first commit

.venv/Lib/site-packages/pythonwin/license.txt

@@ -0,0 +1,30 @@
+Unless stated in the specfic source file, this work is
+Copyright (c) 1994-2008, Mark Hammond 
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without 
+modification, are permitted provided that the following conditions 
+are met:
+
+Redistributions of source code must retain the above copyright notice, 
+this list of conditions and the following disclaimer.
+
+Redistributions in binary form must reproduce the above copyright 
+notice, this list of conditions and the following disclaimer in 
+the documentation and/or other materials provided with the distribution.
+
+Neither name of Mark Hammond nor the name of contributors may be used 
+to endorse or promote products derived from this software without 
+specific prior written permission. 
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS ``AS
+IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED
+TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A
+PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR
+PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF
+LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. 

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/basictimerapp.py

@@ -0,0 +1,258 @@
+# basictimerapp - a really simple timer application.
+# This should be run using the command line:
+# pythonwin /app demos\basictimerapp.py
+import win32ui
+import win32api
+import win32con
+import sys
+from pywin.framework import app, cmdline, dlgappcore, cmdline
+import timer
+import time
+import string
+
+
+class TimerAppDialog(dlgappcore.AppDialog):
+    softspace = 1
+
+    def __init__(self, appName=""):
+        dlgappcore.AppDialog.__init__(self, win32ui.IDD_GENERAL_STATUS)
+        self.timerAppName = appName
+        self.argOff = 0
+        if len(self.timerAppName) == 0:
+            if len(sys.argv) > 1 and sys.argv[1][0] != "/":
+                self.timerAppName = sys.argv[1]
+                self.argOff = 1
+
+    def PreDoModal(self):
+        # 		sys.stderr = sys.stdout
+        pass
+
+    def ProcessArgs(self, args):
+        for arg in args:
+            if arg == "/now":
+                self.OnOK()
+
+    def OnInitDialog(self):
+        win32ui.SetProfileFileName("pytimer.ini")
+        self.title = win32ui.GetProfileVal(
+            self.timerAppName, "Title", "Remote System Timer"
+        )
+        self.buildTimer = win32ui.GetProfileVal(
+            self.timerAppName, "Timer", "EachMinuteIntervaler()"
+        )
+        self.doWork = win32ui.GetProfileVal(self.timerAppName, "Work", "DoDemoWork()")
+        # replace "\n" with real \n.
+        self.doWork = self.doWork.replace("\\n", "\n")
+        dlgappcore.AppDialog.OnInitDialog(self)
+
+        self.SetWindowText(self.title)
+        self.prompt1 = self.GetDlgItem(win32ui.IDC_PROMPT1)
+        self.prompt2 = self.GetDlgItem(win32ui.IDC_PROMPT2)
+        self.prompt3 = self.GetDlgItem(win32ui.IDC_PROMPT3)
+        self.butOK = self.GetDlgItem(win32con.IDOK)
+        self.butCancel = self.GetDlgItem(win32con.IDCANCEL)
+        self.prompt1.SetWindowText("Python Timer App")
+        self.prompt2.SetWindowText("")
+        self.prompt3.SetWindowText("")
+        self.butOK.SetWindowText("Do it now")
+        self.butCancel.SetWindowText("Close")
+
+        self.timerManager = TimerManager(self)
+        self.ProcessArgs(sys.argv[self.argOff :])
+        self.timerManager.go()
+        return 1
+
+    def OnDestroy(self, msg):
+        dlgappcore.AppDialog.OnDestroy(self, msg)
+        self.timerManager.stop()
+
+    def OnOK(self):
+        # stop the timer, then restart after setting special boolean
+        self.timerManager.stop()
+        self.timerManager.bConnectNow = 1
+        self.timerManager.go()
+        return
+
+
+# 	def OnCancel(self): default behaviour - cancel == close.
+# 		return
+
+
+class TimerManager:
+    def __init__(self, dlg):
+        self.dlg = dlg
+        self.timerId = None
+        self.intervaler = eval(self.dlg.buildTimer)
+        self.bConnectNow = 0
+        self.bHaveSetPrompt1 = 0
+
+    def CaptureOutput(self):
+        self.oldOut = sys.stdout
+        self.oldErr = sys.stderr
+        sys.stdout = sys.stderr = self
+        self.bHaveSetPrompt1 = 0
+
+    def ReleaseOutput(self):
+        sys.stdout = self.oldOut
+        sys.stderr = self.oldErr
+
+    def write(self, str):
+        s = str.strip()
+        if len(s):
+            if self.bHaveSetPrompt1:
+                dest = self.dlg.prompt3
+            else:
+                dest = self.dlg.prompt1
+                self.bHaveSetPrompt1 = 1
+            dest.SetWindowText(s)
+
+    def go(self):
+        self.OnTimer(None, None)
+
+    def stop(self):
+        if self.timerId:
+            timer.kill_timer(self.timerId)
+        self.timerId = None
+
+    def OnTimer(self, id, timeVal):
+        if id:
+            timer.kill_timer(id)
+        if self.intervaler.IsTime() or self.bConnectNow:
+            # do the work.
+            try:
+                self.dlg.SetWindowText(self.dlg.title + " - Working...")
+                self.dlg.butOK.EnableWindow(0)
+                self.dlg.butCancel.EnableWindow(0)
+                self.CaptureOutput()
+                try:
+                    exec(self.dlg.doWork)
+                    print("The last operation completed successfully.")
+                except:
+                    t, v, tb = sys.exc_info()
+                    str = "Failed: %s: %s" % (t, repr(v))
+                    print(str)
+                    self.oldErr.write(str)
+                    tb = None  # Prevent cycle
+            finally:
+                self.ReleaseOutput()
+                self.dlg.butOK.EnableWindow()
+                self.dlg.butCancel.EnableWindow()
+                self.dlg.SetWindowText(self.dlg.title)
+        else:
+            now = time.time()
+            nextTime = self.intervaler.GetNextTime()
+            if nextTime:
+                timeDiffSeconds = nextTime - now
+                timeDiffMinutes = int(timeDiffSeconds / 60)
+                timeDiffSeconds = timeDiffSeconds % 60
+                timeDiffHours = int(timeDiffMinutes / 60)
+                timeDiffMinutes = timeDiffMinutes % 60
+                self.dlg.prompt1.SetWindowText(
+                    "Next connection due in %02d:%02d:%02d"
+                    % (timeDiffHours, timeDiffMinutes, timeDiffSeconds)
+                )
+        self.timerId = timer.set_timer(
+            self.intervaler.GetWakeupInterval(), self.OnTimer
+        )
+        self.bConnectNow = 0
+
+
+class TimerIntervaler:
+    def __init__(self):
+        self.nextTime = None
+        self.wakeUpInterval = 2000
+
+    def GetWakeupInterval(self):
+        return self.wakeUpInterval
+
+    def GetNextTime(self):
+        return self.nextTime
+
+    def IsTime(self):
+        now = time.time()
+        if self.nextTime is None:
+            self.nextTime = self.SetFirstTime(now)
+        ret = 0
+        if now >= self.nextTime:
+            ret = 1
+            self.nextTime = self.SetNextTime(self.nextTime, now)
+            # do the work.
+        return ret
+
+
+class EachAnyIntervaler(TimerIntervaler):
+    def __init__(self, timeAt, timePos, timeAdd, wakeUpInterval=None):
+        TimerIntervaler.__init__(self)
+        self.timeAt = timeAt
+        self.timePos = timePos
+        self.timeAdd = timeAdd
+        if wakeUpInterval:
+            self.wakeUpInterval = wakeUpInterval
+
+    def SetFirstTime(self, now):
+        timeTup = time.localtime(now)
+        lst = []
+        for item in timeTup:
+            lst.append(item)
+        bAdd = timeTup[self.timePos] > self.timeAt
+        lst[self.timePos] = self.timeAt
+        for pos in range(self.timePos + 1, 6):
+            lst[pos] = 0
+        ret = time.mktime(tuple(lst))
+        if bAdd:
+            ret = ret + self.timeAdd
+        return ret
+
+    def SetNextTime(self, lastTime, now):
+        return lastTime + self.timeAdd
+
+
+class EachMinuteIntervaler(EachAnyIntervaler):
+    def __init__(self, at=0):
+        EachAnyIntervaler.__init__(self, at, 5, 60, 2000)
+
+
+class EachHourIntervaler(EachAnyIntervaler):
+    def __init__(self, at=0):
+        EachAnyIntervaler.__init__(self, at, 4, 3600, 10000)
+
+
+class EachDayIntervaler(EachAnyIntervaler):
+    def __init__(self, at=0):
+        EachAnyIntervaler.__init__(self, at, 3, 86400, 10000)
+
+
+class TimerDialogApp(dlgappcore.DialogApp):
+    def CreateDialog(self):
+        return TimerAppDialog()
+
+
+def DoDemoWork():
+    print("Doing the work...")
+    print("About to connect")
+    win32api.MessageBeep(win32con.MB_ICONASTERISK)
+    win32api.Sleep(2000)
+    print("Doing something else...")
+    win32api.MessageBeep(win32con.MB_ICONEXCLAMATION)
+    win32api.Sleep(2000)
+    print("More work.")
+    win32api.MessageBeep(win32con.MB_ICONHAND)
+    win32api.Sleep(2000)
+    print("The last bit.")
+    win32api.MessageBeep(win32con.MB_OK)
+    win32api.Sleep(2000)
+
+
+app = TimerDialogApp()
+
+
+def t():
+    t = TimerAppDialog("Test Dialog")
+    t.DoModal()
+    return t
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NeedApp()

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/customprint.py

@@ -0,0 +1,188 @@
+# A demo of an Application object that has some custom print functionality.
+
+# If you desire, you can also run this from inside Pythonwin, in which
+# case it will do the demo inside the Pythonwin environment.
+
+# This sample was contributed by Roger Burnham.
+
+from pywin.mfc import docview, dialog, afxres
+from pywin.framework import app
+
+import win32con
+import win32ui
+import win32api
+
+PRINTDLGORD = 1538
+IDC_PRINT_MAG_EDIT = 1010
+
+
+class PrintDemoTemplate(docview.DocTemplate):
+    def _SetupSharedMenu_(self):
+        pass
+
+
+class PrintDemoView(docview.ScrollView):
+    def OnInitialUpdate(self):
+        ret = self._obj_.OnInitialUpdate()
+        self.colors = {
+            "Black": (0x00 << 0) + (0x00 << 8) + (0x00 << 16),
+            "Red": (0xFF << 0) + (0x00 << 8) + (0x00 << 16),
+            "Green": (0x00 << 0) + (0xFF << 8) + (0x00 << 16),
+            "Blue": (0x00 << 0) + (0x00 << 8) + (0xFF << 16),
+            "Cyan": (0x00 << 0) + (0xFF << 8) + (0xFF << 16),
+            "Magenta": (0xFF << 0) + (0x00 << 8) + (0xFF << 16),
+            "Yellow": (0xFF << 0) + (0xFF << 8) + (0x00 << 16),
+        }
+        self.pens = {}
+        for name, color in self.colors.items():
+            self.pens[name] = win32ui.CreatePen(win32con.PS_SOLID, 5, color)
+        self.pen = None
+        self.size = (128, 128)
+        self.SetScaleToFitSize(self.size)
+        self.HookCommand(self.OnFilePrint, afxres.ID_FILE_PRINT)
+        self.HookCommand(self.OnFilePrintPreview, win32ui.ID_FILE_PRINT_PREVIEW)
+        return ret
+
+    def OnDraw(self, dc):
+        oldPen = None
+        x, y = self.size
+        delta = 2
+        colors = list(self.colors.keys())
+        colors.sort()
+        colors = colors * 2
+        for color in colors:
+            if oldPen is None:
+                oldPen = dc.SelectObject(self.pens[color])
+            else:
+                dc.SelectObject(self.pens[color])
+            dc.MoveTo((delta, delta))
+            dc.LineTo((x - delta, delta))
+            dc.LineTo((x - delta, y - delta))
+            dc.LineTo((delta, y - delta))
+            dc.LineTo((delta, delta))
+            delta = delta + 4
+            if x - delta <= 0 or y - delta <= 0:
+                break
+        dc.SelectObject(oldPen)
+
+    def OnPrepareDC(self, dc, pInfo):
+        if dc.IsPrinting():
+            mag = self.prtDlg["mag"]
+            dc.SetMapMode(win32con.MM_ANISOTROPIC)
+            dc.SetWindowOrg((0, 0))
+            dc.SetWindowExt((1, 1))
+            dc.SetViewportOrg((0, 0))
+            dc.SetViewportExt((mag, mag))
+
+    def OnPreparePrinting(self, pInfo):
+        flags = (
+            win32ui.PD_USEDEVMODECOPIES
+            | win32ui.PD_PAGENUMS
+            | win32ui.PD_NOPAGENUMS
+            | win32ui.PD_NOSELECTION
+        )
+        self.prtDlg = ImagePrintDialog(pInfo, PRINTDLGORD, flags)
+        pInfo.SetPrintDialog(self.prtDlg)
+        pInfo.SetMinPage(1)
+        pInfo.SetMaxPage(1)
+        pInfo.SetFromPage(1)
+        pInfo.SetToPage(1)
+        ret = self.DoPreparePrinting(pInfo)
+        return ret
+
+    def OnBeginPrinting(self, dc, pInfo):
+        return self._obj_.OnBeginPrinting(dc, pInfo)
+
+    def OnEndPrinting(self, dc, pInfo):
+        del self.prtDlg
+        return self._obj_.OnEndPrinting(dc, pInfo)
+
+    def OnFilePrintPreview(self, *arg):
+        self._obj_.OnFilePrintPreview()
+
+    def OnFilePrint(self, *arg):
+        self._obj_.OnFilePrint()
+
+    def OnPrint(self, dc, pInfo):
+        doc = self.GetDocument()
+        metrics = dc.GetTextMetrics()
+        cxChar = metrics["tmAveCharWidth"]
+        cyChar = metrics["tmHeight"]
+        left, top, right, bottom = pInfo.GetDraw()
+        dc.TextOut(0, 2 * cyChar, doc.GetTitle())
+        top = top + (7 * cyChar) / 2
+        dc.MoveTo(left, top)
+        dc.LineTo(right, top)
+        top = top + cyChar
+        # this seems to have not effect...
+        # get what I want with the dc.SetWindowOrg calls
+        pInfo.SetDraw((left, top, right, bottom))
+        dc.SetWindowOrg((0, -top))
+
+        self.OnDraw(dc)
+        dc.SetTextAlign(win32con.TA_LEFT | win32con.TA_BOTTOM)
+
+        rect = self.GetWindowRect()
+        rect = self.ScreenToClient(rect)
+        height = rect[3] - rect[1]
+        dc.SetWindowOrg((0, -(top + height + cyChar)))
+        dc.MoveTo(left, 0)
+        dc.LineTo(right, 0)
+
+        x = 0
+        y = (3 * cyChar) / 2
+
+        dc.TextOut(x, y, doc.GetTitle())
+        y = y + cyChar
+
+
+class PrintDemoApp(app.CApp):
+    def __init__(self):
+        app.CApp.__init__(self)
+
+    def InitInstance(self):
+        template = PrintDemoTemplate(None, None, None, PrintDemoView)
+        self.AddDocTemplate(template)
+        self._obj_.InitMDIInstance()
+        self.LoadMainFrame()
+        doc = template.OpenDocumentFile(None)
+        doc.SetTitle("Custom Print Document")
+
+
+class ImagePrintDialog(dialog.PrintDialog):
+
+    sectionPos = "Image Print Demo"
+
+    def __init__(self, pInfo, dlgID, flags=win32ui.PD_USEDEVMODECOPIES):
+        dialog.PrintDialog.__init__(self, pInfo, dlgID, flags=flags)
+        mag = win32ui.GetProfileVal(self.sectionPos, "Document Magnification", 0)
+        if mag <= 0:
+            mag = 2
+            win32ui.WriteProfileVal(self.sectionPos, "Document Magnification", mag)
+
+        self["mag"] = mag
+
+    def OnInitDialog(self):
+        self.magCtl = self.GetDlgItem(IDC_PRINT_MAG_EDIT)
+        self.magCtl.SetWindowText(repr(self["mag"]))
+        return dialog.PrintDialog.OnInitDialog(self)
+
+    def OnOK(self):
+        dialog.PrintDialog.OnOK(self)
+        strMag = self.magCtl.GetWindowText()
+        try:
+            self["mag"] = int(strMag)
+        except:
+            pass
+        win32ui.WriteProfileVal(self.sectionPos, "Document Magnification", self["mag"])
+
+
+if __name__ == "__main__":
+    # Running under Pythonwin
+    def test():
+        template = PrintDemoTemplate(None, None, None, PrintDemoView)
+        template.OpenDocumentFile(None)
+
+    test()
+else:
+    app = PrintDemoApp()

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/demoutils.py

@@ -0,0 +1,61 @@
+# Utilities for the demos
+
+import sys, win32api, win32con, win32ui
+
+NotScriptMsg = """\
+This demo program is not designed to be run as a Script, but is
+probably used by some other test program.  Please try another demo.
+"""
+
+NeedGUIMsg = """\
+This demo program can only be run from inside of Pythonwin
+
+You must start Pythonwin, and select 'Run' from the toolbar or File menu
+"""
+
+
+NeedAppMsg = """\
+This demo program is a 'Pythonwin Application'.
+
+It is more demo code than an example of Pythonwin's capabilities.
+
+To run it, you must execute the command:
+pythonwin.exe /app "%s"
+
+Would you like to execute it now?
+"""
+
+
+def NotAScript():
+    import win32ui
+
+    win32ui.MessageBox(NotScriptMsg, "Demos")
+
+
+def NeedGoodGUI():
+    from pywin.framework.app import HaveGoodGUI
+
+    rc = HaveGoodGUI()
+    if not rc:
+        win32ui.MessageBox(NeedGUIMsg, "Demos")
+    return rc
+
+
+def NeedApp():
+    import win32ui
+
+    rc = win32ui.MessageBox(NeedAppMsg % sys.argv[0], "Demos", win32con.MB_YESNO)
+    if rc == win32con.IDYES:
+        try:
+            parent = win32ui.GetMainFrame().GetSafeHwnd()
+            win32api.ShellExecute(
+                parent, None, "pythonwin.exe", '/app "%s"' % sys.argv[0], None, 1
+            )
+        except win32api.error as details:
+            win32ui.MessageBox("Error executing command - %s" % (details), "Demos")
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NotAScript()

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/dlgappdemo.py

@@ -0,0 +1,50 @@
+# dlgappdemo - a demo of a dialog application.
+# This is a demonstration of both a custom "application" module,
+# and a Python program in a dialog box.
+#
+# NOTE:  You CAN NOT import this module from either PythonWin or Python.
+# This module must be specified on the commandline to PythonWin only.
+# eg, PythonWin /app dlgappdemo.py
+
+from pywin.framework import dlgappcore, app
+import win32ui
+import sys
+
+
+class TestDialogApp(dlgappcore.DialogApp):
+    def CreateDialog(self):
+        return TestAppDialog()
+
+
+class TestAppDialog(dlgappcore.AppDialog):
+    def __init__(self):
+        self.edit = None
+        dlgappcore.AppDialog.__init__(self, win32ui.IDD_LARGE_EDIT)
+
+    def OnInitDialog(self):
+        self.SetWindowText("Test dialog application")
+        self.edit = self.GetDlgItem(win32ui.IDC_EDIT1)
+        print("Hello from Python")
+        print("args are:", end=" ")
+        for arg in sys.argv:
+            print(arg)
+        return 1
+
+    def PreDoModal(self):
+        sys.stdout = sys.stderr = self
+
+    def write(self, str):
+        if self.edit:
+            self.edit.SetSel(-2)
+            # translate \n to \n\r
+            self.edit.ReplaceSel(str.replace("\n", "\r\n"))
+        else:
+            win32ui.OutputDebug("dlgapp - no edit control! >>\n%s\n<<\n" % str)
+
+
+app.AppBuilder = TestDialogApp
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NeedApp()

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/dojobapp.py

@@ -0,0 +1,73 @@
+# dojobapp - do a job, show the result in a dialog, and exit.
+#
+# Very simple - faily minimal dialog based app.
+#
+# This should be run using the command line:
+# pythonwin /app demos\dojobapp.py
+
+import win32ui
+import win32api
+import win32con
+import sys
+from pywin.framework import app, dlgappcore
+import string
+
+
+class DoJobAppDialog(dlgappcore.AppDialog):
+    softspace = 1
+
+    def __init__(self, appName=""):
+        self.appName = appName
+        dlgappcore.AppDialog.__init__(self, win32ui.IDD_GENERAL_STATUS)
+
+    def PreDoModal(self):
+        pass
+
+    def ProcessArgs(self, args):
+        pass
+
+    def OnInitDialog(self):
+        self.SetWindowText(self.appName)
+        butCancel = self.GetDlgItem(win32con.IDCANCEL)
+        butCancel.ShowWindow(win32con.SW_HIDE)
+        p1 = self.GetDlgItem(win32ui.IDC_PROMPT1)
+        p2 = self.GetDlgItem(win32ui.IDC_PROMPT2)
+
+        # Do something here!
+
+        p1.SetWindowText("Hello there")
+        p2.SetWindowText("from the demo")
+
+    def OnDestroy(self, msg):
+        pass
+
+
+# 	def OnOK(self):
+# 		pass
+# 	def OnCancel(self): default behaviour - cancel == close.
+# 		return
+
+
+class DoJobDialogApp(dlgappcore.DialogApp):
+    def CreateDialog(self):
+        return DoJobAppDialog("Do Something")
+
+
+class CopyToDialogApp(DoJobDialogApp):
+    def __init__(self):
+        DoJobDialogApp.__init__(self)
+
+
+app.AppBuilder = DoJobDialogApp
+
+
+def t():
+    t = DoJobAppDialog("Copy To")
+    t.DoModal()
+    return t
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NeedApp()

.venv/Lib/site-packages/pythonwin/pywin/Demos/app/helloapp.py

@@ -0,0 +1,52 @@
+##
+## helloapp.py
+##
+##
+## A nice, small 'hello world' Pythonwin application.
+## NOT an MDI application - just a single, normal, top-level window.
+##
+## MUST be run with the command line "pythonwin.exe /app helloapp.py"
+## (or if you are really keen, rename "pythonwin.exe" to something else, then
+## using MSVC or similar, edit the string section in the .EXE to name this file)
+##
+## Originally by Willy Heineman <wheineman@uconect.net>
+
+
+import win32con
+import win32ui
+from pywin.mfc import window, dialog, afxres
+from pywin.mfc.thread import WinApp
+
+# The main frame.
+# Does almost nothing at all - doesnt even create a child window!
+class HelloWindow(window.Wnd):
+    def __init__(self):
+        # The window.Wnd ctor creates a Window object, and places it in
+        # self._obj_.  Note the window object exists, but the window itself
+        # does not!
+        window.Wnd.__init__(self, win32ui.CreateWnd())
+
+        # Now we ask the window object to create the window itself.
+        self._obj_.CreateWindowEx(
+            win32con.WS_EX_CLIENTEDGE,
+            win32ui.RegisterWndClass(0, 0, win32con.COLOR_WINDOW + 1),
+            "Hello World!",
+            win32con.WS_OVERLAPPEDWINDOW,
+            (100, 100, 400, 300),
+            None,
+            0,
+            None,
+        )
+
+
+# The application object itself.
+class HelloApp(WinApp):
+    def InitInstance(self):
+        self.frame = HelloWindow()
+        self.frame.ShowWindow(win32con.SW_SHOWNORMAL)
+        # We need to tell MFC what our main frame is.
+        self.SetMainFrame(self.frame)
+
+
+# Now create the application object itself!
+app = HelloApp()

.venv/Lib/site-packages/pythonwin/pywin/Demos/cmdserver.py

@@ -0,0 +1,117 @@
+# cmdserver.py
+
+# Demo code that is not Pythonwin related, but too good to throw away...
+
+import win32api
+import sys
+from pywin.framework import winout
+
+import _thread, sys
+
+import traceback
+
+
+class ThreadWriter:
+    "Assign an instance to sys.stdout for per-thread printing objects - Courtesy Guido!"
+
+    def __init__(self):
+        "Constructor -- initialize the table of writers"
+        self.writers = {}
+        self.origStdOut = None
+
+    def register(self, writer):
+        "Register the writer for the current thread"
+        self.writers[_thread.get_ident()] = writer
+        if self.origStdOut is None:
+            self.origStdOut = sys.stdout
+            sys.stdout = self
+
+    def unregister(self):
+        "Remove the writer for the current thread, if any"
+        try:
+            del self.writers[_thread.get_ident()]
+        except KeyError:
+            pass
+        if len(self.writers) == 0:
+            sys.stdout = self.origStdOut
+            self.origStdOut = None
+
+    def getwriter(self):
+        "Return the current thread's writer, default sys.stdout"
+        try:
+            return self.writers[_thread.get_ident()]
+        except KeyError:
+            return self.origStdOut
+
+    def write(self, str):
+        "Write to the current thread's writer, default sys.stdout"
+        self.getwriter().write(str)
+
+
+def Test():
+    num = 1
+    while num < 1000:
+        print("Hello there no " + str(num))
+        win32api.Sleep(50)
+        num = num + 1
+
+
+class flags:
+    SERVER_BEST = 0
+    SERVER_IMMEDIATE = 1
+    SERVER_THREAD = 2
+    SERVER_PROCESS = 3
+
+
+def StartServer(cmd, title=None, bCloseOnEnd=0, serverFlags=flags.SERVER_BEST):
+    out = winout.WindowOutput(title, None, winout.flags.WQ_IDLE)
+    if not title:
+        title = cmd
+    out.Create(title)
+    # 	ServerThread((out, cmd, title, bCloseOnEnd))
+    # 	out = sys.stdout
+    _thread.start_new_thread(ServerThread, (out, cmd, title, bCloseOnEnd))
+
+
+def ServerThread(myout, cmd, title, bCloseOnEnd):
+    try:
+        writer.register(myout)
+        print('Executing "%s"\n' % cmd)
+        bOK = 1
+        try:
+            import __main__
+
+            exec(cmd + "\n", __main__.__dict__)
+        except:
+            bOK = 0
+        if bOK:
+            print("Command terminated without errors.")
+        else:
+            t, v, tb = sys.exc_info()
+            print(t, ": ", v)
+            traceback.print_tb(tb)
+            tb = None  # prevent a cycle
+            print("Command terminated with an unhandled exception")
+        writer.unregister()
+        if bOK and bCloseOnEnd:
+            myout.frame.DestroyWindow()
+
+    # Unhandled exception of any kind in a thread kills the gui!
+    except:
+        t, v, tb = sys.exc_info()
+        print(t, ": ", v)
+        traceback.print_tb(tb)
+        tb = None
+        print("Thread failed")
+
+
+# assist for reloading (when debugging) - use only 1 tracer object,
+# else a large chain of tracer objects will exist.
+# try:
+# 	writer
+# except NameError:
+# 	writer=ThreadWriter()
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NotAScript()

.venv/Lib/site-packages/pythonwin/pywin/Demos/createwin.py

@@ -0,0 +1,114 @@
+#
+# Window creation example
+#
+# 	This example creates a minimal "control" that just fills in its
+# 	window with red.  To make your own control, subclass Control and
+# 	write your own OnPaint() method.  See PyCWnd.HookMessage for what
+# 	the parameters to OnPaint are.
+#
+
+from pywin.mfc import dialog, window
+import win32ui
+import win32con
+import win32api
+
+
+class Control(window.Wnd):
+    """Generic control class"""
+
+    def __init__(self):
+        window.Wnd.__init__(self, win32ui.CreateWnd())
+
+    def OnPaint(self):
+        dc, paintStruct = self.BeginPaint()
+        self.DoPaint(dc)
+        self.EndPaint(paintStruct)
+
+    def DoPaint(self, dc):  # Override this!
+        pass
+
+
+class RedBox(Control):
+    def DoPaint(self, dc):
+        dc.FillSolidRect(self.GetClientRect(), win32api.RGB(255, 0, 0))
+
+
+class RedBoxWithPie(RedBox):
+    def DoPaint(self, dc):
+        RedBox.DoPaint(self, dc)
+        r = self.GetClientRect()
+        dc.Pie(r[0], r[1], r[2], r[3], 0, 0, r[2], r[3] // 2)
+
+
+def MakeDlgTemplate():
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+
+    w = 64
+    h = 64
+
+    dlg = [
+        ["Red box", (0, 0, w, h), style, None, (8, "MS Sans Serif")],
+    ]
+
+    s = win32con.WS_TABSTOP | cs
+
+    dlg.append(
+        [
+            128,
+            "Cancel",
+            win32con.IDCANCEL,
+            (7, h - 18, 50, 14),
+            s | win32con.BS_PUSHBUTTON,
+        ]
+    )
+
+    return dlg
+
+
+class TestDialog(dialog.Dialog):
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.redbox = RedBox()
+        self.redbox.CreateWindow(
+            None,
+            "RedBox",
+            win32con.WS_CHILD | win32con.WS_VISIBLE,
+            (5, 5, 90, 68),
+            self,
+            1003,
+        )
+        return rc
+
+
+class TestPieDialog(dialog.Dialog):
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.control = RedBoxWithPie()
+        self.control.CreateWindow(
+            None,
+            "RedBox with Pie",
+            win32con.WS_CHILD | win32con.WS_VISIBLE,
+            (5, 5, 90, 68),
+            self,
+            1003,
+        )
+
+
+def demo(modal=0):
+    d = TestPieDialog(MakeDlgTemplate())
+    if modal:
+        d.DoModal()
+    else:
+        d.CreateWindow()
+
+
+if __name__ == "__main__":
+    demo(1)

.venv/Lib/site-packages/pythonwin/pywin/Demos/demoutils.py

@@ -0,0 +1,63 @@
+# Utilities for the demos
+
+import sys, win32api, win32con, win32ui
+
+NotScriptMsg = """\
+This demo program is not designed to be run as a Script, but is
+probably used by some other test program.  Please try another demo.
+"""
+
+NeedGUIMsg = """\
+This demo program can only be run from inside of Pythonwin
+
+You must start Pythonwin, and select 'Run' from the toolbar or File menu
+"""
+
+
+NeedAppMsg = """\
+This demo program is a 'Pythonwin Application'.
+
+It is more demo code than an example of Pythonwin's capabilities.
+
+To run it, you must execute the command:
+pythonwin.exe /app "%s"
+
+Would you like to execute it now?
+"""
+
+
+def NotAScript():
+    import win32ui
+
+    win32ui.MessageBox(NotScriptMsg, "Demos")
+
+
+def NeedGoodGUI():
+    from pywin.framework.app import HaveGoodGUI
+
+    rc = HaveGoodGUI()
+    if not rc:
+        win32ui.MessageBox(NeedGUIMsg, "Demos")
+    return rc
+
+
+def NeedApp():
+    import win32ui
+
+    rc = win32ui.MessageBox(NeedAppMsg % sys.argv[0], "Demos", win32con.MB_YESNO)
+    if rc == win32con.IDYES:
+        try:
+            parent = win32ui.GetMainFrame().GetSafeHwnd()
+            win32api.ShellExecute(
+                parent, None, "pythonwin.exe", '/app "%s"' % sys.argv[0], None, 1
+            )
+        except win32api.error as details:
+            win32ui.MessageBox("Error executing command - %s" % (details), "Demos")
+
+
+from pywin.framework.app import HaveGoodGUI
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NotAScript()

.venv/Lib/site-packages/pythonwin/pywin/Demos/dibdemo.py

@@ -0,0 +1,73 @@
+# A demo which creates a view and a frame which displays a PPM format bitmap
+#
+# This hasnnt been run in a while, as I dont have many of that format around!
+import win32ui
+import win32con
+import win32api
+import string
+
+
+class DIBView:
+    def __init__(self, doc, dib):
+        self.dib = dib
+        self.view = win32ui.CreateView(doc)
+        self.width = self.height = 0
+        # set up message handlers
+        # 		self.view.OnPrepareDC = self.OnPrepareDC
+        self.view.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+    def OnSize(self, params):
+        lParam = params[3]
+        self.width = win32api.LOWORD(lParam)
+        self.height = win32api.HIWORD(lParam)
+
+    def OnDraw(self, ob, dc):
+        # set sizes used for "non strecth" mode.
+        self.view.SetScrollSizes(win32con.MM_TEXT, self.dib.GetSize())
+        dibSize = self.dib.GetSize()
+        dibRect = (0, 0, dibSize[0], dibSize[1])
+        # stretch BMP.
+        # self.dib.Paint(dc, (0,0,self.width, self.height),dibRect)
+        # non stretch.
+        self.dib.Paint(dc)
+
+
+class DIBDemo:
+    def __init__(self, filename, *bPBM):
+        # init data members
+        f = open(filename, "rb")
+        dib = win32ui.CreateDIBitmap()
+        if len(bPBM) > 0:
+            magic = f.readline()
+            if magic != "P6\n":
+                print("The file is not a PBM format file")
+                raise ValueError("Failed - The file is not a PBM format file")
+            # check magic?
+            rowcollist = f.readline().split()
+            cols = int(rowcollist[0])
+            rows = int(rowcollist[1])
+            f.readline()  # whats this one?
+            dib.LoadPBMData(f, (cols, rows))
+        else:
+            dib.LoadWindowsFormatFile(f)
+        f.close()
+        # create doc/view
+        self.doc = win32ui.CreateDoc()
+        self.dibView = DIBView(self.doc, dib)
+        self.frame = win32ui.CreateMDIFrame()
+        self.frame.LoadFrame()  # this will force OnCreateClient
+        self.doc.SetTitle("DIB Demo")
+        self.frame.ShowWindow()
+
+        # display the sucka
+        self.frame.ActivateFrame()
+
+    def OnCreateClient(self, createparams, context):
+        self.dibView.view.CreateWindow(self.frame)
+        return 1
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    demoutils.NotAScript()

.venv/Lib/site-packages/pythonwin/pywin/Demos/dlgtest.py

@@ -0,0 +1,151 @@
+# A Demo of Pythonwin's Dialog and Property Page support.
+
+###################
+#
+# First demo - use the built-in to Pythonwin "Tab Stop" dialog, but
+# customise it heavily.
+#
+# ID's for the tabstop dialog - out test.
+#
+from win32ui import IDD_SET_TABSTOPS
+from win32ui import IDC_EDIT_TABS
+from win32ui import IDC_PROMPT_TABS
+from win32con import IDOK
+from win32con import IDCANCEL
+
+import win32ui
+import win32con
+
+from pywin.mfc import dialog
+
+
+class TestDialog(dialog.Dialog):
+    def __init__(self, modal=1):
+        dialog.Dialog.__init__(self, IDD_SET_TABSTOPS)
+        self.counter = 0
+        if modal:
+            self.DoModal()
+        else:
+            self.CreateWindow()
+
+    def OnInitDialog(self):
+        # Set the caption of the dialog itself.
+        self.SetWindowText("Used to be Tab Stops!")
+        # Get a child control, remember it, and change its text.
+        self.edit = self.GetDlgItem(IDC_EDIT_TABS)  # the text box.
+        self.edit.SetWindowText("Test")
+        # Hook a Windows message for the dialog.
+        self.edit.HookMessage(self.KillFocus, win32con.WM_KILLFOCUS)
+        # Get the prompt control, and change its next.
+        prompt = self.GetDlgItem(IDC_PROMPT_TABS)  # the prompt box.
+        prompt.SetWindowText("Prompt")
+        # And the same for the button..
+        cancel = self.GetDlgItem(IDCANCEL)  # the cancel button
+        cancel.SetWindowText("&Kill me")
+
+        # And just for demonstration purposes, we hook the notify message for the dialog.
+        # This allows us to be notified when the Edit Control text changes.
+        self.HookCommand(self.OnNotify, IDC_EDIT_TABS)
+
+    def OnNotify(self, controlid, code):
+        if code == win32con.EN_CHANGE:
+            print("Edit text changed!")
+        return 1  # I handled this, so no need to call defaults!
+
+    # kill focus for the edit box.
+    # Simply increment the value in the text box.
+    def KillFocus(self, msg):
+        self.counter = self.counter + 1
+        if self.edit != None:
+            self.edit.SetWindowText(str(self.counter))
+
+    # Called when the dialog box is terminating...
+    def OnDestroy(self, msg):
+        del self.edit
+        del self.counter
+
+
+# A very simply Property Sheet.
+# We only make a new class for demonstration purposes.
+class TestSheet(dialog.PropertySheet):
+    def __init__(self, title):
+        dialog.PropertySheet.__init__(self, title)
+        self.HookMessage(self.OnActivate, win32con.WM_ACTIVATE)
+
+    def OnActivate(self, msg):
+        pass
+
+
+# A very simply Property Page, which will be "owned" by the above
+# Property Sheet.
+# We create a new class, just so we can hook a control notification.
+class TestPage(dialog.PropertyPage):
+    def OnInitDialog(self):
+        # We use the HookNotify function to allow Python to respond to
+        # Windows WM_NOTIFY messages.
+        # In this case, we are interested in BN_CLICKED messages.
+        self.HookNotify(self.OnNotify, win32con.BN_CLICKED)
+
+    def OnNotify(self, std, extra):
+        print("OnNotify", std, extra)
+
+
+# Some code that actually uses these objects.
+def demo(modal=0):
+    TestDialog(modal)
+
+    # property sheet/page demo
+    ps = win32ui.CreatePropertySheet("Property Sheet/Page Demo")
+    # Create a completely standard PropertyPage.
+    page1 = win32ui.CreatePropertyPage(win32ui.IDD_PROPDEMO1)
+    # Create our custom property page.
+    page2 = TestPage(win32ui.IDD_PROPDEMO2)
+    ps.AddPage(page1)
+    ps.AddPage(page2)
+    if modal:
+        ps.DoModal()
+    else:
+        style = (
+            win32con.WS_SYSMENU
+            | win32con.WS_POPUP
+            | win32con.WS_CAPTION
+            | win32con.DS_MODALFRAME
+            | win32con.WS_VISIBLE
+        )
+        styleex = win32con.WS_EX_DLGMODALFRAME | win32con.WS_EX_PALETTEWINDOW
+        ps.CreateWindow(win32ui.GetMainFrame(), style, styleex)
+
+
+def test(modal=1):
+
+    # 	dlg=dialog.Dialog(1010)
+    # 	dlg.CreateWindow()
+    # 	dlg.EndDialog(0)
+    # 	del dlg
+    # 	return
+    # property sheet/page demo
+    ps = TestSheet("Property Sheet/Page Demo")
+    page1 = win32ui.CreatePropertyPage(win32ui.IDD_PROPDEMO1)
+    page2 = win32ui.CreatePropertyPage(win32ui.IDD_PROPDEMO2)
+    ps.AddPage(page1)
+    ps.AddPage(page2)
+    del page1
+    del page2
+    if modal:
+        ps.DoModal()
+    else:
+        ps.CreateWindow(win32ui.GetMainFrame())
+    return ps
+
+
+def d():
+    dlg = win32ui.CreateDialog(win32ui.IDD_DEBUGGER)
+    dlg.datalist.append((win32ui.IDC_DBG_RADIOSTACK, "radio"))
+    print("data list is ", dlg.datalist)
+    dlg.data["radio"] = 1
+    dlg.DoModal()
+    print(dlg.data["radio"])
+
+
+if __name__ == "__main__":
+    demo(1)

.venv/Lib/site-packages/pythonwin/pywin/Demos/dyndlg.py

@@ -0,0 +1,104 @@
+# dyndlg.py
+# contributed by Curt Hagenlocher <chi@earthlink.net>
+
+# Dialog Template params:
+# 	Parameter 0 - Window caption
+# 	Parameter 1 - Bounds (rect tuple)
+# 	Parameter 2 - Window style
+# 	Parameter 3 - Extended style
+# 	Parameter 4 - Font tuple
+# 	Parameter 5 - Menu name
+# 	Parameter 6 - Window class
+# Dialog item params:
+# 	Parameter 0 - Window class
+# 	Parameter 1 - Text
+# 	Parameter 2 - ID
+# 	Parameter 3 - Bounds
+# 	Parameter 4 - Style
+# 	Parameter 5 - Extended style
+# 	Parameter 6 - Extra data
+
+
+import win32ui
+import win32con
+from pywin.mfc import dialog, window
+
+
+def MakeDlgTemplate():
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+    dlg = [
+        ["Select Warehouse", (0, 0, 177, 93), style, None, (8, "MS Sans Serif")],
+    ]
+    dlg.append([130, "Current Warehouse:", -1, (7, 7, 69, 9), cs | win32con.SS_LEFT])
+    dlg.append([130, "ASTORIA", 128, (16, 17, 99, 7), cs | win32con.SS_LEFT])
+    dlg.append([130, "New &Warehouse:", -1, (7, 29, 69, 9), cs | win32con.SS_LEFT])
+    s = win32con.WS_TABSTOP | cs
+    # 	dlg.append([131, None, 130, (5, 40, 110, 48),
+    # 		s | win32con.LBS_NOTIFY | win32con.LBS_SORT | win32con.LBS_NOINTEGRALHEIGHT | win32con.WS_VSCROLL | win32con.WS_BORDER])
+    dlg.append(
+        [
+            "{8E27C92B-1264-101C-8A2F-040224009C02}",
+            None,
+            131,
+            (5, 40, 110, 48),
+            win32con.WS_TABSTOP,
+        ]
+    )
+
+    dlg.append(
+        [128, "OK", win32con.IDOK, (124, 5, 50, 14), s | win32con.BS_DEFPUSHBUTTON]
+    )
+    s = win32con.BS_PUSHBUTTON | s
+    dlg.append([128, "Cancel", win32con.IDCANCEL, (124, 22, 50, 14), s])
+    dlg.append([128, "&Help", 100, (124, 74, 50, 14), s])
+
+    return dlg
+
+
+def test1():
+    win32ui.CreateDialogIndirect(MakeDlgTemplate()).DoModal()
+
+
+def test2():
+    dialog.Dialog(MakeDlgTemplate()).DoModal()
+
+
+def test3():
+    dlg = win32ui.LoadDialogResource(win32ui.IDD_SET_TABSTOPS)
+    dlg[0][0] = "New Dialog Title"
+    dlg[0][1] = (80, 20, 161, 60)
+    dlg[1][1] = "&Confusion:"
+    cs = (
+        win32con.WS_CHILD
+        | win32con.WS_VISIBLE
+        | win32con.WS_TABSTOP
+        | win32con.BS_PUSHBUTTON
+    )
+    dlg.append([128, "&Help", 100, (111, 41, 40, 14), cs])
+    dialog.Dialog(dlg).DoModal()
+
+
+def test4():
+    page1 = dialog.PropertyPage(win32ui.LoadDialogResource(win32ui.IDD_PROPDEMO1))
+    page2 = dialog.PropertyPage(win32ui.LoadDialogResource(win32ui.IDD_PROPDEMO2))
+    ps = dialog.PropertySheet("Property Sheet/Page Demo", None, [page1, page2])
+    ps.DoModal()
+
+
+def testall():
+    test1()
+    test2()
+    test3()
+    test4()
+
+
+if __name__ == "__main__":
+    testall()

.venv/Lib/site-packages/pythonwin/pywin/Demos/fontdemo.py

@@ -0,0 +1,88 @@
+# Demo of Generic document windows, DC, and Font usage
+# by Dave Brennan (brennan@hal.com)
+
+# usage examples:
+
+# >>> from fontdemo import *
+# >>> d = FontDemo('Hello, Python')
+# >>> f1 = { 'name':'Arial', 'height':36, 'weight':win32con.FW_BOLD}
+# >>> d.SetFont(f1)
+# >>> f2 = {'name':'Courier New', 'height':24, 'italic':1}
+# >>> d.SetFont (f2)
+
+import win32ui
+import win32con
+import win32api
+
+from pywin.mfc import docview
+
+
+# font is a dictionary in which the following elements matter:
+# (the best matching font to supplied parameters is returned)
+#   name		string name of the font as known by Windows
+#   size		point size of font in logical units
+#   weight		weight of font (win32con.FW_NORMAL, win32con.FW_BOLD)
+#   italic		boolean; true if set to anything but None
+#   underline	boolean; true if set to anything but None
+
+
+class FontView(docview.ScrollView):
+    def __init__(
+        self, doc, text="Python Rules!", font_spec={"name": "Arial", "height": 42}
+    ):
+        docview.ScrollView.__init__(self, doc)
+        self.font = win32ui.CreateFont(font_spec)
+        self.text = text
+        self.width = self.height = 0
+        # set up message handlers
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+    def OnAttachedObjectDeath(self):
+        docview.ScrollView.OnAttachedObjectDeath(self)
+        del self.font
+
+    def SetFont(self, new_font):
+        # Change font on the fly
+        self.font = win32ui.CreateFont(new_font)
+        # redraw the entire client window
+        selfInvalidateRect(None)
+
+    def OnSize(self, params):
+        lParam = params[3]
+        self.width = win32api.LOWORD(lParam)
+        self.height = win32api.HIWORD(lParam)
+
+    def OnPrepareDC(self, dc, printinfo):
+        # Set up the DC for forthcoming OnDraw call
+        self.SetScrollSizes(win32con.MM_TEXT, (100, 100))
+        dc.SetTextColor(win32api.RGB(0, 0, 255))
+        dc.SetBkColor(win32api.GetSysColor(win32con.COLOR_WINDOW))
+        dc.SelectObject(self.font)
+        dc.SetTextAlign(win32con.TA_CENTER | win32con.TA_BASELINE)
+
+    def OnDraw(self, dc):
+        if self.width == 0 and self.height == 0:
+            left, top, right, bottom = self.GetClientRect()
+            self.width = right - left
+            self.height = bottom - top
+        x, y = self.width // 2, self.height // 2
+        dc.TextOut(x, y, self.text)
+
+
+def FontDemo():
+    # create doc/view
+    template = docview.DocTemplate(win32ui.IDR_PYTHONTYPE, None, None, FontView)
+    doc = template.OpenDocumentFile(None)
+    doc.SetTitle("Font Demo")
+    # 	print "template is ", template, "obj is", template._obj_
+    template.close()
+
+
+# 	print "closed"
+# 	del template
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        FontDemo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/guidemo.py

@@ -0,0 +1,85 @@
+# GUI Demo - just a worker script to invoke all the other demo/test scripts.
+import win32ui
+import __main__
+import sys
+import regutil
+import win32api
+
+demos = [  # 	('Font', 'import fontdemo;fontdemo.FontDemo()'),
+    ("Open GL Demo", "import openGLDemo;openGLDemo.test()"),
+    ("Threaded GUI", "import threadedgui;threadedgui.ThreadedDemo()"),
+    ("Tree View Demo", "import hiertest;hiertest.demoboth()"),
+    ("3-Way Splitter Window", "import splittst;splittst.demo()"),
+    ("Custom Toolbars and Tooltips", "import toolbar;toolbar.test()"),
+    ("Progress Bar", "import progressbar;progressbar.demo()"),
+    ("Slider Control", "import sliderdemo;sliderdemo.demo()"),
+    ("Dynamic window creation", "import createwin;createwin.demo()"),
+    ("Various Dialog demos", "import dlgtest;dlgtest.demo()"),
+    ("OCX Control Demo", "from ocx import ocxtest;ocxtest.demo()"),
+    ("OCX Serial Port Demo", "from ocx import ocxserialtest;	ocxserialtest.test()"),
+    (
+        "IE4 Control Demo",
+        'from ocx import webbrowser; webbrowser.Demo("http://www.python.org")',
+    ),
+]
+
+
+def demo():
+    try:
+        # seeif I can locate the demo files.
+        import fontdemo
+    except ImportError:
+        # else put the demos direectory on the path (if not already)
+        try:
+            instPath = regutil.GetRegistryDefaultValue(
+                regutil.BuildDefaultPythonKey() + "\\InstallPath"
+            )
+        except win32api.error:
+            print(
+                "The InstallPath can not be located, and the Demos directory is not on the path"
+            )
+            instPath = "."
+
+        demosDir = win32ui.FullPath(instPath + "\\Demos")
+        for path in sys.path:
+            if win32ui.FullPath(path) == demosDir:
+                break
+        else:
+            sys.path.append(demosDir)
+        import fontdemo
+
+    import sys
+
+    if "/go" in sys.argv:
+        for name, cmd in demos:
+            try:
+                exec(cmd)
+            except:
+                print(
+                    "Demo of %s failed - %s:%s"
+                    % (cmd, sys.exc_info()[0], sys.exc_info()[1])
+                )
+        return
+    # Otherwise allow the user to select the demo to run
+
+    import pywin.dialogs.list
+
+    while 1:
+        rc = pywin.dialogs.list.SelectFromLists("Select a Demo", demos, ["Demo Title"])
+        if rc is None:
+            break
+        title, cmd = demos[rc]
+        try:
+            exec(cmd)
+        except:
+            print(
+                "Demo of %s failed - %s:%s"
+                % (title, sys.exc_info()[0], sys.exc_info()[1])
+            )
+
+
+if __name__ == __main__.__name__:
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/hiertest.py

@@ -0,0 +1,137 @@
+import win32ui
+import os
+import commctrl
+
+from pywin.tools import hierlist
+from pywin.mfc import docview, window
+
+# directory listbox
+# This has obvious limitations - doesnt track subdirs, etc.  Demonstrates
+# simple use of Python code for querying the tree as needed.
+# Only use strings, and lists of strings (from curdir())
+class DirHierList(hierlist.HierList):
+    def __init__(self, root, listBoxID=win32ui.IDC_LIST1):
+        hierlist.HierList.__init__(self, root, win32ui.IDB_HIERFOLDERS, listBoxID)
+
+    def GetText(self, item):
+        return os.path.basename(item)
+
+    def GetSubList(self, item):
+        if os.path.isdir(item):
+            ret = [os.path.join(item, fname) for fname in os.listdir(item)]
+        else:
+            ret = None
+        return ret
+
+    # if the item is a dir, it is expandable.
+    def IsExpandable(self, item):
+        return os.path.isdir(item)
+
+    def GetSelectedBitmapColumn(self, item):
+        return self.GetBitmapColumn(item) + 6  # Use different color for selection
+
+
+class TestDocument(docview.Document):
+    def __init__(self, template):
+        docview.Document.__init__(self, template)
+        self.hierlist = hierlist.HierListWithItems(
+            HLIFileDir("\\"), win32ui.IDB_HIERFOLDERS, win32ui.AFX_IDW_PANE_FIRST
+        )
+
+
+class HierListView(docview.TreeView):
+    def OnInitialUpdate(self):
+        rc = self._obj_.OnInitialUpdate()
+        self.hierList = self.GetDocument().hierlist
+        self.hierList.HierInit(self.GetParent())
+        self.hierList.SetStyle(
+            commctrl.TVS_HASLINES | commctrl.TVS_LINESATROOT | commctrl.TVS_HASBUTTONS
+        )
+        return rc
+
+
+class HierListFrame(window.MDIChildWnd):
+    pass
+
+
+def GetTestRoot():
+    tree1 = ("Tree 1", [("Item 1", "Item 1 data"), "Item 2", 3])
+    tree2 = ("Tree 2", [("Item 2.1", "Item 2 data"), "Item 2.2", 2.3])
+    return ("Root", [tree1, tree2, "Item 3"])
+
+
+def demoboth():
+    template = docview.DocTemplate(
+        win32ui.IDR_PYTHONTYPE, TestDocument, HierListFrame, HierListView
+    )
+    template.OpenDocumentFile(None).SetTitle("Hierlist demo")
+
+    demomodeless()
+
+
+def demomodeless():
+    testList2 = DirHierList("\\")
+    dlg = hierlist.HierDialog("hier list test", testList2)
+    dlg.CreateWindow()
+
+
+def demodlg():
+    testList2 = DirHierList("\\")
+    dlg = hierlist.HierDialog("hier list test", testList2)
+    dlg.DoModal()
+
+
+def demo():
+    template = docview.DocTemplate(
+        win32ui.IDR_PYTHONTYPE, TestDocument, HierListFrame, HierListView
+    )
+    template.OpenDocumentFile(None).SetTitle("Hierlist demo")
+
+
+#
+# Demo/Test for HierList items.
+#
+# Easy to make a better directory program.
+#
+class HLIFileDir(hierlist.HierListItem):
+    def __init__(self, filename):
+        self.filename = filename
+        hierlist.HierListItem.__init__(self)
+
+    def GetText(self):
+        try:
+            return "%-20s %d bytes" % (
+                os.path.basename(self.filename),
+                os.stat(self.filename)[6],
+            )
+        except os.error as details:
+            return "%-20s - %s" % (self.filename, details[1])
+
+    def IsExpandable(self):
+        return os.path.isdir(self.filename)
+
+    def GetSubList(self):
+        ret = []
+        for newname in os.listdir(self.filename):
+            if newname not in [".", ".."]:
+                ret.append(HLIFileDir(os.path.join(self.filename, newname)))
+        return ret
+
+
+def demohli():
+    template = docview.DocTemplate(
+        win32ui.IDR_PYTHONTYPE,
+        TestDocument,
+        hierlist.HierListFrame,
+        hierlist.HierListView,
+    )
+    template.OpenDocumentFile(None).SetTitle("Hierlist demo")
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.HaveGoodGUI():
+        demoboth()
+    else:
+        demodlg()

.venv/Lib/site-packages/pythonwin/pywin/Demos/menutest.py

@@ -0,0 +1,13 @@
+# Run this as a python script, to gray "close" off the edit window system menu.
+from pywin.framework import interact
+import win32con
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        win = interact.edit.currentView.GetParent()
+        menu = win.GetSystemMenu()
+        id = menu.GetMenuItemID(6)
+        menu.EnableMenuItem(id, win32con.MF_BYCOMMAND | win32con.MF_GRAYED)
+        print("The interactive window's 'Close' menu item is now disabled.")

