JSOBJ obj) {
+    PyObject *list, *ret;
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    PRINTMARK();
+    if (!npyarr) {
+        return NULL;
+    }
+
+    // convert decoded list to numpy array
+    list = (PyObject *)npyarr->ret;
+    npyarr->ret = PyArray_FROM_O(list);
+
+    ret = Npy_returnLabelled(npyarr);
+    npyarr->ret = list;
+
+    ((JSONObjectDecoder *)npyarr->dec)->newArray = Object_npyNewArray;
+    ((JSONObjectDecoder *)npyarr->dec)->arrayAddItem = Object_npyArrayAddItem;
+    ((JSONObjectDecoder *)npyarr->dec)->endArray = Object_npyEndArray;
+    Npy_releaseContext(npyarr);
+    return ret;
+}
+
+int Object_npyArrayListAddItem(void *prv, JSOBJ obj, JSOBJ value) {
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    PRINTMARK();
+    if (!npyarr) {
+        return 0;
+    }
+    PyList_Append((PyObject *)npyarr->ret, value);
+    Py_DECREF((PyObject *)value);
+    npyarr->elcount++;
+    return 1;
+}
+
+JSOBJ Object_npyNewObject(void *prv, void *_decoder) {
+    PyObjectDecoder *decoder = (PyObjectDecoder *)_decoder;
+    PRINTMARK();
+    if (decoder->curdim > 1) {
+        PyErr_SetString(PyExc_ValueError,
+                        "labels only supported up to 2 dimensions");
+        return NULL;
+    }
+
+    return ((JSONObjectDecoder *)decoder)->newArray(prv, decoder);
+}
+
+JSOBJ Object_npyEndObject(void *prv, JSOBJ obj) {
+    PyObject *list;
+    npy_intp labelidx;
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    PRINTMARK();
+    if (!npyarr) {
+        return NULL;
+    }
+
+    labelidx = npyarr->dec->curdim - 1;
+
+    list = npyarr->labels[labelidx];
+    if (list) {
+        npyarr->labels[labelidx] = PyArray_FROM_O(list);
+        Py_DECREF(list);
+    }
+
+    return (PyObject *)((JSONObjectDecoder *)npyarr->dec)->endArray(prv, obj);
+}
+
+int Object_npyObjectAddKey(void *prv, JSOBJ obj, JSOBJ name, JSOBJ value) {
+    PyObject *label, *labels;
+    npy_intp labelidx;
+    // add key to label array, value to values array
+    NpyArrContext *npyarr = (NpyArrContext *)obj;
+    PRINTMARK();
+    if (!npyarr) {
+        return 0;
+    }
+
+    label = (PyObject *)name;
+    labelidx = npyarr->dec->curdim - 1;
+
+    if (!npyarr->labels[labelidx]) {
+        npyarr->labels[labelidx] = PyList_New(0);
+    }
+    labels = npyarr->labels[labelidx];
+    // only fill label array once, assumes all column labels are the same
+    // for 2-dimensional arrays.
+    if (PyList_Check(labels) && PyList_GET_SIZE(labels) <= npyarr->elcount) {
+        PyList_Append(labels, label);
+    }
+
+    if (((JSONObjectDecoder *)npyarr->dec)->arrayAddItem(prv, obj, value)) {
+        Py_DECREF(label);
+        return 1;
+    }
+    return 0;
+}
+
+int Object_objectAddKey(void *prv, JSOBJ obj, JSOBJ name, JSOBJ value) {
+    int ret = PyDict_SetItem(obj, name, value);
+    Py_DECREF((PyObject *)name);
+    Py_DECREF((PyObject *)value);
+    return ret == 0 ? 1 : 0;
+}
+
+int Object_arrayAddItem(void *prv, JSOBJ obj, JSOBJ value) {
+    int ret = PyList_Append(obj, value);
+    Py_DECREF((PyObject *)value);
+    return ret == 0 ? 1 : 0;
+}
+
+JSOBJ Object_newString(void *prv, wchar_t *start, wchar_t *end) {
+    return PyUnicode_FromWideChar(start, (end - start));
+}
+
+JSOBJ Object_newTrue(void *prv) { Py_RETURN_TRUE; }
+
+JSOBJ Object_newFalse(void *prv) { Py_RETURN_FALSE; }
+
+JSOBJ Object_newNull(void *prv) { Py_RETURN_NONE; }
+
+JSOBJ Object_newPosInf(void *prv) { return PyFloat_FromDouble(Py_HUGE_VAL); }
+
+JSOBJ Object_newNegInf(void *prv) { return PyFloat_FromDouble(-Py_HUGE_VAL); }
+
+JSOBJ Object_newObject(void *prv, void *decoder) { return PyDict_New(); }
+
+JSOBJ Object_endObject(void *prv, JSOBJ obj) { return obj; }
+
+JSOBJ Object_newArray(void *prv, void *decoder) { return PyList_New(0); }
+
+JSOBJ Object_endArray(void *prv, JSOBJ obj) { return obj; }
+
+JSOBJ Object_newInteger(void *prv, JSINT32 value) {
+    return PyLong_FromLong((long)value);
+}
+
+JSOBJ Object_newLong(void *prv, JSINT64 value) {
+    return PyLong_FromLongLong(value);
+}
+
+JSOBJ Object_newUnsignedLong(void *prv, JSUINT64 value) {
+    return PyLong_FromUnsignedLongLong(value);
+}
+
+JSOBJ Object_newDouble(void *prv, double value) {
+    return PyFloat_FromDouble(value);
+}
+
+static void Object_releaseObject(void *prv, JSOBJ obj, void *_decoder) {
+    PyObjectDecoder *decoder = (PyObjectDecoder *)_decoder;
+    if (obj != decoder->npyarr_addr) {
+        Py_XDECREF(((PyObject *)obj));
+    }
+}
+
+static char *g_kwlist[] = {"obj",      "precise_float", "numpy",
+                           "labelled", "dtype",         NULL};
+
+PyObject *JSONToObj(PyObject *self, PyObject *args, PyObject *kwargs) {
+    PyObject *ret;
+    PyObject *sarg;
+    PyObject *arg;
+    PyObject *opreciseFloat = NULL;
+    JSONObjectDecoder *decoder;
+    PyObjectDecoder pyDecoder;
+    PyArray_Descr *dtype = NULL;
+    int numpy = 0, labelled = 0;
+
+    JSONObjectDecoder dec = {
+        Object_newString, Object_objectAddKey,  Object_arrayAddItem,
+        Object_newTrue,   Object_newFalse,      Object_newNull,
+        Object_newPosInf, Object_newNegInf,     Object_newObject,
+        Object_endObject,     Object_newArray,  Object_endArray,
+        Object_newInteger,    Object_newLong,   Object_newUnsignedLong,
+        Object_newDouble,
+        Object_releaseObject, PyObject_Malloc, PyObject_Free,
+        PyObject_Realloc};
+
+    dec.preciseFloat = 0;
+    dec.prv = NULL;
+
+    pyDecoder.dec = dec;
+    pyDecoder.curdim = 0;
+    pyDecoder.npyarr = NULL;
+    pyDecoder.npyarr_addr = NULL;
+
+    decoder = (JSONObjectDecoder *)&pyDecoder;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwargs, "O|OiiO&", g_kwlist, &arg,
+                                     &opreciseFloat, &numpy, &labelled,
+                                     PyArray_DescrConverter2, &dtype)) {
+        Npy_releaseContext(pyDecoder.npyarr);
+        return NULL;
+    }
+
+    if (opreciseFloat && PyObject_IsTrue(opreciseFloat)) {
+        decoder->preciseFloat = 1;
+    }
+
+    if (PyBytes_Check(arg)) {
+        sarg = arg;
+    } else if (PyUnicode_Check(arg)) {
+        sarg = PyUnicode_AsUTF8String(arg);
+        if (sarg == NULL) {
+            // Exception raised above us by codec according to docs
+            return NULL;
+        }
+    } else {
+        PyErr_Format(PyExc_TypeError, "Expected 'str' or 'bytes'");
+        return NULL;
+    }
+
+    decoder->errorStr = NULL;
+    decoder->errorOffset = NULL;
+
+    if (numpy) {
+        pyDecoder.dtype = dtype;
+        decoder->newArray = Object_npyNewArray;
+        decoder->endArray = Object_npyEndArray;
+        decoder->arrayAddItem = Object_npyArrayAddItem;
+
+        if (labelled) {
+            decoder->newObject = Object_npyNewObject;
+            decoder->endObject = Object_npyEndObject;
+            decoder->objectAddKey = Object_npyObjectAddKey;
+        }
+    }
+
+    ret = JSON_DecodeObject(decoder, PyBytes_AS_STRING(sarg),
+                            PyBytes_GET_SIZE(sarg));
+
+    if (sarg != arg) {
+        Py_DECREF(sarg);
+    }
+
+    if (PyErr_Occurred()) {
+        if (ret) {
+            Py_DECREF((PyObject *)ret);
+        }
+        Npy_releaseContext(pyDecoder.npyarr);
+        return NULL;
+    }
+
+    if (decoder->errorStr) {
+        /*
+        FIXME: It's possible to give a much nicer error message here with actual
+        failing element in input etc*/
+
+        PyErr_Format(PyExc_ValueError, "%s", decoder->errorStr);
+
+        if (ret) {
+            Py_DECREF((PyObject *)ret);
+        }
+        Npy_releaseContext(pyDecoder.npyarr);
+
+        return NULL;
+    }
+
+    return ret;
+}

.venv/Lib/site-packages/pandas/_libs/src/ujson/python/date_conversions.c

@@ -0,0 +1,151 @@
+/*
+Copyright (c) 2020, PyData Development Team
+All rights reserved.