.venv/Lib/site-packages/pythonwin/pywin/Demos/objdoc.py

@@ -0,0 +1,57 @@
+# This is a sample file, and shows the basic framework for using an "Object" based
+# document, rather than a "filename" based document.
+# This is referenced by the Pythonwin .html documentation.
+
+# In the example below, the OpenObject() method is used instead of OpenDocumentFile,
+# and all the core MFC document open functionality is retained.
+
+import win32ui
+from pywin.mfc import docview
+
+
+class object_template(docview.DocTemplate):
+    def __init__(self):
+        docview.DocTemplate.__init__(self, None, None, None, object_view)
+
+    def OpenObject(self, object):  # Use this instead of OpenDocumentFile.
+        # Look for existing open document
+        for doc in self.GetDocumentList():
+            print("document is ", doc)
+            if doc.object is object:
+                doc.GetFirstView().ActivateFrame()
+                return doc
+        # not found - new one.
+        doc = object_document(self, object)
+        frame = self.CreateNewFrame(doc)
+        doc.OnNewDocument()
+        doc.SetTitle(str(object))
+        self.InitialUpdateFrame(frame, doc)
+        return doc
+
+
+class object_document(docview.Document):
+    def __init__(self, template, object):
+        docview.Document.__init__(self, template)
+        self.object = object
+
+    def OnOpenDocument(self, name):
+        raise RuntimeError("Should not be called if template strings set up correctly")
+        return 0
+
+
+class object_view(docview.EditView):
+    def OnInitialUpdate(self):
+        self.ReplaceSel("Object is %s" % repr(self.GetDocument().object))
+
+
+def demo():
+    t = object_template()
+    d = t.OpenObject(win32ui)
+    return (t, d)
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/demoutils.py

@@ -0,0 +1,63 @@
+# Utilities for the demos
+
+import sys, win32api, win32con, win32ui
+
+NotScriptMsg = """\
+This demo program is not designed to be run as a Script, but is
+probably used by some other test program.  Please try another demo.
+"""
+
+NeedGUIMsg = """\
+This demo program can only be run from inside of Pythonwin
+
+You must start Pythonwin, and select 'Run' from the toolbar or File menu
+"""
+
+
+NeedAppMsg = """\
+This demo program is a 'Pythonwin Application'.
+
+It is more demo code than an example of Pythonwin's capabilities.
+
+To run it, you must execute the command:
+pythonwin.exe /app "%s"
+
+Would you like to execute it now?
+"""
+
+
+def NotAScript():
+    import win32ui
+
+    win32ui.MessageBox(NotScriptMsg, "Demos")
+
+
+def NeedGoodGUI():
+    from pywin.framework.app import HaveGoodGUI
+
+    rc = HaveGoodGUI()
+    if not rc:
+        win32ui.MessageBox(NeedGUIMsg, "Demos")
+    return rc
+
+
+def NeedApp():
+    import win32ui
+
+    rc = win32ui.MessageBox(NeedAppMsg % sys.argv[0], "Demos", win32con.MB_YESNO)
+    if rc == win32con.IDYES:
+        try:
+            parent = win32ui.GetMainFrame().GetSafeHwnd()
+            win32api.ShellExecute(
+                parent, None, "pythonwin.exe", '/app "%s"' % sys.argv[0], None, 1
+            )
+        except win32api.error as details:
+            win32ui.MessageBox("Error executing command - %s" % (details), "Demos")
+
+
+from pywin.framework.app import HaveGoodGUI
+
+if __name__ == "__main__":
+    from . import demoutils
+
+    demoutils.NotAScript()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/flash.py

@@ -0,0 +1,91 @@
+# By Bradley Schatz
+# simple flash/python application demonstrating bidirectional
+# communicaion between flash and python. Click the sphere to see
+# behavior. Uses Bounce.swf from FlashBounce.zip, available from
+# http://pages.cpsc.ucalgary.ca/~saul/vb_examples/tutorial12/
+
+# Update to the path of the .swf file (note it could be a true URL)
+flash_url = "c:\\bounce.swf"
+
+import win32ui, win32con, win32api, regutil
+from pywin.mfc import window, activex
+from win32com.client import gencache
+import sys
+
+FlashModule = gencache.EnsureModule("{D27CDB6B-AE6D-11CF-96B8-444553540000}", 0, 1, 0)
+
+if FlashModule is None:
+    raise ImportError("Flash does not appear to be installed.")
+
+
+class MyFlashComponent(activex.Control, FlashModule.ShockwaveFlash):
+    def __init__(self):
+        activex.Control.__init__(self)
+        FlashModule.ShockwaveFlash.__init__(self)
+        self.x = 50
+        self.y = 50
+        self.angle = 30
+        self.started = 0
+
+    def OnFSCommand(self, command, args):
+        print("FSCommend", command, args)
+        self.x = self.x + 20
+        self.y = self.y + 20
+        self.angle = self.angle + 20
+        if self.x > 200 or self.y > 200:
+            self.x = 0
+            self.y = 0
+        if self.angle > 360:
+            self.angle = 0
+        self.SetVariable("xVal", self.x)
+        self.SetVariable("yVal", self.y)
+        self.SetVariable("angle", self.angle)
+        self.TPlay("_root.mikeBall")
+
+    def OnProgress(self, percentDone):
+        print("PercentDone", percentDone)
+
+    def OnReadyStateChange(self, newState):
+        # 0=Loading, 1=Uninitialized, 2=Loaded, 3=Interactive, 4=Complete
+        print("State", newState)
+
+
+class BrowserFrame(window.MDIChildWnd):
+    def __init__(self, url=None):
+        if url is None:
+            self.url = regutil.GetRegisteredHelpFile("Main Python Documentation")
+        else:
+            self.url = url
+        pass  # Dont call base class doc/view version...
+
+    def Create(self, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.AttachObject(self)
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx = MyFlashComponent()
+        self.ocx.CreateControl(
+            "Flash Player", win32con.WS_VISIBLE | win32con.WS_CHILD, rect, self, 1000
+        )
+        self.ocx.LoadMovie(0, flash_url)
+        self.ocx.Play()
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+    def OnSize(self, params):
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx.SetWindowPos(0, rect, 0)
+
+
+def Demo():
+    url = None
+    if len(sys.argv) > 1:
+        url = win32api.GetFullPathName(sys.argv[1])
+    f = BrowserFrame(url)
+    f.Create("Flash Player")
+
+
+if __name__ == "__main__":
+    Demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/msoffice.py

@@ -0,0 +1,147 @@
+# This demo uses some of the Microsoft Office components.
+#
+# It was taken from an MSDN article showing how to embed excel.
+# It is not comlpete yet, but it _does_ show an Excel spreadsheet in a frame!
+#
+
+import win32ui, win32uiole, win32con, regutil
+from pywin.mfc import window, activex, object, docview
+from win32com.client import gencache
+
+# WordModule = gencache.EnsureModule('{00020905-0000-0000-C000-000000000046}', 1033, 8, 0)
+# if WordModule is None:
+# 	raise ImportError, "Microsoft Word version 8 does not appear to be installed."
+
+
+class OleClientItem(object.CmdTarget):
+    def __init__(self, doc):
+        object.CmdTarget.__init__(self, win32uiole.CreateOleClientItem(doc))
+
+    def OnGetItemPosition(self):
+        # For now return a hard-coded rect.
+        return (10, 10, 210, 210)
+
+    def OnActivate(self):
+        # Allow only one inplace activate item per frame
+        view = self.GetActiveView()
+        item = self.GetDocument().GetInPlaceActiveItem(view)
+        if item is not None and item._obj_ != self._obj_:
+            item.Close()
+        self._obj_.OnActivate()
+
+    def OnChange(self, oleNotification, dwParam):
+        self._obj_.OnChange(oleNotification, dwParam)
+        self.GetDocument().UpdateAllViews(None)
+
+    def OnChangeItemPosition(self, rect):
+        # During in-place activation CEmbed_ExcelCntrItem::OnChangeItemPosition
+        #  is called by the server to change the position of the in-place
+        #  window.  Usually, this is a result of the data in the server
+        #  document changing such that the extent has changed or as a result
+        #  of in-place resizing.
+        #
+        # The default here is to call the base class, which will call
+        #  COleClientItem::SetItemRects to move the item
+        #  to the new position.
+        if not self._obj_.OnChangeItemPosition(self, rect):
+            return 0
+
+        # TODO: update any cache you may have of the item's rectangle/extent
+        return 1
+
+
+class OleDocument(object.CmdTarget):
+    def __init__(self, template):
+        object.CmdTarget.__init__(self, win32uiole.CreateOleDocument(template))
+        self.EnableCompoundFile()
+
+
+class ExcelView(docview.ScrollView):
+    def OnInitialUpdate(self):
+        self.HookMessage(self.OnSetFocus, win32con.WM_SETFOCUS)
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+        self.SetScrollSizes(win32con.MM_TEXT, (100, 100))
+        rc = self._obj_.OnInitialUpdate()
+        self.EmbedExcel()
+        return rc
+
+    def EmbedExcel(self):
+        doc = self.GetDocument()
+        self.clientItem = OleClientItem(doc)
+        self.clientItem.CreateNewItem("Excel.Sheet")
+        self.clientItem.DoVerb(-1, self)
+        doc.UpdateAllViews(None)
+
+    def OnDraw(self, dc):
+        doc = self.GetDocument()
+        pos = doc.GetStartPosition()
+        clientItem, pos = doc.GetNextItem(pos)
+        clientItem.Draw(dc, (10, 10, 210, 210))
+
+    # Special handling of OnSetFocus and OnSize are required for a container
+    #  when an object is being edited in-place.
+    def OnSetFocus(self, msg):
+        item = self.GetDocument().GetInPlaceActiveItem(self)
+        if (
+            item is not None
+            and item.GetItemState() == win32uiole.COleClientItem_activeUIState
+        ):
+            wnd = item.GetInPlaceWindow()
+            if wnd is not None:
+                wnd.SetFocus()
+            return 0  # Dont get the base version called.
+        return 1  # Call the base version.
+
+    def OnSize(self, params):
+        item = self.GetDocument().GetInPlaceActiveItem(self)
+        if item is not None:
+            item.SetItemRects()
+        return 1  # do call the base!
+
+
+class OleTemplate(docview.DocTemplate):
+    def __init__(
+        self, resourceId=None, MakeDocument=None, MakeFrame=None, MakeView=None
+    ):
+        if MakeDocument is None:
+            MakeDocument = OleDocument
+        if MakeView is None:
+            MakeView = ExcelView
+        docview.DocTemplate.__init__(
+            self, resourceId, MakeDocument, MakeFrame, MakeView
+        )
+
+
+class WordFrame(window.MDIChildWnd):
+    def __init__(self, doc=None):
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.AttachObject(self)
+        # Dont call base class doc/view version...
+
+    def Create(self, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx = MyWordControl()
+        self.ocx.CreateControl(
+            "Microsoft Word", win32con.WS_VISIBLE | win32con.WS_CHILD, rect, self, 20000
+        )
+
+
+def Demo():
+    import sys, win32api
+
+    docName = None
+    if len(sys.argv) > 1:
+        docName = win32api.GetFullPathName(sys.argv[1])
+    OleTemplate().OpenDocumentFile(None)
+
+
+# 	f = WordFrame(docName)
+# 	f.Create("Microsoft Office")
+
+if __name__ == "__main__":
+    Demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/ocxserialtest.py

@@ -0,0 +1,132 @@
+# ocxserialtest.py
+#
+# Sample that uses the mscomm OCX to talk to a serial
+# device.
+
+# Very simple -  queries a modem for ATI responses
+
+import win32ui, win32uiole
+import win32con
+from pywin.mfc import dialog, activex
+from win32com.client import gencache
+import pythoncom
+
+SERIAL_SETTINGS = "19200,n,8,1"
+SERIAL_PORT = 2
+
+win32ui.DoWaitCursor(1)
+serialModule = gencache.EnsureModule("{648A5603-2C6E-101B-82B6-000000000014}", 0, 1, 1)
+win32ui.DoWaitCursor(0)
+if serialModule is None:
+    raise ImportError("MS COMM Control does not appear to be installed on the PC")
+
+
+def MakeDlgTemplate():
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+    dlg = [
+        ["Very Basic Terminal", (0, 0, 350, 180), style, None, (8, "MS Sans Serif")],
+    ]
+    s = win32con.WS_TABSTOP | cs
+    dlg.append(
+        [
+            "RICHEDIT",
+            None,
+            132,
+            (5, 5, 340, 170),
+            s
+            | win32con.ES_WANTRETURN
+            | win32con.ES_MULTILINE
+            | win32con.ES_AUTOVSCROLL
+            | win32con.WS_VSCROLL,
+        ]
+    )
+    return dlg
+
+
+####################################
+#
+# Serial Control
+#
+class MySerialControl(activex.Control, serialModule.MSComm):
+    def __init__(self, parent):
+        activex.Control.__init__(self)
+        serialModule.MSComm.__init__(self)
+        self.parent = parent
+
+    def OnComm(self):
+        self.parent.OnComm()
+
+
+class TestSerDialog(dialog.Dialog):
+    def __init__(self, *args):
+        dialog.Dialog.__init__(*(self,) + args)
+        self.olectl = None
+
+    def OnComm(self):
+        event = self.olectl.CommEvent
+        if event == serialModule.OnCommConstants.comEvReceive:
+            self.editwindow.ReplaceSel(self.olectl.Input)
+
+    def OnKey(self, key):
+        if self.olectl:
+            self.olectl.Output = chr(key)
+
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.editwindow = self.GetDlgItem(132)
+        self.editwindow.HookAllKeyStrokes(self.OnKey)
+
+        self.olectl = MySerialControl(self)
+        try:
+            self.olectl.CreateControl(
+                "OCX",
+                win32con.WS_TABSTOP | win32con.WS_VISIBLE,
+                (7, 43, 500, 300),
+                self._obj_,
+                131,
+            )
+        except win32ui.error:
+            self.MessageBox("The Serial Control could not be created")
+            self.olectl = None
+            self.EndDialog(win32con.IDCANCEL)
+        if self.olectl:
+            self.olectl.Settings = SERIAL_SETTINGS
+            self.olectl.CommPort = SERIAL_PORT
+            self.olectl.RThreshold = 1
+            try:
+                self.olectl.PortOpen = 1
+            except pythoncom.com_error as details:
+                print(
+                    "Could not open the specified serial port - %s"
+                    % (details.excepinfo[2])
+                )
+                self.EndDialog(win32con.IDCANCEL)
+        return rc
+
+    def OnDestroy(self, msg):
+        if self.olectl:
+            try:
+                self.olectl.PortOpen = 0
+            except pythoncom.com_error as details:
+                print("Error closing port - %s" % (details.excepinfo[2]))
+        return dialog.Dialog.OnDestroy(self, msg)
+
+
+def test():
+    d = TestSerDialog(MakeDlgTemplate())
+    d.DoModal()
+
+
+if __name__ == "__main__":
+    from . import demoutils
+
+    if demoutils.NeedGoodGUI():
+        test()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/ocxtest.py

@@ -0,0 +1,246 @@
+# OCX Tester for Pythonwin
+#
+# This file _is_ ready to run.  All that is required is that the OCXs being tested
+# are installed on your machine.
+#
+# The .py files behind the OCXs will be automatically generated and imported.
+
+from pywin.mfc import dialog, window, activex
+import win32ui, win32uiole
+import win32con
+import os, sys, win32api, glob
+from win32com.client import gencache
+
+
+def MakeDlgTemplate():
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+    dlg = [
+        ["OCX Demos", (0, 0, 350, 350), style, None, (8, "MS Sans Serif")],
+    ]
+    s = win32con.WS_TABSTOP | cs
+    # 	dlg.append([131, None, 130, (5, 40, 110, 48),
+    # 		s | win32con.LBS_NOTIFY | win32con.LBS_SORT | win32con.LBS_NOINTEGRALHEIGHT | win32con.WS_VSCROLL | win32con.WS_BORDER])
+    # 	dlg.append(["{8E27C92B-1264-101C-8A2F-040224009C02}", None, 131, (5, 40, 110, 48),win32con.WS_TABSTOP])
+
+    dlg.append(
+        [128, "About", win32con.IDOK, (124, 5, 50, 14), s | win32con.BS_DEFPUSHBUTTON]
+    )
+    s = win32con.BS_PUSHBUTTON | s
+    dlg.append([128, "Close", win32con.IDCANCEL, (124, 22, 50, 14), s])
+
+    return dlg
+
+
+####################################
+#
+# Calendar test code
+#
+
+
+def GetTestCalendarClass():
+    global calendarParentModule
+    win32ui.DoWaitCursor(1)
+    calendarParentModule = gencache.EnsureModule(
+        "{8E27C92E-1264-101C-8A2F-040224009C02}", 0, 7, 0
+    )
+    win32ui.DoWaitCursor(0)
+    if calendarParentModule is None:
+        return None
+
+    class TestCalDialog(dialog.Dialog):
+        def OnInitDialog(self):
+            class MyCal(activex.Control, calendarParentModule.Calendar):
+                def OnAfterUpdate(self):
+                    print("OnAfterUpdate")
+
+                def OnClick(self):
+                    print("OnClick")
+
+                def OnDblClick(self):
+                    print("OnDblClick")
+
+                def OnKeyDown(self, KeyCode, Shift):
+                    print("OnKeyDown", KeyCode, Shift)
+
+                def OnKeyPress(self, KeyAscii):
+                    print("OnKeyPress", KeyAscii)
+
+                def OnKeyUp(self, KeyCode, Shift):
+                    print("OnKeyUp", KeyCode, Shift)
+
+                def OnBeforeUpdate(self, Cancel):
+                    print("OnBeforeUpdate", Cancel)
+
+                def OnNewMonth(self):
+                    print("OnNewMonth")
+
+                def OnNewYear(self):
+                    print("OnNewYear")
+
+            rc = dialog.Dialog.OnInitDialog(self)
+            self.olectl = MyCal()
+            try:
+                self.olectl.CreateControl(
+                    "OCX",
+                    win32con.WS_TABSTOP | win32con.WS_VISIBLE,
+                    (7, 43, 500, 300),
+                    self._obj_,
+                    131,
+                )
+            except win32ui.error:
+                self.MessageBox("The Calendar Control could not be created")
+                self.olectl = None
+                self.EndDialog(win32con.IDCANCEL)
+
+            return rc
+
+        def OnOK(self):
+            self.olectl.AboutBox()
+
+    return TestCalDialog
+
+
+####################################
+#
+# Video Control
+#
+def GetTestVideoModule():
+    global videoControlModule, videoControlFileName
+    win32ui.DoWaitCursor(1)
+    videoControlModule = gencache.EnsureModule(
+        "{05589FA0-C356-11CE-BF01-00AA0055595A}", 0, 2, 0
+    )
+    win32ui.DoWaitCursor(0)
+    if videoControlModule is None:
+        return None
+    fnames = glob.glob(os.path.join(win32api.GetWindowsDirectory(), "*.avi"))
+    if not fnames:
+        print("No AVI files available in system directory")
+        return None
+    videoControlFileName = fnames[0]
+    return videoControlModule
+
+
+def GetTestVideoDialogClass():
+    if GetTestVideoModule() is None:
+        return None
+
+    class TestVideoDialog(dialog.Dialog):
+        def OnInitDialog(self):
+            rc = dialog.Dialog.OnInitDialog(self)
+            try:
+                self.olectl = activex.MakeControlInstance(
+                    videoControlModule.ActiveMovie
+                )
+                self.olectl.CreateControl(
+                    "",
+                    win32con.WS_TABSTOP | win32con.WS_VISIBLE,
+                    (7, 43, 500, 300),
+                    self._obj_,
+                    131,
+                )
+            except win32ui.error:
+                self.MessageBox("The Video Control could not be created")
+                self.olectl = None
+                self.EndDialog(win32con.IDCANCEL)
+                return
+
+            self.olectl.FileName = videoControlFileName
+            # 			self.olectl.Run()
+            return rc
+
+        def OnOK(self):
+            self.olectl.AboutBox()
+
+    return TestVideoDialog
+
+
+###############
+#
+# An OCX in an MDI Frame
+#
+class OCXFrame(window.MDIChildWnd):
+    def __init__(self):
+        pass  # Dont call base class doc/view version...
+
+    def Create(self, controlClass, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.AttachObject(self)
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx = controlClass()
+        self.ocx.CreateControl(
+            "", win32con.WS_VISIBLE | win32con.WS_CHILD, rect, self, 1000
+        )
+
+
+def MDITest():
+    calendarParentModule = gencache.EnsureModule(
+        "{8E27C92E-1264-101C-8A2F-040224009C02}", 0, 7, 0
+    )
+
+    class MyCal(activex.Control, calendarParentModule.Calendar):
+        def OnAfterUpdate(self):
+            print("OnAfterUpdate")
+
+        def OnClick(self):
+            print("OnClick")
+
+    f = OCXFrame()
+    f.Create(MyCal, "Calendar Test")
+
+
+def test1():
+    klass = GetTestCalendarClass()
+    if klass is None:
+        print(
+            "Can not test the MSAccess Calendar control - it does not appear to be installed"
+        )
+        return
+
+    d = klass(MakeDlgTemplate())
+    d.DoModal()
+
+
+def test2():
+    klass = GetTestVideoDialogClass()
+    if klass is None:
+        print("Can not test the Video OCX - it does not appear to be installed,")
+        print("or no AVI files can be found.")
+        return
+    d = klass(MakeDlgTemplate())
+    d.DoModal()
+    d = None
+
+
+def test3():
+    d = TestCOMMDialog(MakeDlgTemplate())
+    d.DoModal()
+    d = None
+
+
+def testall():
+    test1()
+    test2()
+
+
+def demo():
+    testall()
+
+
+if __name__ == "__main__":
+    from . import demoutils
+
+    if demoutils.NeedGoodGUI():
+        testall()

.venv/Lib/site-packages/pythonwin/pywin/Demos/ocx/webbrowser.py

@@ -0,0 +1,68 @@
+# This demo uses the IE4 Web Browser control.
+
+# It catches an "OnNavigate" event, and updates the frame title.
+# (event stuff by Neil Hodgson)
+
+import win32ui, win32con, win32api, regutil
+from pywin.mfc import window, activex
+from win32com.client import gencache
+import sys
+
+WebBrowserModule = gencache.EnsureModule(
+    "{EAB22AC0-30C1-11CF-A7EB-0000C05BAE0B}", 0, 1, 1
+)
+if WebBrowserModule is None:
+    raise ImportError("IE4 does not appear to be installed.")
+
+
+class MyWebBrowser(activex.Control, WebBrowserModule.WebBrowser):
+    def OnBeforeNavigate2(
+        self, pDisp, URL, Flags, TargetFrameName, PostData, Headers, Cancel
+    ):
+        self.GetParent().OnNavigate(URL)
+        # print "BeforeNavigate2", pDisp, URL, Flags, TargetFrameName, PostData, Headers, Cancel
+
+
+class BrowserFrame(window.MDIChildWnd):
+    def __init__(self, url=None):
+        if url is None:
+            self.url = regutil.GetRegisteredHelpFile("Main Python Documentation")
+            if self.url is None:
+                self.url = "http://www.python.org"
+        else:
+            self.url = url
+        pass  # Dont call base class doc/view version...
+
+    def Create(self, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.AttachObject(self)
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx = MyWebBrowser()
+        self.ocx.CreateControl(
+            "Web Browser", win32con.WS_VISIBLE | win32con.WS_CHILD, rect, self, 1000
+        )
+        self.ocx.Navigate(self.url)
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+    def OnSize(self, params):
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.ocx.SetWindowPos(0, rect, 0)
+
+    def OnNavigate(self, url):
+        title = "Web Browser - %s" % (url,)
+        self.SetWindowText(title)
+
+
+def Demo(url=None):
+    if url is None and len(sys.argv) > 1:
+        url = win32api.GetFullPathName(sys.argv[1])
+    f = BrowserFrame(url)
+    f.Create("Web Browser")
+
+
+if __name__ == "__main__":
+    Demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/openGLDemo.py

@@ -0,0 +1,369 @@
+# Ported from the win32 and MFC OpenGL Samples.
+
+from pywin.mfc import docview
+import sys
+
+try:
+    from OpenGL.GL import *
+    from OpenGL.GLU import *
+except ImportError:
+    print("The OpenGL extensions do not appear to be installed.")
+    print("This Pythonwin demo can not run")
+    sys.exit(1)
+
+import win32con
+import win32ui
+import win32api
+import timer
+
+PFD_TYPE_RGBA = 0
+PFD_TYPE_COLORINDEX = 1
+PFD_MAIN_PLANE = 0
+PFD_OVERLAY_PLANE = 1
+PFD_UNDERLAY_PLANE = -1
+PFD_DOUBLEBUFFER = 0x00000001
+PFD_STEREO = 0x00000002
+PFD_DRAW_TO_WINDOW = 0x00000004
+PFD_DRAW_TO_BITMAP = 0x00000008
+PFD_SUPPORT_GDI = 0x00000010
+PFD_SUPPORT_OPENGL = 0x00000020
+PFD_GENERIC_FORMAT = 0x00000040
+PFD_NEED_PALETTE = 0x00000080
+PFD_NEED_SYSTEM_PALETTE = 0x00000100
+PFD_SWAP_EXCHANGE = 0x00000200
+PFD_SWAP_COPY = 0x00000400
+PFD_SWAP_LAYER_BUFFERS = 0x00000800
+PFD_GENERIC_ACCELERATED = 0x00001000
+PFD_DEPTH_DONTCARE = 0x20000000
+PFD_DOUBLEBUFFER_DONTCARE = 0x40000000
+PFD_STEREO_DONTCARE = 0x80000000
+
+
+# threeto8 = [0, 0o111>>1, 0o222>>1, 0o333>>1, 0o444>>1, 0o555>>1, 0o666>>1, 0o377]
+threeto8 = [0, 73 >> 1, 146 >> 1, 219 >> 1, 292 >> 1, 365 >> 1, 438 >> 1, 255]
+twoto8 = [0, 0x55, 0xAA, 0xFF]
+oneto8 = [0, 255]
+
+
+def ComponentFromIndex(i, nbits, shift):
+    # val = (unsigned char) (i >> shift);
+    val = (i >> shift) & 0xF
+    if nbits == 1:
+        val = val & 0x1
+        return oneto8[val]
+    elif nbits == 2:
+        val = val & 0x3
+        return twoto8[val]
+    elif nbits == 3:
+        val = val & 0x7
+        return threeto8[val]
+    else:
+        return 0
+
+
+OpenGLViewParent = docview.ScrollView
+
+
+class OpenGLView(OpenGLViewParent):
+    def PreCreateWindow(self, cc):
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+        # An OpenGL window must be created with the following flags and must not
+        # include CS_PARENTDC for the class style. Refer to SetPixelFormat
+        # documentation in the "Comments" section for further information.
+        style = cc[5]
+        style = style | win32con.WS_CLIPSIBLINGS | win32con.WS_CLIPCHILDREN
+        cc = cc[0], cc[1], cc[2], cc[3], cc[4], style, cc[6], cc[7], cc[8]
+        cc = self._obj_.PreCreateWindow(cc)
+        return cc
+
+    def OnSize(self, params):
+        lParam = params[3]
+        cx = win32api.LOWORD(lParam)
+        cy = win32api.HIWORD(lParam)
+        glViewport(0, 0, cx, cy)
+
+        if self.oldrect[2] > cx or self.oldrect[3] > cy:
+            self.RedrawWindow()
+
+        self.OnSizeChange(cx, cy)
+
+        self.oldrect = self.oldrect[0], self.oldrect[1], cx, cy
+
+    def OnInitialUpdate(self):
+        self.SetScaleToFitSize(
+            (100, 100)
+        )  # or SetScrollSizes() - A Pythonwin requirement
+        return self._obj_.OnInitialUpdate()
+
+    # 		return rc
+
+    def OnCreate(self, cs):
+        self.oldrect = self.GetClientRect()
+        self._InitContexts()
+        self.Init()
+
+    def OnDestroy(self, msg):
+        self.Term()
+        self._DestroyContexts()
+        return OpenGLViewParent.OnDestroy(self, msg)
+
+    def OnDraw(self, dc):
+        self.DrawScene()
+
+    def OnEraseBkgnd(self, dc):
+        return 1
+
+    # The OpenGL helpers
+    def _SetupPixelFormat(self):
+        dc = self.dc.GetSafeHdc()
+        pfd = CreatePIXELFORMATDESCRIPTOR()
+        pfd.dwFlags = PFD_DRAW_TO_WINDOW | PFD_SUPPORT_OPENGL | PFD_DOUBLEBUFFER
+        pfd.iPixelType = PFD_TYPE_RGBA
+        pfd.cColorBits = 24
+        pfd.cDepthBits = 32
+        pfd.iLayerType = PFD_MAIN_PLANE
+        pixelformat = ChoosePixelFormat(dc, pfd)
+        SetPixelFormat(dc, pixelformat, pfd)
+        self._CreateRGBPalette()
+
+    def _CreateRGBPalette(self):
+        dc = self.dc.GetSafeHdc()
+        n = GetPixelFormat(dc)
+        pfd = DescribePixelFormat(dc, n)
+        if pfd.dwFlags & PFD_NEED_PALETTE:
+            n = 1 << pfd.cColorBits
+            pal = []
+            for i in range(n):
+                this = (
+                    ComponentFromIndex(i, pfd.cRedBits, pfd.cRedShift),
+                    ComponentFromIndex(i, pfd.cGreenBits, pfd.cGreenShift),
+                    ComponentFromIndex(i, pfd.cBlueBits, pfd.cBlueShift),
+                    0,
+                )
+                pal.append(this)
+            hpal = win32ui.CreatePalette(pal)
+            self.dc.SelectPalette(hpal, 0)
+            self.dc.RealizePalette()
+
+    def _InitContexts(self):
+        self.dc = self.GetDC()
+        self._SetupPixelFormat()
+        hrc = wglCreateContext(self.dc.GetSafeHdc())
+        wglMakeCurrent(self.dc.GetSafeHdc(), hrc)
+
+    def _DestroyContexts(self):
+        hrc = wglGetCurrentContext()
+        wglMakeCurrent(0, 0)
+        if hrc:
+            wglDeleteContext(hrc)
+
+    # The methods to support OpenGL
+    def DrawScene(self):
+        assert 0, "You must override this method"
+
+    def Init(self):
+        assert 0, "You must override this method"
+
+    def OnSizeChange(self, cx, cy):
+        pass
+
+    def Term(self):
+        pass
+
+
+class TestView(OpenGLView):
+    def OnSizeChange(self, right, bottom):
+        glClearColor(0.0, 0.0, 0.0, 1.0)
+        glClearDepth(1.0)
+        glEnable(GL_DEPTH_TEST)
+
+        glMatrixMode(GL_PROJECTION)
+        if bottom:
+            aspect = right / bottom
+        else:
+            aspect = 0  # When window created!
+        glLoadIdentity()
+        gluPerspective(45.0, aspect, 3.0, 7.0)
+        glMatrixMode(GL_MODELVIEW)
+
+        near_plane = 3.0
+        far_plane = 7.0
+        maxObjectSize = 3.0
+        self.radius = near_plane + maxObjectSize / 2.0
+
+    def Init(self):
+        pass
+
+    def DrawScene(self):
+        glClearColor(0.0, 0.0, 0.0, 1.0)
+        glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT)
+
+        glPushMatrix()
+        glTranslatef(0.0, 0.0, -self.radius)
+
+        self._DrawCone()
+
+        self._DrawPyramid()
+
+        glPopMatrix()
+        glFinish()
+
+        SwapBuffers(wglGetCurrentDC())
+
+    def _DrawCone(self):
+        glColor3f(0.0, 1.0, 0.0)
+
+        glPushMatrix()
+        glTranslatef(-1.0, 0.0, 0.0)
+        quadObj = gluNewQuadric()
+        gluQuadricDrawStyle(quadObj, GLU_FILL)
+        gluQuadricNormals(quadObj, GLU_SMOOTH)
+        gluCylinder(quadObj, 1.0, 0.0, 1.0, 20, 10)
+        # 		gluDeleteQuadric(quadObj);
+        glPopMatrix()
+
+    def _DrawPyramid(self):
+        glPushMatrix()
+        glTranslatef(1.0, 0.0, 0.0)
+        glBegin(GL_TRIANGLE_FAN)
+        glColor3f(1.0, 0.0, 0.0)
+        glVertex3f(0.0, 1.0, 0.0)
+        glColor3f(0.0, 1.0, 0.0)
+        glVertex3f(-1.0, 0.0, 0.0)
+        glColor3f(0.0, 0.0, 1.0)
+        glVertex3f(0.0, 0.0, 1.0)
+        glColor3f(0.0, 1.0, 0.0)
+        glVertex3f(1.0, 0.0, 0.0)
+        glEnd()
+        glPopMatrix()
+
+
+class CubeView(OpenGLView):
+    def OnSizeChange(self, right, bottom):
+        glClearColor(0.0, 0.0, 0.0, 1.0)
+        glClearDepth(1.0)
+        glEnable(GL_DEPTH_TEST)
+
+        glMatrixMode(GL_PROJECTION)
+        if bottom:
+            aspect = right / bottom
+        else:
+            aspect = 0  # When window created!
+        glLoadIdentity()
+        gluPerspective(45.0, aspect, 3.0, 7.0)
+        glMatrixMode(GL_MODELVIEW)
+
+        near_plane = 3.0
+        far_plane = 7.0
+        maxObjectSize = 3.0
+        self.radius = near_plane + maxObjectSize / 2.0
+
+    def Init(self):
+        self.busy = 0
+        self.wAngleY = 10.0
+        self.wAngleX = 1.0
+        self.wAngleZ = 5.0
+        self.timerid = timer.set_timer(150, self.OnTimer)
+
+    def OnTimer(self, id, timeVal):
+        self.DrawScene()
+
+    def Term(self):
+        timer.kill_timer(self.timerid)
+
+    def DrawScene(self):
+        if self.busy:
+            return
+        self.busy = 1
+
+        glClearColor(0.0, 0.0, 0.0, 1.0)
+        glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT)
+
+        glPushMatrix()
+
+        glTranslatef(0.0, 0.0, -self.radius)
+        glRotatef(self.wAngleX, 1.0, 0.0, 0.0)
+        glRotatef(self.wAngleY, 0.0, 1.0, 0.0)
+        glRotatef(self.wAngleZ, 0.0, 0.0, 1.0)
+
+        self.wAngleX = self.wAngleX + 1.0
+        self.wAngleY = self.wAngleY + 10.0
+        self.wAngleZ = self.wAngleZ + 5.0
+
+        glBegin(GL_QUAD_STRIP)
+        glColor3f(1.0, 0.0, 1.0)
+        glVertex3f(-0.5, 0.5, 0.5)
+
+        glColor3f(1.0, 0.0, 0.0)
+        glVertex3f(-0.5, -0.5, 0.5)
+
+        glColor3f(1.0, 1.0, 1.0)
+        glVertex3f(0.5, 0.5, 0.5)
+
+        glColor3f(1.0, 1.0, 0.0)
+        glVertex3f(0.5, -0.5, 0.5)
+
+        glColor3f(0.0, 1.0, 1.0)
+        glVertex3f(0.5, 0.5, -0.5)
+
+        glColor3f(0.0, 1.0, 0.0)
+        glVertex3f(0.5, -0.5, -0.5)
+
+        glColor3f(0.0, 0.0, 1.0)
+        glVertex3f(-0.5, 0.5, -0.5)
+
+        glColor3f(0.0, 0.0, 0.0)
+        glVertex3f(-0.5, -0.5, -0.5)
+
+        glColor3f(1.0, 0.0, 1.0)
+        glVertex3f(-0.5, 0.5, 0.5)
+
+        glColor3f(1.0, 0.0, 0.0)
+        glVertex3f(-0.5, -0.5, 0.5)
+
+        glEnd()
+
+        glBegin(GL_QUADS)
+        glColor3f(1.0, 0.0, 1.0)
+        glVertex3f(-0.5, 0.5, 0.5)
+
+        glColor3f(1.0, 1.0, 1.0)
+        glVertex3f(0.5, 0.5, 0.5)
+
+        glColor3f(0.0, 1.0, 1.0)
+        glVertex3f(0.5, 0.5, -0.5)
+
+        glColor3f(0.0, 0.0, 1.0)
+        glVertex3f(-0.5, 0.5, -0.5)
+        glEnd()
+
+        glBegin(GL_QUADS)
+        glColor3f(1.0, 0.0, 0.0)
+        glVertex3f(-0.5, -0.5, 0.5)
+
+        glColor3f(1.0, 1.0, 0.0)
+        glVertex3f(0.5, -0.5, 0.5)
+
+        glColor3f(0.0, 1.0, 0.0)
+        glVertex3f(0.5, -0.5, -0.5)
+
+        glColor3f(0.0, 0.0, 0.0)
+        glVertex3f(-0.5, -0.5, -0.5)
+        glEnd()
+
+        glPopMatrix()
+
+        glFinish()
+        SwapBuffers(wglGetCurrentDC())
+
+        self.busy = 0
+
+
+def test():
+    template = docview.DocTemplate(None, None, None, CubeView)
+    # 	template = docview.DocTemplate(None, None, None, TestView )
+    template.OpenDocumentFile(None)
+
+
+if __name__ == "__main__":
+    test()

.venv/Lib/site-packages/pythonwin/pywin/Demos/progressbar.py

@@ -0,0 +1,105 @@
+#
+# Progress bar control example
+#
+# 	PyCProgressCtrl encapsulates the MFC CProgressCtrl class.  To use it,
+# 	you:
+#
+# 	- Create the control with win32ui.CreateProgressCtrl()
+# 	- Create the control window with PyCProgressCtrl.CreateWindow()
+# 	- Initialize the range if you want it to be other than (0, 100) using
+# 	  PyCProgressCtrl.SetRange()
+# 	- Either:
+# 	  - Set the step size with PyCProgressCtrl.SetStep(), and
+# 	  - Increment using PyCProgressCtrl.StepIt()
+# 	  or:
+# 	  - Set the amount completed using PyCProgressCtrl.SetPos()
+#
+# Example and progress bar code courtesy of KDL Technologies, Ltd., Hong Kong SAR, China.
+#
+
+from pywin.mfc import dialog
+import win32ui
+import win32con
+
+
+def MakeDlgTemplate():
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+
+    w = 215
+    h = 36
+
+    dlg = [
+        [
+            "Progress bar control example",
+            (0, 0, w, h),
+            style,
+            None,
+            (8, "MS Sans Serif"),
+        ],
+    ]
+
+    s = win32con.WS_TABSTOP | cs
+
+    dlg.append(
+        [
+            128,
+            "Tick",
+            win32con.IDOK,
+            (10, h - 18, 50, 14),
+            s | win32con.BS_DEFPUSHBUTTON,
+        ]
+    )
+
+    dlg.append(
+        [
+            128,
+            "Cancel",
+            win32con.IDCANCEL,
+            (w - 60, h - 18, 50, 14),
+            s | win32con.BS_PUSHBUTTON,
+        ]
+    )
+
+    return dlg
+
+
+class TestDialog(dialog.Dialog):
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.pbar = win32ui.CreateProgressCtrl()
+        self.pbar.CreateWindow(
+            win32con.WS_CHILD | win32con.WS_VISIBLE, (10, 10, 310, 24), self, 1001
+        )
+        # self.pbar.SetStep (5)
+        self.progress = 0
+        self.pincr = 5
+        return rc
+
+    def OnOK(self):
+        # NB: StepIt wraps at the end if you increment past the upper limit!
+        # self.pbar.StepIt()
+        self.progress = self.progress + self.pincr
+        if self.progress > 100:
+            self.progress = 100
+        if self.progress <= 100:
+            self.pbar.SetPos(self.progress)
+
+
+def demo(modal=0):
+    d = TestDialog(MakeDlgTemplate())
+    if modal:
+        d.DoModal()
+    else:
+        d.CreateWindow()
+
+
+if __name__ == "__main__":
+    demo(1)

.venv/Lib/site-packages/pythonwin/pywin/Demos/sliderdemo.py

@@ -0,0 +1,75 @@
+# sliderdemo.py
+# Demo of the slider control courtesy of Mike Fletcher.
+
+import win32con, win32ui
+from pywin.mfc import dialog
+
+
+class MyDialog(dialog.Dialog):
+    """
+    Example using simple controls
+    """
+
+    _dialogstyle = (
+        win32con.WS_MINIMIZEBOX
+        | win32con.WS_DLGFRAME
+        | win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    _buttonstyle = (
+        win32con.BS_PUSHBUTTON
+        | win32con.WS_TABSTOP
+        | win32con.WS_CHILD
+        | win32con.WS_VISIBLE
+    )
+    ### The static template, contains all "normal" dialog items
+    DIALOGTEMPLATE = [
+        # the dialog itself is the first element in the template
+        ["Example slider", (0, 0, 50, 43), _dialogstyle, None, (8, "MS SansSerif")],
+        # rest of elements are the controls within the dialog
+        # standard "Close" button
+        [128, "Close", win32con.IDCANCEL, (0, 30, 50, 13), _buttonstyle],
+    ]
+    ### ID of the control to be created during dialog initialisation
+    IDC_SLIDER = 9500
+
+    def __init__(self):
+        dialog.Dialog.__init__(self, self.DIALOGTEMPLATE)
+
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        # now initialise your controls that you want to create
+        # programmatically, including those which are OLE controls
+        # those created directly by win32ui.Create*
+        # and your "custom controls" which are subclasses/whatever
+        win32ui.EnableControlContainer()
+        self.slider = win32ui.CreateSliderCtrl()
+        self.slider.CreateWindow(
+            win32con.WS_TABSTOP | win32con.WS_VISIBLE,
+            (0, 0, 100, 30),
+            self._obj_,
+            self.IDC_SLIDER,
+        )
+        self.HookMessage(self.OnSliderMove, win32con.WM_HSCROLL)
+        return rc
+
+    def OnSliderMove(self, params):
+        print("Slider moved")
+
+    def OnCancel(self):
+        print("The slider control is at position", self.slider.GetPos())
+        self._obj_.OnCancel()
+
+
+###
+def demo():
+    dia = MyDialog()
+    dia.DoModal()
+
+
+if __name__ == "__main__":
+    demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/splittst.py

@@ -0,0 +1,80 @@
+import win32ui
+import win32con
+import fontdemo
+from pywin.mfc import window, docview
+import commctrl
+
+# derive from CMDIChild.  This does much work for us.
+
+
+class SplitterFrame(window.MDIChildWnd):
+    def __init__(self):
+        # call base CreateFrame
+        self.images = None
+        window.MDIChildWnd.__init__(self)
+
+    def OnCreateClient(self, cp, context):
+        splitter = win32ui.CreateSplitter()
+        doc = context.doc
+        frame_rect = self.GetWindowRect()
+        size = ((frame_rect[2] - frame_rect[0]), (frame_rect[3] - frame_rect[1]) // 2)
+        sub_size = (size[0] // 2, size[1])
+        splitter.CreateStatic(self, 2, 1)
+        self.v1 = win32ui.CreateEditView(doc)
+        self.v2 = fontdemo.FontView(doc)
+        # CListControl view
+        self.v3 = win32ui.CreateListView(doc)
+        sub_splitter = win32ui.CreateSplitter()
+        # pass "splitter" so each view knows how to get to the others
+        sub_splitter.CreateStatic(splitter, 1, 2)
+        sub_splitter.CreateView(self.v1, 0, 0, (sub_size))
+        sub_splitter.CreateView(self.v2, 0, 1, (0, 0))  # size ignored.
+        splitter.SetRowInfo(0, size[1], 0)
+        splitter.CreateView(self.v3, 1, 0, (0, 0))  # size ignored.
+        # Setup items in the imagelist
+        self.images = win32ui.CreateImageList(32, 32, 1, 5, 5)
+        self.images.Add(win32ui.GetApp().LoadIcon(win32ui.IDR_MAINFRAME))
+        self.images.Add(win32ui.GetApp().LoadIcon(win32ui.IDR_PYTHONCONTYPE))
+        self.images.Add(win32ui.GetApp().LoadIcon(win32ui.IDR_TEXTTYPE))
+        self.v3.SetImageList(self.images, commctrl.LVSIL_NORMAL)
+        self.v3.InsertItem(0, "Icon 1", 0)
+        self.v3.InsertItem(0, "Icon 2", 1)
+        self.v3.InsertItem(0, "Icon 3", 2)
+        # 		self.v3.Arrange(commctrl.LVA_DEFAULT) Hmmm - win95 aligns left always???
+        return 1
+
+    def OnDestroy(self, msg):
+        window.MDIChildWnd.OnDestroy(self, msg)
+        if self.images:
+            self.images.DeleteImageList()
+            self.images = None
+
+    def InitialUpdateFrame(self, doc, makeVisible):
+        self.v1.ReplaceSel("Hello from Edit Window 1")
+        self.v1.SetModifiedFlag(0)
+
+
+class SampleTemplate(docview.DocTemplate):
+    def __init__(self):
+        docview.DocTemplate.__init__(
+            self, win32ui.IDR_PYTHONTYPE, None, SplitterFrame, None
+        )
+
+    def InitialUpdateFrame(self, frame, doc, makeVisible):
+        # 		print "frame is ", frame, frame._obj_
+        # 		print "doc is ", doc, doc._obj_
+        self._obj_.InitialUpdateFrame(frame, doc, makeVisible)  # call default handler.
+        frame.InitialUpdateFrame(doc, makeVisible)
+
+
+def demo():
+    template = SampleTemplate()
+    doc = template.OpenDocumentFile(None)
+    doc.SetTitle("Splitter Demo")
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/threadedgui.py

@@ -0,0 +1,190 @@
+# Demo of using just windows, without documents and views.
+
+# Also demo of a GUI thread, pretty much direct from the MFC C++ sample MTMDI.
+
+import win32ui
+import win32con
+import win32api
+import timer
+
+from pywin.mfc import window, docview, thread
+from pywin.mfc.thread import WinThread
+
+
+WM_USER_PREPARE_TO_CLOSE = win32con.WM_USER + 32
+
+# font is a dictionary in which the following elements matter:
+# (the best matching font to supplied parameters is returned)
+#   name		string name of the font as known by Windows
+#   size		point size of font in logical units
+#   weight		weight of font (win32con.FW_NORMAL, win32con.FW_BOLD)
+#   italic		boolean; true if set to anything but None
+#   underline	boolean; true if set to anything but None
+
+# This window is a child window of a frame.  It is not the frame window itself.
+class FontWindow(window.Wnd):
+    def __init__(self, text="Python Rules!"):
+        window.Wnd.__init__(self)
+        self.text = text
+        self.index = 0
+        self.incr = 1
+        self.width = self.height = 0
+        self.ChangeAttributes()
+        # set up message handlers
+
+    def Create(self, title, style, rect, parent):
+        classStyle = win32con.CS_HREDRAW | win32con.CS_VREDRAW
+        className = win32ui.RegisterWndClass(
+            classStyle, 0, win32con.COLOR_WINDOW + 1, 0
+        )
+        self._obj_ = win32ui.CreateWnd()
+        self._obj_.AttachObject(self)
+        self._obj_.CreateWindow(
+            className, title, style, rect, parent, win32ui.AFX_IDW_PANE_FIRST
+        )
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+        self.HookMessage(self.OnPrepareToClose, WM_USER_PREPARE_TO_CLOSE)
+        self.HookMessage(self.OnDestroy, win32con.WM_DESTROY)
+        self.timerid = timer.set_timer(100, self.OnTimer)
+        self.InvalidateRect()
+
+    def OnDestroy(self, msg):
+        timer.kill_timer(self.timerid)
+
+    def OnTimer(self, id, timeVal):
+        self.index = self.index + self.incr
+        if self.index > len(self.text):
+            self.incr = -1
+            self.index = len(self.text)
+        elif self.index < 0:
+            self.incr = 1
+            self.index = 0
+        self.InvalidateRect()
+
+    def OnPaint(self):
+        # 		print "Paint message from thread", win32api.GetCurrentThreadId()
+        dc, paintStruct = self.BeginPaint()
+        self.OnPrepareDC(dc, None)
+
+        if self.width == 0 and self.height == 0:
+            left, top, right, bottom = self.GetClientRect()
+            self.width = right - left
+            self.height = bottom - top
+        x, y = self.width // 2, self.height // 2
+        dc.TextOut(x, y, self.text[: self.index])
+        self.EndPaint(paintStruct)
+
+    def ChangeAttributes(self):
+        font_spec = {"name": "Arial", "height": 42}
+        self.font = win32ui.CreateFont(font_spec)
+
+    def OnPrepareToClose(self, params):
+        self.DestroyWindow()
+
+    def OnSize(self, params):
+        lParam = params[3]
+        self.width = win32api.LOWORD(lParam)
+        self.height = win32api.HIWORD(lParam)
+
+    def OnPrepareDC(self, dc, printinfo):
+        # Set up the DC for forthcoming OnDraw call
+        dc.SetTextColor(win32api.RGB(0, 0, 255))
+        dc.SetBkColor(win32api.GetSysColor(win32con.COLOR_WINDOW))
+        dc.SelectObject(self.font)
+        dc.SetTextAlign(win32con.TA_CENTER | win32con.TA_BASELINE)
+
+
+class FontFrame(window.MDIChildWnd):
+    def __init__(self):
+        pass  # Dont call base class doc/view version...
+
+    def Create(self, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.AttachObject(self)
+
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+        rect = self.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+        self.child = FontWindow("Not threaded")
+        self.child.Create(
+            "FontDemo", win32con.WS_CHILD | win32con.WS_VISIBLE, rect, self
+        )
+
+
+class TestThread(WinThread):
+    def __init__(self, parentWindow):
+        self.parentWindow = parentWindow
+        self.child = None
+        WinThread.__init__(self)
+
+    def InitInstance(self):
+        rect = self.parentWindow.GetClientRect()
+        rect = (0, 0, rect[2] - rect[0], rect[3] - rect[1])
+
+        self.child = FontWindow()
+        self.child.Create(
+            "FontDemo", win32con.WS_CHILD | win32con.WS_VISIBLE, rect, self.parentWindow
+        )
+        self.SetMainFrame(self.child)
+        return WinThread.InitInstance(self)
+
+    def ExitInstance(self):
+        return 0
+
+
+class ThreadedFontFrame(window.MDIChildWnd):
+    def __init__(self):
+        pass  # Dont call base class doc/view version...
+        self.thread = None
+
+    def Create(self, title, rect=None, parent=None):
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_OVERLAPPEDWINDOW
+        self._obj_ = win32ui.CreateMDIChild()
+        self._obj_.CreateWindow(None, title, style, rect, parent)
+        self._obj_.HookMessage(self.OnDestroy, win32con.WM_DESTROY)
+        self._obj_.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+        self.thread = TestThread(self)
+        self.thread.CreateThread()
+
+    def OnSize(self, msg):
+        pass
+
+    def OnDestroy(self, msg):
+        win32ui.OutputDebugString("OnDestroy\n")
+        if self.thread and self.thread.child:
+            child = self.thread.child
+            child.SendMessage(WM_USER_PREPARE_TO_CLOSE, 0, 0)
+            win32ui.OutputDebugString("Destroyed\n")
+
+
+def Demo():
+    f = FontFrame()
+    f.Create("Font Demo")
+
+
+def ThreadedDemo():
+    rect = win32ui.GetMainFrame().GetMDIClient().GetClientRect()
+    rect = rect[0], int(rect[3] * 3 / 4), int(rect[2] / 4), rect[3]
+    incr = rect[2]
+    for i in range(4):
+        if i == 0:
+            f = FontFrame()
+            title = "Not threaded"
+        else:
+            f = ThreadedFontFrame()
+            title = "Threaded GUI Demo"
+        f.Create(title, rect)
+        rect = rect[0] + incr, rect[1], rect[2] + incr, rect[3]
+    # Givem a chance to start
+    win32api.Sleep(100)
+    win32ui.PumpWaitingMessages()
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        ThreadedDemo()
+# 		Demo()

.venv/Lib/site-packages/pythonwin/pywin/Demos/toolbar.py

@@ -0,0 +1,106 @@
+# Demo of ToolBars
+
+# Shows the toolbar control.
+# Demos how to make custom tooltips, etc.
+
+import win32ui
+import win32con
+import win32api
+from pywin.mfc import docview, window, afxres
+import commctrl
+
+
+class GenericFrame(window.MDIChildWnd):
+    def OnCreateClient(self, cp, context):
+        # handlers for toolbar buttons
+        self.HookCommand(self.OnPrevious, 401)
+        self.HookCommand(self.OnNext, 402)
+        # Its not necessary for us to hook both of these - the
+        # common controls should fall-back all by themselves.
+        # Indeed, given we hook TTN_NEEDTEXTW, commctrl.TTN_NEEDTEXTA
+        # will not be called.
+        self.HookNotify(self.GetTTText, commctrl.TTN_NEEDTEXT)
+        self.HookNotify(self.GetTTText, commctrl.TTN_NEEDTEXTW)
+
+        # 		parent = win32ui.GetMainFrame()
+        parent = self
+        style = (
+            win32con.WS_CHILD
+            | win32con.WS_VISIBLE
+            | afxres.CBRS_SIZE_DYNAMIC
+            | afxres.CBRS_TOP
+            | afxres.CBRS_TOOLTIPS
+            | afxres.CBRS_FLYBY
+        )
+
+        buttons = (win32ui.ID_APP_ABOUT, win32ui.ID_VIEW_INTERACTIVE)
+        bitmap = win32ui.IDB_BROWSER_HIER
+        tbid = 0xE840
+        self.toolbar = tb = win32ui.CreateToolBar(parent, style, tbid)
+        tb.LoadBitmap(bitmap)
+        tb.SetButtons(buttons)
+
+        tb.EnableDocking(afxres.CBRS_ALIGN_ANY)
+        tb.SetWindowText("Test")
+        parent.EnableDocking(afxres.CBRS_ALIGN_ANY)
+        parent.DockControlBar(tb)
+        parent.LoadBarState("ToolbarTest")
+        window.MDIChildWnd.OnCreateClient(self, cp, context)
+        return 1
+
+    def OnDestroy(self, msg):
+        self.SaveBarState("ToolbarTest")
+
+    def GetTTText(self, std, extra):
+        (hwndFrom, idFrom, code) = std
+        text, hinst, flags = extra
+        if flags & commctrl.TTF_IDISHWND:
+            return  # Not handled
+        if idFrom == win32ui.ID_APP_ABOUT:
+            # our 'extra' return value needs to be the following
+            # entries from a NMTTDISPINFO[W] struct:
+            # (szText, hinst, uFlags).  None means 'don't change
+            # the value'
+            return 0, ("It works!", None, None)
+        return None  # not handled.
+
+    def GetMessageString(self, id):
+        if id == win32ui.ID_APP_ABOUT:
+            return "Dialog Test\nTest"
+        else:
+            return self._obj_.GetMessageString(id)
+
+    def OnSize(self, params):
+        print("OnSize called with ", params)
+
+    def OnNext(self, id, cmd):
+        print("OnNext called")
+
+    def OnPrevious(self, id, cmd):
+        print("OnPrevious called")
+
+
+msg = """\
+This toolbar was dynamically created.\r
+\r
+The first item's tooltips is provided by Python code.\r
+\r
+(Dont close the window with the toolbar in a floating state - it may not re-appear!)\r
+"""
+
+
+def test():
+    template = docview.DocTemplate(
+        win32ui.IDR_PYTHONTYPE, None, GenericFrame, docview.EditView
+    )
+    doc = template.OpenDocumentFile(None)
+    doc.SetTitle("Toolbar Test")
+    view = doc.GetFirstView()
+    view.SetWindowText(msg)
+
+
+if __name__ == "__main__":
+    import demoutils
+
+    if demoutils.NeedGoodGUI():
+        test()

.venv/Lib/site-packages/pythonwin/pywin/IDLE.cfg

@@ -0,0 +1,29 @@
+[General]
+# We base this configuration on the default config.
+# You can list "Based On" as many times as you like
+Based On          = default
+
+[Keys]
+# Only list keys different to default.
+# Note you may wish to rebind some of the default
+# Pythonwin keys to "Beep" or "DoNothing"
+
+Alt+L             = LocateSelectedFile
+Ctrl+Q            = AppExit
+
+# Other non-default Pythonwin keys
+Alt+A             = EditSelectAll
+Alt+M             = LocateModule
+
+# Movement
+Ctrl+D            = GotoEndOfFile
+
+# Tabs and other indent features
+Alt+T            = <<toggle-tabs>>
+Ctrl+[            = <<indent-region>>
+Ctrl+]            = <<dedent-region>>
+
+[Keys:Interactive]
+Alt+P             = <<history-previous>>
+Alt+N             = <<history-next>>
+

.venv/Lib/site-packages/pythonwin/pywin/__init__.py

@@ -0,0 +1,10 @@
+# is_platform_unicode is an old variable that was never correctly used and
+# is no longer referenced in pywin32.  It is staying for a few releases incase
+# others are looking at it, but it will go away soon!
+is_platform_unicode = 0
+
+# Ditto default_platform_encoding - not referenced and will die.
+default_platform_encoding = "mbcs"
+
+# This one *is* real and used - but in practice can't be changed.
+default_scintilla_encoding = "utf-8"  # Scintilla _only_ supports this ATM

.venv/Lib/site-packages/pythonwin/pywin/debugger/__init__.py

@@ -0,0 +1,137 @@
+import sys
+
+# Some cruft to deal with the Pythonwin GUI booting up from a non GUI app.
+def _MakeDebuggerGUI():
+    app.InitInstance()
+
+
+isInprocApp = -1
+
+
+def _CheckNeedGUI():
+    global isInprocApp
+    if isInprocApp == -1:
+        import win32ui
+
+        isInprocApp = win32ui.GetApp().IsInproc()
+    if isInprocApp:
+        # MAY Need it - may already have one
+        need = "pywin.debugger.dbgpyapp" not in sys.modules
+    else:
+        need = 0
+    if need:
+        import pywin.framework.app
+        from . import dbgpyapp
+
+        pywin.framework.app.CreateDefaultGUI(dbgpyapp.DebuggerPythonApp)
+
+    else:
+        # Check we have the appropriate editor
+        # No longer necessary!
+        pass
+    return need
+
+
+# Inject some methods in the top level name-space.
+currentDebugger = None  # Wipe out any old one on reload.
+
+
+def _GetCurrentDebugger():
+    global currentDebugger
+    if currentDebugger is None:
+        _CheckNeedGUI()
+        from . import debugger
+
+        currentDebugger = debugger.Debugger()
+    return currentDebugger
+
+
+def GetDebugger():
+    # An error here is not nice - as we are probably trying to
+    # break into the debugger on a Python error, any
+    # error raised by this is usually silent, and causes
+    # big problems later!
+    try:
+        rc = _GetCurrentDebugger()
+        rc.GUICheckInit()
+        return rc
+    except:
+        print("Could not create the debugger!")
+        import traceback
+
+        traceback.print_exc()
+        return None
+
+
+def close():
+    if currentDebugger is not None:
+        currentDebugger.close()
+
+
+def run(cmd, globals=None, locals=None, start_stepping=1):
+    _GetCurrentDebugger().run(cmd, globals, locals, start_stepping)
+
+
+def runeval(expression, globals=None, locals=None):
+    return _GetCurrentDebugger().runeval(expression, globals, locals)
+
+
+def runcall(*args):
+    return _GetCurrentDebugger().runcall(*args)
+
+
+def set_trace():
+    import sys
+
+    d = _GetCurrentDebugger()
+
+    if d.frameShutdown:
+        return  # App closing
+
+    if d.stopframe != d.botframe:
+        # If im not "running"
+        return
+
+    sys.settrace(None)  # May be hooked
+    d.reset()
+    d.set_trace()
+
+
+# "brk" is an alias for "set_trace" ("break" is a reserved word :-(
+brk = set_trace
+
+# Post-Mortem interface
+
+
+def post_mortem(t=None):
+    if t is None:
+        t = sys.exc_info()[2]  # Will be valid if we are called from an except handler.
+    if t is None:
+        try:
+            t = sys.last_traceback
+        except AttributeError:
+            print(
+                "No traceback can be found from which to perform post-mortem debugging!"
+            )
+            print("No debugging can continue")
+            return
+    p = _GetCurrentDebugger()
+    if p.frameShutdown:
+        return  # App closing
+    # No idea why I need to settrace to None - it should have been reset by now?
+    sys.settrace(None)
+    p.reset()
+    while t.tb_next != None:
+        t = t.tb_next
+    p.bAtPostMortem = 1
+    p.prep_run(None)
+    try:
+        p.interaction(t.tb_frame, t)
+    finally:
+        t = None
+        p.bAtPostMortem = 0
+        p.done_run()
+
+
+def pm(t=None):
+    post_mortem(t)

.venv/Lib/site-packages/pythonwin/pywin/debugger/configui.py

@@ -0,0 +1,33 @@
+from . import dbgcon
+from pywin.mfc import dialog
+import win32ui
+
+
+class DebuggerOptionsPropPage(dialog.PropertyPage):
+    def __init__(self):
+        dialog.PropertyPage.__init__(self, win32ui.IDD_PP_DEBUGGER)
+
+    def OnInitDialog(self):
+        options = self.options = dbgcon.LoadDebuggerOptions()
+        self.AddDDX(win32ui.IDC_CHECK1, dbgcon.OPT_HIDE)
+        self[dbgcon.OPT_STOP_EXCEPTIONS] = options[dbgcon.OPT_STOP_EXCEPTIONS]
+        self.AddDDX(win32ui.IDC_CHECK2, dbgcon.OPT_STOP_EXCEPTIONS)
+        self[dbgcon.OPT_HIDE] = options[dbgcon.OPT_HIDE]
+        return dialog.PropertyPage.OnInitDialog(self)
+
+    def OnOK(self):
+        self.UpdateData()
+        dirty = 0
+        for key, val in list(self.items()):
+            if key in self.options:
+                if self.options[key] != val:
+                    self.options[key] = val
+                    dirty = 1
+        if dirty:
+            dbgcon.SaveDebuggerOptions(self.options)
+        # If there is a debugger open, then set its options.
+        import pywin.debugger
+
+        if pywin.debugger.currentDebugger is not None:
+            pywin.debugger.currentDebugger.options = self.options
+        return 1

.venv/Lib/site-packages/pythonwin/pywin/debugger/dbgcon.py

@@ -0,0 +1,31 @@
+# General constants for the debugger
+
+DBGSTATE_NOT_DEBUGGING = 0
+DBGSTATE_RUNNING = 1
+DBGSTATE_BREAK = 2
+DBGSTATE_QUITTING = 3  # Attempting to back out of the debug session.
+
+LINESTATE_CURRENT = 0x1  # This line is where we are stopped
+LINESTATE_BREAKPOINT = 0x2  # This line is a breakpoint
+LINESTATE_CALLSTACK = 0x4  # This line is in the callstack.
+
+OPT_HIDE = "hide"
+OPT_STOP_EXCEPTIONS = "stopatexceptions"
+
+import win32api, win32ui
+
+
+def DoGetOption(optsDict, optName, default):
+    optsDict[optName] = win32ui.GetProfileVal("Debugger Options", optName, default)
+
+
+def LoadDebuggerOptions():
+    opts = {}
+    DoGetOption(opts, OPT_HIDE, 0)
+    DoGetOption(opts, OPT_STOP_EXCEPTIONS, 1)
+    return opts
+
+
+def SaveDebuggerOptions(opts):
+    for key, val in opts.items():
+        win32ui.WriteProfileVal("Debugger Options", key, val)

.venv/Lib/site-packages/pythonwin/pywin/debugger/dbgpyapp.py

@@ -0,0 +1,49 @@
+# dbgpyapp.py  - Debugger Python application class
+#
+import win32con
+import win32ui
+import sys
+import string
+import os
+from pywin.framework import intpyapp
+
+version = "0.3.0"
+
+
+class DebuggerPythonApp(intpyapp.InteractivePythonApp):
+    def LoadMainFrame(self):
+        "Create the main applications frame"
+        self.frame = self.CreateMainFrame()
+        self.SetMainFrame(self.frame)
+        self.frame.LoadFrame(win32ui.IDR_DEBUGGER, win32con.WS_OVERLAPPEDWINDOW)
+        self.frame.DragAcceptFiles()  # we can accept these.
+        self.frame.ShowWindow(win32con.SW_HIDE)
+        self.frame.UpdateWindow()
+
+        # but we do rehook, hooking the new code objects.
+        self.HookCommands()
+
+    def InitInstance(self):
+        # Use a registry path of "Python\Pythonwin Debugger
+        win32ui.SetAppName(win32ui.LoadString(win32ui.IDR_DEBUGGER))
+        win32ui.SetRegistryKey("Python %s" % (sys.winver,))
+        # We _need_ the Scintilla color editor.
+        # (and we _always_ get it now :-)
+
+        numMRU = win32ui.GetProfileVal("Settings", "Recent File List Size", 10)
+        win32ui.LoadStdProfileSettings(numMRU)
+
+        self.LoadMainFrame()
+
+        # Display the interactive window if the user wants it.
+        from pywin.framework import interact
+
+        interact.CreateInteractiveWindowUserPreference()
+
+        # Load the modules we use internally.
+        self.LoadSystemModules()
+        # Load additional module the user may want.
+        self.LoadUserModules()
+
+        # 		win32ui.CreateDebuggerThread()
+        win32ui.EnableControlContainer()

.venv/Lib/site-packages/pythonwin/pywin/debugger/fail.py

@@ -0,0 +1,54 @@
+# NOTE NOTE - This module is designed to fail!
+#
+# The ONLY purpose for this script is testing/demoing the
+# Pythonwin debugger package.
+
+# It does nothing useful, and it even doesnt do that!
+
+import pywin.debugger, sys, time
+import traceback
+
+
+def a():
+    a = 1
+    try:
+        b()
+    except:
+        # Break into the debugger with the exception information.
+        pywin.debugger.post_mortem(sys.exc_info()[2])
+        a = 1
+        a = 2
+        a = 3
+        a = 4
+        pass
+
+
+def b():
+    b = 1
+    pywin.debugger.set_trace()
+    # After importing or running this module, you are likely to be
+    # sitting at the next line.  This is because we explicitely
+    # broke into the debugger using the "set_trace() function
+    # "pywin.debugger.brk()" is a shorter alias for this.
+    c()
+    pass
+
+
+def c():
+    c = 1
+    d()
+
+
+def d():
+    d = 1
+    e(d)
+    raise ValueError("Hi")
+
+
+def e(arg):
+    e = 1
+    time.sleep(1)
+    return e
+
+
+a()

.venv/Lib/site-packages/pythonwin/pywin/default.cfg

@@ -0,0 +1,215 @@
+# The default keyboard etc configuration file for Pythonwin.
+#
+# The format of this file is very similar to a Windows INI file.
+# Sections are identified with [Section] lines, but comments
+# use the standatd Python # character.  Depending on the section,
+# lines may not be in the standard "key=value" format.
+
+# NOTE:  You should not need to modify this file.
+# Simply create a new .CFG file, and add an entry:
+# [General]
+# BasedOn = Default
+#
+# and add your customisations.  Then select your new configuration 
+# from the Pythonwin View/Options/Editor dialog.
+# This way you get to add your own customisations,
+# but still take advantage of changes to the default
+# configuration in new releases.
+
+# See IDLE.cfg for an example extension configuration.
+#
+##########################################################################
+
+[IDLE Extensions]
+
+# The list of IDLE extensions to load.  The extensions
+# AutoIndent, AutoFormat and possibly others are
+# "built-in", so do not need specifying.
+
+FormatParagraph
+CallTips
+
+
+[Keys]
+
+# The list of _default_ key definitions.  
+#  See [Keys:Interactive] and [Keys:Editor] below for further defs.
+
+#Events of the format <<event-name>> 
+# are events defined in IDLE extensions.
+
+Alt+Q             = <<format-paragraph>>
+
+Ctrl+W            = ViewWhitespace
+Ctrl+Shift+8      = ViewWhitespace # The MSVC default key def.
+
+Ctrl+Shift+F      = ViewFixedFont
+
+# Auto-complete, call-tips, etc.
+Alt+/             = <<expand-word>>
+Ctrl+Space   = <<expand-word>>
+(           = <<paren-open>>
+)           = <<paren-close>>
+Up                = <<check-calltip-cancel>>
+Down              = <<check-calltip-cancel>>
+Left              = <<check-calltip-cancel>>
+Right             = <<check-calltip-cancel>>
+.                 = KeyDot
+
+# Debugger - These are the MSVC default keys, for want of a better choice.
+F9                = DbgBreakpointToggle
+F5                = DbgGo
+Shift+F5          = DbgClose
+F11               = DbgStep
+F10               = DbgStepOver
+Shift+F11         = DbgStepOut
+
+Ctrl+F3           = AutoFindNext
+
+
+[Keys:Editor]
+# Key bindings specific to the editor
+F2                = GotoNextBookmark
+Ctrl+F2           = ToggleBookmark
+Ctrl+G            = GotoLine
+
+Alt+I             = ShowInteractiveWindow
+Alt-B             = AddBanner # A sample Event defined in this file.
+
+# Block operations
+Alt+3             = <<comment-region>>
+Shift+Alt+3       = <<uncomment-region>>
+Alt+4             = <<uncomment-region>> # IDLE default.
+Alt+5             = <<tabify-region>>
+Alt+6             = <<untabify-region>>
+
+# Tabs and other indent features
+Back              = <<smart-backspace>>
+Ctrl+T            = <<toggle-tabs>>
+Alt+U             = <<change-indentwidth>>
+Enter             = EnterKey
+Tab               = TabKey
+Shift-Tab         = <<dedent-region>>
+
+# Folding
+Add               = FoldExpand
+Alt+Add           = FoldExpandAll
+Shift+Add         = FoldExpandSecondLevel
+Subtract          = FoldCollapse
+Alt+Subtract      = FoldCollapseAll
+Shift+Subtract    = FoldCollapseSecondLevel
+Multiply          = FoldTopLevel
+
+[Keys:Interactive]
+# Key bindings specific to the interactive window.
+# History for the interactive window
+Ctrl+Up           = <<history-previous>>
+Ctrl+Down         = <<history-next>>
+Enter             = ProcessEnter
+Ctrl+Enter        = ProcessEnter
+Shift+Enter       = ProcessEnter
+Esc               = ProcessEsc
+Alt+I             = WindowBack # Toggle back to previous window.
+Home              = InteractiveHome # A sample Event defined in this file.
+Shift+Home        = InteractiveHomeExtend # A sample Event defined in this file.
+
+# When docked, the Ctrl+Tab and Shift+Ctrl+Tab keys dont work as expected.
+Ctrl+Tab          = MDINext
+Ctrl+Shift+Tab    = MDIPrev
+
+[Extensions]
+# Python event handlers specific to this config file.
+# All functions not starting with an "_" are assumed
+# to be events, and take 2 params:
+# * editor_window is the same object passed to IDLE
+#   extensions.  editor_window.text is a text widget
+#   that conforms to the Tk text widget interface.
+# * event is the event being fired.  Will always be None
+#   in the current implementation.
+
+# Simply by defining these functions, they are available as
+# events.
+# Note that we bind keystrokes to these events in the various
+# [Keys] sections.
+
+# Add a simple file/class/function simple banner
+def AddBanner(editor_window, event):
+
+	text = editor_window.text
+	big_line = "#" * 70
+	banner = "%s\n## \n## \n## \n%s\n" % (big_line, big_line)
+
+	# Insert at the start of the current line.
+	pos = text.index("insert linestart")
+
+	text.undo_block_start() # Allow action to be undone as a single unit.
+	text.insert(pos, banner)
+	text.undo_block_stop()
+
+	# Now set the insert point to the middle of the banner.
+	line, col = [int(s) for s in pos.split(".")]
+	text.mark_set("insert", "%d.1 lineend" % (line+2, ) )
+
+
+# Here is a sample event bound to the "Home" key in the
+# interactive window
+def InteractiveHome(editor_window, event):
+	return _DoInteractiveHome(editor_window.text, 0)
+
+def InteractiveHomeExtend(editor_window, event):
+	return _DoInteractiveHome(editor_window.text, 1)
+
+def _DoInteractiveHome(text, extend):
+	import sys
+	# If Scintilla has an autocomplete window open, then let Scintilla handle it.
+	if text.edit.SCIAutoCActive():
+		return 1
+	of_interest = "insert linestart + %d c" % len(sys.ps1)
+	if not text.compare("insert", "==", of_interest) and \
+	   text.get("insert linestart", of_interest) in [sys.ps1, sys.ps2]: # Not sys.ps? line
+		end = of_interest
+	else:
+		end = "insert linestart"
+
+	if extend: start = "insert"
+	else: start = end
+	text.tag_add("sel", start, end)
+
+# From Niki Spahie
+def AutoFindNext(editor_window, event):
+    "find selected text or word under cursor"
+
+    from pywin.scintilla import find
+    from pywin.scintilla import scintillacon
+
+    try:
+        sci = editor_window.edit
+        word = sci.GetSelText()
+        if word:
+            find.lastSearch.findText = word
+            find.lastSearch.sel = sci.GetSel()
+        else:
+            pos = sci.SendScintilla( scintillacon.SCI_GETCURRENTPOS )
+            start = sci.SendScintilla( scintillacon.SCI_WORDSTARTPOSITION, pos, 1 )
+            end = sci.SendScintilla( scintillacon.SCI_WORDENDPOSITION, pos, 1 )
+            word = sci.GetTextRange( start, end )
+            if word:
+                find.lastSearch.findText = word
+                find.lastSearch.sel = (start,end)
+    except Exception:
+        import traceback
+        traceback.print_exc()
+    find.FindNext()
+
+
+# A couple of generic events.
+def Beep(editor_window, event):
+	editor_window.text.beep()
+
+def DoNothing(editor_window, event):
+	pass
+
+def ContinueEvent(editor_window, event):
+	# Almost an "unbind" - allows Pythonwin/MFC to handle the keystroke
+	return 1
+

.venv/Lib/site-packages/pythonwin/pywin/dialogs/ideoptions.py

@@ -0,0 +1,140 @@
+# The property page to define generic IDE options for Pythonwin
+
+from pywin.mfc import dialog
+from pywin.framework import interact
+import win32ui
+import win32con
+
+buttonControlMap = {
+    win32ui.IDC_BUTTON1: win32ui.IDC_EDIT1,
+    win32ui.IDC_BUTTON2: win32ui.IDC_EDIT2,
+    win32ui.IDC_BUTTON3: win32ui.IDC_EDIT3,
+}
+
+
+class OptionsPropPage(dialog.PropertyPage):
+    def __init__(self):
+        dialog.PropertyPage.__init__(self, win32ui.IDD_PP_IDE)
+        self.AddDDX(win32ui.IDC_CHECK1, "bShowAtStartup")
+        self.AddDDX(win32ui.IDC_CHECK2, "bDocking")
+        self.AddDDX(win32ui.IDC_EDIT4, "MRUSize", "i")
+
+    def OnInitDialog(self):
+
+        edit = self.GetDlgItem(win32ui.IDC_EDIT1)
+        format = eval(
+            win32ui.GetProfileVal(
+                interact.sectionProfile,
+                interact.STYLE_INTERACTIVE_PROMPT,
+                str(interact.formatInput),
+            )
+        )
+        edit.SetDefaultCharFormat(format)
+        edit.SetWindowText("Input Text")
+
+        edit = self.GetDlgItem(win32ui.IDC_EDIT2)
+        format = eval(
+            win32ui.GetProfileVal(
+                interact.sectionProfile,
+                interact.STYLE_INTERACTIVE_OUTPUT,
+                str(interact.formatOutput),
+            )
+        )
+        edit.SetDefaultCharFormat(format)
+        edit.SetWindowText("Output Text")
+
+        edit = self.GetDlgItem(win32ui.IDC_EDIT3)
+        format = eval(
+            win32ui.GetProfileVal(
+                interact.sectionProfile,
+                interact.STYLE_INTERACTIVE_ERROR,
+                str(interact.formatOutputError),
+            )
+        )
+        edit.SetDefaultCharFormat(format)
+        edit.SetWindowText("Error Text")
+
+        self["bShowAtStartup"] = interact.LoadPreference("Show at startup", 1)
+        self["bDocking"] = interact.LoadPreference("Docking", 0)
+        self["MRUSize"] = win32ui.GetProfileVal("Settings", "Recent File List Size", 10)
+
+        # Hook the button clicks.
+        self.HookCommand(self.HandleCharFormatChange, win32ui.IDC_BUTTON1)
+        self.HookCommand(self.HandleCharFormatChange, win32ui.IDC_BUTTON2)
+        self.HookCommand(self.HandleCharFormatChange, win32ui.IDC_BUTTON3)
+
+        # Ensure the spin control remains in range.
+        spinner = self.GetDlgItem(win32ui.IDC_SPIN1)
+        spinner.SetRange(1, 16)
+
+        return dialog.PropertyPage.OnInitDialog(self)
+
+    # Called to save away the new format tuple for the specified item.
+    def HandleCharFormatChange(self, id, code):
+        if code == win32con.BN_CLICKED:
+            editId = buttonControlMap.get(id)
+            assert editId is not None, "Format button has no associated edit control"
+            editControl = self.GetDlgItem(editId)
+            existingFormat = editControl.GetDefaultCharFormat()
+            flags = win32con.CF_SCREENFONTS
+            d = win32ui.CreateFontDialog(existingFormat, flags, None, self)
+            if d.DoModal() == win32con.IDOK:
+                cf = d.GetCharFormat()
+                editControl.SetDefaultCharFormat(cf)
+                self.SetModified(1)
+            return 0  # We handled this fully!
+
+    def OnOK(self):
+        # Handle the edit controls - get all the fonts, put them back into interact, then
+        # get interact to save its stuff!
+        controlAttrs = [
+            (win32ui.IDC_EDIT1, interact.STYLE_INTERACTIVE_PROMPT),
+            (win32ui.IDC_EDIT2, interact.STYLE_INTERACTIVE_OUTPUT),
+            (win32ui.IDC_EDIT3, interact.STYLE_INTERACTIVE_ERROR),
+        ]
+        for id, key in controlAttrs:
+            control = self.GetDlgItem(id)
+            fmt = control.GetDefaultCharFormat()
+            win32ui.WriteProfileVal(interact.sectionProfile, key, str(fmt))
+
+        # Save the other interactive window options.
+        interact.SavePreference("Show at startup", self["bShowAtStartup"])
+        interact.SavePreference("Docking", self["bDocking"])
+
+        # And the other options.
+        win32ui.WriteProfileVal("Settings", "Recent File List Size", self["MRUSize"])
+
+        return 1
+
+    def ChangeFormat(self, fmtAttribute, fmt):
+        dlg = win32ui.CreateFontDialog(fmt)
+        if dlg.DoModal() != win32con.IDOK:
+            return None
+        return dlg.GetCharFormat()
+
+    def OnFormatTitle(self, command, code):
+        fmt = self.GetFormat(interact.formatTitle)
+        if fmt:
+            formatTitle = fmt
+            SaveFontPreferences()
+
+    def OnFormatInput(self, command, code):
+        global formatInput
+        fmt = self.GetFormat(formatInput)
+        if fmt:
+            formatInput = fmt
+            SaveFontPreferences()
+
+    def OnFormatOutput(self, command, code):
+        global formatOutput
+        fmt = self.GetFormat(formatOutput)
+        if fmt:
+            formatOutput = fmt
+            SaveFontPreferences()
+
+    def OnFormatError(self, command, code):
+        global formatOutputError
+        fmt = self.GetFormat(formatOutputError)
+        if fmt:
+            formatOutputError = fmt
+            SaveFontPreferences()

.venv/Lib/site-packages/pythonwin/pywin/dialogs/list.py

@@ -0,0 +1,140 @@
+from pywin.mfc import dialog
+import win32ui, win32con, commctrl, win32api
+
+
+class ListDialog(dialog.Dialog):
+    def __init__(self, title, list):
+        dialog.Dialog.__init__(self, self._maketemplate(title))
+        self.HookMessage(self.on_size, win32con.WM_SIZE)
+        self.HookNotify(self.OnListItemChange, commctrl.LVN_ITEMCHANGED)
+        self.HookCommand(self.OnListClick, win32ui.IDC_LIST1)
+        self.items = list
+
+    def _maketemplate(self, title):
+        style = win32con.WS_DLGFRAME | win32con.WS_SYSMENU | win32con.WS_VISIBLE
+        ls = (
+            win32con.WS_CHILD
+            | win32con.WS_VISIBLE
+            | commctrl.LVS_ALIGNLEFT
+            | commctrl.LVS_REPORT
+        )
+        bs = win32con.WS_CHILD | win32con.WS_VISIBLE
+        return [
+            [title, (0, 0, 200, 200), style, None, (8, "MS Sans Serif")],
+            ["SysListView32", None, win32ui.IDC_LIST1, (0, 0, 200, 200), ls],
+            [128, "OK", win32con.IDOK, (10, 0, 50, 14), bs | win32con.BS_DEFPUSHBUTTON],
+            [128, "Cancel", win32con.IDCANCEL, (0, 0, 50, 14), bs],
+        ]
+
+    def FillList(self):
+        size = self.GetWindowRect()
+        width = size[2] - size[0] - (10)
+        itemDetails = (commctrl.LVCFMT_LEFT, width, "Item", 0)
+        self.itemsControl.InsertColumn(0, itemDetails)
+        index = 0
+        for item in self.items:
+            index = self.itemsControl.InsertItem(index + 1, str(item), 0)
+
+    def OnListClick(self, id, code):
+        if code == commctrl.NM_DBLCLK:
+            self.EndDialog(win32con.IDOK)
+        return 1
+
+    def OnListItemChange(self, std, extra):
+        (hwndFrom, idFrom, code), (
+            itemNotify,
+            sub,
+            newState,
+            oldState,
+            change,
+            point,
+            lparam,
+        ) = (std, extra)
+        oldSel = (oldState & commctrl.LVIS_SELECTED) != 0
+        newSel = (newState & commctrl.LVIS_SELECTED) != 0
+        if oldSel != newSel:
+            try:
+                self.selecteditem = itemNotify
+                self.butOK.EnableWindow(1)
+            except win32ui.error:
+                self.selecteditem = None
+
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.itemsControl = self.GetDlgItem(win32ui.IDC_LIST1)
+        self.butOK = self.GetDlgItem(win32con.IDOK)
+        self.butCancel = self.GetDlgItem(win32con.IDCANCEL)
+
+        self.FillList()
+
+        size = self.GetWindowRect()
+        self.LayoutControls(size[2] - size[0], size[3] - size[1])
+        self.butOK.EnableWindow(0)  # wait for first selection
+        return rc
+
+    def LayoutControls(self, w, h):
+        self.itemsControl.MoveWindow((0, 0, w, h - 30))
+        self.butCancel.MoveWindow((10, h - 24, 60, h - 4))
+        self.butOK.MoveWindow((w - 60, h - 24, w - 10, h - 4))
+
+    def on_size(self, params):
+        lparam = params[3]
+        w = win32api.LOWORD(lparam)
+        h = win32api.HIWORD(lparam)
+        self.LayoutControls(w, h)
+
+
+class ListsDialog(ListDialog):
+    def __init__(self, title, list, colHeadings=["Item"]):
+        ListDialog.__init__(self, title, list)
+        self.colHeadings = colHeadings
+
+    def FillList(self):
+        index = 0
+        size = self.GetWindowRect()
+        width = (
+            size[2] - size[0] - (10) - win32api.GetSystemMetrics(win32con.SM_CXVSCROLL)
+        )
+        numCols = len(self.colHeadings)
+
+        for col in self.colHeadings:
+            itemDetails = (commctrl.LVCFMT_LEFT, int(width / numCols), col, 0)
+            self.itemsControl.InsertColumn(index, itemDetails)
+            index = index + 1
+        index = 0
+        for items in self.items:
+            index = self.itemsControl.InsertItem(index + 1, str(items[0]), 0)
+            for itemno in range(1, numCols):
+                item = items[itemno]
+                self.itemsControl.SetItemText(index, itemno, str(item))
+
+
+def SelectFromList(title, lst):
+    dlg = ListDialog(title, lst)
+    if dlg.DoModal() == win32con.IDOK:
+        return dlg.selecteditem
+    else:
+        return None
+
+
+def SelectFromLists(title, lists, headings):
+    dlg = ListsDialog(title, lists, headings)
+    if dlg.DoModal() == win32con.IDOK:
+        return dlg.selecteditem
+    else:
+        return None
+
+
+def test():
+    # 	print SelectFromList('Single list',  [1,2,3])
+    print(
+        SelectFromLists(
+            "Multi-List",
+            [("1", 1, "a"), ("2", 2, "b"), ("3", 3, "c")],
+            ["Col 1", "Col 2"],
+        )
+    )
+
+
+if __name__ == "__main__":
+    test()

.venv/Lib/site-packages/pythonwin/pywin/dialogs/login.py

@@ -0,0 +1,156 @@
+"""login -- PythonWin user ID and password dialog box
+
+(Adapted from originally distributed with Mark Hammond's PythonWin - 
+this now replaces it!)
+
+login.GetLogin() displays a modal "OK/Cancel" dialog box with input
+fields for a user ID and password. The password field input is masked
+with *'s. GetLogin takes two optional parameters, a window title, and a
+default user ID. If these parameters are omitted, the title defaults to
+"Login", and the user ID is left blank. GetLogin returns a (userid, password)
+tuple. GetLogin can be called from scripts running on the console - i.e. you
+don't need to write a full-blown GUI app to use it.
+
+login.GetPassword() is similar, except there is no username field.
+
+Example:
+import pywin.dialogs.login
+title = "FTP Login"
+def_user = "fred"
+userid, password = pywin.dialogs.login.GetLogin(title, def_user)
+
+Jim Eggleston, 28 August 1996
+Merged with dlgpass and moved to pywin.dialogs by Mark Hammond Jan 1998.
+"""
+
+import win32ui
+import win32api
+import win32con
+from pywin.mfc import dialog
+
+
+def MakeLoginDlgTemplate(title):
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+
+    # Window frame and title
+    dlg = [
+        [title, (0, 0, 184, 40), style, None, (8, "MS Sans Serif")],
+    ]
+
+    # ID label and text box
+    dlg.append([130, "User ID:", -1, (7, 9, 69, 9), cs | win32con.SS_LEFT])
+    s = cs | win32con.WS_TABSTOP | win32con.WS_BORDER
+    dlg.append(["EDIT", None, win32ui.IDC_EDIT1, (50, 7, 60, 12), s])
+
+    # Password label and text box
+    dlg.append([130, "Password:", -1, (7, 22, 69, 9), cs | win32con.SS_LEFT])
+    s = cs | win32con.WS_TABSTOP | win32con.WS_BORDER
+    dlg.append(
+        ["EDIT", None, win32ui.IDC_EDIT2, (50, 20, 60, 12), s | win32con.ES_PASSWORD]
+    )
+
+    # OK/Cancel Buttons
+    s = cs | win32con.WS_TABSTOP
+    dlg.append(
+        [128, "OK", win32con.IDOK, (124, 5, 50, 14), s | win32con.BS_DEFPUSHBUTTON]
+    )
+    s = win32con.BS_PUSHBUTTON | s
+    dlg.append([128, "Cancel", win32con.IDCANCEL, (124, 20, 50, 14), s])
+    return dlg
+
+
+def MakePasswordDlgTemplate(title):
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+    # Window frame and title
+    dlg = [
+        [title, (0, 0, 177, 45), style, None, (8, "MS Sans Serif")],
+    ]
+
+    # Password label and text box
+    dlg.append([130, "Password:", -1, (7, 7, 69, 9), cs | win32con.SS_LEFT])
+    s = cs | win32con.WS_TABSTOP | win32con.WS_BORDER
+    dlg.append(
+        ["EDIT", None, win32ui.IDC_EDIT1, (50, 7, 60, 12), s | win32con.ES_PASSWORD]
+    )
+
+    # OK/Cancel Buttons
+    s = cs | win32con.WS_TABSTOP | win32con.BS_PUSHBUTTON
+    dlg.append(
+        [128, "OK", win32con.IDOK, (124, 5, 50, 14), s | win32con.BS_DEFPUSHBUTTON]
+    )
+    dlg.append([128, "Cancel", win32con.IDCANCEL, (124, 22, 50, 14), s])
+    return dlg
+
+
+class LoginDlg(dialog.Dialog):
+    Cancel = 0
+
+    def __init__(self, title):
+        dialog.Dialog.__init__(self, MakeLoginDlgTemplate(title))
+        self.AddDDX(win32ui.IDC_EDIT1, "userid")
+        self.AddDDX(win32ui.IDC_EDIT2, "password")
+
+
+def GetLogin(title="Login", userid="", password=""):
+    d = LoginDlg(title)
+    d["userid"] = userid
+    d["password"] = password
+    if d.DoModal() != win32con.IDOK:
+        return (None, None)
+    else:
+        return (d["userid"], d["password"])
+
+
+class PasswordDlg(dialog.Dialog):
+    def __init__(self, title):
+        dialog.Dialog.__init__(self, MakePasswordDlgTemplate(title))
+        self.AddDDX(win32ui.IDC_EDIT1, "password")
+
+
+def GetPassword(title="Password", password=""):
+    d = PasswordDlg(title)
+    d["password"] = password
+    if d.DoModal() != win32con.IDOK:
+        return None
+    return d["password"]
+
+
+if __name__ == "__main__":
+    import sys
+
+    title = "Login"
+    def_user = ""
+    if len(sys.argv) > 1:
+        title = sys.argv[1]
+    if len(sys.argv) > 2:
+        def_userid = sys.argv[2]
+    userid, password = GetLogin(title, def_user)
+    if userid == password == None:
+        print("User pressed Cancel")
+    else:
+        print("User ID: ", userid)
+        print("Password:", password)
+        newpassword = GetPassword("Reenter just for fun", password)
+        if newpassword is None:
+            print("User cancelled")
+        else:
+            what = ""
+            if newpassword != password:
+                what = "not "
+            print("The passwords did %smatch" % (what))

.venv/Lib/site-packages/pythonwin/pywin/dialogs/status.py

@@ -0,0 +1,241 @@
+# No cancel button.
+
+from pywin.mfc import dialog
+from pywin.mfc.thread import WinThread
+import threading
+import win32ui
+import win32con
+import win32api
+import time
+
+
+def MakeProgressDlgTemplate(caption, staticText=""):
+    style = (
+        win32con.DS_MODALFRAME
+        | win32con.WS_POPUP
+        | win32con.WS_VISIBLE
+        | win32con.WS_CAPTION
+        | win32con.WS_SYSMENU
+        | win32con.DS_SETFONT
+    )
+    cs = win32con.WS_CHILD | win32con.WS_VISIBLE
+
+    w = 215
+    h = 36  # With button
+    h = 40
+
+    dlg = [
+        [caption, (0, 0, w, h), style, None, (8, "MS Sans Serif")],
+    ]
+
+    s = win32con.WS_TABSTOP | cs
+
+    dlg.append([130, staticText, 1000, (7, 7, w - 7, h - 32), cs | win32con.SS_LEFT])
+
+    #    dlg.append([128,
+    # 		"Cancel",
+    # 		win32con.IDCANCEL,
+    # 		(w - 60, h - 18, 50, 14), s | win32con.BS_PUSHBUTTON])
+
+    return dlg
+
+
+class CStatusProgressDialog(dialog.Dialog):
+    def __init__(self, title, msg="", maxticks=100, tickincr=1):
+        self.initMsg = msg
+        templ = MakeProgressDlgTemplate(title, msg)
+        dialog.Dialog.__init__(self, templ)
+        self.maxticks = maxticks
+        self.tickincr = tickincr
+        self.pbar = None
+
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        self.static = self.GetDlgItem(1000)
+        self.pbar = win32ui.CreateProgressCtrl()
+        self.pbar.CreateWindow(
+            win32con.WS_CHILD | win32con.WS_VISIBLE, (10, 30, 310, 44), self, 1001
+        )
+        self.pbar.SetRange(0, self.maxticks)
+        self.pbar.SetStep(self.tickincr)
+        self.progress = 0
+        self.pincr = 5
+        return rc
+
+    def Close(self):
+        self.EndDialog(0)
+
+    def SetMaxTicks(self, maxticks):
+        if self.pbar is not None:
+            self.pbar.SetRange(0, maxticks)
+
+    def Tick(self):
+        if self.pbar is not None:
+            self.pbar.StepIt()
+
+    def SetTitle(self, text):
+        self.SetWindowText(text)
+
+    def SetText(self, text):
+        self.SetDlgItemText(1000, text)
+
+    def Set(self, pos, max=None):
+        if self.pbar is not None:
+            self.pbar.SetPos(pos)
+            if max is not None:
+                self.pbar.SetRange(0, max)
+
+
+# a progress dialog created in a new thread - especially suitable for
+# console apps with no message loop.
+MYWM_SETTITLE = win32con.WM_USER + 10
+MYWM_SETMSG = win32con.WM_USER + 11
+MYWM_TICK = win32con.WM_USER + 12
+MYWM_SETMAXTICKS = win32con.WM_USER + 13
+MYWM_SET = win32con.WM_USER + 14
+
+
+class CThreadedStatusProcessDialog(CStatusProgressDialog):
+    def __init__(self, title, msg="", maxticks=100, tickincr=1):
+        self.title = title
+        self.msg = msg
+        self.threadid = win32api.GetCurrentThreadId()
+        CStatusProgressDialog.__init__(self, title, msg, maxticks, tickincr)
+
+    def OnInitDialog(self):
+        rc = CStatusProgressDialog.OnInitDialog(self)
+        self.HookMessage(self.OnTitle, MYWM_SETTITLE)
+        self.HookMessage(self.OnMsg, MYWM_SETMSG)
+        self.HookMessage(self.OnTick, MYWM_TICK)
+        self.HookMessage(self.OnMaxTicks, MYWM_SETMAXTICKS)
+        self.HookMessage(self.OnSet, MYWM_SET)
+        return rc
+
+    def _Send(self, msg):
+        try:
+            self.PostMessage(msg)
+        except win32ui.error:
+            # the user closed the window - but this does not cancel the
+            # process - so just ignore it.
+            pass
+
+    def OnTitle(self, msg):
+        CStatusProgressDialog.SetTitle(self, self.title)
+
+    def OnMsg(self, msg):
+        CStatusProgressDialog.SetText(self, self.msg)
+
+    def OnTick(self, msg):
+        CStatusProgressDialog.Tick(self)
+
+    def OnMaxTicks(self, msg):
+        CStatusProgressDialog.SetMaxTicks(self, self.maxticks)
+
+    def OnSet(self, msg):
+        CStatusProgressDialog.Set(self, self.pos, self.max)
+
+    def Close(self):
+        assert self.threadid, "No thread!"
+        win32api.PostThreadMessage(self.threadid, win32con.WM_QUIT, 0, 0)
+
+    def SetMaxTicks(self, maxticks):
+        self.maxticks = maxticks
+        self._Send(MYWM_SETMAXTICKS)
+
+    def SetTitle(self, title):
+        self.title = title
+        self._Send(MYWM_SETTITLE)
+
+    def SetText(self, text):
+        self.msg = text
+        self._Send(MYWM_SETMSG)
+
+    def Tick(self):
+        self._Send(MYWM_TICK)
+
+    def Set(self, pos, max=None):
+        self.pos = pos
+        self.max = max
+        self._Send(MYWM_SET)
+
+
+class ProgressThread(WinThread):
+    def __init__(self, title, msg="", maxticks=100, tickincr=1):
+        self.title = title
+        self.msg = msg
+        self.maxticks = maxticks
+        self.tickincr = tickincr
+        self.dialog = None
+        WinThread.__init__(self)
+        self.createdEvent = threading.Event()
+
+    def InitInstance(self):
+        self.dialog = CThreadedStatusProcessDialog(
+            self.title, self.msg, self.maxticks, self.tickincr
+        )
+        self.dialog.CreateWindow()
+        try:
+            self.dialog.SetForegroundWindow()
+        except win32ui.error:
+            pass
+        self.createdEvent.set()
+        return WinThread.InitInstance(self)
+
+    def ExitInstance(self):
+        return 0
+
+
+def StatusProgressDialog(title, msg="", maxticks=100, parent=None):
+    d = CStatusProgressDialog(title, msg, maxticks)
+    d.CreateWindow(parent)
+    return d
+
+
+def ThreadedStatusProgressDialog(title, msg="", maxticks=100):
+    t = ProgressThread(title, msg, maxticks)
+    t.CreateThread()
+    # Need to run a basic "PumpWaitingMessages" loop just incase we are
+    # running inside Pythonwin.
+    # Basic timeout incase things go terribly wrong.  Ideally we should use
+    # win32event.MsgWaitForMultipleObjects(), but we use a threading module
+    # event - so use a dumb strategy
+    end_time = time.time() + 10
+    while time.time() < end_time:
+        if t.createdEvent.isSet():
+            break
+        win32ui.PumpWaitingMessages()
+        time.sleep(0.1)
+    return t.dialog
+
+
+def demo():
+    d = StatusProgressDialog("A Demo", "Doing something...")
+    import win32api
+
+    for i in range(100):
+        if i == 50:
+            d.SetText("Getting there...")
+        if i == 90:
+            d.SetText("Nearly done...")
+        win32api.Sleep(20)
+        d.Tick()
+    d.Close()
+
+
+def thread_demo():
+    d = ThreadedStatusProgressDialog("A threaded demo", "Doing something")
+    import win32api
+
+    for i in range(100):
+        if i == 50:
+            d.SetText("Getting there...")
+        if i == 90:
+            d.SetText("Nearly done...")
+        win32api.Sleep(20)
+        d.Tick()
+    d.Close()
+
+
+if __name__ == "__main__":
+    thread_demo()
+    # demo()

.venv/Lib/site-packages/pythonwin/pywin/docking/DockingBar.py

@@ -0,0 +1,676 @@
+# DockingBar.py
+
+# Ported directly (comments and all) from the samples at www.codeguru.com
+
+# WARNING: Use at your own risk, as this interface is highly likely to change.
+# Currently we support only one child per DockingBar.  Later we need to add
+# support for multiple children.
+
+import win32api, win32con, win32ui
+from pywin.mfc import afxres, window
+import struct
+
+clrBtnHilight = win32api.GetSysColor(win32con.COLOR_BTNHILIGHT)
+clrBtnShadow = win32api.GetSysColor(win32con.COLOR_BTNSHADOW)
+
+
+def CenterPoint(rect):
+    width = rect[2] - rect[0]
+    height = rect[3] - rect[1]
+    return rect[0] + width // 2, rect[1] + height // 2
+
+
+def OffsetRect(rect, point):
+    (x, y) = point
+    return rect[0] + x, rect[1] + y, rect[2] + x, rect[3] + y
+
+
+def DeflateRect(rect, point):
+    (x, y) = point
+    return rect[0] + x, rect[1] + y, rect[2] - x, rect[3] - y
+
+
+def PtInRect(rect, pt):
+    return rect[0] <= pt[0] < rect[2] and rect[1] <= pt[1] < rect[3]
+
+
+class DockingBar(window.Wnd):
+    def __init__(self, obj=None):
+        if obj is None:
+            obj = win32ui.CreateControlBar()
+        window.Wnd.__init__(self, obj)
+        self.dialog = None
+        self.nDockBarID = 0
+        self.sizeMin = 32, 32
+        self.sizeHorz = 200, 200
+        self.sizeVert = 200, 200
+        self.sizeFloat = 200, 200
+        self.bTracking = 0
+        self.bInRecalcNC = 0
+        self.cxEdge = 6
+        self.cxBorder = 3
+        self.cxGripper = 20
+        self.brushBkgd = win32ui.CreateBrush()
+        self.brushBkgd.CreateSolidBrush(win32api.GetSysColor(win32con.COLOR_BTNFACE))
+
+        # Support for diagonal resizing
+        self.cyBorder = 3
+        self.cCaptionSize = win32api.GetSystemMetrics(win32con.SM_CYSMCAPTION)
+        self.cMinWidth = win32api.GetSystemMetrics(win32con.SM_CXMIN)
+        self.cMinHeight = win32api.GetSystemMetrics(win32con.SM_CYMIN)
+        self.rectUndock = (0, 0, 0, 0)
+
+    def OnUpdateCmdUI(self, target, bDisableIfNoHndler):
+        return self.UpdateDialogControls(target, bDisableIfNoHndler)
+
+    def CreateWindow(
+        self,
+        parent,
+        childCreator,
+        title,
+        id,
+        style=win32con.WS_CHILD | win32con.WS_VISIBLE | afxres.CBRS_LEFT,
+        childCreatorArgs=(),
+    ):
+        assert not (
+            (style & afxres.CBRS_SIZE_FIXED) and (style & afxres.CBRS_SIZE_DYNAMIC)
+        ), "Invalid style"
+        self.rectClose = self.rectBorder = self.rectGripper = self.rectTracker = (
+            0,
+            0,
+            0,
+            0,
+        )
+
+        # save the style
+        self._obj_.dwStyle = style & afxres.CBRS_ALL
+
+        cursor = win32api.LoadCursor(0, win32con.IDC_ARROW)
+        wndClass = win32ui.RegisterWndClass(
+            win32con.CS_DBLCLKS, cursor, self.brushBkgd.GetSafeHandle(), 0
+        )
+
+        self._obj_.CreateWindow(wndClass, title, style, (0, 0, 0, 0), parent, id)
+
+        # Create the child dialog
+        self.dialog = childCreator(*(self,) + childCreatorArgs)
+
+        # use the dialog dimensions as default base dimensions
+        assert self.dialog.IsWindow(), (
+            "The childCreator function %s did not create a window!" % childCreator
+        )
+        rect = self.dialog.GetWindowRect()
+        self.sizeHorz = self.sizeVert = self.sizeFloat = (
+            rect[2] - rect[0],
+            rect[3] - rect[1],
+        )
+
+        self.sizeHorz = self.sizeHorz[0], self.sizeHorz[1] + self.cxEdge + self.cxBorder
+        self.sizeVert = self.sizeVert[0] + self.cxEdge + self.cxBorder, self.sizeVert[1]
+        self.HookMessages()
+
+    def CalcFixedLayout(self, bStretch, bHorz):
+        rectTop = self.dockSite.GetControlBar(
+            afxres.AFX_IDW_DOCKBAR_TOP
+        ).GetWindowRect()
+        rectLeft = self.dockSite.GetControlBar(
+            afxres.AFX_IDW_DOCKBAR_LEFT
+        ).GetWindowRect()
+        if bStretch:
+            nHorzDockBarWidth = 32767
+            nVertDockBarHeight = 32767
+        else:
+            nHorzDockBarWidth = rectTop[2] - rectTop[0] + 4
+            nVertDockBarHeight = rectLeft[3] - rectLeft[1] + 4
+
+        if self.IsFloating():
+            return self.sizeFloat
+        if bHorz:
+            return nHorzDockBarWidth, self.sizeHorz[1]
+        return self.sizeVert[0], nVertDockBarHeight
+
+    def CalcDynamicLayout(self, length, mode):
+        # Support for diagonal sizing.
+        if self.IsFloating():
+            self.GetParent().GetParent().ModifyStyle(win32ui.MFS_4THICKFRAME, 0)
+        if mode & (win32ui.LM_HORZDOCK | win32ui.LM_VERTDOCK):
+            flags = (
+                win32con.SWP_NOSIZE
+                | win32con.SWP_NOMOVE
+                | win32con.SWP_NOZORDER
+                | win32con.SWP_NOACTIVATE
+                | win32con.SWP_FRAMECHANGED
+            )
+            self.SetWindowPos(
+                0,
+                (
+                    0,
+                    0,
+                    0,
+                    0,
+                ),
+                flags,
+            )
+            self.dockSite.RecalcLayout()
+            return self._obj_.CalcDynamicLayout(length, mode)
+
+        if mode & win32ui.LM_MRUWIDTH:
+            return self.sizeFloat
+        if mode & win32ui.LM_COMMIT:
+            self.sizeFloat = length, self.sizeFloat[1]
+            return self.sizeFloat
+        # More diagonal sizing.
+        if self.IsFloating():
+            dc = self.dockContext
+            pt = win32api.GetCursorPos()
+            windowRect = self.GetParent().GetParent().GetWindowRect()
+
+            hittest = dc.nHitTest
+            if hittest == win32con.HTTOPLEFT:
+                cx = max(windowRect[2] - pt[0], self.cMinWidth) - self.cxBorder
+                cy = max(windowRect[3] - self.cCaptionSize - pt[1], self.cMinHeight) - 1
+                self.sizeFloat = cx, cy
+
+                top = (
+                    min(pt[1], windowRect[3] - self.cCaptionSize - self.cMinHeight)
+                    - self.cyBorder
+                )
+                left = min(pt[0], windowRect[2] - self.cMinWidth) - 1
+                dc.rectFrameDragHorz = (
+                    left,
+                    top,
+                    dc.rectFrameDragHorz[2],
+                    dc.rectFrameDragHorz[3],
+                )
+                return self.sizeFloat
+            if hittest == win32con.HTTOPRIGHT:
+                cx = max(pt[0] - windowRect[0], self.cMinWidth)
+                cy = max(windowRect[3] - self.cCaptionSize - pt[1], self.cMinHeight) - 1
+                self.sizeFloat = cx, cy
+
+                top = (
+                    min(pt[1], windowRect[3] - self.cCaptionSize - self.cMinHeight)
+                    - self.cyBorder
+                )
+                dc.rectFrameDragHorz = (
+                    dc.rectFrameDragHorz[0],
+                    top,
+                    dc.rectFrameDragHorz[2],
+                    dc.rectFrameDragHorz[3],
+                )
+                return self.sizeFloat
+
+            if hittest == win32con.HTBOTTOMLEFT:
+                cx = max(windowRect[2] - pt[0], self.cMinWidth) - self.cxBorder
+                cy = max(pt[1] - windowRect[1] - self.cCaptionSize, self.cMinHeight)
+                self.sizeFloat = cx, cy
+
+                left = min(pt[0], windowRect[2] - self.cMinWidth) - 1
+                dc.rectFrameDragHorz = (
+                    left,
+                    dc.rectFrameDragHorz[1],
+                    dc.rectFrameDragHorz[2],
+                    dc.rectFrameDragHorz[3],
+                )
+                return self.sizeFloat
+
+            if hittest == win32con.HTBOTTOMRIGHT:
+                cx = max(pt[0] - windowRect[0], self.cMinWidth)
+                cy = max(pt[1] - windowRect[1] - self.cCaptionSize, self.cMinHeight)
+                self.sizeFloat = cx, cy
+                return self.sizeFloat
+
+        if mode & win32ui.LM_LENGTHY:
+            self.sizeFloat = self.sizeFloat[0], max(self.sizeMin[1], length)
+            return self.sizeFloat
+        else:
+            return max(self.sizeMin[0], length), self.sizeFloat[1]
+
+    def OnWindowPosChanged(self, msg):
+        if self.GetSafeHwnd() == 0 or self.dialog is None:
+            return 0
+        lparam = msg[3]
+        """ LPARAM used with WM_WINDOWPOSCHANGED:
+			typedef struct {
+				HWND hwnd;
+				HWND hwndInsertAfter;
+				int x;
+				int y;
+				int cx;
+				int cy;
+				UINT flags;} WINDOWPOS;
+		"""
+        format = "PPiiiii"
+        bytes = win32ui.GetBytes(lparam, struct.calcsize(format))
+        hwnd, hwndAfter, x, y, cx, cy, flags = struct.unpack(format, bytes)
+
+        if self.bInRecalcNC:
+            rc = self.GetClientRect()
+            self.dialog.MoveWindow(rc)
+            return 0
+        # Find on which side are we docked
+        nDockBarID = self.GetParent().GetDlgCtrlID()
+        # Return if dropped at same location
+        # no docking side change and no size change
+        if (
+            (nDockBarID == self.nDockBarID)
+            and (flags & win32con.SWP_NOSIZE)
+            and (
+                (self._obj_.dwStyle & afxres.CBRS_BORDER_ANY) != afxres.CBRS_BORDER_ANY
+            )
+        ):
+            return
+        self.nDockBarID = nDockBarID
+
+        # Force recalc the non-client area
+        self.bInRecalcNC = 1
+        try:
+            swpflags = (
+                win32con.SWP_NOSIZE
+                | win32con.SWP_NOMOVE
+                | win32con.SWP_NOZORDER
+                | win32con.SWP_FRAMECHANGED
+            )
+            self.SetWindowPos(0, (0, 0, 0, 0), swpflags)
+        finally:
+            self.bInRecalcNC = 0
+        return 0
+
+    # This is a virtual and not a message hook.
+    def OnSetCursor(self, window, nHitTest, wMouseMsg):
+        if nHitTest != win32con.HTSIZE or self.bTracking:
+            return self._obj_.OnSetCursor(window, nHitTest, wMouseMsg)
+
+        if self.IsHorz():
+            win32api.SetCursor(win32api.LoadCursor(0, win32con.IDC_SIZENS))
+        else:
+            win32api.SetCursor(win32api.LoadCursor(0, win32con.IDC_SIZEWE))
+        return 1
+
+    # Mouse Handling
+    def OnLButtonUp(self, msg):
+        if not self.bTracking:
+            return 1  # pass it on.
+        self.StopTracking(1)
+        return 0  # Dont pass on
+
+    def OnLButtonDown(self, msg):
+        # UINT nFlags, CPoint point)
+        # only start dragging if clicked in "void" space
+        if self.dockBar is not None:
+            # start the drag
+            pt = msg[5]
+            pt = self.ClientToScreen(pt)
+            self.dockContext.StartDrag(pt)
+            return 0
+        return 1
+
+    def OnNcLButtonDown(self, msg):
+        if self.bTracking:
+            return 0
+        nHitTest = wparam = msg[2]
+        pt = msg[5]
+
+        if nHitTest == win32con.HTSYSMENU and not self.IsFloating():
+            self.GetDockingFrame().ShowControlBar(self, 0, 0)
+        elif nHitTest == win32con.HTMINBUTTON and not self.IsFloating():
+            self.dockContext.ToggleDocking()
+        elif (
+            nHitTest == win32con.HTCAPTION
+            and not self.IsFloating()
+            and self.dockBar is not None
+        ):
+            self.dockContext.StartDrag(pt)
+        elif nHitTest == win32con.HTSIZE and not self.IsFloating():
+            self.StartTracking()
+        else:
+            return 1
+        return 0
+
+    def OnLButtonDblClk(self, msg):
+        # only toggle docking if clicked in "void" space
+        if self.dockBar is not None:
+            # toggle docking
+            self.dockContext.ToggleDocking()
+            return 0
+        return 1
+
+    def OnNcLButtonDblClk(self, msg):
+        nHitTest = wparam = msg[2]
+        # UINT nHitTest, CPoint point)
+        if self.dockBar is not None and nHitTest == win32con.HTCAPTION:
+            # toggle docking
+            self.dockContext.ToggleDocking()
+            return 0
+        return 1
+
+    def OnMouseMove(self, msg):
+        flags = wparam = msg[2]
+        lparam = msg[3]
+        if self.IsFloating() or not self.bTracking:
+            return 1
+
+        # Convert unsigned 16 bit to signed 32 bit.
+        x = win32api.LOWORD(lparam)
+        if x & 32768:
+            x = x | -65536
+        y = win32api.HIWORD(lparam)
+        if y & 32768:
+            y = y | -65536
+        pt = x, y
+        cpt = CenterPoint(self.rectTracker)
+        pt = self.ClientToWnd(pt)
+        if self.IsHorz():
+            if cpt[1] != pt[1]:
+                self.OnInvertTracker(self.rectTracker)
+                self.rectTracker = OffsetRect(self.rectTracker, (0, pt[1] - cpt[1]))
+                self.OnInvertTracker(self.rectTracker)
+        else:
+            if cpt[0] != pt[0]:
+                self.OnInvertTracker(self.rectTracker)
+                self.rectTracker = OffsetRect(self.rectTracker, (pt[0] - cpt[0], 0))
+                self.OnInvertTracker(self.rectTracker)
+
+        return 0  # Dont pass it on.
+
+    # 	def OnBarStyleChange(self, old, new):
+
+    def OnNcCalcSize(self, bCalcValid, size_info):
+        (rc0, rc1, rc2, pos) = size_info
+        self.rectBorder = self.GetWindowRect()
+        self.rectBorder = OffsetRect(
+            self.rectBorder, (-self.rectBorder[0], -self.rectBorder[1])
+        )
+
+        dwBorderStyle = self._obj_.dwStyle | afxres.CBRS_BORDER_ANY
+
+        if self.nDockBarID == afxres.AFX_IDW_DOCKBAR_TOP:
+            dwBorderStyle = dwBorderStyle & ~afxres.CBRS_BORDER_BOTTOM
+            rc0.left = rc0.left + self.cxGripper
+            rc0.bottom = rc0.bottom - self.cxEdge
+            rc0.top = rc0.top + self.cxBorder
+            rc0.right = rc0.right - self.cxBorder
+            self.rectBorder = (
+                self.rectBorder[0],
+                self.rectBorder[3] - self.cxEdge,
+                self.rectBorder[2],
+                self.rectBorder[3],
+            )
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_BOTTOM:
+            dwBorderStyle = dwBorderStyle & ~afxres.CBRS_BORDER_TOP
+            rc0.left = rc0.left + self.cxGripper
+            rc0.top = rc0.top + self.cxEdge
+            rc0.bottom = rc0.bottom - self.cxBorder
+            rc0.right = rc0.right - self.cxBorder
+            self.rectBorder = (
+                self.rectBorder[0],
+                self.rectBorder[1],
+                self.rectBorder[2],
+                self.rectBorder[1] + self.cxEdge,
+            )
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_LEFT:
+            dwBorderStyle = dwBorderStyle & ~afxres.CBRS_BORDER_RIGHT
+            rc0.right = rc0.right - self.cxEdge
+            rc0.left = rc0.left + self.cxBorder
+            rc0.bottom = rc0.bottom - self.cxBorder
+            rc0.top = rc0.top + self.cxGripper
+            self.rectBorder = (
+                self.rectBorder[2] - self.cxEdge,
+                self.rectBorder[1],
+                self.rectBorder[2],
+                self.rectBorder[3],
+            )
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_RIGHT:
+            dwBorderStyle = dwBorderStyle & ~afxres.CBRS_BORDER_LEFT
+            rc0.left = rc0.left + self.cxEdge
+            rc0.right = rc0.right - self.cxBorder
+            rc0.bottom = rc0.bottom - self.cxBorder
+            rc0.top = rc0.top + self.cxGripper
+            self.rectBorder = (
+                self.rectBorder[0],
+                self.rectBorder[1],
+                self.rectBorder[0] + self.cxEdge,
+                self.rectBorder[3],
+            )
+        else:
+            self.rectBorder = 0, 0, 0, 0
+
+        self.SetBarStyle(dwBorderStyle)
+        return 0
+
+    def OnNcPaint(self, msg):
+        self.EraseNonClient()
+        dc = self.GetWindowDC()
+        ctl = win32api.GetSysColor(win32con.COLOR_BTNHIGHLIGHT)
+        cbr = win32api.GetSysColor(win32con.COLOR_BTNSHADOW)
+        dc.Draw3dRect(self.rectBorder, ctl, cbr)
+
+        self.DrawGripper(dc)
+
+        rect = self.GetClientRect()
+        self.InvalidateRect(rect, 1)
+        return 0
+
+    def OnNcHitTest(self, pt):  # A virtual, not a hooked message.
+        if self.IsFloating():
+            return 1
+
+        ptOrig = pt
+        rect = self.GetWindowRect()
+        pt = pt[0] - rect[0], pt[1] - rect[1]
+
+        if PtInRect(self.rectClose, pt):
+            return win32con.HTSYSMENU
+        elif PtInRect(self.rectUndock, pt):
+            return win32con.HTMINBUTTON
+        elif PtInRect(self.rectGripper, pt):
+            return win32con.HTCAPTION
+        elif PtInRect(self.rectBorder, pt):
+            return win32con.HTSIZE
+        else:
+            return self._obj_.OnNcHitTest(ptOrig)
+
+    def StartTracking(self):
+        self.SetCapture()
+
+        # make sure no updates are pending
+        self.RedrawWindow(None, None, win32con.RDW_ALLCHILDREN | win32con.RDW_UPDATENOW)
+        self.dockSite.LockWindowUpdate()
+
+        self.ptOld = CenterPoint(self.rectBorder)
+        self.bTracking = 1
+
+        self.rectTracker = self.rectBorder
+        if not self.IsHorz():
+            l, t, r, b = self.rectTracker
+            b = b - 4
+            self.rectTracker = l, t, r, b
+
+        self.OnInvertTracker(self.rectTracker)
+
+    def OnCaptureChanged(self, msg):
+        hwnd = lparam = msg[3]
+        if self.bTracking and hwnd != self.GetSafeHwnd():
+            self.StopTracking(0)  # cancel tracking
+        return 1
+
+    def StopTracking(self, bAccept):
+        self.OnInvertTracker(self.rectTracker)
+        self.dockSite.UnlockWindowUpdate()
+        self.bTracking = 0
+        self.ReleaseCapture()
+        if not bAccept:
+            return
+
+        rcc = self.dockSite.GetWindowRect()
+        if self.IsHorz():
+            newsize = self.sizeHorz[1]
+            maxsize = newsize + (rcc[3] - rcc[1])
+            minsize = self.sizeMin[1]
+        else:
+            newsize = self.sizeVert[0]
+            maxsize = newsize + (rcc[2] - rcc[0])
+            minsize = self.sizeMin[0]
+
+        pt = CenterPoint(self.rectTracker)
+        if self.nDockBarID == afxres.AFX_IDW_DOCKBAR_TOP:
+            newsize = newsize + (pt[1] - self.ptOld[1])
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_BOTTOM:
+            newsize = newsize + (-pt[1] + self.ptOld[1])
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_LEFT:
+            newsize = newsize + (pt[0] - self.ptOld[0])
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_RIGHT:
+            newsize = newsize + (-pt[0] + self.ptOld[0])
+        newsize = max(minsize, min(maxsize, newsize))
+        if self.IsHorz():
+            self.sizeHorz = self.sizeHorz[0], newsize
+        else:
+            self.sizeVert = newsize, self.sizeVert[1]
+        self.dockSite.RecalcLayout()
+        return 0
+
+    def OnInvertTracker(self, rect):
+        assert rect[2] - rect[0] > 0 and rect[3] - rect[1] > 0, "rect is empty"
+        assert self.bTracking
+        rcc = self.GetWindowRect()
+        rcf = self.dockSite.GetWindowRect()
+
+        rect = OffsetRect(rect, (rcc[0] - rcf[0], rcc[1] - rcf[1]))
+        rect = DeflateRect(rect, (1, 1))
+
+        flags = win32con.DCX_WINDOW | win32con.DCX_CACHE | win32con.DCX_LOCKWINDOWUPDATE
+        dc = self.dockSite.GetDCEx(None, flags)
+        try:
+            brush = win32ui.GetHalftoneBrush()
+            oldBrush = dc.SelectObject(brush)
+
+            dc.PatBlt(
+                (rect[0], rect[1]),
+                (rect[2] - rect[0], rect[3] - rect[1]),
+                win32con.PATINVERT,
+            )
+            dc.SelectObject(oldBrush)
+        finally:
+            self.dockSite.ReleaseDC(dc)
+
+    def IsHorz(self):
+        return (
+            self.nDockBarID == afxres.AFX_IDW_DOCKBAR_TOP
+            or self.nDockBarID == afxres.AFX_IDW_DOCKBAR_BOTTOM
+        )
+
+    def ClientToWnd(self, pt):
+        x, y = pt
+        if self.nDockBarID == afxres.AFX_IDW_DOCKBAR_BOTTOM:
+            y = y + self.cxEdge
+        elif self.nDockBarID == afxres.AFX_IDW_DOCKBAR_RIGHT:
+            x = x + self.cxEdge
+        return x, y
+
+    def DrawGripper(self, dc):
+        # no gripper if floating
+        if self._obj_.dwStyle & afxres.CBRS_FLOATING:
+            return
+
+        # -==HACK==-
+        # in order to calculate the client area properly after docking,
+        # the client area must be recalculated twice (I have no idea why)
+        self.dockSite.RecalcLayout()
+        # -==END HACK==-
+
+        gripper = self.GetWindowRect()
+        gripper = self.ScreenToClient(gripper)
+        gripper = OffsetRect(gripper, (-gripper[0], -gripper[1]))
+        gl, gt, gr, gb = gripper
+
+        if self._obj_.dwStyle & afxres.CBRS_ORIENT_HORZ:
+            # gripper at left
+            self.rectGripper = gl, gt + 40, gl + 20, gb
+            # draw close box
+            self.rectClose = gl + 7, gt + 10, gl + 19, gt + 22
+            dc.DrawFrameControl(
+                self.rectClose, win32con.DFC_CAPTION, win32con.DFCS_CAPTIONCLOSE
+            )
+            # draw docking toggle box
+            self.rectUndock = OffsetRect(self.rectClose, (0, 13))
+            dc.DrawFrameControl(
+                self.rectUndock, win32con.DFC_CAPTION, win32con.DFCS_CAPTIONMAX
+            )
+
+            gt = gt + 38
+            gb = gb - 10
+            gl = gl + 10
+            gr = gl + 3
+            gripper = gl, gt, gr, gb
+            dc.Draw3dRect(gripper, clrBtnHilight, clrBtnShadow)
+            dc.Draw3dRect(OffsetRect(gripper, (4, 0)), clrBtnHilight, clrBtnShadow)
+        else:
+            # gripper at top
+            self.rectGripper = gl, gt, gr - 40, gt + 20
+            # draw close box
+            self.rectClose = gr - 21, gt + 7, gr - 10, gt + 18
+            dc.DrawFrameControl(
+                self.rectClose, win32con.DFC_CAPTION, win32con.DFCS_CAPTIONCLOSE
+            )
+            #  draw docking toggle box
+            self.rectUndock = OffsetRect(self.rectClose, (-13, 0))
+            dc.DrawFrameControl(
+                self.rectUndock, win32con.DFC_CAPTION, win32con.DFCS_CAPTIONMAX
+            )
+            gr = gr - 38
+            gl = gl + 10
+            gt = gt + 10
+            gb = gt + 3
+
+            gripper = gl, gt, gr, gb
+            dc.Draw3dRect(gripper, clrBtnHilight, clrBtnShadow)
+            dc.Draw3dRect(OffsetRect(gripper, (0, 4)), clrBtnHilight, clrBtnShadow)
+
+    def HookMessages(self):
+        self.HookMessage(self.OnLButtonUp, win32con.WM_LBUTTONUP)
+        self.HookMessage(self.OnLButtonDown, win32con.WM_LBUTTONDOWN)
+        self.HookMessage(self.OnLButtonDblClk, win32con.WM_LBUTTONDBLCLK)
+        self.HookMessage(self.OnNcLButtonDown, win32con.WM_NCLBUTTONDOWN)
+        self.HookMessage(self.OnNcLButtonDblClk, win32con.WM_NCLBUTTONDBLCLK)
+        self.HookMessage(self.OnMouseMove, win32con.WM_MOUSEMOVE)
+        self.HookMessage(self.OnNcPaint, win32con.WM_NCPAINT)
+        self.HookMessage(self.OnCaptureChanged, win32con.WM_CAPTURECHANGED)
+        self.HookMessage(self.OnWindowPosChanged, win32con.WM_WINDOWPOSCHANGED)
+
+
+# 		self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+
+def EditCreator(parent):
+    d = win32ui.CreateEdit()
+    es = (
+        win32con.WS_CHILD
+        | win32con.WS_VISIBLE
+        | win32con.WS_BORDER
+        | win32con.ES_MULTILINE
+        | win32con.ES_WANTRETURN
+    )
+    d.CreateWindow(es, (0, 0, 150, 150), parent, 1000)
+    return d
+
+
+def test():
+    import pywin.mfc.dialog
+
+    global bar
+    bar = DockingBar()
+    creator = EditCreator
+    bar.CreateWindow(win32ui.GetMainFrame(), creator, "Coolbar Demo", 0xFFFFF)
+    # 	win32ui.GetMainFrame().ShowControlBar(bar, 1, 0)
+    bar.SetBarStyle(
+        bar.GetBarStyle()
+        | afxres.CBRS_TOOLTIPS
+        | afxres.CBRS_FLYBY
+        | afxres.CBRS_SIZE_DYNAMIC
+    )
+    bar.EnableDocking(afxres.CBRS_ALIGN_ANY)
+    win32ui.GetMainFrame().DockControlBar(bar, afxres.AFX_IDW_DOCKBAR_BOTTOM)
+
+
+if __name__ == "__main__":
+    test()