+Distributed under the terms of the BSD Simplified License.
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+// Conversion routines that are useful for serialization,
+// but which don't interact with JSON objects directly
+
+#include "date_conversions.h"
+#include <../../../tslibs/src/datetime/np_datetime.h>
+#include <../../../tslibs/src/datetime/np_datetime_strings.h>
+
+/*
+ * Function: scaleNanosecToUnit
+ * -----------------------------
+ *
+ * Scales an integer value representing time in nanoseconds to provided unit.
+ *
+ * Mutates the provided value directly. Returns 0 on success, non-zero on error.
+ */
+int scaleNanosecToUnit(npy_int64 *value, NPY_DATETIMEUNIT unit) {
+    switch (unit) {
+    case NPY_FR_ns:
+        break;
+    case NPY_FR_us:
+        *value /= 1000LL;
+        break;
+    case NPY_FR_ms:
+        *value /= 1000000LL;
+        break;
+    case NPY_FR_s:
+        *value /= 1000000000LL;
+        break;
+    default:
+        return -1;
+    }
+
+    return 0;
+}
+
+/* Converts the int64_t representation of a datetime to ISO; mutates len */
+char *int64ToIso(int64_t value, NPY_DATETIMEUNIT base, size_t *len) {
+    npy_datetimestruct dts;
+    int ret_code;
+
+    pandas_datetime_to_datetimestruct(value, NPY_FR_ns, &dts);
+
+    *len = (size_t)get_datetime_iso_8601_strlen(0, base);
+    char *result = PyObject_Malloc(*len);
+
+    if (result == NULL) {
+        PyErr_NoMemory();
+        return NULL;
+    }
+
+    ret_code = make_iso_8601_datetime(&dts, result, *len, base);
+    if (ret_code != 0) {
+        PyErr_SetString(PyExc_ValueError,
+                        "Could not convert datetime value to string");
+        PyObject_Free(result);
+    }
+
+    // Note that get_datetime_iso_8601_strlen just gives a generic size
+    // for ISO string conversion, not the actual size used
+    *len = strlen(result);
+    return result;
+}
+
+npy_datetime NpyDateTimeToEpoch(npy_datetime dt, NPY_DATETIMEUNIT base) {
+    scaleNanosecToUnit(&dt, base);
+    return dt;
+}
+
+/* Convert PyDatetime To ISO C-string. mutates len */
+char *PyDateTimeToIso(PyObject *obj, NPY_DATETIMEUNIT base,
+                      size_t *len) {
+    npy_datetimestruct dts;
+    int ret;
+
+    ret = convert_pydatetime_to_datetimestruct(obj, &dts);
+    if (ret != 0) {
+        if (!PyErr_Occurred()) {
+            PyErr_SetString(PyExc_ValueError,
+                            "Could not convert PyDateTime to numpy datetime");
+        }
+        return NULL;
+    }
+
+    *len = (size_t)get_datetime_iso_8601_strlen(0, base);
+    char *result = PyObject_Malloc(*len);
+    ret = make_iso_8601_datetime(&dts, result, *len, base);
+
+    if (ret != 0) {
+        PyErr_SetString(PyExc_ValueError,
+                        "Could not convert datetime value to string");
+        PyObject_Free(result);
+        return NULL;
+    }
+
+    // Note that get_datetime_iso_8601_strlen just gives a generic size
+    // for ISO string conversion, not the actual size used
+    *len = strlen(result);
+    return result;
+}
+
+npy_datetime PyDateTimeToEpoch(PyObject *dt, NPY_DATETIMEUNIT base) {
+    npy_datetimestruct dts;
+    int ret;
+
+    ret = convert_pydatetime_to_datetimestruct(dt, &dts);
+    if (ret != 0) {
+        if (!PyErr_Occurred()) {
+            PyErr_SetString(PyExc_ValueError,
+                            "Could not convert PyDateTime to numpy datetime");
+        }
+        // TODO(username): is setting errMsg required?