.venv/Lib/site-packages/pythonwin/pywin/framework/app.py

@@ -0,0 +1,454 @@
+# App.py
+# Application stuff.
+# The application is responsible for managing the main frame window.
+#
+# We also grab the FileOpen command, to invoke our Python editor
+" The PythonWin application code. Manages most aspects of MDI, etc "
+import win32con
+import win32api
+import win32ui
+import sys
+import string
+import os
+from pywin.mfc import window, dialog, afxres
+from pywin.mfc.thread import WinApp
+import traceback
+import regutil
+
+from . import scriptutils
+
+## NOTE: App and AppBuild should NOT be used - instead, you should contruct your
+## APP class manually whenever you like (just ensure you leave these 2 params None!)
+## Whoever wants the generic "Application" should get it via win32iu.GetApp()
+
+# These are "legacy"
+AppBuilder = None
+App = None  # default - if used, must end up a CApp derived class.
+
+# Helpers that should one day be removed!
+def AddIdleHandler(handler):
+    print(
+        "app.AddIdleHandler is deprecated - please use win32ui.GetApp().AddIdleHandler() instead."
+    )
+    return win32ui.GetApp().AddIdleHandler(handler)
+
+
+def DeleteIdleHandler(handler):
+    print(
+        "app.DeleteIdleHandler is deprecated - please use win32ui.GetApp().DeleteIdleHandler() instead."
+    )
+    return win32ui.GetApp().DeleteIdleHandler(handler)
+
+
+# Helper for writing a Window position by name, and later loading it.
+def SaveWindowSize(section, rect, state=""):
+    """Writes a rectangle to an INI file
+    Args: section = section name in the applications INI file
+          rect = a rectangle in a (cy, cx, y, x) tuple
+                 (same format as CREATESTRUCT position tuples)."""
+    left, top, right, bottom = rect
+    if state:
+        state = state + " "
+    win32ui.WriteProfileVal(section, state + "left", left)
+    win32ui.WriteProfileVal(section, state + "top", top)
+    win32ui.WriteProfileVal(section, state + "right", right)
+    win32ui.WriteProfileVal(section, state + "bottom", bottom)
+
+
+def LoadWindowSize(section, state=""):
+    """Loads a section from an INI file, and returns a rect in a tuple (see SaveWindowSize)"""
+    if state:
+        state = state + " "
+    left = win32ui.GetProfileVal(section, state + "left", 0)
+    top = win32ui.GetProfileVal(section, state + "top", 0)
+    right = win32ui.GetProfileVal(section, state + "right", 0)
+    bottom = win32ui.GetProfileVal(section, state + "bottom", 0)
+    return (left, top, right, bottom)
+
+
+def RectToCreateStructRect(rect):
+    return (rect[3] - rect[1], rect[2] - rect[0], rect[1], rect[0])
+
+
+# Define FrameWindow and Application objects
+#
+# The Main Frame of the application.
+class MainFrame(window.MDIFrameWnd):
+    sectionPos = "Main Window"
+    statusBarIndicators = (
+        afxres.ID_SEPARATOR,  # // status line indicator
+        afxres.ID_INDICATOR_CAPS,
+        afxres.ID_INDICATOR_NUM,
+        afxres.ID_INDICATOR_SCRL,
+        win32ui.ID_INDICATOR_LINENUM,
+        win32ui.ID_INDICATOR_COLNUM,
+    )
+
+    def OnCreate(self, cs):
+        self._CreateStatusBar()
+        return 0
+
+    def _CreateStatusBar(self):
+        self.statusBar = win32ui.CreateStatusBar(self)
+        self.statusBar.SetIndicators(self.statusBarIndicators)
+        self.HookCommandUpdate(self.OnUpdatePosIndicator, win32ui.ID_INDICATOR_LINENUM)
+        self.HookCommandUpdate(self.OnUpdatePosIndicator, win32ui.ID_INDICATOR_COLNUM)
+
+    def OnUpdatePosIndicator(self, cmdui):
+        editControl = scriptutils.GetActiveEditControl()
+        value = " " * 5
+        if editControl is not None:
+            try:
+                startChar, endChar = editControl.GetSel()
+                lineNo = editControl.LineFromChar(startChar)
+                colNo = endChar - editControl.LineIndex(lineNo)
+
+                if cmdui.m_nID == win32ui.ID_INDICATOR_LINENUM:
+                    value = "%0*d" % (5, lineNo + 1)
+                else:
+                    value = "%0*d" % (3, colNo + 1)
+            except win32ui.error:
+                pass
+        cmdui.SetText(value)
+        cmdui.Enable()
+
+    def PreCreateWindow(self, cc):
+        cc = self._obj_.PreCreateWindow(cc)
+        pos = LoadWindowSize(self.sectionPos)
+        self.startRect = pos
+        if pos[2] - pos[0]:
+            rect = RectToCreateStructRect(pos)
+            cc = cc[0], cc[1], cc[2], cc[3], rect, cc[5], cc[6], cc[7], cc[8]
+        return cc
+
+    def OnDestroy(self, msg):
+        # use GetWindowPlacement(), as it works even when min'd or max'd
+        rectNow = self.GetWindowPlacement()[4]
+        if rectNow != self.startRect:
+            SaveWindowSize(self.sectionPos, rectNow)
+        return 0
+
+
+class CApp(WinApp):
+    "A class for the application"
+
+    def __init__(self):
+        self.oldCallbackCaller = None
+        WinApp.__init__(self, win32ui.GetApp())
+        self.idleHandlers = []
+
+    def InitInstance(self):
+        "Called to crank up the app"
+        HookInput()
+        numMRU = win32ui.GetProfileVal("Settings", "Recent File List Size", 10)
+        win32ui.LoadStdProfileSettings(numMRU)
+        # 		self._obj_.InitMDIInstance()
+        if win32api.GetVersionEx()[0] < 4:
+            win32ui.SetDialogBkColor()
+            win32ui.Enable3dControls()
+
+        # install a "callback caller" - a manager for the callbacks
+        # 		self.oldCallbackCaller = win32ui.InstallCallbackCaller(self.CallbackManager)
+        self.LoadMainFrame()
+        self.SetApplicationPaths()
+
+    def ExitInstance(self):
+        "Called as the app dies - too late to prevent it here!"
+        win32ui.OutputDebug("Application shutdown\n")
+        # Restore the callback manager, if any.
+        try:
+            win32ui.InstallCallbackCaller(self.oldCallbackCaller)
+        except AttributeError:
+            pass
+        if self.oldCallbackCaller:
+            del self.oldCallbackCaller
+        self.frame = None  # clean Python references to the now destroyed window object.
+        self.idleHandlers = []
+        # Attempt cleanup if not already done!
+        if self._obj_:
+            self._obj_.AttachObject(None)
+        self._obj_ = None
+        global App
+        global AppBuilder
+        App = None
+        AppBuilder = None
+        return 0
+
+    def HaveIdleHandler(self, handler):
+        return handler in self.idleHandlers
+
+    def AddIdleHandler(self, handler):
+        self.idleHandlers.append(handler)
+
+    def DeleteIdleHandler(self, handler):
+        self.idleHandlers.remove(handler)
+
+    def OnIdle(self, count):
+        try:
+            ret = 0
+            handlers = self.idleHandlers[:]  # copy list, as may be modified during loop
+            for handler in handlers:
+                try:
+                    thisRet = handler(handler, count)
+                except:
+                    print("Idle handler %s failed" % (repr(handler)))
+                    traceback.print_exc()
+                    print("Idle handler removed from list")
+                    try:
+                        self.DeleteIdleHandler(handler)
+                    except ValueError:  # Item not in list.
+                        pass
+                    thisRet = 0
+                ret = ret or thisRet
+            return ret
+        except KeyboardInterrupt:
+            pass
+
+    def CreateMainFrame(self):
+        return MainFrame()
+
+    def LoadMainFrame(self):
+        "Create the main applications frame"
+        self.frame = self.CreateMainFrame()
+        self.SetMainFrame(self.frame)
+        self.frame.LoadFrame(win32ui.IDR_MAINFRAME, win32con.WS_OVERLAPPEDWINDOW)
+        self.frame.DragAcceptFiles()  # we can accept these.
+        self.frame.ShowWindow(win32ui.GetInitialStateRequest())
+        self.frame.UpdateWindow()
+        self.HookCommands()
+
+    def OnHelp(self, id, code):
+        try:
+            if id == win32ui.ID_HELP_GUI_REF:
+                helpFile = regutil.GetRegisteredHelpFile("Pythonwin Reference")
+                helpCmd = win32con.HELP_CONTENTS
+            else:
+                helpFile = regutil.GetRegisteredHelpFile("Main Python Documentation")
+                helpCmd = win32con.HELP_FINDER
+            if helpFile is None:
+                win32ui.MessageBox("The help file is not registered!")
+            else:
+                from . import help
+
+                help.OpenHelpFile(helpFile, helpCmd)
+        except:
+            t, v, tb = sys.exc_info()
+            win32ui.MessageBox(
+                "Internal error in help file processing\r\n%s: %s" % (t, v)
+            )
+            tb = None  # Prevent a cycle
+
+    def DoLoadModules(self, modules):
+        # XXX - this should go, but the debugger uses it :-(
+        # dont do much checking!
+        for module in modules:
+            __import__(module)
+
+    def HookCommands(self):
+        self.frame.HookMessage(self.OnDropFiles, win32con.WM_DROPFILES)
+        self.HookCommand(self.HandleOnFileOpen, win32ui.ID_FILE_OPEN)
+        self.HookCommand(self.HandleOnFileNew, win32ui.ID_FILE_NEW)
+        self.HookCommand(self.OnFileMRU, win32ui.ID_FILE_MRU_FILE1)
+        self.HookCommand(self.OnHelpAbout, win32ui.ID_APP_ABOUT)
+        self.HookCommand(self.OnHelp, win32ui.ID_HELP_PYTHON)
+        self.HookCommand(self.OnHelp, win32ui.ID_HELP_GUI_REF)
+        # Hook for the right-click menu.
+        self.frame.GetWindow(win32con.GW_CHILD).HookMessage(
+            self.OnRClick, win32con.WM_RBUTTONDOWN
+        )
+
+    def SetApplicationPaths(self):
+        # Load the users/application paths
+        new_path = []
+        apppath = win32ui.GetProfileVal("Python", "Application Path", "").split(";")
+        for path in apppath:
+            if len(path) > 0:
+                new_path.append(win32ui.FullPath(path))
+        for extra_num in range(1, 11):
+            apppath = win32ui.GetProfileVal(
+                "Python", "Application Path %d" % extra_num, ""
+            ).split(";")
+            if len(apppath) == 0:
+                break
+            for path in apppath:
+                if len(path) > 0:
+                    new_path.append(win32ui.FullPath(path))
+        sys.path = new_path + sys.path
+
+    def OnRClick(self, params):
+        "Handle right click message"
+        # put up the entire FILE menu!
+        menu = win32ui.LoadMenu(win32ui.IDR_TEXTTYPE).GetSubMenu(0)
+        menu.TrackPopupMenu(params[5])  # track at mouse position.
+        return 0
+
+    def OnDropFiles(self, msg):
+        "Handle a file being dropped from file manager"
+        hDropInfo = msg[2]
+        self.frame.SetActiveWindow()  # active us
+        nFiles = win32api.DragQueryFile(hDropInfo)
+        try:
+            for iFile in range(0, nFiles):
+                fileName = win32api.DragQueryFile(hDropInfo, iFile)
+                win32ui.GetApp().OpenDocumentFile(fileName)
+        finally:
+            win32api.DragFinish(hDropInfo)
+
+        return 0
+
+    # No longer used by Pythonwin, as the C++ code has this same basic functionality
+    # but handles errors slightly better.
+    # It all still works, tho, so if you need similar functionality, you can use it.
+    # Therefore I havent deleted this code completely!
+    # 	def CallbackManager( self, ob, args = () ):
+    # 		"""Manage win32 callbacks.  Trap exceptions, report on them, then return 'All OK'
+    # 		to the frame-work. """
+    # 		import traceback
+    # 		try:
+    # 			ret = apply(ob, args)
+    # 			return ret
+    # 		except:
+    # 			# take copies of the exception values, else other (handled) exceptions may get
+    # 			# copied over by the other fns called.
+    # 			win32ui.SetStatusText('An exception occured in a windows command handler.')
+    # 			t, v, tb = sys.exc_info()
+    # 			traceback.print_exception(t, v, tb.tb_next)
+    # 			try:
+    # 				sys.stdout.flush()
+    # 			except (NameError, AttributeError):
+    # 				pass
+
+    # Command handlers.
+    def OnFileMRU(self, id, code):
+        "Called when a File 1-n message is recieved"
+        fileName = win32ui.GetRecentFileList()[id - win32ui.ID_FILE_MRU_FILE1]
+        win32ui.GetApp().OpenDocumentFile(fileName)
+
+    def HandleOnFileOpen(self, id, code):
+        "Called when FileOpen message is received"
+        win32ui.GetApp().OnFileOpen()
+
+    def HandleOnFileNew(self, id, code):
+        "Called when FileNew message is received"
+        win32ui.GetApp().OnFileNew()
+
+    def OnHelpAbout(self, id, code):
+        "Called when HelpAbout message is received.  Displays the About dialog."
+        win32ui.InitRichEdit()
+        dlg = AboutBox()
+        dlg.DoModal()
+
+
+def _GetRegistryValue(key, val, default=None):
+    # val is registry value - None for default val.
+    try:
+        hkey = win32api.RegOpenKey(win32con.HKEY_CURRENT_USER, key)
+        return win32api.RegQueryValueEx(hkey, val)[0]
+    except win32api.error:
+        try:
+            hkey = win32api.RegOpenKey(win32con.HKEY_LOCAL_MACHINE, key)
+            return win32api.RegQueryValueEx(hkey, val)[0]
+        except win32api.error:
+            return default
+
+
+scintilla = "Scintilla is Copyright 1998-2008 Neil Hodgson (http://www.scintilla.org)"
+idle = "This program uses IDLE extensions by Guido van Rossum, Tim Peters and others."
+contributors = "Thanks to the following people for making significant contributions: Roger Upole, Sidnei da Silva, Sam Rushing, Curt Hagenlocher, Dave Brennan, Roger Burnham, Gordon McMillan, Neil Hodgson, Laramie Leavitt. (let me know if I have forgotten you!)"
+# The About Box
+class AboutBox(dialog.Dialog):
+    def __init__(self, idd=win32ui.IDD_ABOUTBOX):
+        dialog.Dialog.__init__(self, idd)
+
+    def OnInitDialog(self):
+        text = (
+            "Pythonwin - Python IDE and GUI Framework for Windows.\n\n%s\n\nPython is %s\n\n%s\n\n%s\n\n%s"
+            % (win32ui.copyright, sys.copyright, scintilla, idle, contributors)
+        )
+        self.SetDlgItemText(win32ui.IDC_EDIT1, text)
+        # Get the build number - written by installers.
+        # For distutils build, read pywin32.version.txt
+        import sysconfig
+
+        site_packages = sysconfig.get_paths()["platlib"]
+        try:
+            build_no = (
+                open(os.path.join(site_packages, "pywin32.version.txt")).read().strip()
+            )
+            ver = "pywin32 build %s" % build_no
+        except EnvironmentError:
+            ver = None
+        if ver is None:
+            # See if we are Part of Active Python
+            ver = _GetRegistryValue(
+                "SOFTWARE\\ActiveState\\ActivePython", "CurrentVersion"
+            )
+            if ver is not None:
+                ver = "ActivePython build %s" % (ver,)
+        if ver is None:
+            ver = ""
+        self.SetDlgItemText(win32ui.IDC_ABOUT_VERSION, ver)
+        self.HookCommand(self.OnButHomePage, win32ui.IDC_BUTTON1)
+
+    def OnButHomePage(self, id, code):
+        if code == win32con.BN_CLICKED:
+            win32api.ShellExecute(
+                0, "open", "https://github.com/mhammond/pywin32", None, "", 1
+            )
+
+
+def Win32RawInput(prompt=None):
+    "Provide raw_input() for gui apps"
+    # flush stderr/out first.
+    try:
+        sys.stdout.flush()
+        sys.stderr.flush()
+    except:
+        pass
+    if prompt is None:
+        prompt = ""
+    ret = dialog.GetSimpleInput(prompt)
+    if ret == None:
+        raise KeyboardInterrupt("operation cancelled")
+    return ret
+
+
+def Win32Input(prompt=None):
+    "Provide input() for gui apps"
+    return eval(input(prompt))
+
+
+def HookInput():
+    try:
+        raw_input
+        # must be py2x...
+        sys.modules["__builtin__"].raw_input = Win32RawInput
+        sys.modules["__builtin__"].input = Win32Input
+    except NameError:
+        # must be py3k
+        import code
+
+        sys.modules["builtins"].input = Win32RawInput
+
+
+def HaveGoodGUI():
+    """Returns true if we currently have a good gui available."""
+    return "pywin.framework.startup" in sys.modules
+
+
+def CreateDefaultGUI(appClass=None):
+    """Creates a default GUI environment"""
+    if appClass is None:
+        from . import intpyapp  # Bring in the default app - could be param'd later.
+
+        appClass = intpyapp.InteractivePythonApp
+    # Create and init the app.
+    appClass().InitInstance()
+
+
+def CheckCreateDefaultGUI():
+    """Checks and creates if necessary a default GUI environment."""
+    rc = HaveGoodGUI()
+    if not rc:
+        CreateDefaultGUI()
+    return rc

.venv/Lib/site-packages/pythonwin/pywin/framework/bitmap.py

@@ -0,0 +1,165 @@
+import win32ui
+import win32con
+import win32api
+import string
+import os
+from . import app
+import sys
+
+from pywin.mfc import docview, window
+
+bStretch = 1
+
+
+class BitmapDocument(docview.Document):
+    "A bitmap document.  Holds the bitmap data itself."
+
+    def __init__(self, template):
+        docview.Document.__init__(self, template)
+        self.bitmap = None
+
+    def OnNewDocument(self):
+        # I can not create new bitmaps.
+        win32ui.MessageBox("Bitmaps can not be created.")
+
+    def OnOpenDocument(self, filename):
+        self.bitmap = win32ui.CreateBitmap()
+        # init data members
+        f = open(filename, "rb")
+        try:
+            try:
+                self.bitmap.LoadBitmapFile(f)
+            except IOError:
+                win32ui.MessageBox("Could not load the bitmap from %s" % filename)
+                return 0
+        finally:
+            f.close()
+        self.size = self.bitmap.GetSize()
+        return 1
+
+    def DeleteContents(self):
+        self.bitmap = None
+
+
+class BitmapView(docview.ScrollView):
+    "A view of a bitmap.  Obtains data from document."
+
+    def __init__(self, doc):
+        docview.ScrollView.__init__(self, doc)
+        self.width = self.height = 0
+        # set up message handlers
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+
+    def OnInitialUpdate(self):
+        doc = self.GetDocument()
+        if doc.bitmap:
+            bitmapSize = doc.bitmap.GetSize()
+            self.SetScrollSizes(win32con.MM_TEXT, bitmapSize)
+
+    def OnSize(self, params):
+        lParam = params[3]
+        self.width = win32api.LOWORD(lParam)
+        self.height = win32api.HIWORD(lParam)
+
+    def OnDraw(self, dc):
+        # set sizes used for "non stretch" mode.
+        doc = self.GetDocument()
+        if doc.bitmap is None:
+            return
+        bitmapSize = doc.bitmap.GetSize()
+        if bStretch:
+            # stretch BMP.
+            viewRect = (0, 0, self.width, self.height)
+            bitmapRect = (0, 0, bitmapSize[0], bitmapSize[1])
+            doc.bitmap.Paint(dc, viewRect, bitmapRect)
+        else:
+            # non stretch.
+            doc.bitmap.Paint(dc)
+
+
+class BitmapFrame(window.MDIChildWnd):
+    def OnCreateClient(self, createparams, context):
+        borderX = win32api.GetSystemMetrics(win32con.SM_CXFRAME)
+        borderY = win32api.GetSystemMetrics(win32con.SM_CYFRAME)
+        titleY = win32api.GetSystemMetrics(win32con.SM_CYCAPTION)  # includes border
+        # try and maintain default window pos, else adjust if cant fit
+        # get the main client window dimensions.
+        mdiClient = win32ui.GetMainFrame().GetWindow(win32con.GW_CHILD)
+        clientWindowRect = mdiClient.ScreenToClient(mdiClient.GetWindowRect())
+        clientWindowSize = (
+            clientWindowRect[2] - clientWindowRect[0],
+            clientWindowRect[3] - clientWindowRect[1],
+        )
+        left, top, right, bottom = mdiClient.ScreenToClient(self.GetWindowRect())
+        # 		width, height=context.doc.size[0], context.doc.size[1]
+        # 		width = width+borderX*2
+        # 		height= height+titleY+borderY*2-1
+        # 		if (left+width)>clientWindowSize[0]:
+        # 			left = clientWindowSize[0] - width
+        # 		if left<0:
+        # 			left = 0
+        # 			width = clientWindowSize[0]
+        # 		if (top+height)>clientWindowSize[1]:
+        # 			top = clientWindowSize[1] - height
+        # 		if top<0:
+        # 			top = 0
+        # 			height = clientWindowSize[1]
+        # 		self.frame.MoveWindow((left, top, left+width, top+height),0)
+        window.MDIChildWnd.OnCreateClient(self, createparams, context)
+        return 1
+
+
+class BitmapTemplate(docview.DocTemplate):
+    def __init__(self):
+        docview.DocTemplate.__init__(
+            self, win32ui.IDR_PYTHONTYPE, BitmapDocument, BitmapFrame, BitmapView
+        )
+
+    def MatchDocType(self, fileName, fileType):
+        doc = self.FindOpenDocument(fileName)
+        if doc:
+            return doc
+        ext = os.path.splitext(fileName)[1].lower()
+        if ext == ".bmp":  # removed due to PIL! or ext=='.ppm':
+            return win32ui.CDocTemplate_Confidence_yesAttemptNative
+        return win32ui.CDocTemplate_Confidence_maybeAttemptForeign
+
+
+# 		return win32ui.CDocTemplate_Confidence_noAttempt
+
+# For debugging purposes, when this module may be reloaded many times.
+try:
+    win32ui.GetApp().RemoveDocTemplate(bitmapTemplate)
+except NameError:
+    pass
+
+bitmapTemplate = BitmapTemplate()
+bitmapTemplate.SetDocStrings(
+    "\nBitmap\nBitmap\nBitmap (*.bmp)\n.bmp\nPythonBitmapFileType\nPython Bitmap File"
+)
+win32ui.GetApp().AddDocTemplate(bitmapTemplate)
+
+# This works, but just didnt make it through the code reorg.
+# class PPMBitmap(Bitmap):
+# 	def LoadBitmapFile(self, file ):
+# 		magic=file.readline()
+# 		if magic <> "P6\n":
+# 			raise TypeError, "The file is not a PPM format file"
+# 		rowcollist=string.split(file.readline())
+# 		cols=string.atoi(rowcollist[0])
+# 		rows=string.atoi(rowcollist[1])
+# 		file.readline()	# whats this one?
+# 		self.bitmap.LoadPPMFile(file,(cols,rows))
+
+
+def t():
+    bitmapTemplate.OpenDocumentFile("d:\\winnt\\arcade.bmp")
+    # OpenBMPFile( 'd:\\winnt\\arcade.bmp')
+
+
+def demo():
+    import glob
+
+    winDir = win32api.GetWindowsDirectory()
+    for fileName in glob.glob1(winDir, "*.bmp")[:2]:
+        bitmapTemplate.OpenDocumentFile(os.path.join(winDir, fileName))

.venv/Lib/site-packages/pythonwin/pywin/framework/cmdline.py

@@ -0,0 +1,55 @@
+# cmdline - command line utilities.
+import sys
+import win32ui
+import string
+
+
+def ParseArgs(str):
+    import string
+
+    ret = []
+    pos = 0
+    length = len(str)
+    while pos < length:
+        try:
+            while str[pos] in string.whitespace:
+                pos = pos + 1
+        except IndexError:
+            break
+        if pos >= length:
+            break
+        if str[pos] == '"':
+            pos = pos + 1
+            try:
+                endPos = str.index('"', pos) - 1
+                nextPos = endPos + 2
+            except ValueError:
+                endPos = length
+                nextPos = endPos + 1
+        else:
+            endPos = pos
+            while endPos < length and not str[endPos] in string.whitespace:
+                endPos = endPos + 1
+            nextPos = endPos + 1
+        ret.append(str[pos : endPos + 1].strip())
+        pos = nextPos
+    return ret
+
+
+def FixArgFileName(fileName):
+    """Convert a filename on the commandline to something useful.
+    Given an automatic filename on the commandline, turn it a python module name,
+    with the path added to sys.path."""
+    import os
+
+    path, fname = os.path.split(fileName)
+    if len(path) == 0:
+        path = os.curdir
+    path = os.path.abspath(path)
+    # must check that the command line arg's path is in sys.path
+    for syspath in sys.path:
+        if os.path.abspath(syspath) == path:
+            break
+    else:
+        sys.path.append(path)
+    return os.path.splitext(fname)[0]

.venv/Lib/site-packages/pythonwin/pywin/framework/dbgcommands.py

@@ -0,0 +1,187 @@
+# Command Handlers for the debugger.
+
+# Not in the debugger package, as I always want these interfaces to be
+# available, even if the debugger has not yet been (or can not be)
+# imported
+import win32ui, win32con
+from . import scriptutils
+import warnings
+from pywin.scintilla.control import CScintillaEditInterface
+
+IdToBarNames = {
+    win32ui.IDC_DBG_STACK: ("Stack", 0),
+    win32ui.IDC_DBG_BREAKPOINTS: ("Breakpoints", 0),
+    win32ui.IDC_DBG_WATCH: ("Watch", 1),
+}
+
+
+class DebuggerCommandHandler:
+    def HookCommands(self):
+        commands = (
+            (self.OnStep, None, win32ui.IDC_DBG_STEP),
+            (self.OnStepOut, self.OnUpdateOnlyBreak, win32ui.IDC_DBG_STEPOUT),
+            (self.OnStepOver, None, win32ui.IDC_DBG_STEPOVER),
+            (self.OnGo, None, win32ui.IDC_DBG_GO),
+            (self.OnClose, self.OnUpdateClose, win32ui.IDC_DBG_CLOSE),
+            (self.OnAdd, self.OnUpdateAddBreakpoints, win32ui.IDC_DBG_ADD),
+            (self.OnClearAll, self.OnUpdateClearAllBreakpoints, win32ui.IDC_DBG_CLEAR),
+            # 		                  (self.OnDebuggerToolbar, self.OnUpdateDebuggerToolbar, win32ui.ID_DEBUGGER_TOOLBAR),
+        )
+
+        frame = win32ui.GetMainFrame()
+
+        for methHandler, methUpdate, id in commands:
+            frame.HookCommand(methHandler, id)
+            if not methUpdate is None:
+                frame.HookCommandUpdate(methUpdate, id)
+
+        for id in list(IdToBarNames.keys()):
+            frame.HookCommand(self.OnDebuggerBar, id)
+            frame.HookCommandUpdate(self.OnUpdateDebuggerBar, id)
+
+    def OnDebuggerToolbar(self, id, code):
+        if code == 0:
+            return not win32ui.GetMainFrame().OnBarCheck(id)
+
+    def OnUpdateDebuggerToolbar(self, cmdui):
+        win32ui.GetMainFrame().OnUpdateControlBarMenu(cmdui)
+        cmdui.Enable(1)
+
+    def _GetDebugger(self):
+        try:
+            import pywin.debugger
+
+            return pywin.debugger.currentDebugger
+        except ImportError:
+            return None
+
+    def _DoOrStart(self, doMethod, startFlag):
+        d = self._GetDebugger()
+        if d is not None and d.IsDebugging():
+            method = getattr(d, doMethod)
+            method()
+        else:
+            scriptutils.RunScript(
+                defName=None, defArgs=None, bShowDialog=0, debuggingType=startFlag
+            )
+
+    def OnStep(self, msg, code):
+        self._DoOrStart("do_set_step", scriptutils.RS_DEBUGGER_STEP)
+
+    def OnStepOver(self, msg, code):
+        self._DoOrStart("do_set_next", scriptutils.RS_DEBUGGER_STEP)
+
+    def OnStepOut(self, msg, code):
+        d = self._GetDebugger()
+        if d is not None and d.IsDebugging():
+            d.do_set_return()
+
+    def OnGo(self, msg, code):
+        self._DoOrStart("do_set_continue", scriptutils.RS_DEBUGGER_GO)
+
+    def OnClose(self, msg, code):
+        d = self._GetDebugger()
+        if d is not None:
+            if d.IsDebugging():
+                d.set_quit()
+            else:
+                d.close()
+
+    def OnUpdateClose(self, cmdui):
+        d = self._GetDebugger()
+        if d is not None and d.inited:
+            cmdui.Enable(1)
+        else:
+            cmdui.Enable(0)
+
+    def OnAdd(self, msg, code):
+        doc, view = scriptutils.GetActiveEditorDocument()
+        if doc is None:
+            ## Don't do a messagebox, as this could be triggered from the app's
+            ## idle loop whenever the debug toolbar is visible, giving a never-ending
+            ## series of dialogs.  This can happen when the OnUpdate handler
+            ## for the toolbar button IDC_DBG_ADD fails, since MFC falls back to
+            ## sending a normal command if the UI update command fails.
+            ## win32ui.MessageBox('There is no active window - no breakpoint can be added')
+            warnings.warn("There is no active window - no breakpoint can be added")
+            return None
+        pathName = doc.GetPathName()
+        lineNo = view.LineFromChar(view.GetSel()[0]) + 1
+        # If I have a debugger, then tell it, otherwise just add a marker
+        d = self._GetDebugger()
+        if d is None:
+            import pywin.framework.editor.color.coloreditor
+
+            doc.MarkerToggle(
+                lineNo, pywin.framework.editor.color.coloreditor.MARKER_BREAKPOINT
+            )
+        else:
+            if d.get_break(pathName, lineNo):
+                win32ui.SetStatusText("Clearing breakpoint", 1)
+                rc = d.clear_break(pathName, lineNo)
+            else:
+                win32ui.SetStatusText("Setting breakpoint", 1)
+                rc = d.set_break(pathName, lineNo)
+            if rc:
+                win32ui.MessageBox(rc)
+            d.GUIRespondDebuggerData()
+
+    def OnClearAll(self, msg, code):
+        win32ui.SetStatusText("Clearing all breakpoints")
+        d = self._GetDebugger()
+        if d is None:
+            import pywin.framework.editor
+            import pywin.framework.editor.color.coloreditor
+
+            for doc in pywin.framework.editor.editorTemplate.GetDocumentList():
+                doc.MarkerDeleteAll(
+                    pywin.framework.editor.color.coloreditor.MARKER_BREAKPOINT
+                )
+        else:
+            d.clear_all_breaks()
+            d.UpdateAllLineStates()
+            d.GUIRespondDebuggerData()
+
+    def OnUpdateOnlyBreak(self, cmdui):
+        d = self._GetDebugger()
+        ok = d is not None and d.IsBreak()
+        cmdui.Enable(ok)
+
+    def OnUpdateAddBreakpoints(self, cmdui):
+        doc, view = scriptutils.GetActiveEditorDocument()
+        if doc is None or not isinstance(view, CScintillaEditInterface):
+            enabled = 0
+        else:
+            enabled = 1
+            lineNo = view.LineFromChar(view.GetSel()[0]) + 1
+            import pywin.framework.editor.color.coloreditor
+
+            cmdui.SetCheck(
+                doc.MarkerAtLine(
+                    lineNo, pywin.framework.editor.color.coloreditor.MARKER_BREAKPOINT
+                )
+                != 0
+            )
+        cmdui.Enable(enabled)
+
+    def OnUpdateClearAllBreakpoints(self, cmdui):
+        d = self._GetDebugger()
+        cmdui.Enable(d is None or len(d.breaks) != 0)
+
+    def OnUpdateDebuggerBar(self, cmdui):
+        name, always = IdToBarNames.get(cmdui.m_nID)
+        enabled = always
+        d = self._GetDebugger()
+        if d is not None and d.IsDebugging() and name is not None:
+            enabled = 1
+            bar = d.GetDebuggerBar(name)
+            cmdui.SetCheck(bar.IsWindowVisible())
+        cmdui.Enable(enabled)
+
+    def OnDebuggerBar(self, id, code):
+        name = IdToBarNames.get(id)[0]
+        d = self._GetDebugger()
+        if d is not None and name is not None:
+            bar = d.GetDebuggerBar(name)
+            newState = not bar.IsWindowVisible()
+            win32ui.GetMainFrame().ShowControlBar(bar, newState, 1)

.venv/Lib/site-packages/pythonwin/pywin/framework/dlgappcore.py

@@ -0,0 +1,74 @@
+# dlgappcore.
+#
+# base classes for dialog based apps.
+
+from . import app
+import win32ui
+import win32con
+import win32api
+import sys
+from pywin.mfc import dialog
+
+error = "Dialog Application Error"
+
+
+class AppDialog(dialog.Dialog):
+    "The dialog box for the application"
+
+    def __init__(self, id, dll=None):
+        self.iconId = win32ui.IDR_MAINFRAME
+        dialog.Dialog.__init__(self, id, dll)
+
+    def OnInitDialog(self):
+        return dialog.Dialog.OnInitDialog(self)
+
+    # Provide support for a dlg app using an icon
+    def OnPaint(self):
+        if not self.IsIconic():
+            return self._obj_.OnPaint()
+        self.DefWindowProc(win32con.WM_ICONERASEBKGND, dc.GetHandleOutput(), 0)
+        left, top, right, bottom = self.GetClientRect()
+        left = (right - win32api.GetSystemMetrics(win32con.SM_CXICON)) >> 1
+        top = (bottom - win32api.GetSystemMetrics(win32con.SM_CYICON)) >> 1
+        hIcon = win32ui.GetApp().LoadIcon(self.iconId)
+        self.GetDC().DrawIcon((left, top), hIcon)
+
+    # Only needed to provide a minimized icon (and this seems
+    # less important under win95/NT4
+    def OnEraseBkgnd(self, dc):
+        if self.IsIconic():
+            return 1
+        else:
+            return self._obj_.OnEraseBkgnd(dc)
+
+    def OnQueryDragIcon(self):
+        return win32ui.GetApp().LoadIcon(self.iconId)
+
+    def PreDoModal(self):
+        pass
+
+
+class DialogApp(app.CApp):
+    "An application class, for an app with main dialog box"
+
+    def InitInstance(self):
+        # 		win32ui.SetProfileFileName('dlgapp.ini')
+        win32ui.LoadStdProfileSettings()
+        win32ui.EnableControlContainer()
+        win32ui.Enable3dControls()
+        self.dlg = self.frame = self.CreateDialog()
+
+        if self.frame is None:
+            raise error("No dialog was created by CreateDialog()")
+            return
+
+        self._obj_.InitDlgInstance(self.dlg)
+        self.PreDoModal()
+        self.dlg.PreDoModal()
+        self.dlg.DoModal()
+
+    def CreateDialog(self):
+        pass
+
+    def PreDoModal(self):
+        pass

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/ModuleBrowser.py

@@ -0,0 +1,235 @@
+# ModuleBrowser.py - A view that provides a module browser for an editor document.
+import pywin.mfc.docview
+import win32ui
+import win32con
+import commctrl
+import win32api
+from pywin.tools import hierlist, browser
+import pywin.framework.scriptutils
+import afxres
+
+import pyclbr
+
+
+class HierListCLBRModule(hierlist.HierListItem):
+    def __init__(self, modName, clbrdata):
+        self.modName = modName
+        self.clbrdata = clbrdata
+
+    def GetText(self):
+        return self.modName
+
+    def GetSubList(self):
+        ret = []
+        for item in self.clbrdata.values():
+            if (
+                item.__class__ != pyclbr.Class
+            ):  # ie, it is a pyclbr Function instance (only introduced post 1.5.2)
+                ret.append(HierListCLBRFunction(item))
+            else:
+                ret.append(HierListCLBRClass(item))
+        ret.sort()
+        return ret
+
+    def IsExpandable(self):
+        return 1
+
+
+class HierListCLBRItem(hierlist.HierListItem):
+    def __init__(self, name, file, lineno, suffix=""):
+        self.name = str(name)
+        self.file = file
+        self.lineno = lineno
+        self.suffix = suffix
+
+    def __lt__(self, other):
+        return self.name < other.name
+
+    def __eq__(self, other):
+        return self.name == other.name
+
+    def GetText(self):
+        return self.name + self.suffix
+
+    def TakeDefaultAction(self):
+        if self.file:
+            pywin.framework.scriptutils.JumpToDocument(
+                self.file, self.lineno, bScrollToTop=1
+            )
+        else:
+            win32ui.SetStatusText("Can not locate the source code for this object.")
+
+    def PerformItemSelected(self):
+        if self.file is None:
+            msg = "%s - source can not be located." % (self.name,)
+        else:
+            msg = "%s defined at line %d of %s" % (self.name, self.lineno, self.file)
+        win32ui.SetStatusText(msg)
+
+
+class HierListCLBRClass(HierListCLBRItem):
+    def __init__(self, clbrclass, suffix=""):
+        try:
+            name = clbrclass.name
+            file = clbrclass.file
+            lineno = clbrclass.lineno
+            self.super = clbrclass.super
+            self.methods = clbrclass.methods
+        except AttributeError:
+            name = clbrclass
+            file = lineno = None
+            self.super = []
+            self.methods = {}
+        HierListCLBRItem.__init__(self, name, file, lineno, suffix)
+
+    def GetSubList(self):
+        r1 = []
+        for c in self.super:
+            r1.append(HierListCLBRClass(c, " (Parent class)"))
+        r1.sort()
+        r2 = []
+        for meth, lineno in self.methods.items():
+            r2.append(HierListCLBRMethod(meth, self.file, lineno))
+        r2.sort()
+        return r1 + r2
+
+    def IsExpandable(self):
+        return len(self.methods) + len(self.super)
+
+    def GetBitmapColumn(self):
+        return 21
+
+
+class HierListCLBRFunction(HierListCLBRItem):
+    def __init__(self, clbrfunc, suffix=""):
+        name = clbrfunc.name
+        file = clbrfunc.file
+        lineno = clbrfunc.lineno
+        HierListCLBRItem.__init__(self, name, file, lineno, suffix)
+
+    def GetBitmapColumn(self):
+        return 22
+
+
+class HierListCLBRMethod(HierListCLBRItem):
+    def GetBitmapColumn(self):
+        return 22
+
+
+class HierListCLBRErrorItem(hierlist.HierListItem):
+    def __init__(self, text):
+        self.text = text
+
+    def GetText(self):
+        return self.text
+
+    def GetSubList(self):
+        return [HierListCLBRErrorItem(self.text)]
+
+    def IsExpandable(self):
+        return 0
+
+
+class HierListCLBRErrorRoot(HierListCLBRErrorItem):
+    def IsExpandable(self):
+        return 1
+
+
+class BrowserView(pywin.mfc.docview.TreeView):
+    def OnInitialUpdate(self):
+        self.list = None
+        rc = self._obj_.OnInitialUpdate()
+        self.HookMessage(self.OnSize, win32con.WM_SIZE)
+        self.bDirty = 0
+        self.destroying = 0
+        return rc
+
+    def DestroyBrowser(self):
+        self.DestroyList()
+
+    def OnActivateView(self, activate, av, dv):
+        #        print "AV", self.bDirty, activate
+        if activate:
+            self.CheckRefreshList()
+        return self._obj_.OnActivateView(activate, av, dv)
+
+    def _MakeRoot(self):
+        path = self.GetDocument().GetPathName()
+        if not path:
+            return HierListCLBRErrorRoot(
+                "Error: Can not browse a file until it is saved"
+            )
+        else:
+            mod, path = pywin.framework.scriptutils.GetPackageModuleName(path)
+            if self.bDirty:
+                what = "Refreshing"
+                # Hack for pyclbr being too smart
+                try:
+                    del pyclbr._modules[mod]
+                except (KeyError, AttributeError):
+                    pass
+            else:
+                what = "Building"
+            win32ui.SetStatusText("%s class list - please wait..." % (what,), 1)
+            win32ui.DoWaitCursor(1)
+            try:
+                reader = pyclbr.readmodule_ex  # new version post 1.5.2
+            except AttributeError:
+                reader = pyclbr.readmodule
+            try:
+                data = reader(mod, [path])
+                if data:
+                    return HierListCLBRModule(mod, data)
+                else:
+                    return HierListCLBRErrorRoot("No Python classes in module.")
+
+            finally:
+                win32ui.DoWaitCursor(0)
+                win32ui.SetStatusText(win32ui.LoadString(afxres.AFX_IDS_IDLEMESSAGE))
+
+    def DestroyList(self):
+        self.destroying = 1
+        list = getattr(
+            self, "list", None
+        )  # If the document was not successfully opened, we may not have a list.
+        self.list = None
+        if list is not None:
+            list.HierTerm()
+        self.destroying = 0
+
+    def CheckMadeList(self):
+        if self.list is not None or self.destroying:
+            return
+        self.rootitem = root = self._MakeRoot()
+        self.list = list = hierlist.HierListWithItems(root, win32ui.IDB_BROWSER_HIER)
+        list.HierInit(self.GetParentFrame(), self)
+        list.SetStyle(
+            commctrl.TVS_HASLINES | commctrl.TVS_LINESATROOT | commctrl.TVS_HASBUTTONS
+        )
+
+    def CheckRefreshList(self):
+        if self.bDirty:
+            if self.list is None:
+                self.CheckMadeList()
+            else:
+                new_root = self._MakeRoot()
+                if self.rootitem.__class__ == new_root.__class__ == HierListCLBRModule:
+                    self.rootitem.modName = new_root.modName
+                    self.rootitem.clbrdata = new_root.clbrdata
+                    self.list.Refresh()
+                else:
+                    self.list.AcceptRoot(self._MakeRoot())
+            self.bDirty = 0
+
+    def OnSize(self, params):
+        lparam = params[3]
+        w = win32api.LOWORD(lparam)
+        h = win32api.HIWORD(lparam)
+        if w != 0:
+            self.CheckMadeList()
+        elif w == 0:
+            self.DestroyList()
+        return 1
+
+    def _UpdateUIForState(self):
+        self.bDirty = 1

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/__init__.py

@@ -0,0 +1,103 @@
+# __init__ for the Pythonwin editor package.
+#
+# We used to support optional editors - eg, color or non-color.
+#
+# This really isnt necessary with Scintilla, and scintilla
+# is getting so deeply embedded that it was too much work.
+
+import win32ui, sys, win32con
+
+defaultCharacterFormat = (-402653169, 0, 200, 0, 0, 0, 49, "Courier New")
+
+##def GetDefaultEditorModuleName():
+##	import pywin
+##	# If someone has set pywin.editormodulename, then this is what we use
+##	try:
+##		prefModule = pywin.editormodulename
+##	except AttributeError:
+##		prefModule = win32ui.GetProfileVal("Editor","Module", "")
+##	return prefModule
+##
+##def WriteDefaultEditorModule(module):
+##	try:
+##		module = module.__name__
+##	except:
+##		pass
+##	win32ui.WriteProfileVal("Editor", "Module", module)
+
+
+def LoadDefaultEditor():
+    pass
+
+
+##	prefModule = GetDefaultEditorModuleName()
+##	restorePrefModule = None
+##	mod = None
+##	if prefModule:
+##		try:
+##			mod = __import__(prefModule)
+##		except 'xx':
+##			msg = "Importing your preferred editor ('%s') failed.\n\nError %s: %s\n\nAn attempt will be made to load the default editor.\n\nWould you like this editor disabled in the future?" % (prefModule, sys.exc_info()[0], sys.exc_info()[1])
+##			rc = win32ui.MessageBox(msg, "Error importing editor", win32con.MB_YESNO)
+##			if rc == win32con.IDNO:
+##				restorePrefModule = prefModule
+##			WriteDefaultEditorModule("")
+##			del rc
+##
+##	try:
+##		# Try and load the default one - dont catch errors here.
+##		if mod is None:
+##			prefModule = "pywin.framework.editor.color.coloreditor"
+##			mod = __import__(prefModule)
+##
+##		# Get at the real module.
+##		mod = sys.modules[prefModule]
+##
+##		# Do a "from mod import *"
+##		globals().update(mod.__dict__)
+##
+##	finally:
+##		# Restore the users default editor if it failed and they requested not to disable it.
+##		if restorePrefModule:
+##			WriteDefaultEditorModule(restorePrefModule)
+
+
+def GetEditorOption(option, defaultValue, min=None, max=None):
+    rc = win32ui.GetProfileVal("Editor", option, defaultValue)
+    if min is not None and rc < min:
+        rc = defaultValue
+    if max is not None and rc > max:
+        rc = defaultValue
+    return rc
+
+
+def SetEditorOption(option, newValue):
+    win32ui.WriteProfileVal("Editor", option, newValue)
+
+
+def DeleteEditorOption(option):
+    try:
+        win32ui.WriteProfileVal("Editor", option, None)
+    except win32ui.error:
+        pass
+
+
+# Load and save font tuples
+def GetEditorFontOption(option, default=None):
+    if default is None:
+        default = defaultCharacterFormat
+    fmt = GetEditorOption(option, "")
+    if fmt == "":
+        return default
+    try:
+        return eval(fmt)
+    except:
+        print("WARNING: Invalid font setting in registry - setting ignored")
+        return default
+
+
+def SetEditorFontOption(option, newValue):
+    SetEditorOption(option, str(newValue))
+
+
+from pywin.framework.editor.color.coloreditor import editorTemplate

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/color/coloreditor.py

@@ -0,0 +1,667 @@
+# Color Editor originally by Neil Hodgson, but restructured by mh to integrate
+# even tighter into Pythonwin.
+import win32ui
+import win32con
+import win32api
+import sys
+
+import pywin.scintilla.keycodes
+from pywin.scintilla import bindings
+
+from pywin.framework.editor import (
+    GetEditorOption,
+    SetEditorOption,
+    GetEditorFontOption,
+    SetEditorFontOption,
+    defaultCharacterFormat,
+)
+
+# from pywin.framework.editor import EditorPropertyPage
+
+MSG_CHECK_EXTERNAL_FILE = (
+    win32con.WM_USER + 1999
+)  ## WARNING: Duplicated in document.py and editor.py
+
+# Define a few common markers
+MARKER_BOOKMARK = 0
+MARKER_BREAKPOINT = 1
+MARKER_CURRENT = 2
+
+from pywin.debugger import dbgcon
+from pywin.scintilla.document import CScintillaDocument
+from pywin.framework.editor.document import EditorDocumentBase
+from pywin.scintilla import scintillacon  # For the marker definitions
+import pywin.scintilla.view
+
+
+class SyntEditDocument(EditorDocumentBase):
+    "A SyntEdit document."
+
+    def OnDebuggerStateChange(self, state):
+        self._ApplyOptionalToViews("OnDebuggerStateChange", state)
+
+    def HookViewNotifications(self, view):
+        EditorDocumentBase.HookViewNotifications(self, view)
+        view.SCISetUndoCollection(1)
+
+    def FinalizeViewCreation(self, view):
+        EditorDocumentBase.FinalizeViewCreation(self, view)
+        if view == self.GetFirstView():
+            self.GetDocTemplate().CheckIDLEMenus(view.idle)
+
+
+SyntEditViewParent = pywin.scintilla.view.CScintillaView
+
+
+class SyntEditView(SyntEditViewParent):
+    "A view of a SyntEdit.  Obtains data from document."
+
+    def __init__(self, doc):
+        SyntEditViewParent.__init__(self, doc)
+        self.bCheckingFile = 0
+
+    def OnInitialUpdate(self):
+        SyntEditViewParent.OnInitialUpdate(self)
+
+        self.HookMessage(self.OnRClick, win32con.WM_RBUTTONDOWN)
+
+        for id in [
+            win32ui.ID_VIEW_FOLD_COLLAPSE,
+            win32ui.ID_VIEW_FOLD_COLLAPSE_ALL,
+            win32ui.ID_VIEW_FOLD_EXPAND,
+            win32ui.ID_VIEW_FOLD_EXPAND_ALL,
+        ]:
+
+            self.HookCommand(self.OnCmdViewFold, id)
+            self.HookCommandUpdate(self.OnUpdateViewFold, id)
+        self.HookCommand(self.OnCmdViewFoldTopLevel, win32ui.ID_VIEW_FOLD_TOPLEVEL)
+
+        # Define the markers
+        # 		self.SCIMarkerDeleteAll()
+        self.SCIMarkerDefineAll(
+            MARKER_BOOKMARK,
+            scintillacon.SC_MARK_ROUNDRECT,
+            win32api.RGB(0x0, 0x0, 0x0),
+            win32api.RGB(0, 0xFF, 0xFF),
+        )
+
+        self.SCIMarkerDefine(MARKER_CURRENT, scintillacon.SC_MARK_ARROW)
+        self.SCIMarkerSetBack(MARKER_CURRENT, win32api.RGB(0xFF, 0xFF, 0x00))
+
+        # Define the folding markers
+        if 1:  # traditional markers
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEROPEN,
+                scintillacon.SC_MARK_MINUS,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDER,
+                scintillacon.SC_MARK_PLUS,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERSUB,
+                scintillacon.SC_MARK_EMPTY,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERTAIL,
+                scintillacon.SC_MARK_EMPTY,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEREND,
+                scintillacon.SC_MARK_EMPTY,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEROPENMID,
+                scintillacon.SC_MARK_EMPTY,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERMIDTAIL,
+                scintillacon.SC_MARK_EMPTY,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+        else:  # curved markers
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEROPEN,
+                scintillacon.SC_MARK_CIRCLEMINUS,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDER,
+                scintillacon.SC_MARK_CIRCLEPLUS,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERSUB,
+                scintillacon.SC_MARK_VLINE,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERTAIL,
+                scintillacon.SC_MARK_LCORNERCURVE,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEREND,
+                scintillacon.SC_MARK_CIRCLEPLUSCONNECTED,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDEROPENMID,
+                scintillacon.SC_MARK_CIRCLEMINUSCONNECTED,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+            self.SCIMarkerDefineAll(
+                scintillacon.SC_MARKNUM_FOLDERMIDTAIL,
+                scintillacon.SC_MARK_TCORNERCURVE,
+                win32api.RGB(0xFF, 0xFF, 0xFF),
+                win32api.RGB(0, 0, 0),
+            )
+
+        self.SCIMarkerDefine(MARKER_BREAKPOINT, scintillacon.SC_MARK_CIRCLE)
+        # Marker background depends on debugger state
+        self.SCIMarkerSetFore(MARKER_BREAKPOINT, win32api.RGB(0x0, 0, 0))
+        # Get the current debugger state.
+        try:
+            import pywin.debugger
+
+            if pywin.debugger.currentDebugger is None:
+                state = dbgcon.DBGSTATE_NOT_DEBUGGING
+            else:
+                state = pywin.debugger.currentDebugger.debuggerState
+        except ImportError:
+            state = dbgcon.DBGSTATE_NOT_DEBUGGING
+        self.OnDebuggerStateChange(state)
+
+    def _GetSubConfigNames(self):
+        return ["editor"]  # Allow [Keys:Editor] sections to be specific to us
+
+    def DoConfigChange(self):
+        SyntEditViewParent.DoConfigChange(self)
+        tabSize = GetEditorOption("Tab Size", 4, 2)
+        indentSize = GetEditorOption("Indent Size", 4, 2)
+        bUseTabs = GetEditorOption("Use Tabs", 0)
+        bSmartTabs = GetEditorOption("Smart Tabs", 1)
+        ext = self.idle.IDLEExtension("AutoIndent")  # Required extension.
+
+        self.SCISetViewWS(GetEditorOption("View Whitespace", 0))
+        self.SCISetViewEOL(GetEditorOption("View EOL", 0))
+        self.SCISetIndentationGuides(GetEditorOption("View Indentation Guides", 0))
+
+        if GetEditorOption("Right Edge Enabled", 0):
+            mode = scintillacon.EDGE_BACKGROUND
+        else:
+            mode = scintillacon.EDGE_NONE
+        self.SCISetEdgeMode(mode)
+        self.SCISetEdgeColumn(GetEditorOption("Right Edge Column", 75))
+        self.SCISetEdgeColor(
+            GetEditorOption("Right Edge Color", win32api.RGB(0xEF, 0xEF, 0xEF))
+        )
+
+        width = GetEditorOption("Marker Margin Width", 16)
+        self.SCISetMarginWidthN(1, width)
+        width = GetEditorOption("Fold Margin Width", 12)
+        self.SCISetMarginWidthN(2, width)
+        width = GetEditorOption("Line Number Margin Width", 0)
+        self.SCISetMarginWidthN(0, width)
+        self.bFolding = GetEditorOption("Enable Folding", 1)
+        fold_flags = 0
+        self.SendScintilla(
+            scintillacon.SCI_SETMODEVENTMASK, scintillacon.SC_MOD_CHANGEFOLD
+        )
+        if self.bFolding:
+            if GetEditorOption("Fold Lines", 1):
+                fold_flags = 16
+
+        self.SCISetProperty("fold", self.bFolding)
+        self.SCISetFoldFlags(fold_flags)
+
+        tt_color = GetEditorOption("Tab Timmy Color", win32api.RGB(0xFF, 0, 0))
+        self.SendScintilla(scintillacon.SCI_INDICSETFORE, 1, tt_color)
+
+        tt_use = GetEditorOption("Use Tab Timmy", 1)
+        if tt_use:
+            self.SCISetProperty("tab.timmy.whinge.level", "1")
+
+        # Auto-indent has very complicated behaviour.  In a nutshell, the only
+        # way to get sensible behaviour from it is to ensure tabwidth != indentsize.
+        # Further, usetabs will only ever go from 1->0, never 0->1.
+        # This is _not_ the behaviour Pythonwin wants:
+        # * Tab width is arbitary, so should have no impact on smarts.
+        # * bUseTabs setting should reflect how new files are created, and
+        #   if Smart Tabs disabled, existing files are edited
+        # * If "Smart Tabs" is enabled, bUseTabs should have no bearing
+        #   for existing files (unless of course no context can be determined)
+        #
+        # So for smart tabs we configure the widget with completely dummy
+        # values (ensuring tabwidth != indentwidth), ask it to guess, then
+        # look at the values it has guessed, and re-configure
+        if bSmartTabs:
+            ext.config(usetabs=1, tabwidth=5, indentwidth=4)
+            ext.set_indentation_params(1)
+            if ext.indentwidth == 5:
+                # Either 5 literal spaces, or a single tab character. Assume a tab
+                usetabs = 1
+                indentwidth = tabSize
+            else:
+                # Either Indented with spaces, and indent size has been guessed or
+                # an empty file (or no context found - tough!)
+                if self.GetTextLength() == 0:  # emtpy
+                    usetabs = bUseTabs
+                    indentwidth = indentSize
+                else:  # guessed.
+                    indentwidth = ext.indentwidth
+                    usetabs = 0
+            # Tab size can never be guessed - set at user preference.
+            ext.config(usetabs=usetabs, indentwidth=indentwidth, tabwidth=tabSize)
+        else:
+            # Dont want smart-tabs - just set the options!
+            ext.config(usetabs=bUseTabs, tabwidth=tabSize, indentwidth=indentSize)
+        self.SCISetIndent(indentSize)
+        self.SCISetTabWidth(tabSize)
+
+    def OnDebuggerStateChange(self, state):
+        if state == dbgcon.DBGSTATE_NOT_DEBUGGING:
+            # Indicate breakpoints arent really usable.
+            # Not quite white - useful when no marker margin, so set as background color.
+            self.SCIMarkerSetBack(MARKER_BREAKPOINT, win32api.RGB(0xEF, 0xEF, 0xEF))
+        else:
+            # A light-red, so still readable when no marker margin.
+            self.SCIMarkerSetBack(MARKER_BREAKPOINT, win32api.RGB(0xFF, 0x80, 0x80))
+
+    def HookDocumentHandlers(self):
+        SyntEditViewParent.HookDocumentHandlers(self)
+        self.HookMessage(self.OnCheckExternalDocumentUpdated, MSG_CHECK_EXTERNAL_FILE)
+
+    def HookHandlers(self):
+        SyntEditViewParent.HookHandlers(self)
+        self.HookMessage(self.OnSetFocus, win32con.WM_SETFOCUS)
+
+    def _PrepareUserStateChange(self):
+        return self.GetSel(), self.GetFirstVisibleLine()
+
+    def _EndUserStateChange(self, info):
+        scrollOff = info[1] - self.GetFirstVisibleLine()
+        if scrollOff:
+            self.LineScroll(scrollOff)
+        # Make sure we dont reset the cursor beyond the buffer.
+        max = self.GetTextLength()
+        newPos = min(info[0][0], max), min(info[0][1], max)
+        self.SetSel(newPos)
+
+    #######################################
+    # The Windows Message or Notify handlers.
+    #######################################
+    def OnMarginClick(self, std, extra):
+        notify = self.SCIUnpackNotifyMessage(extra)
+        if notify.margin == 2:  # Our fold margin
+            line_click = self.LineFromChar(notify.position)
+            # 			max_line = self.GetLineCount()
+            if self.SCIGetFoldLevel(line_click) & scintillacon.SC_FOLDLEVELHEADERFLAG:
+                # If a fold point.
+                self.SCIToggleFold(line_click)
+        return 1
+
+    def OnSetFocus(self, msg):
+        # Even though we use file change notifications, we should be very sure about it here.
+        self.OnCheckExternalDocumentUpdated(msg)
+        return 1
+
+    def OnCheckExternalDocumentUpdated(self, msg):
+        if self.bCheckingFile:
+            return
+        self.bCheckingFile = 1
+        self.GetDocument().CheckExternalDocumentUpdated()
+        self.bCheckingFile = 0
+
+    def OnRClick(self, params):
+        menu = win32ui.CreatePopupMenu()
+        self.AppendMenu(menu, "&Locate module", "LocateModule")
+        self.AppendMenu(menu, flags=win32con.MF_SEPARATOR)
+        self.AppendMenu(menu, "&Undo", "EditUndo")
+        self.AppendMenu(menu, "&Redo", "EditRedo")
+        self.AppendMenu(menu, flags=win32con.MF_SEPARATOR)
+        self.AppendMenu(menu, "Cu&t", "EditCut")
+        self.AppendMenu(menu, "&Copy", "EditCopy")
+        self.AppendMenu(menu, "&Paste", "EditPaste")
+        self.AppendMenu(menu, flags=win32con.MF_SEPARATOR)
+        self.AppendMenu(menu, "&Select all", "EditSelectAll")
+        self.AppendMenu(
+            menu, "View &Whitespace", "ViewWhitespace", checked=self.SCIGetViewWS()
+        )
+        self.AppendMenu(
+            menu, "&Fixed Font", "ViewFixedFont", checked=self._GetColorizer().bUseFixed
+        )
+        self.AppendMenu(menu, flags=win32con.MF_SEPARATOR)
+        self.AppendMenu(menu, "&Goto line...", "GotoLine")
+
+        submenu = win32ui.CreatePopupMenu()
+        newitems = self.idle.GetMenuItems("edit")
+        for text, event in newitems:
+            self.AppendMenu(submenu, text, event)
+
+        flags = win32con.MF_STRING | win32con.MF_ENABLED | win32con.MF_POPUP
+        menu.AppendMenu(flags, submenu.GetHandle(), "&Source code")
+
+        flags = (
+            win32con.TPM_LEFTALIGN | win32con.TPM_LEFTBUTTON | win32con.TPM_RIGHTBUTTON
+        )
+        menu.TrackPopupMenu(params[5], flags, self)
+        return 0
+
+    def OnCmdViewFold(self, cid, code):  # Handle the menu command
+        if cid == win32ui.ID_VIEW_FOLD_EXPAND_ALL:
+            self.FoldExpandAllEvent(None)
+        elif cid == win32ui.ID_VIEW_FOLD_EXPAND:
+            self.FoldExpandEvent(None)
+        elif cid == win32ui.ID_VIEW_FOLD_COLLAPSE_ALL:
+            self.FoldCollapseAllEvent(None)
+        elif cid == win32ui.ID_VIEW_FOLD_COLLAPSE:
+            self.FoldCollapseEvent(None)
+        else:
+            print("Unknown collapse/expand ID")
+
+    def OnUpdateViewFold(self, cmdui):  # Update the tick on the UI.
+        if not self.bFolding:
+            cmdui.Enable(0)
+            return
+        id = cmdui.m_nID
+        if id in [win32ui.ID_VIEW_FOLD_EXPAND_ALL, win32ui.ID_VIEW_FOLD_COLLAPSE_ALL]:
+            cmdui.Enable()
+        else:
+            enable = 0
+            lineno = self.LineFromChar(self.GetSel()[0])
+            foldable = (
+                self.SCIGetFoldLevel(lineno) & scintillacon.SC_FOLDLEVELHEADERFLAG
+            )
+            is_expanded = self.SCIGetFoldExpanded(lineno)
+            if id == win32ui.ID_VIEW_FOLD_EXPAND:
+                if foldable and not is_expanded:
+                    enable = 1
+            elif id == win32ui.ID_VIEW_FOLD_COLLAPSE:
+                if foldable and is_expanded:
+                    enable = 1
+            cmdui.Enable(enable)
+
+    def OnCmdViewFoldTopLevel(self, cid, code):  # Handle the menu command
+        self.FoldTopLevelEvent(None)
+
+    #######################################
+    # The Events
+    #######################################
+    def ToggleBookmarkEvent(self, event, pos=-1):
+        """Toggle a bookmark at the specified or current position"""
+        if pos == -1:
+            pos, end = self.GetSel()
+        startLine = self.LineFromChar(pos)
+        self.GetDocument().MarkerToggle(startLine + 1, MARKER_BOOKMARK)
+        return 0
+
+    def GotoNextBookmarkEvent(self, event, fromPos=-1):
+        """Move to the next bookmark"""
+        if fromPos == -1:
+            fromPos, end = self.GetSel()
+        startLine = self.LineFromChar(fromPos) + 1  # Zero based line to start
+        nextLine = self.GetDocument().MarkerGetNext(startLine + 1, MARKER_BOOKMARK) - 1
+        if nextLine < 0:
+            nextLine = self.GetDocument().MarkerGetNext(0, MARKER_BOOKMARK) - 1
+        if nextLine < 0 or nextLine == startLine - 1:
+            win32api.MessageBeep()
+        else:
+            self.SCIEnsureVisible(nextLine)
+            self.SCIGotoLine(nextLine)
+        return 0
+
+    def TabKeyEvent(self, event):
+        """Insert an indent.  If no selection, a single indent, otherwise a block indent"""
+        # Handle auto-complete first.
+        if self.SCIAutoCActive():
+            self.SCIAutoCComplete()
+            return 0
+        # Call the IDLE event.
+        return self.bindings.fire("<<smart-indent>>", event)
+
+    def EnterKeyEvent(self, event):
+        """Handle the enter key with special handling for auto-complete"""
+        # Handle auto-complete first.
+        if self.SCIAutoCActive():
+            self.SCIAutoCComplete()
+            self.SCIAutoCCancel()
+        # Call the IDLE event.
+        return self.bindings.fire("<<newline-and-indent>>", event)
+
+    def ShowInteractiveWindowEvent(self, event):
+        import pywin.framework.interact
+
+        pywin.framework.interact.ShowInteractiveWindow()
+
+    def FoldTopLevelEvent(self, event=None):
+        if not self.bFolding:
+            return 1
+
+        win32ui.DoWaitCursor(1)
+        try:
+            self.Colorize()
+            maxLine = self.GetLineCount()
+            # Find the first line, and check out its state.
+            for lineSeek in range(maxLine):
+                if self.SCIGetFoldLevel(lineSeek) & scintillacon.SC_FOLDLEVELHEADERFLAG:
+                    expanding = not self.SCIGetFoldExpanded(lineSeek)
+                    break
+            else:
+                # no folds here!
+                return
+            for lineSeek in range(lineSeek, maxLine):
+                level = self.SCIGetFoldLevel(lineSeek)
+                level_no = (
+                    level
+                    & scintillacon.SC_FOLDLEVELNUMBERMASK
+                    - scintillacon.SC_FOLDLEVELBASE
+                )
+                is_header = level & scintillacon.SC_FOLDLEVELHEADERFLAG
+                # 			print lineSeek, level_no, is_header
+                if level_no == 0 and is_header:
+                    if (expanding and not self.SCIGetFoldExpanded(lineSeek)) or (
+                        not expanding and self.SCIGetFoldExpanded(lineSeek)
+                    ):
+                        self.SCIToggleFold(lineSeek)
+        finally:
+            win32ui.DoWaitCursor(-1)
+
+    def FoldExpandSecondLevelEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        ## I think this is needed since Scintilla may not have
+        ## already formatted parts of file outside visible window.
+        self.Colorize()
+        levels = [scintillacon.SC_FOLDLEVELBASE]
+        ## Scintilla's level number is based on amount of whitespace indentation
+        for lineno in range(self.GetLineCount()):
+            level = self.SCIGetFoldLevel(lineno)
+            if not level & scintillacon.SC_FOLDLEVELHEADERFLAG:
+                continue
+            curr_level = level & scintillacon.SC_FOLDLEVELNUMBERMASK
+            if curr_level > levels[-1]:
+                levels.append(curr_level)
+            try:
+                level_ind = levels.index(curr_level)
+            except ValueError:
+                ## probably syntax error in source file, bail
+                break
+            levels = levels[: level_ind + 1]
+            if level_ind == 1 and not self.SCIGetFoldExpanded(lineno):
+                self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+    def FoldCollapseSecondLevelEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        ## I think this is needed since Scintilla may not have
+        ## already formatted parts of file outside visible window.
+        self.Colorize()
+        levels = [scintillacon.SC_FOLDLEVELBASE]
+        ## Scintilla's level number is based on amount of whitespace indentation
+        for lineno in range(self.GetLineCount()):
+            level = self.SCIGetFoldLevel(lineno)
+            if not level & scintillacon.SC_FOLDLEVELHEADERFLAG:
+                continue
+            curr_level = level & scintillacon.SC_FOLDLEVELNUMBERMASK
+            if curr_level > levels[-1]:
+                levels.append(curr_level)
+            try:
+                level_ind = levels.index(curr_level)
+            except ValueError:
+                ## probably syntax error in source file, bail
+                break
+            levels = levels[: level_ind + 1]
+            if level_ind == 1 and self.SCIGetFoldExpanded(lineno):
+                self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+    def FoldExpandEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        lineno = self.LineFromChar(self.GetSel()[0])
+        if self.SCIGetFoldLevel(
+            lineno
+        ) & scintillacon.SC_FOLDLEVELHEADERFLAG and not self.SCIGetFoldExpanded(lineno):
+            self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+    def FoldExpandAllEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        for lineno in range(0, self.GetLineCount()):
+            if self.SCIGetFoldLevel(
+                lineno
+            ) & scintillacon.SC_FOLDLEVELHEADERFLAG and not self.SCIGetFoldExpanded(
+                lineno
+            ):
+                self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+    def FoldCollapseEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        lineno = self.LineFromChar(self.GetSel()[0])
+        if self.SCIGetFoldLevel(
+            lineno
+        ) & scintillacon.SC_FOLDLEVELHEADERFLAG and self.SCIGetFoldExpanded(lineno):
+            self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+    def FoldCollapseAllEvent(self, event):
+        if not self.bFolding:
+            return 1
+        win32ui.DoWaitCursor(1)
+        self.Colorize()
+        for lineno in range(0, self.GetLineCount()):
+            if self.SCIGetFoldLevel(
+                lineno
+            ) & scintillacon.SC_FOLDLEVELHEADERFLAG and self.SCIGetFoldExpanded(lineno):
+                self.SCIToggleFold(lineno)
+        win32ui.DoWaitCursor(-1)
+
+
+from pywin.framework.editor.frame import EditorFrame
+
+
+class SplitterFrame(EditorFrame):
+    def OnCreate(self, cs):
+        self.HookCommand(self.OnWindowSplit, win32ui.ID_WINDOW_SPLIT)
+        return 1
+
+    def OnWindowSplit(self, id, code):
+        self.GetDlgItem(win32ui.AFX_IDW_PANE_FIRST).DoKeyboardSplit()
+        return 1
+
+
+from pywin.framework.editor.template import EditorTemplateBase
+
+
+class SyntEditTemplate(EditorTemplateBase):
+    def __init__(
+        self, res=win32ui.IDR_TEXTTYPE, makeDoc=None, makeFrame=None, makeView=None
+    ):
+        if makeDoc is None:
+            makeDoc = SyntEditDocument
+        if makeView is None:
+            makeView = SyntEditView
+        if makeFrame is None:
+            makeFrame = SplitterFrame
+        self.bSetMenus = 0
+        EditorTemplateBase.__init__(self, res, makeDoc, makeFrame, makeView)
+
+    def CheckIDLEMenus(self, idle):
+        if self.bSetMenus:
+            return
+        self.bSetMenus = 1
+
+        submenu = win32ui.CreatePopupMenu()
+        newitems = idle.GetMenuItems("edit")
+        flags = win32con.MF_STRING | win32con.MF_ENABLED
+        for text, event in newitems:
+            id = bindings.event_to_commands.get(event)
+            if id is not None:
+                keyname = pywin.scintilla.view.configManager.get_key_binding(
+                    event, ["editor"]
+                )
+                if keyname is not None:
+                    text = text + "\t" + keyname
+                submenu.AppendMenu(flags, id, text)
+
+        mainMenu = self.GetSharedMenu()
+        editMenu = mainMenu.GetSubMenu(1)
+        editMenu.AppendMenu(win32con.MF_SEPARATOR, 0, "")
+        editMenu.AppendMenu(
+            win32con.MF_STRING | win32con.MF_POPUP | win32con.MF_ENABLED,
+            submenu.GetHandle(),
+            "&Source Code",
+        )
+
+    def _CreateDocTemplate(self, resourceId):
+        return win32ui.CreateDocTemplate(resourceId)
+
+    def CreateWin32uiDocument(self):
+        return self.DoCreateDoc()
+
+    def GetPythonPropertyPages(self):
+        """Returns a list of property pages"""
+        from pywin.scintilla import configui
+
+        return EditorTemplateBase.GetPythonPropertyPages(self) + [
+            configui.ScintillaFormatPropertyPage()
+        ]
+
+
+# For debugging purposes, when this module may be reloaded many times.
+try:
+    win32ui.GetApp().RemoveDocTemplate(editorTemplate)
+except NameError:
+    pass
+
+editorTemplate = SyntEditTemplate()
+win32ui.GetApp().AddDocTemplate(editorTemplate)

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/configui.py

@@ -0,0 +1,307 @@
+from pywin.mfc import dialog
+from . import document
+import win32ui
+import win32con
+import win32api
+
+from pywin.framework.editor import (
+    GetEditorOption,
+    SetEditorOption,
+    DeleteEditorOption,
+    GetEditorFontOption,
+    SetEditorFontOption,
+    defaultCharacterFormat,
+    editorTemplate,
+)
+import pywin.scintilla.config
+
+# The standard 16 color VGA palette should always be possible
+paletteVGA = (
+    ("Black", 0, 0, 0),
+    ("Navy", 0, 0, 128),
+    ("Green", 0, 128, 0),
+    ("Cyan", 0, 128, 128),
+    ("Maroon", 128, 0, 0),
+    ("Purple", 128, 0, 128),
+    ("Olive", 128, 128, 0),
+    ("Gray", 128, 128, 128),
+    ("Silver", 192, 192, 192),
+    ("Blue", 0, 0, 255),
+    ("Lime", 0, 255, 0),
+    ("Aqua", 0, 255, 255),
+    ("Red", 255, 0, 0),
+    ("Fuchsia", 255, 0, 255),
+    ("Yellow", 255, 255, 0),
+    ("White", 255, 255, 255),
+)
+
+######################################################
+#
+# Property Page for editor options
+#
+class EditorPropertyPage(dialog.PropertyPage):
+    def __init__(self):
+        dialog.PropertyPage.__init__(self, win32ui.IDD_PP_EDITOR)
+        self.autooptions = []
+        self._AddEditorOption(win32ui.IDC_AUTO_RELOAD, "i", "Auto Reload", 1)
+        self._AddEditorOption(
+            win32ui.IDC_COMBO1, "i", "Backup Type", document.BAK_DOT_BAK_BAK_DIR
+        )
+        self._AddEditorOption(
+            win32ui.IDC_AUTOCOMPLETE, "i", "Autocomplete Attributes", 1
+        )
+        self._AddEditorOption(win32ui.IDC_CALLTIPS, "i", "Show Call Tips", 1)
+        self._AddEditorOption(
+            win32ui.IDC_MARGIN_LINENUMBER, "i", "Line Number Margin Width", 0
+        )
+        self._AddEditorOption(win32ui.IDC_RADIO1, "i", "MarkersInMargin", None)
+        self._AddEditorOption(
+            win32ui.IDC_MARGIN_MARKER, "i", "Marker Margin Width", None
+        )
+        self["Marker Margin Width"] = GetEditorOption("Marker Margin Width", 16)
+
+        # Folding
+        self._AddEditorOption(win32ui.IDC_MARGIN_FOLD, "i", "Fold Margin Width", 12)
+        self._AddEditorOption(win32ui.IDC_FOLD_ENABLE, "i", "Enable Folding", 1)
+        self._AddEditorOption(win32ui.IDC_FOLD_ON_OPEN, "i", "Fold On Open", 0)
+        self._AddEditorOption(win32ui.IDC_FOLD_SHOW_LINES, "i", "Fold Lines", 1)
+
+        # Right edge.
+        self._AddEditorOption(
+            win32ui.IDC_RIGHTEDGE_ENABLE, "i", "Right Edge Enabled", 0
+        )
+        self._AddEditorOption(
+            win32ui.IDC_RIGHTEDGE_COLUMN, "i", "Right Edge Column", 75
+        )
+
+        # Source control, etc
+        self.AddDDX(win32ui.IDC_VSS_INTEGRATE, "bVSS")
+        self.AddDDX(win32ui.IDC_KEYBOARD_CONFIG, "Configs", "l")
+        self["Configs"] = pywin.scintilla.config.find_config_files()
+
+    def _AddEditorOption(self, idd, typ, optionName, defaultVal):
+        self.AddDDX(idd, optionName, typ)
+        # some options are "derived" - ie, can be implied from others
+        # (eg, "view markers in background" is implied from "markerMarginWidth==0"
+        # So we don't actually store these values, but they do still get DDX support.
+        if defaultVal is not None:
+            self[optionName] = GetEditorOption(optionName, defaultVal)
+            self.autooptions.append((optionName, defaultVal))
+
+    def OnInitDialog(self):
+        for name, val in self.autooptions:
+            self[name] = GetEditorOption(name, val)
+
+        # Note that these MUST be in the same order as the BAK constants.
+        cbo = self.GetDlgItem(win32ui.IDC_COMBO1)
+        cbo.AddString("None")
+        cbo.AddString(".BAK File")
+        cbo.AddString("TEMP dir")
+        cbo.AddString("Own dir")
+
+        # Source Safe
+        bVSS = (
+            GetEditorOption("Source Control Module", "") == "pywin.framework.editor.vss"
+        )
+        self["bVSS"] = bVSS
+
+        edit = self.GetDlgItem(win32ui.IDC_RIGHTEDGE_SAMPLE)
+        edit.SetWindowText("Sample Color")
+
+        rc = dialog.PropertyPage.OnInitDialog(self)
+
+        try:
+            self.GetDlgItem(win32ui.IDC_KEYBOARD_CONFIG).SelectString(
+                -1, GetEditorOption("Keyboard Config", "default")
+            )
+        except win32ui.error:
+            import traceback
+
+            traceback.print_exc()
+            pass
+
+        self.HookCommand(self.OnButSimple, win32ui.IDC_FOLD_ENABLE)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_RADIO1)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_RADIO2)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_RIGHTEDGE_ENABLE)
+        self.HookCommand(self.OnButEdgeColor, win32ui.IDC_RIGHTEDGE_DEFINE)
+
+        butMarginEnabled = self["Marker Margin Width"] > 0
+        self.GetDlgItem(win32ui.IDC_RADIO1).SetCheck(butMarginEnabled)
+        self.GetDlgItem(win32ui.IDC_RADIO2).SetCheck(not butMarginEnabled)
+
+        self.edgeColor = self.initialEdgeColor = GetEditorOption(
+            "Right Edge Color", win32api.RGB(0xEF, 0xEF, 0xEF)
+        )
+        for spinner_id in (win32ui.IDC_SPIN1, win32ui.IDC_SPIN2, win32ui.IDC_SPIN3):
+            spinner = self.GetDlgItem(spinner_id)
+            spinner.SetRange(0, 100)
+        self.UpdateUIForState()
+
+        return rc
+
+    def OnButSimple(self, id, code):
+        if code == win32con.BN_CLICKED:
+            self.UpdateUIForState()
+
+    def OnButEdgeColor(self, id, code):
+        if code == win32con.BN_CLICKED:
+            d = win32ui.CreateColorDialog(self.edgeColor, 0, self)
+            # Ensure the current color is a custom color (as it may not be in the swatch)
+            # plus some other nice gray scales.
+            ccs = [self.edgeColor]
+            for c in range(0xEF, 0x4F, -0x10):
+                ccs.append(win32api.RGB(c, c, c))
+            d.SetCustomColors(ccs)
+            if d.DoModal() == win32con.IDOK:
+                self.edgeColor = d.GetColor()
+                self.UpdateUIForState()
+
+    def UpdateUIForState(self):
+        folding = self.GetDlgItem(win32ui.IDC_FOLD_ENABLE).GetCheck()
+        self.GetDlgItem(win32ui.IDC_FOLD_ON_OPEN).EnableWindow(folding)
+        self.GetDlgItem(win32ui.IDC_FOLD_SHOW_LINES).EnableWindow(folding)
+
+        widthEnabled = self.GetDlgItem(win32ui.IDC_RADIO1).GetCheck()
+        self.GetDlgItem(win32ui.IDC_MARGIN_MARKER).EnableWindow(widthEnabled)
+        self.UpdateData()  # Ensure self[] is up to date with the control data.
+        if widthEnabled and self["Marker Margin Width"] == 0:
+            self["Marker Margin Width"] = 16
+            self.UpdateData(0)  # Ensure control up to date with self[]
+
+        # Right edge
+        edgeEnabled = self.GetDlgItem(win32ui.IDC_RIGHTEDGE_ENABLE).GetCheck()
+        self.GetDlgItem(win32ui.IDC_RIGHTEDGE_COLUMN).EnableWindow(edgeEnabled)
+        self.GetDlgItem(win32ui.IDC_RIGHTEDGE_SAMPLE).EnableWindow(edgeEnabled)
+        self.GetDlgItem(win32ui.IDC_RIGHTEDGE_DEFINE).EnableWindow(edgeEnabled)
+
+        edit = self.GetDlgItem(win32ui.IDC_RIGHTEDGE_SAMPLE)
+        edit.SetBackgroundColor(0, self.edgeColor)
+
+    def OnOK(self):
+        for name, defVal in self.autooptions:
+            SetEditorOption(name, self[name])
+        # Margin width gets handled differently.
+        if self["MarkersInMargin"] == 0:
+            SetEditorOption("Marker Margin Width", self["Marker Margin Width"])
+        else:
+            SetEditorOption("Marker Margin Width", 0)
+        if self.edgeColor != self.initialEdgeColor:
+            SetEditorOption("Right Edge Color", self.edgeColor)
+        if self["bVSS"]:
+            SetEditorOption("Source Control Module", "pywin.framework.editor.vss")
+        else:
+            if (
+                GetEditorOption("Source Control Module", "")
+                == "pywin.framework.editor.vss"
+            ):
+                SetEditorOption("Source Control Module", "")
+        # Keyboard config
+        configname = self.GetDlgItem(win32ui.IDC_KEYBOARD_CONFIG).GetWindowText()
+        if configname:
+            if configname == "default":
+                DeleteEditorOption("Keyboard Config")
+            else:
+                SetEditorOption("Keyboard Config", configname)
+
+            import pywin.scintilla.view
+
+            pywin.scintilla.view.LoadConfiguration()
+
+        # Now tell all views we have changed.
+        ##		for doc in editorTemplate.GetDocumentList():
+        ##			for view in doc.GetAllViews():
+        ##				try:
+        ##					fn = view.OnConfigChange
+        ##				except AttributeError:
+        ##					continue
+        ##				fn()
+        return 1
+
+
+class EditorWhitespacePropertyPage(dialog.PropertyPage):
+    def __init__(self):
+        dialog.PropertyPage.__init__(self, win32ui.IDD_PP_TABS)
+        self.autooptions = []
+        self._AddEditorOption(win32ui.IDC_TAB_SIZE, "i", "Tab Size", 4)
+        self._AddEditorOption(win32ui.IDC_INDENT_SIZE, "i", "Indent Size", 4)
+        self._AddEditorOption(win32ui.IDC_USE_SMART_TABS, "i", "Smart Tabs", 1)
+        self._AddEditorOption(win32ui.IDC_VIEW_WHITESPACE, "i", "View Whitespace", 0)
+        self._AddEditorOption(win32ui.IDC_VIEW_EOL, "i", "View EOL", 0)
+        self._AddEditorOption(
+            win32ui.IDC_VIEW_INDENTATIONGUIDES, "i", "View Indentation Guides", 0
+        )
+
+    def _AddEditorOption(self, idd, typ, optionName, defaultVal):
+        self.AddDDX(idd, optionName, typ)
+        self[optionName] = GetEditorOption(optionName, defaultVal)
+        self.autooptions.append((optionName, defaultVal))
+
+    def OnInitDialog(self):
+        for name, val in self.autooptions:
+            self[name] = GetEditorOption(name, val)
+
+        rc = dialog.PropertyPage.OnInitDialog(self)
+
+        idc = win32ui.IDC_TABTIMMY_NONE
+        if GetEditorOption("Use Tab Timmy", 1):
+            idc = win32ui.IDC_TABTIMMY_IND
+        self.GetDlgItem(idc).SetCheck(1)
+
+        idc = win32ui.IDC_RADIO1
+        if GetEditorOption("Use Tabs", 0):
+            idc = win32ui.IDC_USE_TABS
+        self.GetDlgItem(idc).SetCheck(1)
+
+        tt_color = GetEditorOption("Tab Timmy Color", win32api.RGB(0xFF, 0, 0))
+        self.cbo = self.GetDlgItem(win32ui.IDC_COMBO1)
+        for c in paletteVGA:
+            self.cbo.AddString(c[0])
+        sel = 0
+        for c in paletteVGA:
+            if tt_color == win32api.RGB(c[1], c[2], c[3]):
+                break
+            sel = sel + 1
+        else:
+            sel = -1
+        self.cbo.SetCurSel(sel)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_TABTIMMY_NONE)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_TABTIMMY_IND)
+        self.HookCommand(self.OnButSimple, win32ui.IDC_TABTIMMY_BG)
+        # Set ranges for the spinners.
+        for spinner_id in [win32ui.IDC_SPIN1, win32ui.IDC_SPIN2]:
+            spinner = self.GetDlgItem(spinner_id)
+            spinner.SetRange(1, 16)
+        return rc
+
+    def OnButSimple(self, id, code):
+        if code == win32con.BN_CLICKED:
+            self.UpdateUIForState()
+
+    def UpdateUIForState(self):
+        timmy = self.GetDlgItem(win32ui.IDC_TABTIMMY_NONE).GetCheck()
+        self.GetDlgItem(win32ui.IDC_COMBO1).EnableWindow(not timmy)
+
+    def OnOK(self):
+        for name, defVal in self.autooptions:
+            SetEditorOption(name, self[name])
+
+        SetEditorOption("Use Tabs", self.GetDlgItem(win32ui.IDC_USE_TABS).GetCheck())
+
+        SetEditorOption(
+            "Use Tab Timmy", self.GetDlgItem(win32ui.IDC_TABTIMMY_IND).GetCheck()
+        )
+        c = paletteVGA[self.cbo.GetCurSel()]
+        SetEditorOption("Tab Timmy Color", win32api.RGB(c[1], c[2], c[3]))
+
+        return 1
+
+
+def testpp():
+    ps = dialog.PropertySheet("Editor Options")
+    ps.AddPage(EditorWhitespacePropertyPage())
+    ps.DoModal()
+
+
+if __name__ == "__main__":
+    testpp()

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/document.py

@@ -0,0 +1,378 @@
+# We no longer support the old, non-colour editor!
+
+from pywin.mfc import docview, object
+from pywin.framework.editor import GetEditorOption
+import win32ui
+import os
+import win32con
+import string
+import traceback
+import win32api
+import shutil
+
+BAK_NONE = 0
+BAK_DOT_BAK = 1
+BAK_DOT_BAK_TEMP_DIR = 2
+BAK_DOT_BAK_BAK_DIR = 3
+
+MSG_CHECK_EXTERNAL_FILE = (
+    win32con.WM_USER + 1999
+)  ## WARNING: Duplicated in editor.py and coloreditor.py
+
+import pywin.scintilla.document
+
+ParentEditorDocument = pywin.scintilla.document.CScintillaDocument
+
+
+class EditorDocumentBase(ParentEditorDocument):
+    def __init__(self, template):
+        self.bAutoReload = GetEditorOption("Auto Reload", 1)
+        self.bDeclinedReload = 0  # Has the user declined to reload.
+        self.fileStat = None
+        self.bReportedFileNotFound = 0
+
+        # what sort of bak file should I create.
+        # default to write to %temp%/bak/filename.ext
+        self.bakFileType = GetEditorOption("Backup Type", BAK_DOT_BAK_BAK_DIR)
+
+        self.watcherThread = FileWatchingThread(self)
+        self.watcherThread.CreateThread()
+        # Should I try and use VSS integration?
+        self.scModuleName = GetEditorOption("Source Control Module", "")
+        self.scModule = None  # Loaded when first used.
+        ParentEditorDocument.__init__(self, template, template.CreateWin32uiDocument())
+
+    def OnCloseDocument(self):
+        self.watcherThread.SignalStop()
+        return self._obj_.OnCloseDocument()
+
+    # 	def OnOpenDocument(self, name):
+    # 		rc = ParentEditorDocument.OnOpenDocument(self, name)
+    # 		self.GetFirstView()._SetLoadedText(self.text)
+    # 		self._DocumentStateChanged()
+    # 		return rc
+
+    def OnSaveDocument(self, fileName):
+        win32ui.SetStatusText("Saving file...", 1)
+        # rename to bak if required.
+        dir, basename = os.path.split(fileName)
+        if self.bakFileType == BAK_DOT_BAK:
+            bakFileName = dir + "\\" + os.path.splitext(basename)[0] + ".bak"
+        elif self.bakFileType == BAK_DOT_BAK_TEMP_DIR:
+            bakFileName = (
+                win32api.GetTempPath() + "\\" + os.path.splitext(basename)[0] + ".bak"
+            )
+        elif self.bakFileType == BAK_DOT_BAK_BAK_DIR:
+            tempPath = os.path.join(win32api.GetTempPath(), "bak")
+            try:
+                os.mkdir(tempPath, 0)
+            except os.error:
+                pass
+            bakFileName = os.path.join(tempPath, basename)
+        try:
+            os.unlink(bakFileName)  # raise NameError if no bakups wanted.
+        except (os.error, NameError):
+            pass
+        try:
+            # Do a copy as it might be on different volumes,
+            # and the file may be a hard-link, causing the link
+            # to follow the backup.
+            shutil.copy2(fileName, bakFileName)
+        except (os.error, NameError, IOError):
+            pass
+        try:
+            self.SaveFile(fileName)
+        except IOError as details:
+            win32ui.MessageBox("Error - could not save file\r\n\r\n%s" % details)
+            return 0
+        except (UnicodeEncodeError, LookupError) as details:
+            rc = win32ui.MessageBox(
+                "Encoding failed: \r\n%s" % details
+                + "\r\nPlease add desired source encoding as first line of file, eg \r\n"
+                + "# -*- coding: mbcs -*-\r\n\r\n"
+                + "If you continue, the file will be saved as binary and will\r\n"
+                + "not be valid in the declared encoding.\r\n\r\n"
+                + "Save the file as binary with an invalid encoding?",
+                "File save failed",
+                win32con.MB_YESNO | win32con.MB_DEFBUTTON2,
+            )
+            if rc == win32con.IDYES:
+                try:
+                    self.SaveFile(fileName, encoding="latin-1")
+                except IOError as details:
+                    win32ui.MessageBox(
+                        "Error - could not save file\r\n\r\n%s" % details
+                    )
+                    return 0
+            else:
+                return 0
+        self.SetModifiedFlag(0)  # No longer dirty
+        self.bDeclinedReload = 0  # They probably want to know if it changes again!
+        win32ui.AddToRecentFileList(fileName)
+        self.SetPathName(fileName)
+        win32ui.SetStatusText("Ready")
+        self._DocumentStateChanged()
+        return 1
+
+    def FinalizeViewCreation(self, view):
+        ParentEditorDocument.FinalizeViewCreation(self, view)
+        if view == self.GetFirstView():
+            self._DocumentStateChanged()
+            if view.bFolding and GetEditorOption("Fold On Open", 0):
+                view.FoldTopLevelEvent()
+
+    def HookViewNotifications(self, view):
+        ParentEditorDocument.HookViewNotifications(self, view)
+
+    # Support for reloading the document from disk - presumably after some
+    # external application has modified it (or possibly source control has
+    # checked it out.
+    def ReloadDocument(self):
+        """Reloads the document from disk.  Assumes the file has
+        been saved and user has been asked if necessary - it just does it!
+        """
+        win32ui.SetStatusText("Reloading document.  Please wait...", 1)
+        self.SetModifiedFlag(0)
+        # Loop over all views, saving their state, then reload the document
+        views = self.GetAllViews()
+        states = []
+        for view in views:
+            try:
+                info = view._PrepareUserStateChange()
+            except AttributeError:  # Not our editor view?
+                info = None
+            states.append(info)
+        self.OnOpenDocument(self.GetPathName())
+        for view, info in zip(views, states):
+            if info is not None:
+                view._EndUserStateChange(info)
+        self._DocumentStateChanged()
+        win32ui.SetStatusText("Document reloaded.")
+
+    # Reloading the file
+    def CheckExternalDocumentUpdated(self):
+        if self.bDeclinedReload or not self.GetPathName():
+            return
+        try:
+            newstat = os.stat(self.GetPathName())
+        except os.error as exc:
+            if not self.bReportedFileNotFound:
+                print(
+                    "The file '%s' is open for editing, but\nchecking it for changes caused the error: %s"
+                    % (self.GetPathName(), exc.strerror)
+                )
+                self.bReportedFileNotFound = 1
+            return
+        if self.bReportedFileNotFound:
+            print(
+                "The file '%s' has re-appeared - continuing to watch for changes..."
+                % (self.GetPathName(),)
+            )
+            self.bReportedFileNotFound = (
+                0  # Once found again we want to start complaining.
+            )
+        changed = (
+            (self.fileStat is None)
+            or self.fileStat[0] != newstat[0]
+            or self.fileStat[6] != newstat[6]
+            or self.fileStat[8] != newstat[8]
+            or self.fileStat[9] != newstat[9]
+        )
+        if changed:
+            question = None
+            if self.IsModified():
+                question = (
+                    "%s\r\n\r\nThis file has been modified outside of the source editor.\r\nDo you want to reload it and LOSE THE CHANGES in the source editor?"
+                    % self.GetPathName()
+                )
+                mbStyle = win32con.MB_YESNO | win32con.MB_DEFBUTTON2  # Default to "No"
+            else:
+                if not self.bAutoReload:
+                    question = (
+                        "%s\r\n\r\nThis file has been modified outside of the source editor.\r\nDo you want to reload it?"
+                        % self.GetPathName()
+                    )
+                    mbStyle = win32con.MB_YESNO  # Default to "Yes"
+            if question:
+                rc = win32ui.MessageBox(question, None, mbStyle)
+                if rc != win32con.IDYES:
+                    self.bDeclinedReload = 1
+                    return
+            self.ReloadDocument()
+
+    def _DocumentStateChanged(self):
+        """Called whenever the documents state (on disk etc) has been changed
+        by the editor (eg, as the result of a save operation)
+        """
+        if self.GetPathName():
+            try:
+                self.fileStat = os.stat(self.GetPathName())
+            except os.error:
+                self.fileStat = None
+        else:
+            self.fileStat = None
+        self.watcherThread._DocumentStateChanged()
+        self._UpdateUIForState()
+        self._ApplyOptionalToViews("_UpdateUIForState")
+        self._ApplyOptionalToViews("SetReadOnly", self._IsReadOnly())
+        self._ApplyOptionalToViews("SCISetSavePoint")
+        # Allow the debugger to reset us too.
+        import pywin.debugger
+
+        if pywin.debugger.currentDebugger is not None:
+            pywin.debugger.currentDebugger.UpdateDocumentLineStates(self)
+
+    # Read-only document support - make it obvious to the user
+    # that the file is read-only.
+    def _IsReadOnly(self):
+        return self.fileStat is not None and (self.fileStat[0] & 128) == 0
+
+    def _UpdateUIForState(self):
+        """Change the title to reflect the state of the document -
+        eg ReadOnly, Dirty, etc
+        """
+        filename = self.GetPathName()
+        if not filename:
+            return  # New file - nothing to do
+        try:
+            # This seems necessary so the internal state of the window becomes
+            # "visible".  without it, it is still shown, but certain functions
+            # (such as updating the title) dont immediately work?
+            self.GetFirstView().ShowWindow(win32con.SW_SHOW)
+            title = win32ui.GetFileTitle(filename)
+        except win32ui.error:
+            title = filename
+        if self._IsReadOnly():
+            title = title + " (read-only)"
+        self.SetTitle(title)
+
+    def MakeDocumentWritable(self):
+        pretend_ss = 0  # Set to 1 to test this without source safe :-)
+        if not self.scModuleName and not pretend_ss:  # No Source Control support.
+            win32ui.SetStatusText(
+                "Document is read-only, and no source-control system is configured"
+            )
+            win32api.MessageBeep()
+            return 0
+
+        # We have source control support - check if the user wants to use it.
+        msg = "Would you like to check this file out?"
+        defButton = win32con.MB_YESNO
+        if self.IsModified():
+            msg = msg + "\r\n\r\nALL CHANGES IN THE EDITOR WILL BE LOST"
+            defButton = win32con.MB_YESNO
+        if win32ui.MessageBox(msg, None, defButton) != win32con.IDYES:
+            return 0
+
+        if pretend_ss:
+            print("We are only pretending to check it out!")
+            win32api.SetFileAttributes(
+                self.GetPathName(), win32con.FILE_ATTRIBUTE_NORMAL
+            )
+            self.ReloadDocument()
+            return 1
+
+        # Now call on the module to do it.
+        if self.scModule is None:
+            try:
+                self.scModule = __import__(self.scModuleName)
+                for part in self.scModuleName.split(".")[1:]:
+                    self.scModule = getattr(self.scModule, part)
+            except:
+                traceback.print_exc()
+                print("Error loading source control module.")
+                return 0
+
+        if self.scModule.CheckoutFile(self.GetPathName()):
+            self.ReloadDocument()
+            return 1
+        return 0
+
+    def CheckMakeDocumentWritable(self):
+        if self._IsReadOnly():
+            return self.MakeDocumentWritable()
+        return 1
+
+    def SaveModified(self):
+        # Called as the document is closed.  If we are about
+        # to prompt for a save, bring the document to the foreground.
+        if self.IsModified():
+            frame = self.GetFirstView().GetParentFrame()
+            try:
+                frame.MDIActivate()
+                frame.AutoRestore()
+            except:
+                print("Could not bring document to foreground")
+        return self._obj_.SaveModified()
+
+
+# NOTE - I DONT use the standard threading module,
+# as this waits for all threads to terminate at shutdown.
+# When using the debugger, it is possible shutdown will
+# occur without Pythonwin getting a complete shutdown,
+# so we deadlock at the end - threading is waiting for
+import pywin.mfc.thread
+import win32event
+
+
+class FileWatchingThread(pywin.mfc.thread.WinThread):
+    def __init__(self, doc):
+        self.doc = doc
+        self.adminEvent = win32event.CreateEvent(None, 0, 0, None)
+        self.stopEvent = win32event.CreateEvent(None, 0, 0, None)
+        self.watchEvent = None
+        pywin.mfc.thread.WinThread.__init__(self)
+
+    def _DocumentStateChanged(self):
+        win32event.SetEvent(self.adminEvent)
+
+    def RefreshEvent(self):
+        self.hwnd = self.doc.GetFirstView().GetSafeHwnd()
+        if self.watchEvent is not None:
+            win32api.FindCloseChangeNotification(self.watchEvent)
+            self.watchEvent = None
+        path = self.doc.GetPathName()
+        if path:
+            path = os.path.dirname(path)
+        if path:
+            filter = (
+                win32con.FILE_NOTIFY_CHANGE_FILE_NAME
+                | win32con.FILE_NOTIFY_CHANGE_ATTRIBUTES
+                | win32con.FILE_NOTIFY_CHANGE_LAST_WRITE
+            )
+            try:
+                self.watchEvent = win32api.FindFirstChangeNotification(path, 0, filter)
+            except win32api.error as exc:
+                print("Can not watch file", path, "for changes -", exc.strerror)
+
+    def SignalStop(self):
+        win32event.SetEvent(self.stopEvent)
+
+    def Run(self):
+        while 1:
+            handles = [self.stopEvent, self.adminEvent]
+            if self.watchEvent is not None:
+                handles.append(self.watchEvent)
+            rc = win32event.WaitForMultipleObjects(handles, 0, win32event.INFINITE)
+            if rc == win32event.WAIT_OBJECT_0:
+                break
+            elif rc == win32event.WAIT_OBJECT_0 + 1:
+                self.RefreshEvent()
+            else:
+                win32api.PostMessage(self.hwnd, MSG_CHECK_EXTERNAL_FILE, 0, 0)
+                try:
+                    # If the directory has been removed underneath us, we get this error.
+                    win32api.FindNextChangeNotification(self.watchEvent)
+                except win32api.error as exc:
+                    print(
+                        "Can not watch file",
+                        self.doc.GetPathName(),
+                        "for changes -",
+                        exc.strerror,
+                    )
+                    break
+
+        # close a circular reference
+        self.doc = None
+        if self.watchEvent:
+            win32api.FindCloseChangeNotification(self.watchEvent)

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/editor.py

@@ -0,0 +1,526 @@
+#####################################################################
+#
+# editor.py
+#
+# A general purpose text editor, built on top of the win32ui edit
+# type, which is built on an MFC CEditView
+#
+#
+# We now support reloading of externally modified documented
+# (eg, presumably by some other process, such as source control or
+# another editor.
+# We also suport auto-loading of externally modified files.
+# - if the current document has not been modified in this
+# editor, but has been modified on disk, then the file
+# can be automatically reloaded.
+#
+# Note that it will _always_ prompt you if the file in the editor has been modified.
+
+
+import win32ui
+import win32api
+import win32con
+import regex
+import re
+import string
+import sys, os
+import traceback
+from pywin.mfc import docview, dialog, afxres
+
+from pywin.framework.editor import (
+    GetEditorOption,
+    SetEditorOption,
+    GetEditorFontOption,
+    SetEditorFontOption,
+    defaultCharacterFormat,
+)
+
+patImport = regex.symcomp("import \(<name>.*\)")
+patIndent = regex.compile("^\\([ \t]*[~ \t]\\)")
+
+ID_LOCATE_FILE = 0xE200
+ID_GOTO_LINE = 0xE2001
+MSG_CHECK_EXTERNAL_FILE = (
+    win32con.WM_USER + 1999
+)  ## WARNING: Duplicated in document.py and coloreditor.py
+
+# Key Codes that modify the bufffer when Ctrl or Alt are NOT pressed.
+MODIFYING_VK_KEYS = [
+    win32con.VK_BACK,
+    win32con.VK_TAB,
+    win32con.VK_RETURN,
+    win32con.VK_SPACE,
+    win32con.VK_DELETE,
+]
+for k in range(48, 91):
+    MODIFYING_VK_KEYS.append(k)
+
+# Key Codes that modify the bufffer when Ctrl is pressed.
+MODIFYING_VK_KEYS_CTRL = [
+    win32con.VK_BACK,
+    win32con.VK_RETURN,
+    win32con.VK_SPACE,
+    win32con.VK_DELETE,
+]
+
+# Key Codes that modify the bufffer when Alt is pressed.
+MODIFYING_VK_KEYS_ALT = [
+    win32con.VK_BACK,
+    win32con.VK_RETURN,
+    win32con.VK_SPACE,
+    win32con.VK_DELETE,
+]
+
+
+# The editor itself starts here.
+# Using the MFC Document/View model, we have an EditorDocument, which is responsible for
+# managing the contents of the file, and a view which is responsible for rendering it.
+#
+# Due to a limitation in the Windows edit controls, we are limited to one view
+# per document, although nothing in this code assumes this (I hope!)
+
+isRichText = 1  # We are using the Rich Text control.  This has not been tested with value "0" for quite some time!
+
+# ParentEditorDocument=docview.Document
+from .document import EditorDocumentBase
+
+ParentEditorDocument = EditorDocumentBase
+
+
+class EditorDocument(ParentEditorDocument):
+    #
+    # File loading and saving operations
+    #
+    def OnOpenDocument(self, filename):
+        #
+        # handle Unix and PC text file format.
+        #
+
+        # Get the "long name" of the file name, as it may have been translated
+        # to short names by the shell.
+        self.SetPathName(filename)  # Must set this early!
+        # Now do the work!
+        self.BeginWaitCursor()
+        win32ui.SetStatusText("Loading file...", 1)
+        try:
+            f = open(filename, "rb")
+        except IOError:
+            win32ui.MessageBox(
+                filename
+                + "\nCan not find this file\nPlease verify that the correct path and file name are given"
+            )
+            self.EndWaitCursor()
+            return 0
+        raw = f.read()
+        f.close()
+        contents = self.TranslateLoadedData(raw)
+        rc = 0
+        if win32ui.IsWin32s() and len(contents) > 62000:  # give or take a few bytes
+            win32ui.MessageBox(
+                "This file is too big for Python on Windows 3.1\r\nPlease use another editor to view this file."
+            )
+        else:
+            try:
+                self.GetFirstView().SetWindowText(contents)
+                rc = 1
+            except TypeError:  # Null byte in file.
+                win32ui.MessageBox(
+                    "This file contains NULL bytes, and can not be edited"
+                )
+                rc = 0
+
+            self.EndWaitCursor()
+            self.SetModifiedFlag(0)  # No longer dirty
+            self._DocumentStateChanged()
+        return rc
+
+    def TranslateLoadedData(self, data):
+        """Given raw data read from a file, massage it suitable for the edit window"""
+        # if a CR in the first 250 chars, then perform the expensive translate
+        if data[:250].find("\r") == -1:
+            win32ui.SetStatusText(
+                "Translating from Unix file format - please wait...", 1
+            )
+            return re.sub("\r*\n", "\r\n", data)
+        else:
+            return data
+
+    def SaveFile(self, fileName, encoding=None):
+        if isRichText:
+            view = self.GetFirstView()
+            view.SaveTextFile(fileName, encoding=encoding)
+        else:  # Old style edit view window.
+            self.GetFirstView().SaveFile(fileName)
+        try:
+            # Make sure line cache has updated info about me!
+            import linecache
+
+            linecache.checkcache()
+        except:
+            pass
+
+    #
+    # Color state stuff
+    #
+    def SetAllLineColors(self, color=None):
+        for view in self.GetAllViews():
+            view.SetAllLineColors(color)
+
+    def SetLineColor(self, lineNo, color):
+        "Color a line of all views"
+        for view in self.GetAllViews():
+            view.SetLineColor(lineNo, color)
+
+
+# 	def StreamTextOut(self, data): ### This seems unreliable???
+# 		self.saveFileHandle.write(data)
+# 		return 1 # keep em coming!
+
+# ParentEditorView=docview.EditView
+ParentEditorView = docview.RichEditView
+
+
+class EditorView(ParentEditorView):
+    def __init__(self, doc):
+        ParentEditorView.__init__(self, doc)
+        if isRichText:
+            self.SetWordWrap(win32ui.CRichEditView_WrapNone)
+
+        self.addToMRU = 1
+        self.HookHandlers()
+        self.bCheckingFile = 0
+
+        self.defCharFormat = GetEditorFontOption("Default Font", defaultCharacterFormat)
+
+        # Smart tabs override everything else if context can be worked out.
+        self.bSmartTabs = GetEditorOption("Smart Tabs", 1)
+
+        self.tabSize = GetEditorOption("Tab Size", 8)
+        self.indentSize = GetEditorOption("Indent Size", 8)
+        # If next indent is at a tab position, and useTabs is set, a tab will be inserted.
+        self.bUseTabs = GetEditorOption("Use Tabs", 1)
+
+    def OnInitialUpdate(self):
+        rc = self._obj_.OnInitialUpdate()
+        self.SetDefaultCharFormat(self.defCharFormat)
+        return rc
+
+    def CutCurLine(self):
+        curLine = self._obj_.LineFromChar()
+        nextLine = curLine + 1
+        start = self._obj_.LineIndex(curLine)
+        end = self._obj_.LineIndex(nextLine)
+        if end == 0:  # must be last line.
+            end = start + self.end.GetLineLength(curLine)
+        self._obj_.SetSel(start, end)
+        self._obj_.Cut()
+
+    def _PrepareUserStateChange(self):
+        "Return selection, lineindex, etc info, so it can be restored"
+        self.SetRedraw(0)
+        return self.GetModify(), self.GetSel(), self.GetFirstVisibleLine()
+
+    def _EndUserStateChange(self, info):
+        scrollOff = info[2] - self.GetFirstVisibleLine()
+        if scrollOff:
+            self.LineScroll(scrollOff)
+        self.SetSel(info[1])
+        self.SetModify(info[0])
+        self.SetRedraw(1)
+        self.InvalidateRect()
+        self.UpdateWindow()
+
+    def _UpdateUIForState(self):
+        self.SetReadOnly(self.GetDocument()._IsReadOnly())
+
+    def SetAllLineColors(self, color=None):
+        if isRichText:
+            info = self._PrepareUserStateChange()
+            try:
+                if color is None:
+                    color = self.defCharFormat[4]
+                self.SetSel(0, -1)
+                self.SetSelectionCharFormat((win32con.CFM_COLOR, 0, 0, 0, color))
+            finally:
+                self._EndUserStateChange(info)
+
+    def SetLineColor(self, lineNo, color):
+        "lineNo is the 1 based line number to set.  If color is None, default color is used."
+        if isRichText:
+            info = self._PrepareUserStateChange()
+            try:
+                if color is None:
+                    color = self.defCharFormat[4]
+                lineNo = lineNo - 1
+                startIndex = self.LineIndex(lineNo)
+                if startIndex != -1:
+                    self.SetSel(startIndex, self.LineIndex(lineNo + 1))
+                    self.SetSelectionCharFormat((win32con.CFM_COLOR, 0, 0, 0, color))
+            finally:
+                self._EndUserStateChange(info)
+
+    def Indent(self):
+        """Insert an indent to move the cursor to the next tab position.
+
+        Honors the tab size and 'use tabs' settings.  Assumes the cursor is already at the
+        position to be indented, and the selection is a single character (ie, not a block)
+        """
+        start, end = self._obj_.GetSel()
+        startLine = self._obj_.LineFromChar(start)
+        line = self._obj_.GetLine(startLine)
+        realCol = start - self._obj_.LineIndex(startLine)
+        # Calulate the next tab stop.
+        # Expand existing tabs.
+        curCol = 0
+        for ch in line[:realCol]:
+            if ch == "\t":
+                curCol = ((curCol / self.tabSize) + 1) * self.tabSize
+            else:
+                curCol = curCol + 1
+        nextColumn = ((curCol / self.indentSize) + 1) * self.indentSize
+        # 		print "curCol is", curCol, "nextColumn is", nextColumn
+        ins = None
+        if self.bSmartTabs:
+            # Look for some context.
+            if realCol == 0:  # Start of the line - see if the line above can tell us
+                lookLine = startLine - 1
+                while lookLine >= 0:
+                    check = self._obj_.GetLine(lookLine)[0:1]
+                    if check in ["\t", " "]:
+                        ins = check
+                        break
+                    lookLine = lookLine - 1
+            else:  # See if the previous char can tell us
+                check = line[realCol - 1]
+                if check in ["\t", " "]:
+                    ins = check
+
+        # Either smart tabs off, or not smart enough!
+        # Use the "old style" settings.
+        if ins is None:
+            if self.bUseTabs and nextColumn % self.tabSize == 0:
+                ins = "\t"
+            else:
+                ins = " "
+
+        if ins == " ":
+            # Calc the number of spaces to take us to the next stop
+            ins = ins * (nextColumn - curCol)
+
+        self._obj_.ReplaceSel(ins)
+
+    def BlockDent(self, isIndent, startLine, endLine):
+        "Indent/Undent all lines specified"
+        if not self.GetDocument().CheckMakeDocumentWritable():
+            return 0
+        tabSize = self.tabSize  # hard-code for now!
+        info = self._PrepareUserStateChange()
+        try:
+            for lineNo in range(startLine, endLine):
+                pos = self._obj_.LineIndex(lineNo)
+                self._obj_.SetSel(pos, pos)
+                if isIndent:
+                    self.Indent()
+                else:
+                    line = self._obj_.GetLine(lineNo)
+                    try:
+                        noToDel = 0
+                        if line[0] == "\t":
+                            noToDel = 1
+                        elif line[0] == " ":
+                            for noToDel in range(0, tabSize):
+                                if line[noToDel] != " ":
+                                    break
+                            else:
+                                noToDel = tabSize
+                        if noToDel:
+                            self._obj_.SetSel(pos, pos + noToDel)
+                            self._obj_.Clear()
+                    except IndexError:
+                        pass
+        finally:
+            self._EndUserStateChange(info)
+        self.GetDocument().SetModifiedFlag(1)  # Now dirty
+        self._obj_.SetSel(self.LineIndex(startLine), self.LineIndex(endLine))
+
+    def GotoLine(self, lineNo=None):
+        try:
+            if lineNo is None:
+                lineNo = int(input("Enter Line Number"))
+        except (ValueError, KeyboardInterrupt):
+            return 0
+        self.GetLineCount()  # Seems to be needed when file first opened???
+        charNo = self.LineIndex(lineNo - 1)
+        self.SetSel(charNo)
+
+    def HookHandlers(self):  # children can override, but should still call me!
+        # 		self.HookAllKeyStrokes(self.OnKey)
+        self.HookMessage(self.OnCheckExternalDocumentUpdated, MSG_CHECK_EXTERNAL_FILE)
+        self.HookMessage(self.OnRClick, win32con.WM_RBUTTONDOWN)
+        self.HookMessage(self.OnSetFocus, win32con.WM_SETFOCUS)
+        self.HookMessage(self.OnKeyDown, win32con.WM_KEYDOWN)
+        self.HookKeyStroke(self.OnKeyCtrlY, 25)  # ^Y
+        self.HookKeyStroke(self.OnKeyCtrlG, 7)  # ^G
+        self.HookKeyStroke(self.OnKeyTab, 9)  # TAB
+        self.HookKeyStroke(self.OnKeyEnter, 13)  # Enter
+        self.HookCommand(self.OnCmdLocateFile, ID_LOCATE_FILE)
+        self.HookCommand(self.OnCmdGotoLine, ID_GOTO_LINE)
+        self.HookCommand(self.OnEditPaste, afxres.ID_EDIT_PASTE)
+        self.HookCommand(self.OnEditCut, afxres.ID_EDIT_CUT)
+
+    # Hook Handlers
+    def OnSetFocus(self, msg):
+        # Even though we use file change notifications, we should be very sure about it here.
+        self.OnCheckExternalDocumentUpdated(msg)
+
+    def OnRClick(self, params):
+        menu = win32ui.CreatePopupMenu()
+
+        # look for a module name
+        line = self._obj_.GetLine().strip()
+        flags = win32con.MF_STRING | win32con.MF_ENABLED
+        if patImport.match(line) == len(line):
+            menu.AppendMenu(
+                flags, ID_LOCATE_FILE, "&Locate %s.py" % patImport.group("name")
+            )
+            menu.AppendMenu(win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_UNDO, "&Undo")
+        menu.AppendMenu(win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_CUT, "Cu&t")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_COPY, "&Copy")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_PASTE, "&Paste")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_SELECT_ALL, "&Select all")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, ID_GOTO_LINE, "&Goto line...")
+        menu.TrackPopupMenu(params[5])
+        return 0
+
+    def OnCmdGotoLine(self, cmd, code):
+        self.GotoLine()
+        return 0
+
+    def OnCmdLocateFile(self, cmd, code):
+        modName = patImport.group("name")
+        if not modName:
+            return 0
+        import pywin.framework.scriptutils
+
+        fileName = pywin.framework.scriptutils.LocatePythonFile(modName)
+        if fileName is None:
+            win32ui.SetStatusText("Can't locate module %s" % modName)
+        else:
+            win32ui.GetApp().OpenDocumentFile(fileName)
+        return 0
+
+    # Key handlers
+    def OnKeyEnter(self, key):
+        if not self.GetDocument().CheckMakeDocumentWritable():
+            return 0
+        curLine = self._obj_.GetLine()
+        self._obj_.ReplaceSel("\r\n")  # insert the newline
+        # If the current line indicates the next should be indented,
+        # then copy the current indentation to this line.
+        res = patIndent.match(curLine, 0)
+        if res > 0 and curLine.strip():
+            curIndent = patIndent.group(1)
+            self._obj_.ReplaceSel(curIndent)
+        return 0  # dont pass on
+
+    def OnKeyCtrlY(self, key):
+        if not self.GetDocument().CheckMakeDocumentWritable():
+            return 0
+        self.CutCurLine()
+        return 0  # dont let him have it!
+
+    def OnKeyCtrlG(self, key):
+        self.GotoLine()
+        return 0  # dont let him have it!
+
+    def OnKeyTab(self, key):
+        if not self.GetDocument().CheckMakeDocumentWritable():
+            return 0
+        start, end = self._obj_.GetSel()
+        if start == end:  # normal TAB key
+            self.Indent()
+            return 0  # we handled this.
+
+        # Otherwise it is a block indent/dedent.
+        if start > end:
+            start, end = end, start  # swap them.
+        startLine = self._obj_.LineFromChar(start)
+        endLine = self._obj_.LineFromChar(end)
+
+        self.BlockDent(win32api.GetKeyState(win32con.VK_SHIFT) >= 0, startLine, endLine)
+        return 0
+
+    def OnEditPaste(self, id, code):
+        # Return 1 if we can make the file editable.(or it already is!)
+        return self.GetDocument().CheckMakeDocumentWritable()
+
+    def OnEditCut(self, id, code):
+        # Return 1 if we can make the file editable.(or it already is!)
+        return self.GetDocument().CheckMakeDocumentWritable()
+
+    def OnKeyDown(self, msg):
+        key = msg[2]
+        if win32api.GetKeyState(win32con.VK_CONTROL) & 0x8000:
+            modList = MODIFYING_VK_KEYS_CTRL
+        elif win32api.GetKeyState(win32con.VK_MENU) & 0x8000:
+            modList = MODIFYING_VK_KEYS_ALT
+        else:
+            modList = MODIFYING_VK_KEYS
+
+        if key in modList:
+            # Return 1 if we can make the file editable.(or it already is!)
+            return self.GetDocument().CheckMakeDocumentWritable()
+        return 1  # Pass it on OK
+
+    # 	def OnKey(self, key):
+    # 		return self.GetDocument().CheckMakeDocumentWritable()
+
+    def OnCheckExternalDocumentUpdated(self, msg):
+        if self._obj_ is None or self.bCheckingFile:
+            return
+        self.bCheckingFile = 1
+        self.GetDocument().CheckExternalDocumentUpdated()
+        self.bCheckingFile = 0
+
+
+from .template import EditorTemplateBase
+
+
+class EditorTemplate(EditorTemplateBase):
+    def __init__(
+        self, res=win32ui.IDR_TEXTTYPE, makeDoc=None, makeFrame=None, makeView=None
+    ):
+        if makeDoc is None:
+            makeDoc = EditorDocument
+        if makeView is None:
+            makeView = EditorView
+        EditorTemplateBase.__init__(self, res, makeDoc, makeFrame, makeView)
+
+    def _CreateDocTemplate(self, resourceId):
+        return win32ui.CreateRichEditDocTemplate(resourceId)
+
+    def CreateWin32uiDocument(self):
+        return self.DoCreateRichEditDoc()
+
+
+def Create(fileName=None, title=None, template=None):
+    return editorTemplate.OpenDocumentFile(fileName)
+
+
+from pywin.framework.editor import GetDefaultEditorModuleName
+
+prefModule = GetDefaultEditorModuleName()
+# Initialize only if this is the "default" editor.
+if __name__ == prefModule:
+    # For debugging purposes, when this module may be reloaded many times.
+    try:
+        win32ui.GetApp().RemoveDocTemplate(editorTemplate)
+    except (NameError, win32ui.error):
+        pass
+
+    editorTemplate = EditorTemplate()
+    win32ui.GetApp().AddDocTemplate(editorTemplate)