+        // ((JSONObjectEncoder *)tc->encoder)->errorMsg = "";
+        // return NULL;
+    }
+
+    npy_datetime npy_dt = npy_datetimestruct_to_datetime(NPY_FR_ns, &dts);
+    return NpyDateTimeToEpoch(npy_dt, base);
+}
+
+/* Converts the int64_t representation of a duration to ISO; mutates len */
+char *int64ToIsoDuration(int64_t value, size_t *len) {
+    pandas_timedeltastruct tds;
+    int ret_code;
+
+    pandas_timedelta_to_timedeltastruct(value, NPY_FR_ns, &tds);
+
+    // Max theoretical length of ISO Duration with 64 bit day
+    // as the largest unit is 70 characters + 1 for a null terminator
+    char *result = PyObject_Malloc(71);
+    if (result == NULL) {
+        PyErr_NoMemory();
+        return NULL;
+    }
+
+    ret_code = make_iso_8601_timedelta(&tds, result, len);
+    if (ret_code == -1) {
+        PyErr_SetString(PyExc_ValueError,
+                        "Could not convert timedelta value to string");
+        PyObject_Free(result);
+        return NULL;
+    }
+
+    return result;
+}

.venv/Lib/site-packages/pandas/_libs/src/ujson/python/date_conversions.h

@@ -0,0 +1,39 @@
+/*
+Copyright (c) 2020, PyData Development Team
+All rights reserved.
+Distributed under the terms of the BSD Simplified License.
+The full license is in the LICENSE file, distributed with this software.
+*/
+
+#ifndef PANDAS__LIBS_SRC_UJSON_PYTHON_DATE_CONVERSIONS_H_
+#define PANDAS__LIBS_SRC_UJSON_PYTHON_DATE_CONVERSIONS_H_
+
+#define PY_SSIZE_T_CLEAN
+#include <Python.h>
+#include <numpy/ndarraytypes.h>
+
+// Scales value inplace from nanosecond resolution to unit resolution
+int scaleNanosecToUnit(npy_int64 *value, NPY_DATETIMEUNIT unit);
+
+// Converts an int64 object representing a date to ISO format
+// up to precision `base` e.g. base="s" yields 2020-01-03T00:00:00Z
+// while base="ns" yields "2020-01-01T00:00:00.000000000Z"
+// len is mutated to save the length of the returned string
+char *int64ToIso(int64_t value, NPY_DATETIMEUNIT base, size_t *len);
+
+// TODO(username): this function doesn't do a lot; should augment or
+// replace with scaleNanosecToUnit
+npy_datetime NpyDateTimeToEpoch(npy_datetime dt, NPY_DATETIMEUNIT base);
+
+// Converts a Python object representing a Date / Datetime to ISO format
+// up to precision `base` e.g. base="s" yields 2020-01-03T00:00:00Z
+// while base="ns" yields "2020-01-01T00:00:00.000000000Z"
+// len is mutated to save the length of the returned string
+char *PyDateTimeToIso(PyObject *obj, NPY_DATETIMEUNIT base, size_t *len);
+
+// Convert a Python Date/Datetime to Unix epoch with resolution base
+npy_datetime PyDateTimeToEpoch(PyObject *dt, NPY_DATETIMEUNIT base);
+
+char *int64ToIsoDuration(int64_t value, size_t *len);
+
+#endif  // PANDAS__LIBS_SRC_UJSON_PYTHON_DATE_CONVERSIONS_H_

.venv/Lib/site-packages/pandas/_libs/src/ujson/python/ujson.c

@@ -0,0 +1,81 @@
+/*
+Copyright (c) 2011-2013, ESN Social Software AB and Jonas Tarnstrom
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+* Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+* Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+* Neither the name of the ESN Social Software AB nor the
+names of its contributors may be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL ESN SOCIAL SOFTWARE AB OR JONAS TARNSTROM BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+Portions of code from MODP_ASCII - Ascii transformations (upper/lower, etc)
+https://github.com/client9/stringencoders
+Copyright (c) 2007  Nick Galbreath -- nickg [at] modp [dot] com. All rights reserved.