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/frame.py

@@ -0,0 +1,76 @@
+# frame.py - The MDI frame window for an editor.
+import pywin.framework.window
+import win32ui
+import win32con
+import afxres
+
+from . import ModuleBrowser
+
+
+class EditorFrame(pywin.framework.window.MDIChildWnd):
+    def OnCreateClient(self, cp, context):
+
+        # Create the default view as specified by the template (ie, the editor view)
+        view = context.template.MakeView(context.doc)
+        # Create the browser view.
+        browserView = ModuleBrowser.BrowserView(context.doc)
+        view2 = context.template.MakeView(context.doc)
+
+        splitter = win32ui.CreateSplitter()
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE
+        splitter.CreateStatic(self, 1, 2, style, win32ui.AFX_IDW_PANE_FIRST)
+        sub_splitter = self.sub_splitter = win32ui.CreateSplitter()
+        sub_splitter.CreateStatic(splitter, 2, 1, style, win32ui.AFX_IDW_PANE_FIRST + 1)
+
+        # Note we must add the default view first, so that doc.GetFirstView() returns the editor view.
+        sub_splitter.CreateView(view, 1, 0, (0, 0))
+        splitter.CreateView(browserView, 0, 0, (0, 0))
+        sub_splitter.CreateView(view2, 0, 0, (0, 0))
+
+        ##        print "First view is", context.doc.GetFirstView()
+        ##        print "Views are", view, view2, browserView
+        ##        print "Parents are", view.GetParent(), view2.GetParent(), browserView.GetParent()
+        ##        print "Splitter is", splitter
+        ##        print "sub splitter is", sub_splitter
+        ## Old
+        ##        splitter.CreateStatic (self, 1, 2)
+        ##        splitter.CreateView(view, 0, 1, (0,0)) # size ignored.
+        ##        splitter.CreateView (browserView, 0, 0, (0, 0))
+
+        # Restrict the size of the browser splitter (and we can avoid filling
+        # it until it is shown)
+        splitter.SetColumnInfo(0, 10, 20)
+        # And the active view is our default view (so it gets initial focus)
+        self.SetActiveView(view)
+
+    def GetEditorView(self):
+        # In a multi-view (eg, splitter) environment, get
+        # an editor (ie, scintilla) view
+        # Look for the splitter opened the most!
+        if self.sub_splitter is None:
+            return self.GetDlgItem(win32ui.AFX_IDW_PANE_FIRST)
+        v1 = self.sub_splitter.GetPane(0, 0)
+        v2 = self.sub_splitter.GetPane(1, 0)
+        r1 = v1.GetWindowRect()
+        r2 = v2.GetWindowRect()
+        if r1[3] - r1[1] > r2[3] - r2[1]:
+            return v1
+        return v2
+
+    def GetBrowserView(self):
+        # XXX - should fix this :-)
+        return self.GetActiveDocument().GetAllViews()[1]
+
+    def OnClose(self):
+        doc = self.GetActiveDocument()
+        if not doc.SaveModified():
+            ## Cancel button selected from Save dialog, do not actually close
+            ## print 'close cancelled'
+            return 0
+        ## So the 'Save' dialog doesn't come up twice
+        doc._obj_.SetModifiedFlag(False)
+
+        # Must force the module browser to close itself here (OnDestroy for the view itself is too late!)
+        self.sub_splitter = None  # ensure no circles!
+        self.GetBrowserView().DestroyBrowser()
+        return self._obj_.OnClose()

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/template.py

@@ -0,0 +1,59 @@
+import string
+import win32ui
+import win32api
+from pywin.mfc import docview
+import pywin.framework.window
+import os
+from . import frame
+
+ParentEditorTemplate = docview.DocTemplate
+
+
+class EditorTemplateBase(ParentEditorTemplate):
+    def __init__(
+        self, res=win32ui.IDR_TEXTTYPE, makeDoc=None, makeFrame=None, makeView=None
+    ):
+        if makeFrame is None:
+            makeFrame = frame.EditorFrame
+        ParentEditorTemplate.__init__(self, res, makeDoc, makeFrame, makeView)
+
+    def _CreateDocTemplate(self, resourceId):
+        assert 0, "You must override this"
+
+    def CreateWin32uiDocument(self):
+        assert 0, "You must override this"
+
+    def GetFileExtensions(self):
+        return ".txt", ".py"
+
+    def MatchDocType(self, fileName, fileType):
+        doc = self.FindOpenDocument(fileName)
+        if doc:
+            return doc
+        ext = os.path.splitext(fileName)[1].lower()
+        if ext in self.GetFileExtensions():
+            return win32ui.CDocTemplate_Confidence_yesAttemptNative
+        return win32ui.CDocTemplate_Confidence_maybeAttemptForeign
+
+    def InitialUpdateFrame(self, frame, doc, makeVisible=1):
+        self._obj_.InitialUpdateFrame(frame, doc, makeVisible)  # call default handler.
+        doc._UpdateUIForState()
+
+    def GetPythonPropertyPages(self):
+        """Returns a list of property pages"""
+        from . import configui
+
+        return [configui.EditorPropertyPage(), configui.EditorWhitespacePropertyPage()]
+
+    def OpenDocumentFile(self, filename, bMakeVisible=1):
+        if filename is not None:
+            try:
+                path = os.path.split(filename)[0]
+                # 				print "The editor is translating", `filename`,"to",
+                filename = win32api.FindFiles(filename)[0][8]
+                filename = os.path.join(path, filename)
+            # 				print `filename`
+            except (win32api.error, IndexError) as details:
+                pass
+        # 				print "Couldnt get the full filename!", details
+        return self._obj_.OpenDocumentFile(filename, bMakeVisible)

.venv/Lib/site-packages/pythonwin/pywin/framework/editor/vss.py

@@ -0,0 +1,100 @@
+# vss.py -- Source Control using Microsoft VSS.
+
+# Provides routines for checking files out of VSS.
+#
+# Uses an INI file very similar to how VB integrates with VSS - even
+# as far as using the same name.
+
+# The file must be named "Mssccprj.scc", and be in the format of
+# an INI file.  This file may be in a parent directory, in which
+# case the project name will be built from what is specified in the
+# ini file, plus the path from the INI file to the file itself.
+#
+# The INI file should have a [Python] section, and a
+# Project=Project Name
+#  and optionally
+# Database=??
+
+
+import win32ui, win32api, win32con, os, string, sys
+
+import traceback
+
+g_iniName = "Mssccprj.scc"  # Use the same INI name as VB!
+
+g_sourceSafe = None
+
+
+def FindVssProjectInfo(fullfname):
+    """Looks up the file system for an INI file describing the project.
+
+    Looking up the tree is for ni style packages.
+
+    Returns (projectName, pathToFileName) where pathToFileName contains
+    the path from the ini file to the actual file.
+    """
+    path, fnameonly = os.path.split(fullfname)
+    origPath = path
+    project = ""
+    retPaths = [fnameonly]
+    while not project:
+        iniName = os.path.join(path, g_iniName)
+        database = win32api.GetProfileVal("Python", "Database", "", iniName)
+        project = win32api.GetProfileVal("Python", "Project", "", iniName)
+        if project:
+            break
+        # No valid INI file in this directory - look up a level.
+        path, addpath = os.path.split(path)
+        if not addpath:  # Root?
+            break
+        retPaths.insert(0, addpath)
+    if not project:
+        win32ui.MessageBox(
+            "%s\r\n\r\nThis directory is not configured for Python/VSS" % origPath
+        )
+        return
+    return project, "/".join(retPaths), database
+
+
+def CheckoutFile(fileName):
+    global g_sourceSafe
+    import pythoncom
+
+    ok = 0
+    # Assumes the fileName has a complete path,
+    # and that the INI file can be found in that path
+    # (or a parent path if a ni style package)
+    try:
+        import win32com.client, win32com.client.gencache
+
+        mod = win32com.client.gencache.EnsureModule(
+            "{783CD4E0-9D54-11CF-B8EE-00608CC9A71F}", 0, 5, 0
+        )
+        if mod is None:
+            win32ui.MessageBox(
+                "VSS does not appear to be installed.  The TypeInfo can not be created"
+            )
+            return ok
+
+        rc = FindVssProjectInfo(fileName)
+        if rc is None:
+            return
+        project, vssFname, database = rc
+        if g_sourceSafe is None:
+            g_sourceSafe = win32com.client.Dispatch("SourceSafe")
+            # SS seems a bit wierd.  It defaults the arguments as empty strings, but
+            # then complains when they are used - so we pass "Missing"
+            if not database:
+                database = pythoncom.Missing
+            g_sourceSafe.Open(database, pythoncom.Missing, pythoncom.Missing)
+        item = g_sourceSafe.VSSItem("$/%s/%s" % (project, vssFname))
+        item.Checkout(None, fileName)
+        ok = 1
+    except pythoncom.com_error as exc:
+        win32ui.MessageBox(exc.strerror, "Error checking out file")
+    except:
+        typ, val, tb = sys.exc_info()
+        traceback.print_exc()
+        win32ui.MessageBox("%s - %s" % (str(typ), str(val)), "Error checking out file")
+        tb = None  # Cleanup a cycle
+    return ok

.venv/Lib/site-packages/pythonwin/pywin/framework/help.py

@@ -0,0 +1,174 @@
+# help.py - help utilities for PythonWin.
+import win32api
+import win32con
+import win32ui
+import string
+import sys
+import regutil
+import string, os
+
+htmlhelp_handle = None
+
+html_help_command_translators = {
+    win32con.HELP_CONTENTS: 1,  # HH_DISPLAY_TOC
+    win32con.HELP_CONTEXT: 15,  # HH_HELP_CONTEXT
+    win32con.HELP_FINDER: 1,  # HH_DISPLAY_TOC
+}
+
+
+def FinalizeHelp():
+    global htmlhelp_handle
+    if htmlhelp_handle is not None:
+        import win32help
+
+        try:
+            # frame = win32ui.GetMainFrame().GetSafeHwnd()
+            frame = 0
+            win32help.HtmlHelp(frame, None, win32help.HH_UNINITIALIZE, htmlhelp_handle)
+        except win32help.error:
+            print("Failed to finalize htmlhelp!")
+        htmlhelp_handle = None
+
+
+def OpenHelpFile(fileName, helpCmd=None, helpArg=None):
+    "Open a help file, given a full path"
+    # default help arg.
+    win32ui.DoWaitCursor(1)
+    try:
+        if helpCmd is None:
+            helpCmd = win32con.HELP_CONTENTS
+        ext = os.path.splitext(fileName)[1].lower()
+        if ext == ".hlp":
+            win32api.WinHelp(
+                win32ui.GetMainFrame().GetSafeHwnd(), fileName, helpCmd, helpArg
+            )
+        # XXX - using the htmlhelp API wreaks havoc with keyboard shortcuts
+        # so we disable it, forcing ShellExecute, which works fine (but
+        # doesn't close the help file when Pythonwin is closed.
+        # Tom Heller also points out http://www.microsoft.com/mind/0499/faq/faq0499.asp,
+        # which may or may not be related.
+        elif 0 and ext == ".chm":
+            import win32help
+
+            global htmlhelp_handle
+            helpCmd = html_help_command_translators.get(helpCmd, helpCmd)
+            # frame = win32ui.GetMainFrame().GetSafeHwnd()
+            frame = 0  # Dont want it overlapping ours!
+            if htmlhelp_handle is None:
+                htmlhelp_hwnd, htmlhelp_handle = win32help.HtmlHelp(
+                    frame, None, win32help.HH_INITIALIZE
+                )
+            win32help.HtmlHelp(frame, fileName, helpCmd, helpArg)
+        else:
+            # Hope that the extension is registered, and we know what to do!
+            win32api.ShellExecute(0, "open", fileName, None, "", win32con.SW_SHOW)
+        return fileName
+    finally:
+        win32ui.DoWaitCursor(-1)
+
+
+def ListAllHelpFiles():
+    ret = []
+    ret = _ListAllHelpFilesInRoot(win32con.HKEY_LOCAL_MACHINE)
+    # Ensure we don't get dups.
+    for item in _ListAllHelpFilesInRoot(win32con.HKEY_CURRENT_USER):
+        if item not in ret:
+            ret.append(item)
+    return ret
+
+
+def _ListAllHelpFilesInRoot(root):
+    """Returns a list of (helpDesc, helpFname) for all registered help files"""
+    import regutil
+
+    retList = []
+    try:
+        key = win32api.RegOpenKey(
+            root, regutil.BuildDefaultPythonKey() + "\\Help", 0, win32con.KEY_READ
+        )
+    except win32api.error as exc:
+        import winerror
+
+        if exc.winerror != winerror.ERROR_FILE_NOT_FOUND:
+            raise
+        return retList
+    try:
+        keyNo = 0
+        while 1:
+            try:
+                helpDesc = win32api.RegEnumKey(key, keyNo)
+                helpFile = win32api.RegQueryValue(key, helpDesc)
+                retList.append((helpDesc, helpFile))
+                keyNo = keyNo + 1
+            except win32api.error as exc:
+                import winerror
+
+                if exc.winerror != winerror.ERROR_NO_MORE_ITEMS:
+                    raise
+                break
+    finally:
+        win32api.RegCloseKey(key)
+    return retList
+
+
+def SelectAndRunHelpFile():
+    from pywin.dialogs import list
+
+    helpFiles = ListAllHelpFiles()
+    if len(helpFiles) == 1:
+        # only 1 help file registered - probably ours - no point asking
+        index = 0
+    else:
+        index = list.SelectFromLists("Select Help file", helpFiles, ["Title"])
+    if index is not None:
+        OpenHelpFile(helpFiles[index][1])
+
+
+helpIDMap = None
+
+
+def SetHelpMenuOtherHelp(mainMenu):
+    """Modifies the main Help Menu to handle all registered help files.
+    mainMenu -- The main menu to modify - usually from docTemplate.GetSharedMenu()
+    """
+
+    # Load all help files from the registry.
+    global helpIDMap
+    if helpIDMap is None:
+        helpIDMap = {}
+        cmdID = win32ui.ID_HELP_OTHER
+        excludeList = ["Main Python Documentation", "Pythonwin Reference"]
+        firstList = ListAllHelpFiles()
+        # We actually want to not only exclude these entries, but
+        # their help file names (as many entries may share the same name)
+        excludeFnames = []
+        for desc, fname in firstList:
+            if desc in excludeList:
+                excludeFnames.append(fname)
+
+        helpDescs = []
+        for desc, fname in firstList:
+            if fname not in excludeFnames:
+                helpIDMap[cmdID] = (desc, fname)
+                win32ui.GetMainFrame().HookCommand(HandleHelpOtherCommand, cmdID)
+                cmdID = cmdID + 1
+
+    helpMenu = mainMenu.GetSubMenu(
+        mainMenu.GetMenuItemCount() - 1
+    )  # Help menu always last.
+    otherHelpMenuPos = 2  # cant search for ID, as sub-menu has no ID.
+    otherMenu = helpMenu.GetSubMenu(otherHelpMenuPos)
+    while otherMenu.GetMenuItemCount():
+        otherMenu.DeleteMenu(0, win32con.MF_BYPOSITION)
+
+    if helpIDMap:
+        for id, (desc, fname) in helpIDMap.items():
+            otherMenu.AppendMenu(win32con.MF_ENABLED | win32con.MF_STRING, id, desc)
+    else:
+        helpMenu.EnableMenuItem(
+            otherHelpMenuPos, win32con.MF_BYPOSITION | win32con.MF_GRAYED
+        )
+
+
+def HandleHelpOtherCommand(cmd, code):
+    OpenHelpFile(helpIDMap[cmd][1])

.venv/Lib/site-packages/pythonwin/pywin/framework/interact.py

@@ -0,0 +1,985 @@
+##################################################################
+##
+## Interactive Shell Window
+##
+
+import sys, os
+import code
+import string
+
+import win32ui
+import win32api
+import win32clipboard
+import win32con
+import traceback
+import afxres
+import array
+import __main__
+
+import pywin.scintilla.formatter
+import pywin.scintilla.control
+import pywin.scintilla.IDLEenvironment
+import pywin.framework.app
+
+## sequential after ID_GOTO_LINE defined in editor.py
+ID_EDIT_COPY_CODE = 0xE2002
+ID_EDIT_EXEC_CLIPBOARD = 0x2003
+
+trace = pywin.scintilla.formatter.trace
+
+from . import winout
+
+import re
+
+# from IDLE.
+_is_block_opener = re.compile(r":\s*(#.*)?$").search
+_is_block_closer = re.compile(
+    r"""
+    \s*
+    ( return
+    | break
+    | continue
+    | raise
+    | pass
+    )
+    \b
+""",
+    re.VERBOSE,
+).match
+
+tracebackHeader = "Traceback (".encode("ascii")
+
+sectionProfile = "Interactive Window"
+valueFormatTitle = "FormatTitle"
+valueFormatInput = "FormatInput"
+valueFormatOutput = "FormatOutput"
+valueFormatOutputError = "FormatOutputError"
+
+# These are defaults only.  Values are read from the registry.
+formatTitle = (-536870897, 0, 220, 0, 16711680, 184, 34, "Arial")
+formatInput = (-402653169, 0, 200, 0, 0, 0, 49, "Courier New")
+formatOutput = (-402653169, 0, 200, 0, 8421376, 0, 49, "Courier New")
+formatOutputError = (-402653169, 0, 200, 0, 255, 0, 49, "Courier New")
+
+try:
+    sys.ps1
+except AttributeError:
+    sys.ps1 = ">>> "
+    sys.ps2 = "... "
+
+
+def LoadPreference(preference, default=""):
+    return win32ui.GetProfileVal(sectionProfile, preference, default)
+
+
+def SavePreference(prefName, prefValue):
+    win32ui.WriteProfileVal(sectionProfile, prefName, prefValue)
+
+
+def GetPromptPrefix(line):
+    ps1 = sys.ps1
+    if line[: len(ps1)] == ps1:
+        return ps1
+    ps2 = sys.ps2
+    if line[: len(ps2)] == ps2:
+        return ps2
+
+
+#############################################################
+#
+# Colorizer related code.
+#
+#############################################################
+STYLE_INTERACTIVE_EOL = "Interactive EOL"
+STYLE_INTERACTIVE_OUTPUT = "Interactive Output"
+STYLE_INTERACTIVE_PROMPT = "Interactive Prompt"
+STYLE_INTERACTIVE_BANNER = "Interactive Banner"
+STYLE_INTERACTIVE_ERROR = "Interactive Error"
+STYLE_INTERACTIVE_ERROR_FINALLINE = "Interactive Error (final line)"
+
+INTERACTIVE_STYLES = [
+    STYLE_INTERACTIVE_EOL,
+    STYLE_INTERACTIVE_OUTPUT,
+    STYLE_INTERACTIVE_PROMPT,
+    STYLE_INTERACTIVE_BANNER,
+    STYLE_INTERACTIVE_ERROR,
+    STYLE_INTERACTIVE_ERROR_FINALLINE,
+]
+
+FormatterParent = pywin.scintilla.formatter.PythonSourceFormatter
+
+
+class InteractiveFormatter(FormatterParent):
+    def __init__(self, scintilla):
+        FormatterParent.__init__(self, scintilla)
+        self.bannerDisplayed = False
+
+    def SetStyles(self):
+        FormatterParent.SetStyles(self)
+        Style = pywin.scintilla.formatter.Style
+        self.RegisterStyle(Style(STYLE_INTERACTIVE_EOL, STYLE_INTERACTIVE_PROMPT))
+        self.RegisterStyle(Style(STYLE_INTERACTIVE_PROMPT, formatInput))
+        self.RegisterStyle(Style(STYLE_INTERACTIVE_OUTPUT, formatOutput))
+        self.RegisterStyle(Style(STYLE_INTERACTIVE_BANNER, formatTitle))
+        self.RegisterStyle(Style(STYLE_INTERACTIVE_ERROR, formatOutputError))
+        self.RegisterStyle(
+            Style(STYLE_INTERACTIVE_ERROR_FINALLINE, STYLE_INTERACTIVE_ERROR)
+        )
+
+    def LoadPreference(self, name, default):
+        rc = win32ui.GetProfileVal("Format", name, default)
+        if rc == default:
+            rc = win32ui.GetProfileVal(sectionProfile, name, default)
+        return rc
+
+    def ColorizeInteractiveCode(self, cdoc, styleStart, stylePyStart):
+        lengthDoc = len(cdoc)
+        if lengthDoc == 0:
+            return
+        state = styleStart
+        # As per comments in Colorize(), we work with the raw utf8
+        # bytes. To avoid too muych py3k pain, we treat each utf8 byte
+        # as a latin-1 unicode character - we only use it to compare
+        # against ascii chars anyway...
+        chNext = cdoc[0:1].decode("latin-1")
+        startSeg = 0
+        i = 0
+        lastState = state  # debug only
+        while i < lengthDoc:
+            ch = chNext
+            chNext = cdoc[i + 1 : i + 2].decode("latin-1")
+
+            # 			trace("ch=%r, i=%d, next=%r, state=%s" % (ch, i, chNext, state))
+            if state == STYLE_INTERACTIVE_EOL:
+                if ch not in "\r\n":
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    if ch in [sys.ps1[0], sys.ps2[0]]:
+                        state = STYLE_INTERACTIVE_PROMPT
+                    elif cdoc[i : i + len(tracebackHeader)] == tracebackHeader:
+                        state = STYLE_INTERACTIVE_ERROR
+                    else:
+                        state = STYLE_INTERACTIVE_OUTPUT
+            elif state == STYLE_INTERACTIVE_PROMPT:
+                if ch not in sys.ps1 + sys.ps2 + " ":
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    if ch in "\r\n":
+                        state = STYLE_INTERACTIVE_EOL
+                    else:
+                        state = stylePyStart  # Start coloring Python code.
+            elif state in [STYLE_INTERACTIVE_OUTPUT]:
+                if ch in "\r\n":
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    state = STYLE_INTERACTIVE_EOL
+            elif state == STYLE_INTERACTIVE_ERROR:
+                if ch in "\r\n" and chNext and chNext not in string.whitespace:
+                    # Everything including me
+                    self.ColorSeg(startSeg, i, state)
+                    startSeg = i + 1
+                    state = STYLE_INTERACTIVE_ERROR_FINALLINE
+                elif i == 0 and ch not in string.whitespace:
+                    # If we are coloring from the start of a line,
+                    # we need this better check for the last line
+                    # Color up to not including me
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    state = STYLE_INTERACTIVE_ERROR_FINALLINE
+            elif state == STYLE_INTERACTIVE_ERROR_FINALLINE:
+                if ch in "\r\n":
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    state = STYLE_INTERACTIVE_EOL
+            elif state == STYLE_INTERACTIVE_BANNER:
+                if ch in "\r\n" and (chNext == "" or chNext in ">["):
+                    # Everything including me
+                    self.ColorSeg(startSeg, i - 1, state)
+                    startSeg = i
+                    state = STYLE_INTERACTIVE_EOL
+            else:
+                # It is a PythonColorizer state - seek past the end of the line
+                # and ask the Python colorizer to color that.
+                end = startSeg
+                while end < lengthDoc and cdoc[end] not in "\r\n".encode("ascii"):
+                    end = end + 1
+                self.ColorizePythonCode(cdoc[:end], startSeg, state)
+                stylePyStart = self.GetStringStyle(end - 1)
+                if stylePyStart is None:
+                    stylePyStart = pywin.scintilla.formatter.STYLE_DEFAULT
+                else:
+                    stylePyStart = stylePyStart.name
+                startSeg = end
+                i = end - 1  # ready for increment.
+                chNext = cdoc[end : end + 1].decode("latin-1")
+                state = STYLE_INTERACTIVE_EOL
+            if lastState != state:
+                lastState = state
+            i = i + 1
+        # and the rest
+        if startSeg < i:
+            self.ColorSeg(startSeg, i - 1, state)
+
+    def Colorize(self, start=0, end=-1):
+        # scintilla's formatting is all done in terms of utf, so
+        # we work with utf8 bytes instead of unicode.  This magically
+        # works as any extended chars found in the utf8 don't change
+        # the semantics.
+        stringVal = self.scintilla.GetTextRange(start, end, decode=False)
+        styleStart = None
+        stylePyStart = None
+        if start > 1:
+            # Likely we are being asked to color from the start of the line.
+            # We find the last formatted character on the previous line.
+            # If TQString, we continue it.  Otherwise, we reset.
+            look = start - 1
+            while look and self.scintilla.SCIGetCharAt(look) in "\n\r":
+                look = look - 1
+            if look and look < start - 1:  # Did we find a char before the \n\r sets?
+                strstyle = self.GetStringStyle(look)
+                quote_char = None
+                if strstyle is not None:
+                    if strstyle.name == pywin.scintilla.formatter.STYLE_TQSSTRING:
+                        quote_char = "'"
+                    elif strstyle.name == pywin.scintilla.formatter.STYLE_TQDSTRING:
+                        quote_char = '"'
+                    if quote_char is not None:
+                        # It is a TQS.  If the TQS is not terminated, we
+                        # carry the style through.
+                        if look > 2:
+                            look_str = (
+                                self.scintilla.SCIGetCharAt(look - 2)
+                                + self.scintilla.SCIGetCharAt(look - 1)
+                                + self.scintilla.SCIGetCharAt(look)
+                            )
+                            if look_str != quote_char * 3:
+                                stylePyStart = strstyle.name
+        if stylePyStart is None:
+            stylePyStart = pywin.scintilla.formatter.STYLE_DEFAULT
+
+        if start > 0:
+            stylenum = self.scintilla.SCIGetStyleAt(start - 1)
+            styleStart = self.GetStyleByNum(stylenum).name
+        elif self.bannerDisplayed:
+            styleStart = STYLE_INTERACTIVE_EOL
+        else:
+            styleStart = STYLE_INTERACTIVE_BANNER
+            self.bannerDisplayed = True
+        self.scintilla.SCIStartStyling(start, 31)
+        self.style_buffer = array.array("b", (0,) * len(stringVal))
+        self.ColorizeInteractiveCode(stringVal, styleStart, stylePyStart)
+        self.scintilla.SCISetStylingEx(self.style_buffer)
+        self.style_buffer = None
+
+
+###############################################################
+#
+# This class handles the Python interactive interpreter.
+#
+# It uses a basic EditWindow, and does all the magic.
+# This is triggered by the enter key hander attached by the
+# start-up code.  It determines if a command is to be executed
+# or continued (ie, emit "... ") by snooping around the current
+# line, looking for the prompts
+#
+class PythonwinInteractiveInterpreter(code.InteractiveInterpreter):
+    def __init__(self, locals=None, globals=None):
+        if locals is None:
+            locals = __main__.__dict__
+        if globals is None:
+            globals = locals
+        self.globals = globals
+        code.InteractiveInterpreter.__init__(self, locals)
+
+    def showsyntaxerror(self, filename=None):
+        sys.stderr.write(
+            tracebackHeader.decode("ascii")
+        )  # So the color syntaxer recognises it.
+        code.InteractiveInterpreter.showsyntaxerror(self, filename)
+
+    def runcode(self, code):
+        try:
+            exec(code, self.globals, self.locals)
+        except SystemExit:
+            raise
+        except:
+            self.showtraceback()
+
+
+class InteractiveCore:
+    def __init__(self, banner=None):
+        self.banner = banner
+
+    # 		LoadFontPreferences()
+    def Init(self):
+        self.oldStdOut = self.oldStdErr = None
+
+        # 		self.SetWordWrap(win32ui.CRichEditView_WrapNone)
+        self.interp = PythonwinInteractiveInterpreter()
+
+        self.OutputGrab()  # Release at cleanup.
+
+        if self.GetTextLength() == 0:
+            if self.banner is None:
+                suffix = ""
+                if win32ui.debug:
+                    suffix = ", debug build"
+                sys.stderr.write(
+                    "PythonWin %s on %s%s.\n" % (sys.version, sys.platform, suffix)
+                )
+                sys.stderr.write(
+                    "Portions %s - see 'Help/About PythonWin' for further copyright information.\n"
+                    % (win32ui.copyright,)
+                )
+            else:
+                sys.stderr.write(banner)
+        rcfile = os.environ.get("PYTHONSTARTUP")
+        if rcfile:
+            import __main__
+
+            try:
+                exec(
+                    compile(
+                        open(rcfile, "rb").read(), rcfile, "exec", dont_inherit=True
+                    ),
+                    __main__.__dict__,
+                    __main__.__dict__,
+                )
+            except:
+                sys.stderr.write(
+                    ">>> \nError executing PYTHONSTARTUP script %r\n" % (rcfile)
+                )
+                traceback.print_exc(file=sys.stderr)
+        self.AppendToPrompt([])
+
+    def SetContext(self, globals, locals, name="Dbg"):
+        oldPrompt = sys.ps1
+        if globals is None:
+            # Reset
+            sys.ps1 = ">>> "
+            sys.ps2 = "... "
+            locals = globals = __main__.__dict__
+        else:
+            sys.ps1 = "[%s]>>> " % name
+            sys.ps2 = "[%s]... " % name
+        self.interp.locals = locals
+        self.interp.globals = globals
+        self.AppendToPrompt([], oldPrompt)
+
+    def GetContext(self):
+        return self.interp.globals, self.interp.locals
+
+    def DoGetLine(self, line=-1):
+        if line == -1:
+            line = self.LineFromChar()
+        line = self.GetLine(line)
+        while line and line[-1] in ["\r", "\n"]:
+            line = line[:-1]
+        return line
+
+    def AppendToPrompt(self, bufLines, oldPrompt=None):
+        "Take a command and stick it at the end of the buffer (with python prompts inserted if required)."
+        self.flush()
+        lastLineNo = self.GetLineCount() - 1
+        line = self.DoGetLine(lastLineNo)
+        if oldPrompt and line == oldPrompt:
+            self.SetSel(self.GetTextLength() - len(oldPrompt), self.GetTextLength())
+            self.ReplaceSel(sys.ps1)
+        elif line != str(sys.ps1):
+            if len(line) != 0:
+                self.write("\n")
+            self.write(sys.ps1)
+        self.flush()
+        self.idle.text.mark_set("iomark", "end-1c")
+        if not bufLines:
+            return
+        terms = (["\n" + sys.ps2] * (len(bufLines) - 1)) + [""]
+        for bufLine, term in zip(bufLines, terms):
+            if bufLine.strip():
+                self.write(bufLine + term)
+        self.flush()
+
+    def EnsureNoPrompt(self):
+        # Get ready to write some text NOT at a Python prompt.
+        self.flush()
+        lastLineNo = self.GetLineCount() - 1
+        line = self.DoGetLine(lastLineNo)
+        if not line or line in [sys.ps1, sys.ps2]:
+            self.SetSel(self.GetTextLength() - len(line), self.GetTextLength())
+            self.ReplaceSel("")
+        else:
+            # Just add a new line.
+            self.write("\n")
+
+    def _GetSubConfigNames(self):
+        return ["interactive"]  # Allow [Keys:Interactive] sections to be specific
+
+    def HookHandlers(self):
+        # Hook menu command (executed when a menu item with that ID is selected from a menu/toolbar
+        self.HookCommand(self.OnSelectBlock, win32ui.ID_EDIT_SELECT_BLOCK)
+        self.HookCommand(self.OnEditCopyCode, ID_EDIT_COPY_CODE)
+        self.HookCommand(self.OnEditExecClipboard, ID_EDIT_EXEC_CLIPBOARD)
+        mod = pywin.scintilla.IDLEenvironment.GetIDLEModule("IdleHistory")
+        if mod is not None:
+            self.history = mod.History(self.idle.text, "\n" + sys.ps2)
+        else:
+            self.history = None
+        # hack for now for event handling.
+
+    # GetBlockBoundary takes a line number, and will return the
+    # start and and line numbers of the block, and a flag indicating if the
+    # block is a Python code block.
+    # If the line specified has a Python prompt, then the lines are parsed
+    # backwards and forwards, and the flag is true.
+    # If the line does not start with a prompt, the block is searched forward
+    # and backward until a prompt _is_ found, and all lines in between without
+    # prompts are returned, and the flag is false.
+    def GetBlockBoundary(self, lineNo):
+        line = self.DoGetLine(lineNo)
+        maxLineNo = self.GetLineCount() - 1
+        prefix = GetPromptPrefix(line)
+        if prefix is None:  # Non code block
+            flag = 0
+            startLineNo = lineNo
+            while startLineNo > 0:
+                if GetPromptPrefix(self.DoGetLine(startLineNo - 1)) is not None:
+                    break  # there _is_ a prompt
+                startLineNo = startLineNo - 1
+            endLineNo = lineNo
+            while endLineNo < maxLineNo:
+                if GetPromptPrefix(self.DoGetLine(endLineNo + 1)) is not None:
+                    break  # there _is_ a prompt
+                endLineNo = endLineNo + 1
+        else:  # Code block
+            flag = 1
+            startLineNo = lineNo
+            while startLineNo > 0 and prefix != str(sys.ps1):
+                prefix = GetPromptPrefix(self.DoGetLine(startLineNo - 1))
+                if prefix is None:
+                    break
+                    # there is no prompt.
+                startLineNo = startLineNo - 1
+            endLineNo = lineNo
+            while endLineNo < maxLineNo:
+                prefix = GetPromptPrefix(self.DoGetLine(endLineNo + 1))
+                if prefix is None:
+                    break  # there is no prompt
+                if prefix == str(sys.ps1):
+                    break  # this is another command
+                endLineNo = endLineNo + 1
+                # continue until end of buffer, or no prompt
+        return (startLineNo, endLineNo, flag)
+
+    def ExtractCommand(self, lines):
+        start, end = lines
+        retList = []
+        while end >= start:
+            thisLine = self.DoGetLine(end)
+            promptLen = len(GetPromptPrefix(thisLine))
+            retList = [thisLine[promptLen:]] + retList
+            end = end - 1
+        return retList
+
+    def OutputGrab(self):
+        # 		import win32traceutil; return
+        self.oldStdOut = sys.stdout
+        self.oldStdErr = sys.stderr
+        sys.stdout = self
+        sys.stderr = self
+        self.flush()
+
+    def OutputRelease(self):
+        # a command may have overwritten these - only restore if not.
+        if self.oldStdOut is not None:
+            if sys.stdout == self:
+                sys.stdout = self.oldStdOut
+        if self.oldStdErr is not None:
+            if sys.stderr == self:
+                sys.stderr = self.oldStdErr
+        self.oldStdOut = None
+        self.oldStdErr = None
+        self.flush()
+
+    ###################################
+    #
+    # Message/Command/Key Hooks.
+    #
+    # Enter key handler
+    #
+    def ProcessEnterEvent(self, event):
+        # If autocompletion has been triggered, complete and do not process event
+        if self.SCIAutoCActive():
+            self.SCIAutoCComplete()
+            self.SCICancel()
+            return
+
+        self.SCICancel()
+        # First, check for an error message
+        haveGrabbedOutput = 0
+        if self.HandleSpecialLine():
+            return 0
+
+        lineNo = self.LineFromChar()
+        start, end, isCode = self.GetBlockBoundary(lineNo)
+        # If we are not in a code block just go to the prompt (or create a new one)
+        if not isCode:
+            self.AppendToPrompt([])
+            win32ui.SetStatusText(win32ui.LoadString(afxres.AFX_IDS_IDLEMESSAGE))
+            return
+
+        lines = self.ExtractCommand((start, end))
+
+        # If we are in a code-block, but it isnt at the end of the buffer
+        # then copy it to the end ready for editing and subsequent execution
+        if end != self.GetLineCount() - 1:
+            win32ui.SetStatusText("Press ENTER to execute command")
+            self.AppendToPrompt(lines)
+            self.SetSel(-2)
+            return
+
+        # If SHIFT held down, we want new code here and now!
+        bNeedIndent = (
+            win32api.GetKeyState(win32con.VK_SHIFT) < 0
+            or win32api.GetKeyState(win32con.VK_CONTROL) < 0
+        )
+        if bNeedIndent:
+            self.ReplaceSel("\n")
+        else:
+            self.SetSel(-2)
+            self.ReplaceSel("\n")
+            source = "\n".join(lines)
+            while source and source[-1] in "\t ":
+                source = source[:-1]
+            self.OutputGrab()  # grab the output for the command exec.
+            try:
+                if self.interp.runsource(
+                    source, "<interactive input>"
+                ):  # Need more input!
+                    bNeedIndent = 1
+                else:
+                    # If the last line isnt empty, append a newline
+                    if self.history is not None:
+                        self.history.history_store(source)
+                    self.AppendToPrompt([])
+                    win32ui.SetStatusText(
+                        win32ui.LoadString(afxres.AFX_IDS_IDLEMESSAGE)
+                    )
+            # 					win32ui.SetStatusText('Successfully executed statement')
+            finally:
+                self.OutputRelease()
+        if bNeedIndent:
+            win32ui.SetStatusText("Ready to continue the command")
+            # Now attempt correct indentation (should use IDLE?)
+            curLine = self.DoGetLine(lineNo)[len(sys.ps2) :]
+            pos = 0
+            indent = ""
+            while len(curLine) > pos and curLine[pos] in string.whitespace:
+                indent = indent + curLine[pos]
+                pos = pos + 1
+            if _is_block_opener(curLine):
+                indent = indent + "\t"
+            elif _is_block_closer(curLine):
+                indent = indent[:-1]
+            # use ReplaceSel to ensure it goes at the cursor rather than end of buffer.
+            self.ReplaceSel(sys.ps2 + indent)
+        return 0
+
+    # ESC key handler
+    def ProcessEscEvent(self, event):
+        # Implement a cancel.
+        if self.SCIAutoCActive() or self.SCICallTipActive():
+            self.SCICancel()
+        else:
+            win32ui.SetStatusText("Cancelled.")
+            self.AppendToPrompt(("",))
+        return 0
+
+    def OnSelectBlock(self, command, code):
+        lineNo = self.LineFromChar()
+        start, end, isCode = self.GetBlockBoundary(lineNo)
+        startIndex = self.LineIndex(start)
+        endIndex = self.LineIndex(end + 1) - 2  # skip \r + \n
+        if endIndex < 0:  # must be beyond end of buffer
+            endIndex = -2  # self.Length()
+        self.SetSel(startIndex, endIndex)
+
+    def OnEditCopyCode(self, command, code):
+        """Sanitizes code from interactive window, removing prompts and output,
+        and inserts it in the clipboard."""
+        code = self.GetSelText()
+        lines = code.splitlines()
+        out_lines = []
+        for line in lines:
+            if line.startswith(sys.ps1):
+                line = line[len(sys.ps1) :]
+                out_lines.append(line)
+            elif line.startswith(sys.ps2):
+                line = line[len(sys.ps2) :]
+                out_lines.append(line)
+        out_code = os.linesep.join(out_lines)
+        win32clipboard.OpenClipboard()
+        try:
+            win32clipboard.SetClipboardData(
+                win32clipboard.CF_UNICODETEXT, str(out_code)
+            )
+        finally:
+            win32clipboard.CloseClipboard()
+
+    def OnEditExecClipboard(self, command, code):
+        """Executes python code directly from the clipboard."""
+        win32clipboard.OpenClipboard()
+        try:
+            code = win32clipboard.GetClipboardData(win32clipboard.CF_UNICODETEXT)
+        finally:
+            win32clipboard.CloseClipboard()
+
+        code = code.replace("\r\n", "\n") + "\n"
+        try:
+            o = compile(code, "<clipboard>", "exec")
+            exec(o, __main__.__dict__)
+        except:
+            traceback.print_exc()
+
+    def GetRightMenuItems(self):
+        # Just override parents
+        ret = []
+        flags = 0
+        ret.append((flags, win32ui.ID_EDIT_UNDO, "&Undo"))
+        ret.append(win32con.MF_SEPARATOR)
+        ret.append((flags, win32ui.ID_EDIT_CUT, "Cu&t"))
+        ret.append((flags, win32ui.ID_EDIT_COPY, "&Copy"))
+
+        start, end = self.GetSel()
+        if start != end:
+            ret.append((flags, ID_EDIT_COPY_CODE, "Copy code without prompts"))
+        if win32clipboard.IsClipboardFormatAvailable(win32clipboard.CF_UNICODETEXT):
+            ret.append(
+                (flags, ID_EDIT_EXEC_CLIPBOARD, "Execute python code from clipboard")
+            )
+
+        ret.append((flags, win32ui.ID_EDIT_PASTE, "&Paste"))
+        ret.append(win32con.MF_SEPARATOR)
+        ret.append((flags, win32ui.ID_EDIT_SELECT_ALL, "&Select all"))
+        ret.append((flags, win32ui.ID_EDIT_SELECT_BLOCK, "Select &block"))
+        ret.append((flags, win32ui.ID_VIEW_WHITESPACE, "View &Whitespace"))
+        return ret
+
+    def MDINextEvent(self, event):
+        win32ui.GetMainFrame().MDINext(0)
+
+    def MDIPrevEvent(self, event):
+        win32ui.GetMainFrame().MDINext(0)
+
+    def WindowBackEvent(self, event):
+        parent = self.GetParentFrame()
+        if parent == win32ui.GetMainFrame():
+            # It is docked.
+            try:
+                wnd, isactive = parent.MDIGetActive()
+                wnd.SetFocus()
+            except win32ui.error:
+                # No MDI window active!
+                pass
+        else:
+            # Normal Window
+            try:
+                lastActive = self.GetParentFrame().lastActive
+                # If the window is invalid, reset it.
+                if lastActive is not None and (
+                    lastActive._obj_ is None or lastActive.GetSafeHwnd() == 0
+                ):
+                    lastActive = self.GetParentFrame().lastActive = None
+                    win32ui.SetStatusText("The last active Window has been closed.")
+            except AttributeError:
+                print("Can't find the last active window!")
+                lastActive = None
+            if lastActive is not None:
+                lastActive.MDIActivate()
+
+
+class InteractiveView(InteractiveCore, winout.WindowOutputView):
+    def __init__(self, doc):
+        InteractiveCore.__init__(self)
+        winout.WindowOutputView.__init__(self, doc)
+        self.encoding = pywin.default_scintilla_encoding
+
+    def _MakeColorizer(self):
+        return InteractiveFormatter(self)
+
+    def OnInitialUpdate(self):
+        winout.WindowOutputView.OnInitialUpdate(self)
+        self.SetWordWrap()
+        self.Init()
+
+    def HookHandlers(self):
+        winout.WindowOutputView.HookHandlers(self)
+        InteractiveCore.HookHandlers(self)
+
+
+class CInteractivePython(winout.WindowOutput):
+    def __init__(self, makeDoc=None, makeFrame=None):
+        self.IsFinalDestroy = 0
+        winout.WindowOutput.__init__(
+            self,
+            sectionProfile,
+            sectionProfile,
+            winout.flags.WQ_LINE,
+            1,
+            None,
+            makeDoc,
+            makeFrame,
+            InteractiveView,
+        )
+        self.Create()
+
+    def OnViewDestroy(self, view):
+        if self.IsFinalDestroy:
+            view.OutputRelease()
+        winout.WindowOutput.OnViewDestroy(self, view)
+
+    def Close(self):
+        self.IsFinalDestroy = 1
+        winout.WindowOutput.Close(self)
+
+
+class InteractiveFrame(winout.WindowOutputFrame):
+    def __init__(self):
+        self.lastActive = None
+        winout.WindowOutputFrame.__init__(self)
+
+    def OnMDIActivate(self, bActive, wndActive, wndDeactive):
+        if bActive:
+            self.lastActive = wndDeactive
+
+
+######################################################################
+##
+## Dockable Window Support
+##
+######################################################################
+ID_DOCKED_INTERACTIVE_CONTROLBAR = 0xE802
+
+DockedInteractiveViewParent = InteractiveView
+
+
+class DockedInteractiveView(DockedInteractiveViewParent):
+    def HookHandlers(self):
+        DockedInteractiveViewParent.HookHandlers(self)
+        self.HookMessage(self.OnSetFocus, win32con.WM_SETFOCUS)
+        self.HookMessage(self.OnKillFocus, win32con.WM_KILLFOCUS)
+
+    def OnSetFocus(self, msg):
+        self.GetParentFrame().SetActiveView(self)
+        return 1
+
+    def OnKillFocus(self, msg):
+        # If we are losing focus to another in this app, reset the main frame's active view.
+        hwnd = wparam = msg[2]
+        try:
+            wnd = win32ui.CreateWindowFromHandle(hwnd)
+            reset = wnd.GetTopLevelFrame() == self.GetTopLevelFrame()
+        except win32ui.error:
+            reset = 0  # Not my window
+        if reset:
+            self.GetParentFrame().SetActiveView(None)
+        return 1
+
+    def OnDestroy(self, msg):
+        newSize = self.GetWindowPlacement()[4]
+        pywin.framework.app.SaveWindowSize("Interactive Window", newSize, "docked")
+        try:
+            if self.GetParentFrame().GetActiveView == self:
+                self.GetParentFrame().SetActiveView(None)
+        except win32ui.error:
+            pass
+        try:
+            if win32ui.GetMainFrame().GetActiveView() == self:
+                win32ui.GetMainFrame().SetActiveView(None)
+        except win32ui.error:
+            pass
+        return DockedInteractiveViewParent.OnDestroy(self, msg)
+
+
+class CDockedInteractivePython(CInteractivePython):
+    def __init__(self, dockbar):
+        self.bFirstCreated = 0
+        self.dockbar = dockbar
+        CInteractivePython.__init__(self)
+
+    def NeedRecreateWindow(self):
+        if self.bCreating:
+            return 0
+        try:
+            frame = win32ui.GetMainFrame()
+            if frame.closing:
+                return 0  # Dieing!
+        except (win32ui.error, AttributeError):
+            return 0  # The app is dieing!
+        try:
+            cb = frame.GetControlBar(ID_DOCKED_INTERACTIVE_CONTROLBAR)
+            return not cb.IsWindowVisible()
+        except win32ui.error:
+            return 1  # Control bar does not exist!
+
+    def RecreateWindow(self):
+        try:
+            dockbar = win32ui.GetMainFrame().GetControlBar(
+                ID_DOCKED_INTERACTIVE_CONTROLBAR
+            )
+            win32ui.GetMainFrame().ShowControlBar(dockbar, 1, 1)
+        except win32ui.error:
+            CreateDockedInteractiveWindow()
+
+    def Create(self):
+        self.bCreating = 1
+        doc = InteractiveDocument(None, self.DoCreateDoc())
+        view = DockedInteractiveView(doc)
+        defRect = pywin.framework.app.LoadWindowSize("Interactive Window", "docked")
+        if defRect[2] - defRect[0] == 0:
+            defRect = 0, 0, 500, 200
+        style = win32con.WS_CHILD | win32con.WS_VISIBLE | win32con.WS_BORDER
+        id = 1050  # win32ui.AFX_IDW_PANE_FIRST
+        view.CreateWindow(self.dockbar, id, style, defRect)
+        view.OnInitialUpdate()
+        self.bFirstCreated = 1
+
+        self.currentView = doc.GetFirstView()
+        self.bCreating = 0
+        if self.title:
+            doc.SetTitle(self.title)
+
+
+# The factory we pass to the dockable window support.
+def InteractiveViewCreator(parent):
+    global edit
+    edit = CDockedInteractivePython(parent)
+    return edit.currentView
+
+
+def CreateDockedInteractiveWindow():
+    # Later, the DockingBar should be capable of hosting multiple
+    # children.
+    from pywin.docking.DockingBar import DockingBar
+
+    bar = DockingBar()
+    creator = InteractiveViewCreator
+    bar.CreateWindow(
+        win32ui.GetMainFrame(),
+        creator,
+        "Interactive Window",
+        ID_DOCKED_INTERACTIVE_CONTROLBAR,
+    )
+    bar.SetBarStyle(
+        bar.GetBarStyle()
+        | afxres.CBRS_TOOLTIPS
+        | afxres.CBRS_FLYBY
+        | afxres.CBRS_SIZE_DYNAMIC
+    )
+    bar.EnableDocking(afxres.CBRS_ALIGN_ANY)
+    win32ui.GetMainFrame().DockControlBar(bar, afxres.AFX_IDW_DOCKBAR_BOTTOM)
+
+
+######################################################################
+#
+# The public interface to this module.
+#
+######################################################################
+# No extra functionality now, but maybe later, so
+# publicize these names.
+InteractiveDocument = winout.WindowOutputDocument
+
+# We remember our one and only interactive window in the "edit" variable.
+edit = None
+
+
+def CreateInteractiveWindowUserPreference(makeDoc=None, makeFrame=None):
+    """Create some sort of interactive window if the user's preference say we should."""
+    bCreate = LoadPreference("Show at startup", 1)
+    if bCreate:
+        CreateInteractiveWindow(makeDoc, makeFrame)
+
+
+def CreateInteractiveWindow(makeDoc=None, makeFrame=None):
+    """Create a standard or docked interactive window unconditionally"""
+    assert edit is None, "Creating second interactive window!"
+    bDocking = LoadPreference("Docking", 0)
+    if bDocking:
+        CreateDockedInteractiveWindow()
+    else:
+        CreateMDIInteractiveWindow(makeDoc, makeFrame)
+    assert edit is not None, "Created interactive window, but did not set the global!"
+    edit.currentView.SetFocus()
+
+
+def CreateMDIInteractiveWindow(makeDoc=None, makeFrame=None):
+    """Create a standard (non-docked) interactive window unconditionally"""
+    global edit
+    if makeDoc is None:
+        makeDoc = InteractiveDocument
+    if makeFrame is None:
+        makeFrame = InteractiveFrame
+    edit = CInteractivePython(makeDoc=makeDoc, makeFrame=makeFrame)
+
+
+def DestroyInteractiveWindow():
+    """Destroy the interactive window.
+    This is different to Closing the window,
+    which may automatically re-appear.  Once destroyed, it can never be recreated,
+    and a complete new instance must be created (which the various other helper
+    functions will then do after making this call
+    """
+    global edit
+    if edit is not None and edit.currentView is not None:
+        if edit.currentView.GetParentFrame() == win32ui.GetMainFrame():
+            # It is docked - do nothing now (this is only called at shutdown!)
+            pass
+        else:
+            # It is a standard window - call Close on the container.
+            edit.Close()
+            edit = None
+
+
+def CloseInteractiveWindow():
+    """Close the interactive window, allowing it to be re-created on demand."""
+    global edit
+    if edit is not None and edit.currentView is not None:
+        if edit.currentView.GetParentFrame() == win32ui.GetMainFrame():
+            # It is docked, just hide the dock bar.
+            frame = win32ui.GetMainFrame()
+            cb = frame.GetControlBar(ID_DOCKED_INTERACTIVE_CONTROLBAR)
+            frame.ShowControlBar(cb, 0, 1)
+        else:
+            # It is a standard window - destroy the frame/view, allowing the object itself to remain.
+            edit.currentView.GetParentFrame().DestroyWindow()
+
+
+def ToggleInteractiveWindow():
+    """If the interactive window is visible, hide it, otherwise show it."""
+    if edit is None:
+        CreateInteractiveWindow()
+    else:
+        if edit.NeedRecreateWindow():
+            edit.RecreateWindow()
+        else:
+            # Close it, allowing a reopen.
+            CloseInteractiveWindow()
+
+
+def ShowInteractiveWindow():
+    """Shows (or creates if necessary) an interactive window"""
+    if edit is None:
+        CreateInteractiveWindow()
+    else:
+        if edit.NeedRecreateWindow():
+            edit.RecreateWindow()
+        else:
+            parent = edit.currentView.GetParentFrame()
+            if parent == win32ui.GetMainFrame():  # It is docked.
+                edit.currentView.SetFocus()
+            else:  # It is a "normal" window
+                edit.currentView.GetParentFrame().AutoRestore()
+                win32ui.GetMainFrame().MDIActivate(edit.currentView.GetParentFrame())
+
+
+def IsInteractiveWindowVisible():
+    return edit is not None and not edit.NeedRecreateWindow()

.venv/Lib/site-packages/pythonwin/pywin/framework/intpyapp.py

@@ -0,0 +1,553 @@
+# intpyapp.py  - Interactive Python application class
+#
+import win32con
+import win32api
+import win32ui
+import __main__
+import sys
+import os
+from . import app
+import traceback
+from pywin.mfc import afxres, dialog
+import commctrl
+from . import dbgcommands
+
+lastLocateFileName = ".py"  # used in the "File/Locate" dialog...
+
+# todo - _SetupSharedMenu should be moved to a framework class.
+def _SetupSharedMenu_(self):
+    sharedMenu = self.GetSharedMenu()
+    from pywin.framework import toolmenu
+
+    toolmenu.SetToolsMenu(sharedMenu)
+    from pywin.framework import help
+
+    help.SetHelpMenuOtherHelp(sharedMenu)
+
+
+from pywin.mfc import docview
+
+docview.DocTemplate._SetupSharedMenu_ = _SetupSharedMenu_
+
+
+class MainFrame(app.MainFrame):
+    def OnCreate(self, createStruct):
+        self.closing = 0
+        if app.MainFrame.OnCreate(self, createStruct) == -1:
+            return -1
+        style = (
+            win32con.WS_CHILD
+            | afxres.CBRS_SIZE_DYNAMIC
+            | afxres.CBRS_TOP
+            | afxres.CBRS_TOOLTIPS
+            | afxres.CBRS_FLYBY
+        )
+
+        self.EnableDocking(afxres.CBRS_ALIGN_ANY)
+
+        tb = win32ui.CreateToolBar(self, style | win32con.WS_VISIBLE)
+        tb.ModifyStyle(0, commctrl.TBSTYLE_FLAT)
+        tb.LoadToolBar(win32ui.IDR_MAINFRAME)
+        tb.EnableDocking(afxres.CBRS_ALIGN_ANY)
+        tb.SetWindowText("Standard")
+        self.DockControlBar(tb)
+        # Any other packages which use toolbars
+        from pywin.debugger.debugger import PrepareControlBars
+
+        PrepareControlBars(self)
+        # Note "interact" also uses dockable windows, but they already happen
+
+        # And a "Tools" menu on the main frame.
+        menu = self.GetMenu()
+        from . import toolmenu
+
+        toolmenu.SetToolsMenu(menu, 2)
+        # And fix the "Help" menu on the main frame
+        from pywin.framework import help
+
+        help.SetHelpMenuOtherHelp(menu)
+
+    def OnClose(self):
+        try:
+            import pywin.debugger
+
+            if (
+                pywin.debugger.currentDebugger is not None
+                and pywin.debugger.currentDebugger.pumping
+            ):
+                try:
+                    pywin.debugger.currentDebugger.close(1)
+                except:
+                    traceback.print_exc()
+                return
+        except win32ui.error:
+            pass
+        self.closing = 1
+        self.SaveBarState("ToolbarDefault")
+        self.SetActiveView(None)  # Otherwise MFC's OnClose may _not_ prompt for save.
+
+        from pywin.framework import help
+
+        help.FinalizeHelp()
+
+        self.DestroyControlBar(afxres.AFX_IDW_TOOLBAR)
+        self.DestroyControlBar(win32ui.ID_VIEW_TOOLBAR_DBG)
+
+        return self._obj_.OnClose()
+
+    def DestroyControlBar(self, id):
+        try:
+            bar = self.GetControlBar(id)
+        except win32ui.error:
+            return
+        bar.DestroyWindow()
+
+    def OnCommand(self, wparam, lparam):
+        # By default, the current MDI child frame will process WM_COMMAND
+        # messages before any docked control bars - even if the control bar
+        # has focus.  This is a problem for the interactive window when docked.
+        # Therefore, we detect the situation of a view having the main frame
+        # as its parent, and assume it must be a docked view (which it will in an MDI app)
+        try:
+            v = (
+                self.GetActiveView()
+            )  # Raise an exception if none - good - then we want default handling
+            # Main frame _does_ have a current view (ie, a docking view) - see if it wants it.
+            if v.OnCommand(wparam, lparam):
+                return 1
+        except (win32ui.error, AttributeError):
+            pass
+        return self._obj_.OnCommand(wparam, lparam)
+
+
+class InteractivePythonApp(app.CApp):
+    # This works if necessary - just we dont need to override the Run method.
+    # 	def Run(self):
+    # 		return self._obj_.Run()
+
+    def HookCommands(self):
+        app.CApp.HookCommands(self)
+        dbgcommands.DebuggerCommandHandler().HookCommands()
+        self.HookCommand(self.OnViewBrowse, win32ui.ID_VIEW_BROWSE)
+        self.HookCommand(self.OnFileImport, win32ui.ID_FILE_IMPORT)
+        self.HookCommand(self.OnFileCheck, win32ui.ID_FILE_CHECK)
+        self.HookCommandUpdate(self.OnUpdateFileCheck, win32ui.ID_FILE_CHECK)
+        self.HookCommand(self.OnFileRun, win32ui.ID_FILE_RUN)
+        self.HookCommand(self.OnFileLocate, win32ui.ID_FILE_LOCATE)
+        self.HookCommand(self.OnInteractiveWindow, win32ui.ID_VIEW_INTERACTIVE)
+        self.HookCommandUpdate(
+            self.OnUpdateInteractiveWindow, win32ui.ID_VIEW_INTERACTIVE
+        )
+        self.HookCommand(self.OnViewOptions, win32ui.ID_VIEW_OPTIONS)
+        self.HookCommand(self.OnHelpIndex, afxres.ID_HELP_INDEX)
+        self.HookCommand(self.OnFileSaveAll, win32ui.ID_FILE_SAVE_ALL)
+        self.HookCommand(self.OnViewToolbarDbg, win32ui.ID_VIEW_TOOLBAR_DBG)
+        self.HookCommandUpdate(self.OnUpdateViewToolbarDbg, win32ui.ID_VIEW_TOOLBAR_DBG)
+
+    def CreateMainFrame(self):
+        return MainFrame()
+
+    def MakeExistingDDEConnection(self):
+        # Use DDE to connect to an existing instance
+        # Return None if no existing instance
+        try:
+            from . import intpydde
+        except ImportError:
+            # No dde support!
+            return None
+        conv = intpydde.CreateConversation(self.ddeServer)
+        try:
+            conv.ConnectTo("Pythonwin", "System")
+            return conv
+        except intpydde.error:
+            return None
+
+    def InitDDE(self):
+        # Do all the magic DDE handling.
+        # Returns TRUE if we have pumped the arguments to our
+        # remote DDE app, and we should terminate.
+        try:
+            from . import intpydde
+        except ImportError:
+            self.ddeServer = None
+            intpydde = None
+        if intpydde is not None:
+            self.ddeServer = intpydde.DDEServer(self)
+            self.ddeServer.Create("Pythonwin", intpydde.CBF_FAIL_SELFCONNECTIONS)
+            try:
+                # If there is an existing instance, pump the arguments to it.
+                connection = self.MakeExistingDDEConnection()
+                if connection is not None:
+                    connection.Exec("self.Activate()")
+                    if self.ProcessArgs(sys.argv, connection) is None:
+                        return 1
+            except:
+                # It is too early to 'print' an exception - we
+                # don't have stdout setup yet!
+                win32ui.DisplayTraceback(
+                    sys.exc_info(), " - error in DDE conversation with Pythonwin"
+                )
+                return 1
+
+    def InitInstance(self):
+        # Allow "/nodde" and "/new" to optimize this!
+        if (
+            "/nodde" not in sys.argv
+            and "/new" not in sys.argv
+            and "-nodde" not in sys.argv
+            and "-new" not in sys.argv
+        ):
+            if self.InitDDE():
+                return 1  # A remote DDE client is doing it for us!
+        else:
+            self.ddeServer = None
+
+        win32ui.SetRegistryKey(
+            "Python %s" % (sys.winver,)
+        )  # MFC automatically puts the main frame caption on!
+        app.CApp.InitInstance(self)
+
+        # Create the taskbar icon
+        win32ui.CreateDebuggerThread()
+
+        # Allow Pythonwin to host OCX controls.
+        win32ui.EnableControlContainer()
+
+        # Display the interactive window if the user wants it.
+        from . import interact
+
+        interact.CreateInteractiveWindowUserPreference()
+
+        # Load the modules we use internally.
+        self.LoadSystemModules()
+
+        # Load additional module the user may want.
+        self.LoadUserModules()
+
+        # Load the ToolBar state near the end of the init process, as
+        # there may be Toolbar IDs created by the user or other modules.
+        # By now all these modules should be loaded, so all the toolbar IDs loaded.
+        try:
+            self.frame.LoadBarState("ToolbarDefault")
+        except win32ui.error:
+            # MFC sucks.  It does essentially "GetDlgItem(x)->Something", so if the
+            # toolbar with ID x does not exist, MFC crashes!  Pythonwin has a trap for this
+            # but I need to investigate more how to prevent it (AFAIK, ensuring all the
+            # toolbars are created by now _should_ stop it!)
+            pass
+
+        # Finally process the command line arguments.
+        try:
+            self.ProcessArgs(sys.argv)
+        except:
+            # too early for printing anything.
+            win32ui.DisplayTraceback(
+                sys.exc_info(), " - error processing command line args"
+            )
+
+    def ExitInstance(self):
+        win32ui.DestroyDebuggerThread()
+        try:
+            from . import interact
+
+            interact.DestroyInteractiveWindow()
+        except:
+            pass
+        if self.ddeServer is not None:
+            self.ddeServer.Shutdown()
+            self.ddeServer = None
+        return app.CApp.ExitInstance(self)
+
+    def Activate(self):
+        # Bring to the foreground.  Mainly used when another app starts up, it asks
+        # this one to activate itself, then it terminates.
+        frame = win32ui.GetMainFrame()
+        frame.SetForegroundWindow()
+        if frame.GetWindowPlacement()[1] == win32con.SW_SHOWMINIMIZED:
+            frame.ShowWindow(win32con.SW_RESTORE)
+
+    def ProcessArgs(self, args, dde=None):
+        # If we are going to talk to a remote app via DDE, then
+        # activate it!
+        if (
+            len(args) < 1 or not args[0]
+        ):  # argv[0]=='' when started without args, just like Python.exe!
+            return
+
+        i = 0
+        while i < len(args):
+            argType = args[i]
+            i += 1
+            if argType.startswith("-"):
+                # Support dash options. Slash options are misinterpreted by python init
+                # as path and not finding usually 'C:\\' ends up in sys.path[0]
+                argType = "/" + argType[1:]
+            if not argType.startswith("/"):
+                argType = win32ui.GetProfileVal(
+                    "Python", "Default Arg Type", "/edit"
+                ).lower()
+                i -= 1  #  arg is /edit's parameter
+            par = i < len(args) and args[i] or "MISSING"
+            if argType in ["/nodde", "/new", "-nodde", "-new"]:
+                # Already handled
+                pass
+            elif argType.startswith("/goto:"):
+                gotoline = int(argType[len("/goto:") :])
+                if dde:
+                    dde.Exec(
+                        "from pywin.framework import scriptutils\n"
+                        "ed = scriptutils.GetActiveEditControl()\n"
+                        "if ed: ed.SetSel(ed.LineIndex(%s - 1))" % gotoline
+                    )
+                else:
+                    from . import scriptutils
+
+                    ed = scriptutils.GetActiveEditControl()
+                    if ed:
+                        ed.SetSel(ed.LineIndex(gotoline - 1))
+            elif argType == "/edit":
+                # Load up the default application.
+                i += 1
+                fname = win32api.GetFullPathName(par)
+                if not os.path.isfile(fname):
+                    # if we don't catch this, OpenDocumentFile() (actually
+                    # PyCDocument.SetPathName() in
+                    # pywin.scintilla.document.CScintillaDocument.OnOpenDocument)
+                    # segfaults Pythonwin on recent PY3 builds (b228)
+                    win32ui.MessageBox(
+                        "No such file: %s\n\nCommand Line: %s"
+                        % (fname, win32api.GetCommandLine()),
+                        "Open file for edit",
+                        win32con.MB_ICONERROR,
+                    )
+                    continue
+                if dde:
+                    dde.Exec("win32ui.GetApp().OpenDocumentFile(%s)" % (repr(fname)))
+                else:
+                    win32ui.GetApp().OpenDocumentFile(par)
+            elif argType == "/rundlg":
+                if dde:
+                    dde.Exec(
+                        "from pywin.framework import scriptutils;scriptutils.RunScript(%r, %r, 1)"
+                        % (par, " ".join(args[i + 1 :]))
+                    )
+                else:
+                    from . import scriptutils
+
+                    scriptutils.RunScript(par, " ".join(args[i + 1 :]))
+                return
+            elif argType == "/run":
+                if dde:
+                    dde.Exec(
+                        "from pywin.framework import scriptutils;scriptutils.RunScript(%r, %r, 0)"
+                        % (par, " ".join(args[i + 1 :]))
+                    )
+                else:
+                    from . import scriptutils
+
+                    scriptutils.RunScript(par, " ".join(args[i + 1 :]), 0)
+                return
+            elif argType == "/app":
+                raise RuntimeError(
+                    "/app only supported for new instances of Pythonwin.exe"
+                )
+            elif argType == "/dde":  # Send arbitary command
+                if dde is not None:
+                    dde.Exec(par)
+                else:
+                    win32ui.MessageBox(
+                        "The /dde command can only be used\r\nwhen Pythonwin is already running"
+                    )
+                i += 1
+            else:
+                raise ValueError("Command line argument not recognised: %s" % argType)
+
+    def LoadSystemModules(self):
+        self.DoLoadModules("pywin.framework.editor,pywin.framework.stdin")
+
+    def LoadUserModules(self, moduleNames=None):
+        # Load the users modules.
+        if moduleNames is None:
+            default = "pywin.framework.sgrepmdi,pywin.framework.mdi_pychecker"
+            moduleNames = win32ui.GetProfileVal("Python", "Startup Modules", default)
+        self.DoLoadModules(moduleNames)
+
+    def DoLoadModules(self, moduleNames):  # ", sep string of module names.
+        if not moduleNames:
+            return
+        modules = moduleNames.split(",")
+        for module in modules:
+            try:
+                __import__(module)
+            except:  # Catch em all, else the app itself dies! 'ImportError:
+                traceback.print_exc()
+                msg = 'Startup import of user module "%s" failed' % module
+                print(msg)
+                win32ui.MessageBox(msg)
+
+    #
+    # DDE Callback
+    #
+    def OnDDECommand(self, command):
+        try:
+            exec(command + "\n")
+        except:
+            print("ERROR executing DDE command: ", command)
+            traceback.print_exc()
+            raise
+
+    #
+    # General handlers
+    #
+    def OnViewBrowse(self, id, code):
+        "Called when ViewBrowse message is received"
+        from pywin.tools import browser
+
+        obName = dialog.GetSimpleInput("Object", "__builtins__", "Browse Python Object")
+        if obName is None:
+            return
+        try:
+            browser.Browse(eval(obName, __main__.__dict__, __main__.__dict__))
+        except NameError:
+            win32ui.MessageBox("This is no object with this name")
+        except AttributeError:
+            win32ui.MessageBox("The object has no attribute of that name")
+        except:
+            traceback.print_exc()
+            win32ui.MessageBox("This object can not be browsed")
+
+    def OnFileImport(self, id, code):
+        "Called when a FileImport message is received. Import the current or specified file"
+        from . import scriptutils
+
+        scriptutils.ImportFile()
+
+    def OnFileCheck(self, id, code):
+        "Called when a FileCheck message is received. Check the current file."
+        from . import scriptutils
+
+        scriptutils.CheckFile()
+
+    def OnUpdateFileCheck(self, cmdui):
+        from . import scriptutils
+
+        cmdui.Enable(scriptutils.GetActiveFileName(0) is not None)
+
+    def OnFileRun(self, id, code):
+        "Called when a FileRun message is received."
+        from . import scriptutils
+
+        showDlg = win32api.GetKeyState(win32con.VK_SHIFT) >= 0
+        scriptutils.RunScript(None, None, showDlg)
+
+    def OnFileLocate(self, id, code):
+        from . import scriptutils
+
+        global lastLocateFileName  # save the new version away for next time...
+
+        name = dialog.GetSimpleInput(
+            "File name", lastLocateFileName, "Locate Python File"
+        )
+        if name is None:  # Cancelled.
+            return
+        lastLocateFileName = name
+        # if ".py" supplied, rip it off!
+        # should also check for .pys and .pyw
+        if lastLocateFileName[-3:].lower() == ".py":
+            lastLocateFileName = lastLocateFileName[:-3]
+        lastLocateFileName = lastLocateFileName.replace(".", "\\")
+        newName = scriptutils.LocatePythonFile(lastLocateFileName)
+        if newName is None:
+            win32ui.MessageBox("The file '%s' can not be located" % lastLocateFileName)
+        else:
+            win32ui.GetApp().OpenDocumentFile(newName)
+
+    # Display all the "options" proprety pages we can find
+    def OnViewOptions(self, id, code):
+        win32ui.InitRichEdit()
+        sheet = dialog.PropertySheet("Pythonwin Options")
+        # Add property pages we know about that need manual work.
+        from pywin.dialogs import ideoptions
+
+        sheet.AddPage(ideoptions.OptionsPropPage())
+
+        from . import toolmenu
+
+        sheet.AddPage(toolmenu.ToolMenuPropPage())
+
+        # Get other dynamic pages from templates.
+        pages = []
+        for template in self.GetDocTemplateList():
+            try:
+                # Dont actually call the function with the exception handler.
+                getter = template.GetPythonPropertyPages
+            except AttributeError:
+                # Template does not provide property pages!
+                continue
+            pages = pages + getter()
+
+        # Debugger template goes at the end
+        try:
+            from pywin.debugger import configui
+        except ImportError:
+            configui = None
+        if configui is not None:
+            pages.append(configui.DebuggerOptionsPropPage())
+        # Now simply add the pages, and display the dialog.
+        for page in pages:
+            sheet.AddPage(page)
+
+        if sheet.DoModal() == win32con.IDOK:
+            win32ui.SetStatusText("Applying configuration changes...", 1)
+            win32ui.DoWaitCursor(1)
+            # Tell every Window in our app that win.ini has changed!
+            win32ui.GetMainFrame().SendMessageToDescendants(
+                win32con.WM_WININICHANGE, 0, 0
+            )
+            win32ui.DoWaitCursor(0)
+
+    def OnInteractiveWindow(self, id, code):
+        # toggle the existing state.
+        from . import interact
+
+        interact.ToggleInteractiveWindow()
+
+    def OnUpdateInteractiveWindow(self, cmdui):
+        try:
+            interact = sys.modules["pywin.framework.interact"]
+            state = interact.IsInteractiveWindowVisible()
+        except KeyError:  # Interactive module hasnt ever been imported.
+            state = 0
+        cmdui.Enable()
+        cmdui.SetCheck(state)
+
+    def OnFileSaveAll(self, id, code):
+        # Only attempt to save editor documents.
+        from pywin.framework.editor import editorTemplate
+
+        num = 0
+        for doc in editorTemplate.GetDocumentList():
+            if doc.IsModified() and doc.GetPathName():
+                num = num = 1
+                doc.OnSaveDocument(doc.GetPathName())
+        win32ui.SetStatusText("%d documents saved" % num, 1)
+
+    def OnViewToolbarDbg(self, id, code):
+        if code == 0:
+            return not win32ui.GetMainFrame().OnBarCheck(id)
+
+    def OnUpdateViewToolbarDbg(self, cmdui):
+        win32ui.GetMainFrame().OnUpdateControlBarMenu(cmdui)
+        cmdui.Enable(1)
+
+    def OnHelpIndex(self, id, code):
+        from . import help
+
+        help.SelectAndRunHelpFile()
+
+
+# As per the comments in app.py, this use is depreciated.
+# app.AppBuilder = InteractivePythonApp
+
+# Now all we do is create the application
+thisApp = InteractivePythonApp()

.venv/Lib/site-packages/pythonwin/pywin/framework/intpydde.py

@@ -0,0 +1,58 @@
+# DDE support for Pythonwin
+#
+# Seems to work fine (in the context that IE4 seems to have broken
+# DDE on _all_ NT4 machines I have tried, but only when a "Command Prompt" window
+# is open.  Strange, but true.  If you have problems with this, close all Command Prompts!
+
+
+import win32ui
+import win32api, win32con
+from pywin.mfc import object
+from dde import *
+import sys, traceback
+
+
+class DDESystemTopic(object.Object):
+    def __init__(self, app):
+        self.app = app
+        object.Object.__init__(self, CreateServerSystemTopic())
+
+    def Exec(self, data):
+        try:
+            # 			print "Executing", cmd
+            self.app.OnDDECommand(data)
+        except:
+            t, v, tb = sys.exc_info()
+            # The DDE Execution failed.
+            print("Error executing DDE command.")
+            traceback.print_exception(t, v, tb)
+            return 0
+
+
+class DDEServer(object.Object):
+    def __init__(self, app):
+        self.app = app
+        object.Object.__init__(self, CreateServer())
+        self.topic = self.item = None
+
+    def CreateSystemTopic(self):
+        return DDESystemTopic(self.app)
+
+    def Shutdown(self):
+        self._obj_.Shutdown()
+        self._obj_.Destroy()
+        if self.topic is not None:
+            self.topic.Destroy()
+            self.topic = None
+        if self.item is not None:
+            self.item.Destroy()
+            self.item = None
+
+    def OnCreate(self):
+        return 1
+
+    def Status(self, msg):
+        try:
+            win32ui.SetStatusText(msg)
+        except win32ui.error:
+            pass

.venv/Lib/site-packages/pythonwin/pywin/framework/mdi_pychecker.py

@@ -0,0 +1,843 @@
+######################################################################
+##
+## The Pychecker MDI Plug-In UserModule for Pythonwin
+##
+## contributed by Robert Kiendl
+##
+## Style is similar to (and inherited) from the SGrepMDI UserModule
+##
+## Usage:
+##
+## Start Pychecker on current file: Menu/File/New../Pychecker.
+## Use it: Jump to Pychecker warning source lines by double-click.
+## Auto-add "#$pycheck_no" / "#$pycheck_no=specific-re-pattern" tags
+## to source lines by context/right-mouse-click on warning lines.
+##
+## It requires pychecker installed and the pychecker.bat to be on
+## the PATH. Example pychecker.bat:
+##
+##   REM pychecker.bat
+##   C:\bin\python.exe C:\PYTHON23\Lib\site-packages\pychecker\checker.py %1 %2 %3 %4 %5 %6 %7 %8 %9
+##
+## Adding it as default module in PythonWin:
+##
+##  +++ ./intpyapp.py	2006-10-02 17:59:32.974161600 +0200
+##  @@ -272,7 +282,7 @@
+## 	def LoadUserModules(self, moduleNames = None):
+## 		# Load the users modules.
+## 		if moduleNames is None:
+##  -			default = "sgrepmdi"
+##  +			default = "sgrepmdi,mdi_pychecker"
+## 			moduleNames=win32ui.GetProfileVal('Python','Startup Modules',default)
+## 		self.DoLoadModules(moduleNames)
+##
+######################################################################
+
+import win32ui
+import win32api
+from pywin.mfc import docview, dialog, window
+import win32con
+import sys, string, re, glob, os, stat, time
+from . import scriptutils
+
+
+def getsubdirs(d):
+    dlist = []
+    flist = glob.glob(d + "\\*")
+    for f in flist:
+        if os.path.isdir(f):
+            dlist.append(f)
+            dlist = dlist + getsubdirs(f)
+    return dlist
+
+
+class dirpath:
+    def __init__(self, str, recurse=0):
+        dp = str.split(";")
+        dirs = {}
+        for d in dp:
+            if os.path.isdir(d):
+                d = d.lower()
+                if d not in dirs:
+                    dirs[d] = None
+                    if recurse:
+                        subdirs = getsubdirs(d)
+                        for sd in subdirs:
+                            sd = sd.lower()
+                            if sd not in dirs:
+                                dirs[sd] = None
+            elif os.path.isfile(d):
+                pass
+            else:
+                x = None
+                if d in os.environ:
+                    x = dirpath(os.environ[d])
+                elif d[:5] == "HKEY_":
+                    keystr = d.split("\\")
+                    try:
+                        root = eval("win32con." + keystr[0])
+                    except:
+                        win32ui.MessageBox(
+                            "Can't interpret registry key name '%s'" % keystr[0]
+                        )
+                    try:
+                        subkey = "\\".join(keystr[1:])
+                        val = win32api.RegQueryValue(root, subkey)
+                        if val:
+                            x = dirpath(val)
+                        else:
+                            win32ui.MessageBox(
+                                "Registry path '%s' did not return a path entry" % d
+                            )
+                    except:
+                        win32ui.MessageBox(
+                            "Can't interpret registry key value: %s" % keystr[1:]
+                        )
+                else:
+                    win32ui.MessageBox("Directory '%s' not found" % d)
+                if x:
+                    for xd in x:
+                        if xd not in dirs:
+                            dirs[xd] = None
+                            if recurse:
+                                subdirs = getsubdirs(xd)
+                                for sd in subdirs:
+                                    sd = sd.lower()
+                                    if sd not in dirs:
+                                        dirs[sd] = None
+        self.dirs = []
+        for d in dirs.keys():
+            self.dirs.append(d)
+
+    def __getitem__(self, key):
+        return self.dirs[key]
+
+    def __len__(self):
+        return len(self.dirs)
+
+    def __setitem__(self, key, value):
+        self.dirs[key] = value
+
+    def __delitem__(self, key):
+        del self.dirs[key]
+
+    def __getslice__(self, lo, hi):
+        return self.dirs[lo:hi]
+
+    def __setslice__(self, lo, hi, seq):
+        self.dirs[lo:hi] = seq
+
+    def __delslice__(self, lo, hi):
+        del self.dirs[lo:hi]
+
+    def __add__(self, other):
+        if type(other) == type(self) or type(other) == type([]):
+            return self.dirs + other.dirs
+
+    def __radd__(self, other):
+        if type(other) == type(self) or type(other) == type([]):
+            return other.dirs + self.dirs
+
+
+# Group(1) is the filename, group(2) is the lineno.
+# regexGrepResult=regex.compile("^\\([a-zA-Z]:.*\\)(\\([0-9]+\\))")
+# regexGrep=re.compile(r"^([a-zA-Z]:[^(]*)\((\d+)\)")
+regexGrep = re.compile(r"^(..[^\(:]+)?[\(:](\d+)[\):]:?\s*(.*)")
+
+# these are the atom numbers defined by Windows for basic dialog controls
+
+BUTTON = 0x80
+EDIT = 0x81
+STATIC = 0x82
+LISTBOX = 0x83
+SCROLLBAR = 0x84
+COMBOBOX = 0x85
+
+
+class TheTemplate(docview.RichEditDocTemplate):
+    def __init__(self):
+        docview.RichEditDocTemplate.__init__(
+            self, win32ui.IDR_TEXTTYPE, TheDocument, TheFrame, TheView
+        )
+        self.SetDocStrings(
+            "\nPychecker\nPychecker\nPychecker params (*.pychecker)\n.pychecker\n\n\n"
+        )
+        win32ui.GetApp().AddDocTemplate(self)
+        self.docparams = None
+
+    def MatchDocType(self, fileName, fileType):
+        doc = self.FindOpenDocument(fileName)
+        if doc:
+            return doc
+        ext = os.path.splitext(fileName)[1].lower()
+        if ext == ".pychecker":
+            return win32ui.CDocTemplate_Confidence_yesAttemptNative
+        return win32ui.CDocTemplate_Confidence_noAttempt
+
+    def setParams(self, params):
+        self.docparams = params
+
+    def readParams(self):
+        tmp = self.docparams
+        self.docparams = None
+        return tmp
+
+
+class TheFrame(window.MDIChildWnd):
+    # The template and doc params will one day be removed.
+    def __init__(self, wnd=None):
+        window.MDIChildWnd.__init__(self, wnd)
+
+
+class TheDocument(docview.RichEditDoc):
+    def __init__(self, template):
+        docview.RichEditDoc.__init__(self, template)
+        self.dirpattern = ""
+        self.filpattern = ""
+        self.greppattern = ""
+        self.casesensitive = 1
+        self.recurse = 1
+        self.verbose = 0
+
+    def OnOpenDocument(self, fnm):
+        # this bizarre stuff with params is so right clicking in a result window
+        # and starting a new grep can communicate the default parameters to the
+        # new grep.
+        try:
+            params = open(fnm, "r").read()
+        except:
+            params = None
+        self.setInitParams(params)
+        return self.OnNewDocument()
+
+    def OnCloseDocument(self):
+        try:
+            win32ui.GetApp().DeleteIdleHandler(self.idleHandler)
+        except:
+            pass
+        return self._obj_.OnCloseDocument()
+
+    def saveInitParams(self):
+        # Only save the flags, not the text boxes.
+        paramstr = "\t\t\t%d\t%d" % (self.casesensitive, self.recurse)
+        win32ui.WriteProfileVal("Pychecker", "Params", paramstr)
+
+    def setInitParams(self, paramstr):
+        if paramstr is None:
+            paramstr = win32ui.GetProfileVal("Pychecker", "Params", "\t\t\t1\t0\t0")
+        params = paramstr.split("\t")
+        if len(params) < 3:
+            params = params + [""] * (3 - len(params))
+        if len(params) < 6:
+            params = params + [0] * (6 - len(params))
+        self.dirpattern = params[0]
+        self.filpattern = params[1]
+        self.greppattern = params[2] or "-#1000 --only"
+        self.casesensitive = int(params[3])
+        self.recurse = int(params[4])
+        self.verbose = int(params[5])
+        # setup some reasonable defaults.
+        if not self.dirpattern:
+            try:
+                editor = win32ui.GetMainFrame().MDIGetActive()[0].GetEditorView()
+                self.dirpattern = os.path.abspath(
+                    os.path.dirname(editor.GetDocument().GetPathName())
+                )
+            except (AttributeError, win32ui.error):
+                self.dirpattern = os.getcwd()
+        if not self.filpattern:
+            try:
+                editor = win32ui.GetMainFrame().MDIGetActive()[0].GetEditorView()
+                self.filpattern = editor.GetDocument().GetPathName()
+            except AttributeError:
+                self.filpattern = "*.py"
+
+    def OnNewDocument(self):
+        if self.dirpattern == "":
+            self.setInitParams(greptemplate.readParams())
+        d = TheDialog(
+            self.dirpattern,
+            self.filpattern,
+            self.greppattern,
+            self.casesensitive,
+            self.recurse,
+            self.verbose,
+        )
+        if d.DoModal() == win32con.IDOK:
+            self.dirpattern = d["dirpattern"]
+            self.filpattern = d["filpattern"]
+            self.greppattern = d["greppattern"]
+            # self.casesensitive = d['casesensitive']
+            # self.recurse = d['recursive']
+            # self.verbose = d['verbose']
+            self.doSearch()
+            self.saveInitParams()
+            return 1
+        return 0  # cancelled - return zero to stop frame creation.
+
+    def doSearch(self):
+        self.dp = dirpath(self.dirpattern, self.recurse)
+        self.SetTitle(
+            "Pychecker Run '%s' (options: %s)" % (self.filpattern, self.greppattern)
+        )
+        # self.text = []
+        self.GetFirstView().Append(
+            "#Pychecker Run in " + self.dirpattern + "  %s\n" % time.asctime()
+        )
+        if self.verbose:
+            self.GetFirstView().Append("#   =" + repr(self.dp.dirs) + "\n")
+        self.GetFirstView().Append("# Files   " + self.filpattern + "\n")
+        self.GetFirstView().Append("# Options " + self.greppattern + "\n")
+        self.fplist = self.filpattern.split(";")
+        self.GetFirstView().Append(
+            "# Running...  ( double click on result lines in order to jump to the source code ) \n"
+        )
+        win32ui.SetStatusText("Pychecker running.  Please wait...", 0)
+        self.dpndx = self.fpndx = 0
+        self.fndx = -1
+        if not self.dp:
+            self.GetFirstView().Append(
+                "# ERROR: '%s' does not resolve to any search locations"
+                % self.dirpattern
+            )
+            self.SetModifiedFlag(0)
+        else:
+            ##self.flist = glob.glob(self.dp[0]+'\\'+self.fplist[0])
+            import operator
+
+            self.flist = reduce(operator.add, list(map(glob.glob, self.fplist)))
+            # import pywin.debugger;pywin.debugger.set_trace()
+            self.startPycheckerRun()
+
+    def idleHandler(self, handler, count):
+        import time
+
+        time.sleep(0.001)
+        if self.result != None:
+            win32ui.GetApp().DeleteIdleHandler(self.idleHandler)
+            return 0
+        return 1  # more
+
+    def startPycheckerRun(self):
+        self.result = None
+        old = win32api.SetCursor(win32api.LoadCursor(0, win32con.IDC_APPSTARTING))
+        win32ui.GetApp().AddIdleHandler(self.idleHandler)
+        import _thread
+
+        _thread.start_new(self.threadPycheckerRun, ())
+        ##win32api.SetCursor(old)
+
+    def threadPycheckerRun(self):
+        result = ""
+        rc = -1
+        try:
+            options = self.greppattern
+            files = " ".join(self.flist)
+            # Recently MarkH has failed to run pychecker without it having
+            # been explicitly installed - so we assume it is and locate it
+            # from its default location.
+            # Step1 - get python.exe
+            py = os.path.join(sys.prefix, "python.exe")
+            if not os.path.isfile(py):
+                if "64 bit" in sys.version:
+                    py = os.path.join(sys.prefix, "PCBuild", "amd64", "python.exe")
+                else:
+                    py = os.path.join(sys.prefix, "PCBuild", "python.exe")
+            try:
+                py = win32api.GetShortPathName(py)
+            except win32api.error:
+                py = ""
+            # Find checker.py
+            import sysconfig
+
+            pychecker = os.path.join(
+                sysconfig.get_paths()["purelib"], "pychecker", "checker.py"
+            )
+            if not os.path.isfile(py):
+                result = "Can't find python.exe!\n"
+            elif not os.path.isfile(pychecker):
+                result = (
+                    "Can't find checker.py - please install pychecker "
+                    "(or run 'setup.py install' if you have the source version)\n"
+                )
+            else:
+                cmd = '%s "%s" %s %s 2>&1' % (py, pychecker, options, files)
+                ##fin,fout,ferr=os.popen3(cmd)
+                ##result=ferr.read()+fout.read()
+                result = os.popen(cmd).read()
+                ##rc=f.close()
+            self.GetFirstView().Append(result)
+        finally:
+            self.result = result
+            print("== Pychecker run finished ==")
+            self.GetFirstView().Append("\n" + "== Pychecker run finished ==")
+            self.SetModifiedFlag(0)
+
+    def _inactive_idleHandler(self, handler, count):
+        self.fndx = self.fndx + 1
+        if self.fndx < len(self.flist):
+            f = self.flist[self.fndx]
+            if self.verbose:
+                self.GetFirstView().Append("# .." + f + "\n")
+            win32ui.SetStatusText("Searching " + f, 0)
+            lines = open(f, "r").readlines()
+            for i in range(len(lines)):
+                line = lines[i]
+                if self.pat.search(line) != None:
+                    self.GetFirstView().Append(f + "(" + repr(i + 1) + ") " + line)
+        else:
+            self.fndx = -1
+            self.fpndx = self.fpndx + 1
+            if self.fpndx < len(self.fplist):
+                self.flist = glob.glob(
+                    self.dp[self.dpndx] + "\\" + self.fplist[self.fpndx]
+                )
+            else:
+                self.fpndx = 0
+                self.dpndx = self.dpndx + 1
+                if self.dpndx < len(self.dp):
+                    self.flist = glob.glob(
+                        self.dp[self.dpndx] + "\\" + self.fplist[self.fpndx]
+                    )
+                else:
+                    win32ui.SetStatusText("Search complete.", 0)
+                    self.SetModifiedFlag(0)  # default to not modified.
+                    try:
+                        win32ui.GetApp().DeleteIdleHandler(self.idleHandler)
+                    except:
+                        pass
+                    return 0
+        return 1
+
+    def GetParams(self):
+        return (
+            self.dirpattern
+            + "\t"
+            + self.filpattern
+            + "\t"
+            + self.greppattern
+            + "\t"
+            + repr(self.casesensitive)
+            + "\t"
+            + repr(self.recurse)
+            + "\t"
+            + repr(self.verbose)
+        )
+
+    def OnSaveDocument(self, filename):
+        #       print 'OnSaveDocument() filename=',filename
+        savefile = open(filename, "wb")
+        txt = self.GetParams() + "\n"
+        #       print 'writing',txt
+        savefile.write(txt)
+        savefile.close()
+        self.SetModifiedFlag(0)
+        return 1
+
+
+ID_OPEN_FILE = 0xE500
+ID_PYCHECKER = 0xE501
+ID_SAVERESULTS = 0x502
+ID_TRYAGAIN = 0x503
+ID_ADDCOMMENT = 0x504
+ID_ADDPYCHECKNO2 = 0x505
+
+
+class TheView(docview.RichEditView):
+    def __init__(self, doc):
+        docview.RichEditView.__init__(self, doc)
+        self.SetWordWrap(win32ui.CRichEditView_WrapNone)
+        self.HookHandlers()
+
+    def OnInitialUpdate(self):
+        rc = self._obj_.OnInitialUpdate()
+        format = (-402653169, 0, 200, 0, 0, 0, 49, "Courier New")
+        self.SetDefaultCharFormat(format)
+        return rc
+
+    def HookHandlers(self):
+        self.HookMessage(self.OnRClick, win32con.WM_RBUTTONDOWN)
+        self.HookCommand(self.OnCmdOpenFile, ID_OPEN_FILE)
+        self.HookCommand(self.OnCmdThe, ID_PYCHECKER)
+        self.HookCommand(self.OnCmdSave, ID_SAVERESULTS)
+        self.HookCommand(self.OnTryAgain, ID_TRYAGAIN)
+        self.HookCommand(self.OnAddComment, ID_ADDCOMMENT)
+        self.HookCommand(self.OnAddComment, ID_ADDPYCHECKNO2)
+        self.HookMessage(self.OnLDblClick, win32con.WM_LBUTTONDBLCLK)
+
+    def OnLDblClick(self, params):
+        line = self.GetLine()
+        regexGrepResult = regexGrep.match(line)
+        if regexGrepResult:
+            fname = regexGrepResult.group(1)
+            line = int(regexGrepResult.group(2))
+            scriptutils.JumpToDocument(fname, line)
+            return 0  # dont pass on
+        return 1  # pass it on by default.
+
+    def OnRClick(self, params):
+        menu = win32ui.CreatePopupMenu()
+        flags = win32con.MF_STRING | win32con.MF_ENABLED
+        lineno = self._obj_.LineFromChar(-1)  # selection or current line
+        line = self._obj_.GetLine(lineno)
+        regexGrepResult = regexGrep.match(line)
+        charstart, charend = self._obj_.GetSel()
+        if regexGrepResult:
+            self.fnm = regexGrepResult.group(1)
+            self.lnnum = int(regexGrepResult.group(2))
+            menu.AppendMenu(flags, ID_OPEN_FILE, "&Open " + self.fnm)
+            menu.AppendMenu(
+                flags, ID_ADDCOMMENT, "&Add to source: Comment Tag/#$pycheck_no .."
+            )
+            menu.AppendMenu(
+                flags,
+                ID_ADDPYCHECKNO2,
+                "&Add to source: Specific #$pycheck_no=%(errtext)s ..",
+            )
+            menu.AppendMenu(win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, ID_TRYAGAIN, "&Try Again")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_CUT, "Cu&t")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_COPY, "&Copy")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_PASTE, "&Paste")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_SELECT_ALL, "&Select all")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, ID_SAVERESULTS, "Sa&ve results")
+        menu.TrackPopupMenu(params[5])
+        return 0
+
+    def OnAddComment(self, cmd, code):
+        addspecific = cmd == ID_ADDPYCHECKNO2
+        _ = list(self.GetSel())
+        _.sort()
+        start, end = _
+        line_start, line_end = self.LineFromChar(start), self.LineFromChar(end)
+        first = 1
+        for i in range(line_start, line_end + 1):
+            line = self.GetLine(i)
+            m = regexGrep.match(line)
+            if m:
+                if first:
+                    first = 0
+                    cmnt = dialog.GetSimpleInput(
+                        "Add to %s lines" % (line_end - line_start + 1),
+                        addspecific
+                        and "  #$pycheck_no=%(errtext)s"
+                        or "  #$pycheck_no",
+                    )
+                    if not cmnt:
+                        return 0
+                ##import pywin.debugger;pywin.debugger.set_trace()
+                fname = m.group(1)
+                line = int(m.group(2))
+                view = scriptutils.JumpToDocument(fname, line)
+                pos = view.LineIndex(line) - 1
+                if view.GetTextRange(pos - 1, pos) in ("\r", "\n"):
+                    pos -= 1
+                view.SetSel(pos, pos)
+                errtext = m.group(3)
+                if start != end and line_start == line_end:
+                    errtext = self.GetSelText()
+                errtext = repr(re.escape(errtext).replace("\ ", " "))
+                view.ReplaceSel(addspecific and cmnt % locals() or cmnt)
+        return 0
+
+    def OnCmdOpenFile(self, cmd, code):
+        doc = win32ui.GetApp().OpenDocumentFile(self.fnm)
+        if doc:
+            vw = doc.GetFirstView()
+            # hope you have an editor that implements GotoLine()!
+            try:
+                vw.GotoLine(int(self.lnnum))
+            except:
+                pass
+        return 0
+
+    def OnCmdThe(self, cmd, code):
+        curparamsstr = self.GetDocument().GetParams()
+        params = curparamsstr.split("\t")
+        params[2] = self.sel
+        greptemplate.setParams("\t".join(params))
+        greptemplate.OpenDocumentFile()
+        return 0
+
+    def OnTryAgain(self, cmd, code):
+        greptemplate.setParams(self.GetDocument().GetParams())
+        greptemplate.OpenDocumentFile()
+        return 0
+
+    def OnCmdSave(self, cmd, code):
+        flags = win32con.OFN_OVERWRITEPROMPT
+        dlg = win32ui.CreateFileDialog(
+            0, None, None, flags, "Text Files (*.txt)|*.txt||", self
+        )
+        dlg.SetOFNTitle("Save Results As")
+        if dlg.DoModal() == win32con.IDOK:
+            pn = dlg.GetPathName()
+            self._obj_.SaveFile(pn)
+        return 0
+
+    def Append(self, strng):
+        numlines = self.GetLineCount()
+        endpos = self.LineIndex(numlines - 1) + len(self.GetLine(numlines - 1))
+        self.SetSel(endpos, endpos)
+        self.ReplaceSel(strng)
+
+
+class TheDialog(dialog.Dialog):
+    def __init__(self, dp, fp, gp, cs, r, v):
+        style = (
+            win32con.DS_MODALFRAME
+            | win32con.WS_POPUP
+            | win32con.WS_VISIBLE
+            | win32con.WS_CAPTION
+            | win32con.WS_SYSMENU
+            | win32con.DS_SETFONT
+        )
+        CS = win32con.WS_CHILD | win32con.WS_VISIBLE
+        tmp = [
+            ["Pychecker Run", (0, 0, 210, 90), style, None, (8, "MS Sans Serif")],
+        ]
+        tmp.append([STATIC, "Files:", -1, (7, 7, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                gp,
+                103,
+                (52, 7, 144, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append([STATIC, "Directories:", -1, (7, 20, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                dp,
+                102,
+                (52, 20, 128, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "...",
+                110,
+                (182, 20, 16, 11),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append([STATIC, "Options:", -1, (7, 33, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                fp,
+                101,
+                (52, 33, 128, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "...",
+                111,
+                (182, 33, 16, 11),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        # tmp.append([BUTTON,'Case sensitive',       104, (7,  45,  72,  9), CS | win32con.BS_AUTOCHECKBOX | win32con.BS_LEFTTEXT| win32con.WS_TABSTOP])
+        # tmp.append([BUTTON,'Subdirectories',       105, (7,  56,  72,  9), CS | win32con.BS_AUTOCHECKBOX | win32con.BS_LEFTTEXT| win32con.WS_TABSTOP])
+        # tmp.append([BUTTON,'Verbose',              106, (7,  67,  72,  9), CS | win32con.BS_AUTOCHECKBOX | win32con.BS_LEFTTEXT| win32con.WS_TABSTOP])
+        tmp.append(
+            [
+                BUTTON,
+                "OK",
+                win32con.IDOK,
+                (166, 53, 32, 12),
+                CS | win32con.BS_DEFPUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Cancel",
+                win32con.IDCANCEL,
+                (166, 67, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        dialog.Dialog.__init__(self, tmp)
+        self.AddDDX(101, "greppattern")
+        self.AddDDX(102, "dirpattern")
+        self.AddDDX(103, "filpattern")
+        # self.AddDDX(104,'casesensitive')
+        # self.AddDDX(105,'recursive')
+        # self.AddDDX(106,'verbose')
+        self._obj_.data["greppattern"] = gp
+        self._obj_.data["dirpattern"] = dp
+        self._obj_.data["filpattern"] = fp
+        # self._obj_.data['casesensitive']  = cs
+        # self._obj_.data['recursive'] = r
+        # self._obj_.data['verbose']  = v
+        self.HookCommand(self.OnMoreDirectories, 110)
+        self.HookCommand(self.OnMoreFiles, 111)
+
+    def OnMoreDirectories(self, cmd, code):
+        self.getMore("Pychecker\\Directories", "dirpattern")
+
+    def OnMoreFiles(self, cmd, code):
+        self.getMore("Pychecker\\File Types", "filpattern")
+
+    def getMore(self, section, key):
+        self.UpdateData(1)
+        # get the items out of the ini file
+        ini = win32ui.GetProfileFileName()
+        secitems = win32api.GetProfileSection(section, ini)
+        items = []
+        for secitem in secitems:
+            items.append(secitem.split("=")[1])
+        dlg = TheParamsDialog(items)
+        if dlg.DoModal() == win32con.IDOK:
+            itemstr = ";".join(dlg.getItems())
+            self._obj_.data[key] = itemstr
+            # update the ini file with dlg.getNew()
+            i = 0
+            newitems = dlg.getNew()
+            if newitems:
+                items = items + newitems
+                for item in items:
+                    win32api.WriteProfileVal(section, repr(i), item, ini)
+                    i = i + 1
+            self.UpdateData(0)
+
+    def OnOK(self):
+        self.UpdateData(1)
+        for id, name in [
+            (101, "greppattern"),
+            (102, "dirpattern"),
+            (103, "filpattern"),
+        ]:
+            if not self[name]:
+                self.GetDlgItem(id).SetFocus()
+                win32api.MessageBeep()
+                win32ui.SetStatusText("Please enter a value")
+                return
+        self._obj_.OnOK()
+
+
+class TheParamsDialog(dialog.Dialog):
+    def __init__(self, items):
+        self.items = items
+        self.newitems = []
+        style = (
+            win32con.DS_MODALFRAME
+            | win32con.WS_POPUP
+            | win32con.WS_VISIBLE
+            | win32con.WS_CAPTION
+            | win32con.WS_SYSMENU
+            | win32con.DS_SETFONT
+        )
+        CS = win32con.WS_CHILD | win32con.WS_VISIBLE
+        tmp = [
+            [
+                "Pychecker Parameters",
+                (0, 0, 205, 100),
+                style,
+                None,
+                (8, "MS Sans Serif"),
+            ],
+        ]
+        tmp.append(
+            [
+                LISTBOX,
+                "",
+                107,
+                (7, 7, 150, 72),
+                CS
+                | win32con.LBS_MULTIPLESEL
+                | win32con.LBS_STANDARD
+                | win32con.LBS_HASSTRINGS
+                | win32con.WS_TABSTOP
+                | win32con.LBS_NOTIFY,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "OK",
+                win32con.IDOK,
+                (167, 7, 32, 12),
+                CS | win32con.BS_DEFPUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Cancel",
+                win32con.IDCANCEL,
+                (167, 23, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append([STATIC, "New:", -1, (2, 83, 15, 12), CS])
+        tmp.append(
+            [
+                EDIT,
+                "",
+                108,
+                (18, 83, 139, 12),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Add",
+                109,
+                (167, 83, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        dialog.Dialog.__init__(self, tmp)
+        self.HookCommand(self.OnAddItem, 109)
+        self.HookCommand(self.OnListDoubleClick, 107)
+
+    def OnInitDialog(self):
+        lb = self.GetDlgItem(107)
+        for item in self.items:
+            lb.AddString(item)
+        return self._obj_.OnInitDialog()
+
+    def OnAddItem(self, cmd, code):
+        eb = self.GetDlgItem(108)
+        item = eb.GetLine(0)
+        self.newitems.append(item)
+        lb = self.GetDlgItem(107)
+        i = lb.AddString(item)
+        lb.SetSel(i, 1)
+        return 1
+
+    def OnListDoubleClick(self, cmd, code):
+        if code == win32con.LBN_DBLCLK:
+            self.OnOK()
+            return 1
+
+    def OnOK(self):
+        lb = self.GetDlgItem(107)
+        self.selections = lb.GetSelTextItems()
+        self._obj_.OnOK()
+
+    def getItems(self):
+        return self.selections
+
+    def getNew(self):
+        return self.newitems
+
+
+try:
+    win32ui.GetApp().RemoveDocTemplate(greptemplate)
+except NameError:
+    pass
+
+greptemplate = TheTemplate()