+
+Numeric decoder derived from from TCL library
+https://www.opensource.apple.com/source/tcl/tcl-14/tcl/license.terms
+* Copyright (c) 1988-1993 The Regents of the University of California.
+* Copyright (c) 1994 Sun Microsystems, Inc.
+*/
+
+#include "version.h"
+#define PY_SSIZE_T_CLEAN
+#include <Python.h>
+#define PY_ARRAY_UNIQUE_SYMBOL UJSON_NUMPY
+#include "numpy/arrayobject.h"
+
+/* objToJSON */
+PyObject *objToJSON(PyObject *self, PyObject *args, PyObject *kwargs);
+void initObjToJSON(void);
+
+/* JSONToObj */
+PyObject *JSONToObj(PyObject *self, PyObject *args, PyObject *kwargs);
+
+#define ENCODER_HELP_TEXT                                                  \
+    "Use ensure_ascii=false to output UTF-8. Pass in double_precision to " \
+    "alter the maximum digit precision of doubles. Set "                   \
+    "encode_html_chars=True to encode < > & as unicode escape sequences."
+
+static PyMethodDef ujsonMethods[] = {
+    {"encode", (PyCFunction)objToJSON, METH_VARARGS | METH_KEYWORDS,
+     "Converts arbitrary object recursively into JSON. " ENCODER_HELP_TEXT},
+    {"decode", (PyCFunction)JSONToObj, METH_VARARGS | METH_KEYWORDS,
+     "Converts JSON as string to dict object structure. Use precise_float=True "
+     "to use high precision float decoder."},
+    {"dumps", (PyCFunction)objToJSON, METH_VARARGS | METH_KEYWORDS,
+     "Converts arbitrary object recursively into JSON. " ENCODER_HELP_TEXT},
+    {"loads", (PyCFunction)JSONToObj, METH_VARARGS | METH_KEYWORDS,
+     "Converts JSON as string to dict object structure. Use precise_float=True "
+     "to use high precision float decoder."},
+    {NULL, NULL, 0, NULL} /* Sentinel */
+};
+
+static PyModuleDef moduledef = {
+    .m_base = PyModuleDef_HEAD_INIT,
+    .m_name = "_libjson",
+    .m_methods = ujsonMethods
+};
+
+
+PyMODINIT_FUNC PyInit_json(void) {
+  import_array()
+  initObjToJSON();  // TODO(username): clean up, maybe via tp_free?
+  return PyModuleDef_Init(&moduledef);
+}

.venv/Lib/site-packages/pandas/_libs/src/ujson/python/version.h

@@ -0,0 +1,43 @@
+/*
+Copyright (c) 2011-2013, ESN Social Software AB and Jonas Tarnstrom
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+    * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+    * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+    * Neither the name of the ESN Social Software AB nor the
+      names of its contributors may be used to endorse or promote products
+      derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL ESN SOCIAL SOFTWARE AB OR JONAS TARNSTROM BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+Portions of code from MODP_ASCII - Ascii transformations (upper/lower, etc)
+https://github.com/client9/stringencoders
+Copyright (c) 2007  Nick Galbreath -- nickg [at] modp [dot] com. All rights reserved.
+
+Numeric decoder derived from from TCL library
+https://www.opensource.apple.com/source/tcl/tcl-14/tcl/license.terms
+ * Copyright (c) 1988-1993 The Regents of the University of California.
+ * Copyright (c) 1994 Sun Microsystems, Inc.
+*/
+
+#ifndef PANDAS__LIBS_SRC_UJSON_PYTHON_VERSION_H_
+#define PANDAS__LIBS_SRC_UJSON_PYTHON_VERSION_H_
+
+#define UJSON_VERSION "1.33"
+
+#endif  // PANDAS__LIBS_SRC_UJSON_PYTHON_VERSION_H_