.venv/Lib/site-packages/pythonwin/pywin/framework/scriptutils.py

@@ -0,0 +1,685 @@
+"""
+Various utilities for running/importing a script
+"""
+import sys
+import win32ui
+import win32api
+import win32con
+import __main__
+from pywin.mfc import dialog
+from pywin.mfc.docview import TreeView
+import os
+import string
+import traceback
+import linecache
+import bdb
+
+from .cmdline import ParseArgs
+
+RS_DEBUGGER_NONE = 0  # Dont run under the debugger.
+RS_DEBUGGER_STEP = 1  # Start stepping under the debugger
+RS_DEBUGGER_GO = 2  # Just run under the debugger, stopping only at break-points.
+RS_DEBUGGER_PM = 3  # Dont run under debugger, but do post-mortem analysis on exception.
+
+debugging_options = """No debugging
+Step-through in the debugger
+Run in the debugger
+Post-Mortem of unhandled exceptions""".split(
+    "\n"
+)
+
+byte_cr = "\r".encode("ascii")
+byte_lf = "\n".encode("ascii")
+byte_crlf = "\r\n".encode("ascii")
+
+# A dialog box for the "Run Script" command.
+class DlgRunScript(dialog.Dialog):
+    "A class for the 'run script' dialog"
+
+    def __init__(self, bHaveDebugger):
+        dialog.Dialog.__init__(self, win32ui.IDD_RUN_SCRIPT)
+        self.AddDDX(win32ui.IDC_EDIT1, "script")
+        self.AddDDX(win32ui.IDC_EDIT2, "args")
+        self.AddDDX(win32ui.IDC_COMBO1, "debuggingType", "i")
+        self.HookCommand(self.OnBrowse, win32ui.IDC_BUTTON2)
+        self.bHaveDebugger = bHaveDebugger
+
+    def OnInitDialog(self):
+        rc = dialog.Dialog.OnInitDialog(self)
+        cbo = self.GetDlgItem(win32ui.IDC_COMBO1)
+        for o in debugging_options:
+            cbo.AddString(o)
+        cbo.SetCurSel(self["debuggingType"])
+        if not self.bHaveDebugger:
+            cbo.EnableWindow(0)
+
+    def OnBrowse(self, id, cmd):
+        openFlags = win32con.OFN_OVERWRITEPROMPT | win32con.OFN_FILEMUSTEXIST
+        dlg = win32ui.CreateFileDialog(
+            1, None, None, openFlags, "Python Scripts (*.py)|*.py||", self
+        )
+        dlg.SetOFNTitle("Run Script")
+        if dlg.DoModal() != win32con.IDOK:
+            return 0
+        self["script"] = dlg.GetPathName()
+        self.UpdateData(0)
+        return 0
+
+
+def GetDebugger():
+    """Get the default Python debugger.  Returns the debugger, or None.
+
+    It is assumed the debugger has a standard "pdb" defined interface.
+    Currently always returns the 'pywin.debugger' debugger, or None
+    (pdb is _not_ returned as it is not effective in this GUI environment)
+    """
+    try:
+        import pywin.debugger
+
+        return pywin.debugger
+    except ImportError:
+        return None
+
+
+def IsOnPythonPath(path):
+    "Given a path only, see if it is on the Pythonpath.  Assumes path is a full path spec."
+    # must check that the command line arg's path is in sys.path
+    for syspath in sys.path:
+        try:
+            # Python 1.5 and later allows an empty sys.path entry.
+            if syspath and win32ui.FullPath(syspath) == path:
+                return 1
+        except win32ui.error as details:
+            print(
+                "Warning: The sys.path entry '%s' is invalid\n%s" % (syspath, details)
+            )
+    return 0
+
+
+def GetPackageModuleName(fileName):
+    """Given a filename, return (module name, new path).
+    eg - given "c:\a\b\c\my.py", return ("b.c.my",None) if "c:\a" is on sys.path.
+    If no package found, will return ("my", "c:\a\b\c")
+    """
+    path, fname = os.path.split(fileName)
+    path = origPath = win32ui.FullPath(path)
+    fname = os.path.splitext(fname)[0]
+    modBits = []
+    newPathReturn = None
+    if not IsOnPythonPath(path):
+        # Module not directly on the search path - see if under a package.
+        while len(path) > 3:  # ie 'C:\'
+            path, modBit = os.path.split(path)
+            modBits.append(modBit)
+            # If on path, _and_ existing package of that name loaded.
+            if (
+                IsOnPythonPath(path)
+                and modBit in sys.modules
+                and (
+                    os.path.exists(os.path.join(path, modBit, "__init__.py"))
+                    or os.path.exists(os.path.join(path, modBit, "__init__.pyc"))
+                    or os.path.exists(os.path.join(path, modBit, "__init__.pyo"))
+                )
+            ):
+                modBits.reverse()
+                return ".".join(modBits) + "." + fname, newPathReturn
+            # Not found - look a level higher
+        else:
+            newPathReturn = origPath
+
+    return fname, newPathReturn
+
+
+def GetActiveView():
+    """Gets the edit control (eg, EditView) with the focus, or None"""
+    try:
+        childFrame, bIsMaximised = win32ui.GetMainFrame().MDIGetActive()
+        return childFrame.GetActiveView()
+    except win32ui.error:
+        return None
+
+
+def GetActiveEditControl():
+    view = GetActiveView()
+    if view is None:
+        return None
+    if hasattr(view, "SCIAddText"):  # Is it a scintilla control?
+        return view
+    try:
+        return view.GetRichEditCtrl()
+    except AttributeError:
+        pass
+    try:
+        return view.GetEditCtrl()
+    except AttributeError:
+        pass
+
+
+def GetActiveEditorDocument():
+    """Returns the active editor document and view, or (None,None) if no
+    active document or its not an editor document.
+    """
+    view = GetActiveView()
+    if view is None or isinstance(view, TreeView):
+        return (None, None)
+    doc = view.GetDocument()
+    if hasattr(doc, "MarkerAdd"):  # Is it an Editor document?
+        return doc, view
+    return (None, None)
+
+
+def GetActiveFileName(bAutoSave=1):
+    """Gets the file name for the active frame, saving it if necessary.
+
+    Returns None if it cant be found, or raises KeyboardInterrupt.
+    """
+    pathName = None
+    active = GetActiveView()
+    if active is None:
+        return None
+    try:
+        doc = active.GetDocument()
+        pathName = doc.GetPathName()
+
+        if bAutoSave and (
+            len(pathName) > 0
+            or doc.GetTitle()[:8] == "Untitled"
+            or doc.GetTitle()[:6] == "Script"
+        ):  # if not a special purpose window
+            if doc.IsModified():
+                try:
+                    doc.OnSaveDocument(pathName)
+                    pathName = doc.GetPathName()
+
+                    # clear the linecache buffer
+                    linecache.clearcache()
+
+                except win32ui.error:
+                    raise KeyboardInterrupt
+
+    except (win32ui.error, AttributeError):
+        pass
+    if not pathName:
+        return None
+    return pathName
+
+
+lastScript = ""
+lastArgs = ""
+lastDebuggingType = RS_DEBUGGER_NONE
+
+
+def RunScript(defName=None, defArgs=None, bShowDialog=1, debuggingType=None):
+    global lastScript, lastArgs, lastDebuggingType
+    _debugger_stop_frame_ = 1  # Magic variable so the debugger will hide me!
+
+    # Get the debugger - may be None!
+    debugger = GetDebugger()
+
+    if defName is None:
+        try:
+            pathName = GetActiveFileName()
+        except KeyboardInterrupt:
+            return  # User cancelled save.
+    else:
+        pathName = defName
+    if not pathName:
+        pathName = lastScript
+    if defArgs is None:
+        args = ""
+        if pathName == lastScript:
+            args = lastArgs
+    else:
+        args = defArgs
+    if debuggingType is None:
+        debuggingType = lastDebuggingType
+
+    if not pathName or bShowDialog:
+        dlg = DlgRunScript(debugger is not None)
+        dlg["script"] = pathName
+        dlg["args"] = args
+        dlg["debuggingType"] = debuggingType
+        if dlg.DoModal() != win32con.IDOK:
+            return
+        script = dlg["script"]
+        args = dlg["args"]
+        debuggingType = dlg["debuggingType"]
+        if not script:
+            return
+        if debuggingType == RS_DEBUGGER_GO and debugger is not None:
+            # This may surprise users - they select "Run under debugger", but
+            # it appears not to!  Only warn when they pick from the dialog!
+            # First - ensure the debugger is activated to pickup any break-points
+            # set in the editor.
+            try:
+                # Create the debugger, but _dont_ init the debugger GUI.
+                rd = debugger._GetCurrentDebugger()
+            except AttributeError:
+                rd = None
+            if rd is not None and len(rd.breaks) == 0:
+                msg = "There are no active break-points.\r\n\r\nSelecting this debug option without any\r\nbreak-points is unlikely to have the desired effect\r\nas the debugger is unlikely to be invoked..\r\n\r\nWould you like to step-through in the debugger instead?"
+                rc = win32ui.MessageBox(
+                    msg,
+                    win32ui.LoadString(win32ui.IDR_DEBUGGER),
+                    win32con.MB_YESNOCANCEL | win32con.MB_ICONINFORMATION,
+                )
+                if rc == win32con.IDCANCEL:
+                    return
+                if rc == win32con.IDYES:
+                    debuggingType = RS_DEBUGGER_STEP
+
+        lastDebuggingType = debuggingType
+        lastScript = script
+        lastArgs = args
+    else:
+        script = pathName
+
+    # try and open the script.
+    if (
+        len(os.path.splitext(script)[1]) == 0
+    ):  # check if no extension supplied, and give one.
+        script = script + ".py"
+    # If no path specified, try and locate the file
+    path, fnameonly = os.path.split(script)
+    if len(path) == 0:
+        try:
+            os.stat(fnameonly)  # See if it is OK as is...
+            script = fnameonly
+        except os.error:
+            fullScript = LocatePythonFile(script)
+            if fullScript is None:
+                win32ui.MessageBox("The file '%s' can not be located" % script)
+                return
+            script = fullScript
+    else:
+        path = win32ui.FullPath(path)
+        if not IsOnPythonPath(path):
+            sys.path.append(path)
+
+    # py3k fun: If we use text mode to open the file, we get \r\n
+    # translated so Python allows the syntax (good!), but we get back
+    # text already decoded from the default encoding (bad!) and Python
+    # ignores any encoding decls (bad!).  If we use binary mode we get
+    # the raw bytes and Python looks at the encoding (good!) but \r\n
+    # chars stay in place so Python throws a syntax error (bad!).
+    # So: so the binary thing and manually normalize \r\n.
+    try:
+        f = open(script, "rb")
+    except IOError as exc:
+        win32ui.MessageBox(
+            "The file could not be opened - %s (%d)" % (exc.strerror, exc.errno)
+        )
+        return
+
+    # Get the source-code - as above, normalize \r\n
+    code = f.read().replace(byte_crlf, byte_lf).replace(byte_cr, byte_lf) + byte_lf
+
+    # Remember and hack sys.argv for the script.
+    oldArgv = sys.argv
+    sys.argv = ParseArgs(args)
+    sys.argv.insert(0, script)
+    # sys.path[0] is the path of the script
+    oldPath0 = sys.path[0]
+    newPath0 = os.path.split(script)[0]
+    if not oldPath0:  # if sys.path[0] is empty
+        sys.path[0] = newPath0
+        insertedPath0 = 0
+    else:
+        sys.path.insert(0, newPath0)
+        insertedPath0 = 1
+    bWorked = 0
+    win32ui.DoWaitCursor(1)
+    base = os.path.split(script)[1]
+    # Allow windows to repaint before starting.
+    win32ui.PumpWaitingMessages()
+    win32ui.SetStatusText("Running script %s..." % base, 1)
+    exitCode = 0
+    from pywin.framework import interact
+
+    # Check the debugger flags
+    if debugger is None and (debuggingType != RS_DEBUGGER_NONE):
+        win32ui.MessageBox(
+            "No debugger is installed.  Debugging options have been ignored!"
+        )
+        debuggingType = RS_DEBUGGER_NONE
+
+    # Get a code object - ignore the debugger for this, as it is probably a syntax error
+    # at this point
+    try:
+        codeObject = compile(code, script, "exec")
+    except:
+        # Almost certainly a syntax error!
+        _HandlePythonFailure("run script", script)
+        # No code object which to run/debug.
+        return
+    __main__.__file__ = script
+    try:
+        if debuggingType == RS_DEBUGGER_STEP:
+            debugger.run(codeObject, __main__.__dict__, start_stepping=1)
+        elif debuggingType == RS_DEBUGGER_GO:
+            debugger.run(codeObject, __main__.__dict__, start_stepping=0)
+        else:
+            # Post mortem or no debugging
+            exec(codeObject, __main__.__dict__)
+        bWorked = 1
+    except bdb.BdbQuit:
+        # Dont print tracebacks when the debugger quit, but do print a message.
+        print("Debugging session cancelled.")
+        exitCode = 1
+        bWorked = 1
+    except SystemExit as code:
+        exitCode = code
+        bWorked = 1
+    except KeyboardInterrupt:
+        # Consider this successful, as we dont want the debugger.
+        # (but we do want a traceback!)
+        if interact.edit and interact.edit.currentView:
+            interact.edit.currentView.EnsureNoPrompt()
+        traceback.print_exc()
+        if interact.edit and interact.edit.currentView:
+            interact.edit.currentView.AppendToPrompt([])
+        bWorked = 1
+    except:
+        if interact.edit and interact.edit.currentView:
+            interact.edit.currentView.EnsureNoPrompt()
+        traceback.print_exc()
+        if interact.edit and interact.edit.currentView:
+            interact.edit.currentView.AppendToPrompt([])
+        if debuggingType == RS_DEBUGGER_PM:
+            debugger.pm()
+    del __main__.__file__
+    sys.argv = oldArgv
+    if insertedPath0:
+        del sys.path[0]
+    else:
+        sys.path[0] = oldPath0
+    f.close()
+    if bWorked:
+        win32ui.SetStatusText("Script '%s' returned exit code %s" % (script, exitCode))
+    else:
+        win32ui.SetStatusText("Exception raised while running script  %s" % base)
+    try:
+        sys.stdout.flush()
+    except AttributeError:
+        pass
+
+    win32ui.DoWaitCursor(0)
+
+
+def ImportFile():
+    """This code looks for the current window, and determines if it can be imported.  If not,
+    it will prompt for a file name, and allow it to be imported."""
+    try:
+        pathName = GetActiveFileName()
+    except KeyboardInterrupt:
+        pathName = None
+
+    if pathName is not None:
+        if os.path.splitext(pathName)[1].lower() not in (".py", ".pyw", ".pyx"):
+            pathName = None
+
+    if pathName is None:
+        openFlags = win32con.OFN_OVERWRITEPROMPT | win32con.OFN_FILEMUSTEXIST
+        dlg = win32ui.CreateFileDialog(
+            1, None, None, openFlags, "Python Scripts (*.py;*.pyw)|*.py;*.pyw;*.pyx||"
+        )
+        dlg.SetOFNTitle("Import Script")
+        if dlg.DoModal() != win32con.IDOK:
+            return 0
+
+        pathName = dlg.GetPathName()
+
+    # If already imported, dont look for package
+    path, modName = os.path.split(pathName)
+    modName, modExt = os.path.splitext(modName)
+    newPath = None
+    # note that some packages (*cough* email *cough*) use "lazy importers"
+    # meaning sys.modules can change as a side-effect of looking at
+    # module.__file__ - so we must take a copy (ie, items() in py2k,
+    # list(items()) in py3k)
+    for key, mod in list(sys.modules.items()):
+        if getattr(mod, "__file__", None):
+            fname = mod.__file__
+            base, ext = os.path.splitext(fname)
+            if ext.lower() in [".pyo", ".pyc"]:
+                ext = ".py"
+            fname = base + ext
+            if win32ui.ComparePath(fname, pathName):
+                modName = key
+                break
+    else:  # for not broken
+        modName, newPath = GetPackageModuleName(pathName)
+        if newPath:
+            sys.path.append(newPath)
+
+    if modName in sys.modules:
+        bNeedReload = 1
+        what = "reload"
+    else:
+        what = "import"
+        bNeedReload = 0
+
+    win32ui.SetStatusText(what.capitalize() + "ing module...", 1)
+    win32ui.DoWaitCursor(1)
+    # 	win32ui.GetMainFrame().BeginWaitCursor()
+
+    try:
+        # always do an import, as it is cheap if it's already loaded.  This ensures
+        # it is in our name space.
+        codeObj = compile("import " + modName, "<auto import>", "exec")
+    except SyntaxError:
+        win32ui.SetStatusText('Invalid filename for import: "' + modName + '"')
+        return
+    try:
+        exec(codeObj, __main__.__dict__)
+        mod = sys.modules.get(modName)
+        if bNeedReload:
+            from importlib import reload
+
+            mod = reload(sys.modules[modName])
+        win32ui.SetStatusText(
+            "Successfully "
+            + what
+            + "ed module '"
+            + modName
+            + "': %s" % getattr(mod, "__file__", "<unkown file>")
+        )
+    except:
+        _HandlePythonFailure(what)
+    win32ui.DoWaitCursor(0)
+
+
+def CheckFile():
+    """This code looks for the current window, and gets Python to check it
+    without actually executing any code (ie, by compiling only)
+    """
+    try:
+        pathName = GetActiveFileName()
+    except KeyboardInterrupt:
+        return
+
+    what = "check"
+    win32ui.SetStatusText(what.capitalize() + "ing module...", 1)
+    win32ui.DoWaitCursor(1)
+    try:
+        f = open(pathName)
+    except IOError as details:
+        print("Cant open file '%s' - %s" % (pathName, details))
+        return
+    try:
+        code = f.read() + "\n"
+    finally:
+        f.close()
+    try:
+        codeObj = compile(code, pathName, "exec")
+        if RunTabNanny(pathName):
+            win32ui.SetStatusText(
+                "Python and the TabNanny successfully checked the file '"
+                + os.path.basename(pathName)
+                + "'"
+            )
+    except SyntaxError:
+        _HandlePythonFailure(what, pathName)
+    except:
+        traceback.print_exc()
+        _HandlePythonFailure(what)
+    win32ui.DoWaitCursor(0)
+
+
+def RunTabNanny(filename):
+    import io as io
+
+    tabnanny = FindTabNanny()
+    if tabnanny is None:
+        win32ui.MessageBox("The TabNanny is not around, so the children can run amok!")
+        return
+
+    # Capture the tab-nanny output
+    newout = io.StringIO()
+    old_out = sys.stderr, sys.stdout
+    sys.stderr = sys.stdout = newout
+    try:
+        tabnanny.check(filename)
+    finally:
+        # Restore output
+        sys.stderr, sys.stdout = old_out
+    data = newout.getvalue()
+    if data:
+        try:
+            lineno = data.split()[1]
+            lineno = int(lineno)
+            _JumpToPosition(filename, lineno)
+            try:  # Try and display whitespace
+                GetActiveEditControl().SCISetViewWS(1)
+            except:
+                pass
+            win32ui.SetStatusText("The TabNanny found trouble at line %d" % lineno)
+        except (IndexError, TypeError, ValueError):
+            print("The tab nanny complained, but I cant see where!")
+            print(data)
+        return 0
+    return 1
+
+
+def _JumpToPosition(fileName, lineno, col=1):
+    JumpToDocument(fileName, lineno, col)
+
+
+def JumpToDocument(fileName, lineno=0, col=1, nChars=0, bScrollToTop=0):
+    # Jump to the position in a file.
+    # If lineno is <= 0, dont move the position - just open/restore.
+    # if nChars > 0, select that many characters.
+    # if bScrollToTop, the specified line will be moved to the top of the window
+    #  (eg, bScrollToTop should be false when jumping to an error line to retain the
+    #  context, but true when jumping to a method defn, where we want the full body.
+    # Return the view which is editing the file, or None on error.
+    doc = win32ui.GetApp().OpenDocumentFile(fileName)
+    if doc is None:
+        return None
+    frame = doc.GetFirstView().GetParentFrame()
+    try:
+        view = frame.GetEditorView()
+        if frame.GetActiveView() != view:
+            frame.SetActiveView(view)
+        frame.AutoRestore()
+    except AttributeError:  # Not an editor frame??
+        view = doc.GetFirstView()
+    if lineno > 0:
+        charNo = view.LineIndex(lineno - 1)
+        start = charNo + col - 1
+        size = view.GetTextLength()
+        try:
+            view.EnsureCharsVisible(charNo)
+        except AttributeError:
+            print("Doesnt appear to be one of our views?")
+        view.SetSel(min(start, size), min(start + nChars, size))
+    if bScrollToTop:
+        curTop = view.GetFirstVisibleLine()
+        nScroll = (lineno - 1) - curTop
+        view.LineScroll(nScroll, 0)
+    view.SetFocus()
+    return view
+
+
+def _HandlePythonFailure(what, syntaxErrorPathName=None):
+    typ, details, tb = sys.exc_info()
+    if isinstance(details, SyntaxError):
+        try:
+            msg, (fileName, line, col, text) = details
+            if (not fileName or fileName == "<string>") and syntaxErrorPathName:
+                fileName = syntaxErrorPathName
+            _JumpToPosition(fileName, line, col)
+        except (TypeError, ValueError):
+            msg = str(details)
+        win32ui.SetStatusText("Failed to " + what + " - syntax error - %s" % msg)
+    else:
+        traceback.print_exc()
+        win32ui.SetStatusText("Failed to " + what + " - " + str(details))
+    tb = None  # Clean up a cycle.
+
+
+# Find the Python TabNanny in either the standard library or the Python Tools/Scripts directory.
+def FindTabNanny():
+    try:
+        return __import__("tabnanny")
+    except ImportError:
+        pass
+    # OK - not in the standard library - go looking.
+    filename = "tabnanny.py"
+    try:
+        path = win32api.RegQueryValue(
+            win32con.HKEY_LOCAL_MACHINE,
+            "SOFTWARE\\Python\\PythonCore\\%s\\InstallPath" % (sys.winver),
+        )
+    except win32api.error:
+        print("WARNING - The Python registry does not have an 'InstallPath' setting")
+        print("          The file '%s' can not be located" % (filename))
+        return None
+    fname = os.path.join(path, "Tools\\Scripts\\%s" % filename)
+    try:
+        os.stat(fname)
+    except os.error:
+        print(
+            "WARNING - The file '%s' can not be located in path '%s'" % (filename, path)
+        )
+        return None
+
+    tabnannyhome, tabnannybase = os.path.split(fname)
+    tabnannybase = os.path.splitext(tabnannybase)[0]
+    # Put tab nanny at the top of the path.
+    sys.path.insert(0, tabnannyhome)
+    try:
+        return __import__(tabnannybase)
+    finally:
+        # remove the tab-nanny from the path
+        del sys.path[0]
+
+
+def LocatePythonFile(fileName, bBrowseIfDir=1):
+    "Given a file name, return a fully qualified file name, or None"
+    # first look for the exact file as specified
+    if not os.path.isfile(fileName):
+        # Go looking!
+        baseName = fileName
+        for path in sys.path:
+            fileName = os.path.abspath(os.path.join(path, baseName))
+            if os.path.isdir(fileName):
+                if bBrowseIfDir:
+                    d = win32ui.CreateFileDialog(
+                        1, "*.py", None, 0, "Python Files (*.py)|*.py|All files|*.*"
+                    )
+                    d.SetOFNInitialDir(fileName)
+                    rc = d.DoModal()
+                    if rc == win32con.IDOK:
+                        fileName = d.GetPathName()
+                        break
+                    else:
+                        return None
+            else:
+                fileName = fileName + ".py"
+                if os.path.isfile(fileName):
+                    break  # Found it!
+
+        else:  # for not broken out of
+            return None
+    return win32ui.FullPath(fileName)

.venv/Lib/site-packages/pythonwin/pywin/framework/sgrepmdi.py

@@ -0,0 +1,747 @@
+# SGrepMDI is by Gordon McMillan (gmcm@hypernet.com)
+# It does basically what Find In Files does in MSVC with a couple enhancements.
+# - It saves any directories in the app's ini file (if you want to get rid
+# 	of them you'll have to edit the file)
+# - "Directories" can be directories,
+#  -	semicolon separated lists of "directories",
+#  -	environment variables that evaluate to "directories",
+#  -	registry path names that evaluate to "directories",
+#  -	all of which is recursive, so you can mix them all up.
+# - It is MDI, so you can 'nest' greps and return to earlier ones,
+# 	(ie, have multiple results open at the same time)
+# - Like FIF, double clicking a line opens an editor and takes you to the line.
+# - You can highlight text, right click and start a new grep with the selected
+# 	text as search pattern and same directories etc as before.
+# - You can save grep parameters (so you don't lose your hardearned pattern)
+# 	from File|Save
+# - You can save grep results by right clicking in the result window.
+# Hats off to Mark Hammond for providing an environment where I could cobble
+# something like this together in a couple evenings!
+
+import win32ui
+import win32api
+from pywin.mfc import docview, dialog, window
+import win32con
+import string
+import re
+import glob
+import os
+import stat
+import glob
+from . import scriptutils
+
+
+def getsubdirs(d):
+    dlist = []
+    flist = glob.glob(d + "\\*")
+    for f in flist:
+        if os.path.isdir(f):
+            dlist.append(f)
+            dlist = dlist + getsubdirs(f)
+    return dlist
+
+
+class dirpath:
+    def __init__(self, str, recurse=0):
+        dp = str.split(";")
+        dirs = {}
+        for d in dp:
+            if os.path.isdir(d):
+                d = d.lower()
+                if d not in dirs:
+                    dirs[d] = None
+                    if recurse:
+                        subdirs = getsubdirs(d)
+                        for sd in subdirs:
+                            sd = sd.lower()
+                            if sd not in dirs:
+                                dirs[sd] = None
+            elif os.path.isfile(d):
+                pass
+            else:
+                x = None
+                if d in os.environ:
+                    x = dirpath(os.environ[d])
+                elif d[:5] == "HKEY_":
+                    keystr = d.split("\\")
+                    try:
+                        root = eval("win32con." + keystr[0])
+                    except:
+                        win32ui.MessageBox(
+                            "Can't interpret registry key name '%s'" % keystr[0]
+                        )
+                    try:
+                        subkey = "\\".join(keystr[1:])
+                        val = win32api.RegQueryValue(root, subkey)
+                        if val:
+                            x = dirpath(val)
+                        else:
+                            win32ui.MessageBox(
+                                "Registry path '%s' did not return a path entry" % d
+                            )
+                    except:
+                        win32ui.MessageBox(
+                            "Can't interpret registry key value: %s" % keystr[1:]
+                        )
+                else:
+                    win32ui.MessageBox("Directory '%s' not found" % d)
+                if x:
+                    for xd in x:
+                        if xd not in dirs:
+                            dirs[xd] = None
+                            if recurse:
+                                subdirs = getsubdirs(xd)
+                                for sd in subdirs:
+                                    sd = sd.lower()
+                                    if sd not in dirs:
+                                        dirs[sd] = None
+        self.dirs = []
+        for d in list(dirs.keys()):
+            self.dirs.append(d)
+
+    def __getitem__(self, key):
+        return self.dirs[key]
+
+    def __len__(self):
+        return len(self.dirs)
+
+    def __setitem__(self, key, value):
+        self.dirs[key] = value
+
+    def __delitem__(self, key):
+        del self.dirs[key]
+
+    def __getslice__(self, lo, hi):
+        return self.dirs[lo:hi]
+
+    def __setslice__(self, lo, hi, seq):
+        self.dirs[lo:hi] = seq
+
+    def __delslice__(self, lo, hi):
+        del self.dirs[lo:hi]
+
+    def __add__(self, other):
+        if type(other) == type(self) or type(other) == type([]):
+            return self.dirs + other.dirs
+
+    def __radd__(self, other):
+        if type(other) == type(self) or type(other) == type([]):
+            return other.dirs + self.dirs
+
+
+# Group(1) is the filename, group(2) is the lineno.
+# regexGrepResult=regex.compile("^\\([a-zA-Z]:.*\\)(\\([0-9]+\\))")
+
+regexGrep = re.compile(r"^([a-zA-Z]:[^(]*)\(([0-9]+)\)")
+
+# these are the atom numbers defined by Windows for basic dialog controls
+
+BUTTON = 0x80
+EDIT = 0x81
+STATIC = 0x82
+LISTBOX = 0x83
+SCROLLBAR = 0x84
+COMBOBOX = 0x85
+
+
+class GrepTemplate(docview.RichEditDocTemplate):
+    def __init__(self):
+        docview.RichEditDocTemplate.__init__(
+            self, win32ui.IDR_TEXTTYPE, GrepDocument, GrepFrame, GrepView
+        )
+        self.SetDocStrings("\nGrep\nGrep\nGrep params (*.grep)\n.grep\n\n\n")
+        win32ui.GetApp().AddDocTemplate(self)
+        self.docparams = None
+
+    def MatchDocType(self, fileName, fileType):
+        doc = self.FindOpenDocument(fileName)
+        if doc:
+            return doc
+        ext = os.path.splitext(fileName)[1].lower()
+        if ext == ".grep":
+            return win32ui.CDocTemplate_Confidence_yesAttemptNative
+        return win32ui.CDocTemplate_Confidence_noAttempt
+
+    def setParams(self, params):
+        self.docparams = params
+
+    def readParams(self):
+        tmp = self.docparams
+        self.docparams = None
+        return tmp
+
+
+class GrepFrame(window.MDIChildWnd):
+    # The template and doc params will one day be removed.
+    def __init__(self, wnd=None):
+        window.MDIChildWnd.__init__(self, wnd)
+
+
+class GrepDocument(docview.RichEditDoc):
+    def __init__(self, template):
+        docview.RichEditDoc.__init__(self, template)
+        self.dirpattern = ""
+        self.filpattern = ""
+        self.greppattern = ""
+        self.casesensitive = 1
+        self.recurse = 1
+        self.verbose = 0
+
+    def OnOpenDocument(self, fnm):
+        # this bizarre stuff with params is so right clicking in a result window
+        # and starting a new grep can communicate the default parameters to the
+        # new grep.
+        try:
+            params = open(fnm, "r").read()
+        except:
+            params = None
+        self.setInitParams(params)
+        return self.OnNewDocument()
+
+    def OnCloseDocument(self):
+        try:
+            win32ui.GetApp().DeleteIdleHandler(self.SearchFile)
+        except:
+            pass
+        return self._obj_.OnCloseDocument()
+
+    def saveInitParams(self):
+        # Only save the flags, not the text boxes.
+        paramstr = "\t%s\t\t%d\t%d" % (
+            self.filpattern,
+            self.casesensitive,
+            self.recurse,
+        )
+        win32ui.WriteProfileVal("Grep", "Params", paramstr)
+
+    def setInitParams(self, paramstr):
+        if paramstr is None:
+            paramstr = win32ui.GetProfileVal("Grep", "Params", "\t\t\t1\t0\t0")
+        params = paramstr.split("\t")
+        if len(params) < 3:
+            params = params + [""] * (3 - len(params))
+        if len(params) < 6:
+            params = params + [0] * (6 - len(params))
+        self.dirpattern = params[0]
+        self.filpattern = params[1]
+        self.greppattern = params[2]
+        self.casesensitive = int(params[3])
+        self.recurse = int(params[4])
+        self.verbose = int(params[5])
+        # setup some reasonable defaults.
+        if not self.dirpattern:
+            try:
+                editor = win32ui.GetMainFrame().MDIGetActive()[0].GetEditorView()
+                self.dirpattern = os.path.abspath(
+                    os.path.dirname(editor.GetDocument().GetPathName())
+                )
+            except (AttributeError, win32ui.error):
+                self.dirpattern = os.getcwd()
+        if not self.filpattern:
+            self.filpattern = "*.py"
+
+    def OnNewDocument(self):
+        if self.dirpattern == "":
+            self.setInitParams(greptemplate.readParams())
+        d = GrepDialog(
+            self.dirpattern,
+            self.filpattern,
+            self.greppattern,
+            self.casesensitive,
+            self.recurse,
+            self.verbose,
+        )
+        if d.DoModal() == win32con.IDOK:
+            self.dirpattern = d["dirpattern"]
+            self.filpattern = d["filpattern"]
+            self.greppattern = d["greppattern"]
+            self.casesensitive = d["casesensitive"]
+            self.recurse = d["recursive"]
+            self.verbose = d["verbose"]
+            self.doSearch()
+            self.saveInitParams()
+            return 1
+        return 0  # cancelled - return zero to stop frame creation.
+
+    def doSearch(self):
+        self.dp = dirpath(self.dirpattern, self.recurse)
+        self.SetTitle("Grep for %s in %s" % (self.greppattern, self.filpattern))
+        # self.text = []
+        self.GetFirstView().Append("#Search " + self.dirpattern + "\n")
+        if self.verbose:
+            self.GetFirstView().Append("#   =" + repr(self.dp.dirs) + "\n")
+        self.GetFirstView().Append("# Files " + self.filpattern + "\n")
+        self.GetFirstView().Append("#   For " + self.greppattern + "\n")
+        self.fplist = self.filpattern.split(";")
+        if self.casesensitive:
+            self.pat = re.compile(self.greppattern)
+        else:
+            self.pat = re.compile(self.greppattern, re.IGNORECASE)
+        win32ui.SetStatusText("Searching.  Please wait...", 0)
+        self.dpndx = self.fpndx = 0
+        self.fndx = -1
+        if not self.dp:
+            self.GetFirstView().Append(
+                "# ERROR: '%s' does not resolve to any search locations"
+                % self.dirpattern
+            )
+            self.SetModifiedFlag(0)
+        else:
+            self.flist = glob.glob(self.dp[0] + "\\" + self.fplist[0])
+            win32ui.GetApp().AddIdleHandler(self.SearchFile)
+
+    def SearchFile(self, handler, count):
+        self.fndx = self.fndx + 1
+        if self.fndx < len(self.flist):
+            f = self.flist[self.fndx]
+            if self.verbose:
+                self.GetFirstView().Append("# .." + f + "\n")
+            # Directories may match the file type pattern, and files may be removed
+            #  while grep is running
+            if os.path.isfile(f):
+                win32ui.SetStatusText("Searching " + f, 0)
+                lines = open(f, "r").readlines()
+                for i in range(len(lines)):
+                    line = lines[i]
+                    if self.pat.search(line) != None:
+                        self.GetFirstView().Append(f + "(" + repr(i + 1) + ") " + line)
+        else:
+            self.fndx = -1
+            self.fpndx = self.fpndx + 1
+            if self.fpndx < len(self.fplist):
+                self.flist = glob.glob(
+                    self.dp[self.dpndx] + "\\" + self.fplist[self.fpndx]
+                )
+            else:
+                self.fpndx = 0
+                self.dpndx = self.dpndx + 1
+                if self.dpndx < len(self.dp):
+                    self.flist = glob.glob(
+                        self.dp[self.dpndx] + "\\" + self.fplist[self.fpndx]
+                    )
+                else:
+                    win32ui.SetStatusText("Search complete.", 0)
+                    self.SetModifiedFlag(0)  # default to not modified.
+                    try:
+                        win32ui.GetApp().DeleteIdleHandler(self.SearchFile)
+                    except:
+                        pass
+                    return 0
+        return 1
+
+    def GetParams(self):
+        return (
+            self.dirpattern
+            + "\t"
+            + self.filpattern
+            + "\t"
+            + self.greppattern
+            + "\t"
+            + repr(self.casesensitive)
+            + "\t"
+            + repr(self.recurse)
+            + "\t"
+            + repr(self.verbose)
+        )
+
+    def OnSaveDocument(self, filename):
+        # 		print 'OnSaveDocument() filename=',filename
+        savefile = open(filename, "wb")
+        txt = self.GetParams() + "\n"
+        # 		print 'writing',txt
+        savefile.write(txt)
+        savefile.close()
+        self.SetModifiedFlag(0)
+        return 1
+
+
+ID_OPEN_FILE = 0xE400
+ID_GREP = 0xE401
+ID_SAVERESULTS = 0x402
+ID_TRYAGAIN = 0x403
+
+
+class GrepView(docview.RichEditView):
+    def __init__(self, doc):
+        docview.RichEditView.__init__(self, doc)
+        self.SetWordWrap(win32ui.CRichEditView_WrapNone)
+        self.HookHandlers()
+
+    def OnInitialUpdate(self):
+        rc = self._obj_.OnInitialUpdate()
+        format = (-402653169, 0, 200, 0, 0, 0, 49, "Courier New")
+        self.SetDefaultCharFormat(format)
+        return rc
+
+    def HookHandlers(self):
+        self.HookMessage(self.OnRClick, win32con.WM_RBUTTONDOWN)
+        self.HookCommand(self.OnCmdOpenFile, ID_OPEN_FILE)
+        self.HookCommand(self.OnCmdGrep, ID_GREP)
+        self.HookCommand(self.OnCmdSave, ID_SAVERESULTS)
+        self.HookCommand(self.OnTryAgain, ID_TRYAGAIN)
+        self.HookMessage(self.OnLDblClick, win32con.WM_LBUTTONDBLCLK)
+
+    def OnLDblClick(self, params):
+        line = self.GetLine()
+        regexGrepResult = regexGrep.match(line)
+        if regexGrepResult:
+            fname = regexGrepResult.group(1)
+            line = int(regexGrepResult.group(2))
+            scriptutils.JumpToDocument(fname, line)
+            return 0  # dont pass on
+        return 1  # pass it on by default.
+
+    def OnRClick(self, params):
+        menu = win32ui.CreatePopupMenu()
+        flags = win32con.MF_STRING | win32con.MF_ENABLED
+        lineno = self._obj_.LineFromChar(-1)  # selection or current line
+        line = self._obj_.GetLine(lineno)
+        regexGrepResult = regexGrep.match(line)
+        if regexGrepResult:
+            self.fnm = regexGrepResult.group(1)
+            self.lnnum = int(regexGrepResult.group(2))
+            menu.AppendMenu(flags, ID_OPEN_FILE, "&Open " + self.fnm)
+            menu.AppendMenu(win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, ID_TRYAGAIN, "&Try Again")
+        charstart, charend = self._obj_.GetSel()
+        if charstart != charend:
+            linestart = self._obj_.LineIndex(lineno)
+            self.sel = line[charstart - linestart : charend - linestart]
+            menu.AppendMenu(flags, ID_GREP, "&Grep for " + self.sel)
+            menu.AppendMenu(win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_CUT, "Cu&t")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_COPY, "&Copy")
+        menu.AppendMenu(flags, win32ui.ID_EDIT_PASTE, "&Paste")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, win32ui.ID_EDIT_SELECT_ALL, "&Select all")
+        menu.AppendMenu(flags, win32con.MF_SEPARATOR)
+        menu.AppendMenu(flags, ID_SAVERESULTS, "Sa&ve results")
+        menu.TrackPopupMenu(params[5])
+        return 0
+
+    def OnCmdOpenFile(self, cmd, code):
+        doc = win32ui.GetApp().OpenDocumentFile(self.fnm)
+        if doc:
+            vw = doc.GetFirstView()
+            # hope you have an editor that implements GotoLine()!
+            try:
+                vw.GotoLine(int(self.lnnum))
+            except:
+                pass
+        return 0
+
+    def OnCmdGrep(self, cmd, code):
+        curparamsstr = self.GetDocument().GetParams()
+        params = curparamsstr.split("\t")
+        params[2] = self.sel
+        greptemplate.setParams("\t".join(params))
+        greptemplate.OpenDocumentFile()
+        return 0
+
+    def OnTryAgain(self, cmd, code):
+        greptemplate.setParams(self.GetDocument().GetParams())
+        greptemplate.OpenDocumentFile()
+        return 0
+
+    def OnCmdSave(self, cmd, code):
+        flags = win32con.OFN_OVERWRITEPROMPT
+        dlg = win32ui.CreateFileDialog(
+            0, None, None, flags, "Text Files (*.txt)|*.txt||", self
+        )
+        dlg.SetOFNTitle("Save Results As")
+        if dlg.DoModal() == win32con.IDOK:
+            pn = dlg.GetPathName()
+            self._obj_.SaveTextFile(pn)
+        return 0
+
+    def Append(self, strng):
+        numlines = self.GetLineCount()
+        endpos = self.LineIndex(numlines - 1) + len(self.GetLine(numlines - 1))
+        self.SetSel(endpos, endpos)
+        self.ReplaceSel(strng)
+
+
+class GrepDialog(dialog.Dialog):
+    def __init__(self, dp, fp, gp, cs, r, v):
+        style = (
+            win32con.DS_MODALFRAME
+            | win32con.WS_POPUP
+            | win32con.WS_VISIBLE
+            | win32con.WS_CAPTION
+            | win32con.WS_SYSMENU
+            | win32con.DS_SETFONT
+        )
+        CS = win32con.WS_CHILD | win32con.WS_VISIBLE
+        tmp = [
+            ["Grep", (0, 0, 210, 90), style, None, (8, "MS Sans Serif")],
+        ]
+        tmp.append([STATIC, "Grep For:", -1, (7, 7, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                gp,
+                101,
+                (52, 7, 144, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append([STATIC, "Directories:", -1, (7, 20, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                dp,
+                102,
+                (52, 20, 128, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "...",
+                110,
+                (182, 20, 16, 11),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append([STATIC, "File types:", -1, (7, 33, 50, 9), CS])
+        tmp.append(
+            [
+                EDIT,
+                fp,
+                103,
+                (52, 33, 128, 11),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "...",
+                111,
+                (182, 33, 16, 11),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Case sensitive",
+                104,
+                (7, 45, 72, 9),
+                CS
+                | win32con.BS_AUTOCHECKBOX
+                | win32con.BS_LEFTTEXT
+                | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Subdirectories",
+                105,
+                (7, 56, 72, 9),
+                CS
+                | win32con.BS_AUTOCHECKBOX
+                | win32con.BS_LEFTTEXT
+                | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Verbose",
+                106,
+                (7, 67, 72, 9),
+                CS
+                | win32con.BS_AUTOCHECKBOX
+                | win32con.BS_LEFTTEXT
+                | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "OK",
+                win32con.IDOK,
+                (166, 53, 32, 12),
+                CS | win32con.BS_DEFPUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Cancel",
+                win32con.IDCANCEL,
+                (166, 67, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        dialog.Dialog.__init__(self, tmp)
+        self.AddDDX(101, "greppattern")
+        self.AddDDX(102, "dirpattern")
+        self.AddDDX(103, "filpattern")
+        self.AddDDX(104, "casesensitive")
+        self.AddDDX(105, "recursive")
+        self.AddDDX(106, "verbose")
+        self._obj_.data["greppattern"] = gp
+        self._obj_.data["dirpattern"] = dp
+        self._obj_.data["filpattern"] = fp
+        self._obj_.data["casesensitive"] = cs
+        self._obj_.data["recursive"] = r
+        self._obj_.data["verbose"] = v
+        self.HookCommand(self.OnMoreDirectories, 110)
+        self.HookCommand(self.OnMoreFiles, 111)
+
+    def OnMoreDirectories(self, cmd, code):
+        self.getMore("Grep\\Directories", "dirpattern")
+
+    def OnMoreFiles(self, cmd, code):
+        self.getMore("Grep\\File Types", "filpattern")
+
+    def getMore(self, section, key):
+        self.UpdateData(1)
+        # get the items out of the ini file
+        ini = win32ui.GetProfileFileName()
+        secitems = win32api.GetProfileSection(section, ini)
+        items = []
+        for secitem in secitems:
+            items.append(secitem.split("=")[1])
+        dlg = GrepParamsDialog(items)
+        if dlg.DoModal() == win32con.IDOK:
+            itemstr = ";".join(dlg.getItems())
+            self._obj_.data[key] = itemstr
+            # update the ini file with dlg.getNew()
+            i = 0
+            newitems = dlg.getNew()
+            if newitems:
+                items = items + newitems
+                for item in items:
+                    win32api.WriteProfileVal(section, repr(i), item, ini)
+                    i = i + 1
+            self.UpdateData(0)
+
+    def OnOK(self):
+        self.UpdateData(1)
+        for id, name in [
+            (101, "greppattern"),
+            (102, "dirpattern"),
+            (103, "filpattern"),
+        ]:
+            if not self[name]:
+                self.GetDlgItem(id).SetFocus()
+                win32api.MessageBeep()
+                win32ui.SetStatusText("Please enter a value")
+                return
+        self._obj_.OnOK()
+
+
+class GrepParamsDialog(dialog.Dialog):
+    def __init__(self, items):
+        self.items = items
+        self.newitems = []
+        style = (
+            win32con.DS_MODALFRAME
+            | win32con.WS_POPUP
+            | win32con.WS_VISIBLE
+            | win32con.WS_CAPTION
+            | win32con.WS_SYSMENU
+            | win32con.DS_SETFONT
+        )
+        CS = win32con.WS_CHILD | win32con.WS_VISIBLE
+        tmp = [
+            ["Grep Parameters", (0, 0, 205, 100), style, None, (8, "MS Sans Serif")],
+        ]
+        tmp.append(
+            [
+                LISTBOX,
+                "",
+                107,
+                (7, 7, 150, 72),
+                CS
+                | win32con.LBS_MULTIPLESEL
+                | win32con.LBS_STANDARD
+                | win32con.LBS_HASSTRINGS
+                | win32con.WS_TABSTOP
+                | win32con.LBS_NOTIFY,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "OK",
+                win32con.IDOK,
+                (167, 7, 32, 12),
+                CS | win32con.BS_DEFPUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Cancel",
+                win32con.IDCANCEL,
+                (167, 23, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        tmp.append([STATIC, "New:", -1, (2, 83, 15, 12), CS])
+        tmp.append(
+            [
+                EDIT,
+                "",
+                108,
+                (18, 83, 139, 12),
+                CS | win32con.WS_TABSTOP | win32con.ES_AUTOHSCROLL | win32con.WS_BORDER,
+            ]
+        )
+        tmp.append(
+            [
+                BUTTON,
+                "Add",
+                109,
+                (167, 83, 32, 12),
+                CS | win32con.BS_PUSHBUTTON | win32con.WS_TABSTOP,
+            ]
+        )
+        dialog.Dialog.__init__(self, tmp)
+        self.HookCommand(self.OnAddItem, 109)
+        self.HookCommand(self.OnListDoubleClick, 107)
+
+    def OnInitDialog(self):
+        lb = self.GetDlgItem(107)
+        for item in self.items:
+            lb.AddString(item)
+        return self._obj_.OnInitDialog()
+
+    def OnAddItem(self, cmd, code):
+        eb = self.GetDlgItem(108)
+        item = eb.GetLine(0)
+        self.newitems.append(item)
+        lb = self.GetDlgItem(107)
+        i = lb.AddString(item)
+        lb.SetSel(i, 1)
+        return 1
+
+    def OnListDoubleClick(self, cmd, code):
+        if code == win32con.LBN_DBLCLK:
+            self.OnOK()
+            return 1
+
+    def OnOK(self):
+        lb = self.GetDlgItem(107)
+        self.selections = lb.GetSelTextItems()
+        self._obj_.OnOK()
+
+    def getItems(self):
+        return self.selections
+
+    def getNew(self):
+        return self.newitems
+
+
+try:
+    win32ui.GetApp().RemoveDocTemplate(greptemplate)
+except NameError:
+    pass
+
+greptemplate = GrepTemplate()

.venv/Lib/site-packages/pythonwin/pywin/framework/startup.py

@@ -0,0 +1,78 @@
+# startup.py
+#
+"The main application startup code for PythonWin."
+
+#
+# This does the basic command line handling.
+
+# Keep this as short as possible, cos error output is only redirected if
+# this runs OK.  Errors in imported modules are much better - the messages go somewhere (not any more :-)
+
+import sys
+import os
+import win32api
+import win32ui
+
+if not sys.argv:
+    # Initialize sys.argv from commandline. When sys.argv is empty list (
+    # different from [''] meaning "no cmd line arguments" ), then C
+    # bootstrapping or another method of invocation failed to initialize
+    # sys.argv and it will be done here. ( This was a workaround for a bug in
+    # win32ui but is retained for other situations. )
+    argv = win32api.CommandLineToArgv(win32api.GetCommandLine())
+    sys.argv = argv[1:]
+    if os.getcwd() not in sys.path and "." not in sys.path:
+        sys.path.insert(0, os.getcwd())
+
+# You may wish to redirect error output somewhere useful if you have startup errors.
+# eg, 'import win32traceutil' will do this for you.
+# import win32traceutil # Just uncomment this line to see error output!
+
+# An old class I used to use - generally only useful if Pythonwin is running under MSVC
+# class DebugOutput:
+# 	softspace=1
+# 	def write(self,message):
+# 		win32ui.OutputDebug(message)
+# sys.stderr=sys.stdout=DebugOutput()
+
+# To fix a problem with Pythonwin when started from the Pythonwin directory,
+# we update the pywin path to ensure it is absolute.
+# If it is indeed relative, it will be relative to our current directory.
+# If its already absolute, then this will have no affect.
+import pywin, pywin.framework
+
+pywin.__path__[0] = win32ui.FullPath(pywin.__path__[0])
+pywin.framework.__path__[0] = win32ui.FullPath(pywin.framework.__path__[0])
+
+# make a few wierd sys values.  This is so later we can clobber sys.argv to trick
+# scripts when running under a GUI environment.
+
+moduleName = "pywin.framework.intpyapp"
+sys.appargvoffset = 0
+sys.appargv = sys.argv[:]
+# Must check for /app param here.
+if len(sys.argv) >= 2 and sys.argv[0].lower() in ("/app", "-app"):
+    from . import cmdline
+
+    moduleName = cmdline.FixArgFileName(sys.argv[1])
+    sys.appargvoffset = 2
+    newargv = sys.argv[sys.appargvoffset :]
+    # 	newargv.insert(0, sys.argv[0])
+    sys.argv = newargv
+
+# Import the application module.
+__import__(moduleName)
+
+try:
+    win32ui.GetApp()._obj_
+    # This worked - an app already exists - do nothing more
+except (AttributeError, win32ui.error):
+    # This means either no app object exists at all, or the one
+    # that does exist does not have a Python class (ie, was created
+    # by the host .EXE).  In this case, we do the "old style" init...
+    from . import app
+
+    if app.AppBuilder is None:
+        raise TypeError("No application object has been registered")
+
+    app.App = app.AppBuilder()

.venv/Lib/site-packages/pythonwin/pywin/framework/stdin.py

@@ -0,0 +1,176 @@
+# Copyright (c) 2000 David Abrahams. Permission to copy, use, modify, sell
+# and distribute this software is granted provided this copyright
+# notice appears in all copies. This software is provided "as is" without
+# express or implied warranty, and with no claim as to its suitability for
+# any purpose.
+"""Provides a class Stdin which can be used to emulate the regular old
+sys.stdin for the PythonWin interactive window. Right now it just pops
+up a raw_input() dialog. With luck, someone will integrate it into the
+actual PythonWin interactive window someday.
+
+WARNING: Importing this file automatically replaces sys.stdin with an
+instance of Stdin (below). This is useful because you can just open
+Stdin.py in PythonWin and hit the import button to get it set up right
+if you don't feel like changing PythonWin's source. To put things back
+the way they were, simply use this magic incantation:
+    import sys
+    sys.stdin = sys.stdin.real_file
+"""
+import sys
+
+try:
+    get_input_line = raw_input  # py2x
+except NameError:
+    get_input_line = input  # py3k
+
+
+class Stdin:
+    def __init__(self):
+        self.real_file = sys.stdin  # NOTE: Likely to be None in py3k
+        self.buffer = ""
+        self.closed = False
+
+    def __getattr__(self, name):
+        """Forward most functions to the real sys.stdin for absolute realism."""
+        if self.real_file is None:
+            raise AttributeError(name)
+        return getattr(self.real_file, name)
+
+    def isatty(self):
+        """Return 1 if the file is connected to a tty(-like) device, else 0."""
+        return 1
+
+    def read(self, size=-1):
+        """Read at most size bytes from the file (less if the read
+        hits EOF or no more data is immediately available on a pipe,
+        tty or similar device). If the size argument is negative or
+        omitted, read all data until EOF is reached. The bytes are
+        returned as a string object. An empty string is returned when
+        EOF is encountered immediately. (For certain files, like ttys,
+        it makes sense to continue reading after an EOF is hit.)"""
+        result_size = self.__get_lines(size)
+        return self.__extract_from_buffer(result_size)
+
+    def readline(self, size=-1):
+        """Read one entire line from the file. A trailing newline
+        character is kept in the string2.6 (but may be absent when a file ends
+        with an incomplete line). If the size argument is present and
+        non-negative, it is a maximum byte count (including the trailing
+        newline) and an incomplete line may be returned. An empty string is
+        returned when EOF is hit immediately. Note: unlike stdio's fgets(),
+        the returned string contains null characters ('\0') if they occurred
+        in the input.
+        """
+        maximum_result_size = self.__get_lines(size, lambda buffer: "\n" in buffer)
+
+        if "\n" in self.buffer[:maximum_result_size]:
+            result_size = self.buffer.find("\n", 0, maximum_result_size) + 1
+            assert result_size > 0
+        else:
+            result_size = maximum_result_size
+
+        return self.__extract_from_buffer(result_size)
+
+    def __extract_from_buffer(self, character_count):
+        """Remove the first character_count characters from the internal buffer and
+        return them.
+        """
+        result = self.buffer[:character_count]
+        self.buffer = self.buffer[character_count:]
+        return result
+
+    def __get_lines(self, desired_size, done_reading=lambda buffer: False):
+        """Keep adding lines to our internal buffer until done_reading(self.buffer)
+        is true or EOF has been reached or we have desired_size bytes in the buffer.
+        If desired_size < 0, we are never satisfied until we reach EOF. If done_reading
+        is not supplied, it is not consulted.
+
+        If desired_size < 0, returns the length of the internal buffer. Otherwise,
+        returns desired_size.
+        """
+        while not done_reading(self.buffer) and (
+            desired_size < 0 or len(self.buffer) < desired_size
+        ):
+            try:
+                self.__get_line()
+            except (
+                EOFError,
+                KeyboardInterrupt,
+            ):  # deal with cancellation of get_input_line dialog
+                desired_size = len(self.buffer)  # Be satisfied!
+
+        if desired_size < 0:
+            return len(self.buffer)
+        else:
+            return desired_size
+
+    def __get_line(self):
+        """Grab one line from get_input_line() and append it to the buffer."""
+        line = get_input_line()
+        print(">>>", line)  # echo input to console
+        self.buffer = self.buffer + line + "\n"
+
+    def readlines(self, *sizehint):
+        """Read until EOF using readline() and return a list containing the lines
+        thus read. If the optional sizehint argument is present, instead of
+        reading up to EOF, whole lines totalling approximately sizehint bytes
+        (possibly after rounding up to an internal buffer size) are read.
+        """
+        result = []
+        total_read = 0
+        while sizehint == () or total_read < sizehint[0]:
+            line = self.readline()
+            if line == "":
+                break
+            total_read = total_read + len(line)
+            result.append(line)
+        return result
+
+
+if __name__ == "__main__":
+    test_input = r"""this is some test
+input that I am hoping
+~
+will be very instructive
+and when I am done
+I will have tested everything.
+Twelve and twenty blackbirds
+baked in a pie. Patty cake
+patty cake so am I.
+~
+Thirty-five niggling idiots!
+Sell you soul to the devil, baby
+"""
+
+    def fake_raw_input(prompt=None):
+        """Replacement for raw_input() which pulls lines out of global test_input.
+        For testing only!
+        """
+        global test_input
+        if "\n" not in test_input:
+            end_of_line_pos = len(test_input)
+        else:
+            end_of_line_pos = test_input.find("\n")
+        result = test_input[:end_of_line_pos]
+        test_input = test_input[end_of_line_pos + 1 :]
+        if len(result) == 0 or result[0] == "~":
+            raise EOFError()
+        return result
+
+    get_input_line = fake_raw_input
+
+    # Some completely inadequate tests, just to make sure the code's not totally broken
+    try:
+        x = Stdin()
+        print(x.read())
+        print(x.readline())
+        print(x.read(12))
+        print(x.readline(47))
+        print(x.readline(3))
+        print(x.readlines())
+    finally:
+        get_input_line = raw_input
+else:
+    import sys
+
+    sys.stdin = Stdin()

.venv/Lib/site-packages/pythonwin/pywin/framework/toolmenu.py

@@ -0,0 +1,280 @@
+# toolmenu.py
+
+import win32ui
+import win32con
+import win32api
+from . import app
+import sys
+import string
+
+tools = {}
+idPos = 100
+
+# The default items should no tools menu exist in the INI file.
+defaultToolMenuItems = [
+    ("Browser", "win32ui.GetApp().OnViewBrowse(0,0)"),
+    (
+        "Browse PythonPath",
+        "from pywin.tools import browseProjects;browseProjects.Browse()",
+    ),
+    ("Edit Python Path", "from pywin.tools import regedit;regedit.EditRegistry()"),
+    ("COM Makepy utility", "from win32com.client import makepy;makepy.main()"),
+    ("COM Browser", "from win32com.client import combrowse;combrowse.main()"),
+    (
+        "Trace Collector Debugging tool",
+        "from pywin.tools import TraceCollector;TraceCollector.MakeOutputWindow()",
+    ),
+]
+
+
+def LoadToolMenuItems():
+    # Load from the registry.
+    items = []
+    lookNo = 1
+    while 1:
+        menu = win32ui.GetProfileVal("Tools Menu\\%s" % lookNo, "", "")
+        if menu == "":
+            break
+        cmd = win32ui.GetProfileVal("Tools Menu\\%s" % lookNo, "Command", "")
+        items.append((menu, cmd))
+        lookNo = lookNo + 1
+
+    if len(items) == 0:
+        items = defaultToolMenuItems
+    return items
+
+
+def WriteToolMenuItems(items):
+    # Items is a list of (menu, command)
+    # Delete the entire registry tree.
+    try:
+        mainKey = win32ui.GetAppRegistryKey()
+        toolKey = win32api.RegOpenKey(mainKey, "Tools Menu")
+    except win32ui.error:
+        toolKey = None
+    if toolKey is not None:
+        while 1:
+            try:
+                subkey = win32api.RegEnumKey(toolKey, 0)
+            except win32api.error:
+                break
+            win32api.RegDeleteKey(toolKey, subkey)
+    # Keys are now removed - write the new ones.
+    # But first check if we have the defaults - and if so, dont write anything!
+    if items == defaultToolMenuItems:
+        return
+    itemNo = 1
+    for menu, cmd in items:
+        win32ui.WriteProfileVal("Tools Menu\\%s" % itemNo, "", menu)
+        win32ui.WriteProfileVal("Tools Menu\\%s" % itemNo, "Command", cmd)
+        itemNo = itemNo + 1
+
+
+def SetToolsMenu(menu, menuPos=None):
+    global tools
+    global idPos
+
+    # todo - check the menu does not already exist.
+    # Create the new menu
+    toolsMenu = win32ui.CreatePopupMenu()
+
+    # Load from the ini file.
+    items = LoadToolMenuItems()
+    for menuString, cmd in items:
+        tools[idPos] = (menuString, cmd, menuString)
+        toolsMenu.AppendMenu(
+            win32con.MF_ENABLED | win32con.MF_STRING, idPos, menuString
+        )
+        win32ui.GetMainFrame().HookCommand(HandleToolCommand, idPos)
+        idPos = idPos + 1
+
+    # Find the correct spot to insert the new tools menu.
+    if menuPos is None:
+        menuPos = menu.GetMenuItemCount() - 2
+        if menuPos < 0:
+            menuPos = 0
+
+    menu.InsertMenu(
+        menuPos,
+        win32con.MF_BYPOSITION
+        | win32con.MF_ENABLED
+        | win32con.MF_STRING
+        | win32con.MF_POPUP,
+        toolsMenu.GetHandle(),
+        "&Tools",
+    )
+
+
+def HandleToolCommand(cmd, code):
+    import traceback
+    import re
+
+    global tools
+    (menuString, pyCmd, desc) = tools[cmd]
+    win32ui.SetStatusText("Executing tool %s" % desc, 1)
+    pyCmd = re.sub("\\\\n", "\n", pyCmd)
+    win32ui.DoWaitCursor(1)
+    oldFlag = None
+    try:
+        oldFlag = sys.stdout.template.writeQueueing
+        sys.stdout.template.writeQueueing = 0
+    except (NameError, AttributeError):
+        pass
+
+    try:
+        exec("%s\n" % pyCmd)
+        worked = 1
+    except SystemExit:
+        # The program raised a SystemExit - ignore it.
+        worked = 1
+    except:
+        print("Failed to execute command:\n%s" % pyCmd)
+        traceback.print_exc()
+        worked = 0
+    if oldFlag is not None:
+        sys.stdout.template.writeQueueing = oldFlag
+    win32ui.DoWaitCursor(0)
+    if worked:
+        text = "Completed successfully."
+    else:
+        text = "Error executing %s." % desc
+    win32ui.SetStatusText(text, 1)
+
+
+# The property page for maintaing the items on the Tools menu.
+import commctrl
+from pywin.mfc import dialog
+
+if win32ui.UNICODE:
+    LVN_ENDLABELEDIT = commctrl.LVN_ENDLABELEDITW
+else:
+    LVN_ENDLABELEDIT = commctrl.LVN_ENDLABELEDITA
+
+
+class ToolMenuPropPage(dialog.PropertyPage):
+    def __init__(self):
+        self.bImChangingEditControls = 0  # Am I programatically changing the controls?
+        dialog.PropertyPage.__init__(self, win32ui.IDD_PP_TOOLMENU)
+
+    def OnInitDialog(self):
+        self.editMenuCommand = self.GetDlgItem(win32ui.IDC_EDIT2)
+        self.butNew = self.GetDlgItem(win32ui.IDC_BUTTON3)
+
+        # Now hook the change notification messages for the edit controls.
+        self.HookCommand(self.OnCommandEditControls, win32ui.IDC_EDIT1)
+        self.HookCommand(self.OnCommandEditControls, win32ui.IDC_EDIT2)
+
+        self.HookNotify(self.OnNotifyListControl, commctrl.LVN_ITEMCHANGED)
+        self.HookNotify(self.OnNotifyListControlEndLabelEdit, commctrl.LVN_ENDLABELEDIT)
+
+        # Hook the button clicks.
+        self.HookCommand(self.OnButtonNew, win32ui.IDC_BUTTON3)  # New Item
+        self.HookCommand(self.OnButtonDelete, win32ui.IDC_BUTTON4)  # Delete item
+        self.HookCommand(self.OnButtonMove, win32ui.IDC_BUTTON1)  # Move up
+        self.HookCommand(self.OnButtonMove, win32ui.IDC_BUTTON2)  # Move down
+
+        # Setup the columns in the list control
+        lc = self.GetDlgItem(win32ui.IDC_LIST1)
+        rect = lc.GetWindowRect()
+        cx = rect[2] - rect[0]
+        colSize = cx / 2 - win32api.GetSystemMetrics(win32con.SM_CXBORDER) - 1
+
+        item = commctrl.LVCFMT_LEFT, colSize, "Menu Text"
+        lc.InsertColumn(0, item)
+
+        item = commctrl.LVCFMT_LEFT, colSize, "Python Command"
+        lc.InsertColumn(1, item)
+
+        # Insert the existing tools menu
+        itemNo = 0
+        for desc, cmd in LoadToolMenuItems():
+            lc.InsertItem(itemNo, desc)
+            lc.SetItemText(itemNo, 1, cmd)
+            itemNo = itemNo + 1
+
+        self.listControl = lc
+        return dialog.PropertyPage.OnInitDialog(self)
+
+    def OnOK(self):
+        # Write the menu back to the registry.
+        items = []
+        itemLook = 0
+        while 1:
+            try:
+                text = self.listControl.GetItemText(itemLook, 0)
+                if not text:
+                    break
+                items.append((text, self.listControl.GetItemText(itemLook, 1)))
+            except win32ui.error:
+                # no more items!
+                break
+            itemLook = itemLook + 1
+        WriteToolMenuItems(items)
+        return self._obj_.OnOK()
+
+    def OnCommandEditControls(self, id, cmd):
+        # 		print "OnEditControls", id, cmd
+        if cmd == win32con.EN_CHANGE and not self.bImChangingEditControls:
+            itemNo = self.listControl.GetNextItem(-1, commctrl.LVNI_SELECTED)
+            newText = self.editMenuCommand.GetWindowText()
+            self.listControl.SetItemText(itemNo, 1, newText)
+
+        return 0
+
+    def OnNotifyListControlEndLabelEdit(self, id, cmd):
+        newText = self.listControl.GetEditControl().GetWindowText()
+        itemNo = self.listControl.GetNextItem(-1, commctrl.LVNI_SELECTED)
+        self.listControl.SetItemText(itemNo, 0, newText)
+
+    def OnNotifyListControl(self, id, cmd):
+        # 		print id, cmd
+        try:
+            itemNo = self.listControl.GetNextItem(-1, commctrl.LVNI_SELECTED)
+        except win32ui.error:  # No selection!
+            return
+
+        self.bImChangingEditControls = 1
+        try:
+            item = self.listControl.GetItem(itemNo, 1)
+            self.editMenuCommand.SetWindowText(item[4])
+        finally:
+            self.bImChangingEditControls = 0
+
+        return 0  # we have handled this!
+
+    def OnButtonNew(self, id, cmd):
+        if cmd == win32con.BN_CLICKED:
+            newIndex = self.listControl.GetItemCount()
+            self.listControl.InsertItem(newIndex, "Click to edit the text")
+            self.listControl.EnsureVisible(newIndex, 0)
+
+    def OnButtonMove(self, id, cmd):
+        if cmd == win32con.BN_CLICKED:
+            try:
+                itemNo = self.listControl.GetNextItem(-1, commctrl.LVNI_SELECTED)
+            except win32ui.error:
+                return
+            menu = self.listControl.GetItemText(itemNo, 0)
+            cmd = self.listControl.GetItemText(itemNo, 1)
+            if id == win32ui.IDC_BUTTON1:
+                # Move up
+                if itemNo > 0:
+                    self.listControl.DeleteItem(itemNo)
+                    # reinsert it.
+                    self.listControl.InsertItem(itemNo - 1, menu)
+                    self.listControl.SetItemText(itemNo - 1, 1, cmd)
+            else:
+                # Move down.
+                if itemNo < self.listControl.GetItemCount() - 1:
+                    self.listControl.DeleteItem(itemNo)
+                    # reinsert it.
+                    self.listControl.InsertItem(itemNo + 1, menu)
+                    self.listControl.SetItemText(itemNo + 1, 1, cmd)
+
+    def OnButtonDelete(self, id, cmd):
+        if cmd == win32con.BN_CLICKED:
+            try:
+                itemNo = self.listControl.GetNextItem(-1, commctrl.LVNI_SELECTED)
+            except win32ui.error:  # No selection!
+                return
+            self.listControl.DeleteItem(itemNo)

.venv/Lib/site-packages/pythonwin/pywin/framework/window.py

@@ -0,0 +1,14 @@
+# Framework Window classes.
+
+# Most Pythonwin windows should use these classes rather than
+# the raw MFC ones if they want Pythonwin specific functionality.
+import pywin.mfc.window
+import win32con
+
+
+class MDIChildWnd(pywin.mfc.window.MDIChildWnd):
+    def AutoRestore(self):
+        "If the window is minimised or maximised, restore it."
+        p = self.GetWindowPlacement()
+        if p[1] == win32con.SW_MINIMIZE or p[1] == win32con.SW_SHOWMINIMIZED:
+            self.SetWindowPlacement(p[0], win32con.SW_RESTORE, p[2], p[3], p[4])

.venv/Lib/site-packages/pythonwin/pywin/framework/winout.py

@@ -0,0 +1,588 @@
+# winout.py
+#
+# generic "output window"
+#
+# This Window will detect itself closing, and recreate next time output is
+# written to it.
+
+# This has the option of writing output at idle time (by hooking the
+# idle message, and queueing output) or writing as each
+# write is executed.
+# Updating the window directly gives a jerky appearance as many writes
+# take place between commands, and the windows scrolls, and updates etc
+# Updating at idle-time may defer all output of a long process, giving the
+# appearence nothing is happening.
+# There is a compromise "line" mode, which will output whenever
+# a complete line is available.
+
+# behaviour depends on self.writeQueueing
+
+# This module is thread safe - output can originate from any thread.  If any thread
+# other than the main thread attempts to print, it is always queued until next idle time
+
+import sys, string, re
+from pywin.mfc import docview
+from pywin.framework import app, window
+import win32ui, win32api, win32con
+import queue
+
+debug = lambda msg: None
+
+##debug=win32ui.OutputDebugString
+##import win32trace;win32trace.InitWrite() # for debugging - delete me!
+##debug = win32trace.write
+
+
+class flags:
+    # queueing of output.
+    WQ_NONE = 0
+    WQ_LINE = 1
+    WQ_IDLE = 2
+
+
+# WindowOutputDocumentParent=docview.RichEditDoc
+# WindowOutputDocumentParent=docview.Document
+import pywin.scintilla.document
+from pywin.scintilla import scintillacon
+from pywin import default_scintilla_encoding
+
+WindowOutputDocumentParent = pywin.scintilla.document.CScintillaDocument
+
+
+class WindowOutputDocument(WindowOutputDocumentParent):
+    def SaveModified(self):
+        return 1  # say it is OK to destroy my document
+
+    def OnSaveDocument(self, fileName):
+        win32ui.SetStatusText("Saving file...", 1)
+        try:
+            self.SaveFile(fileName)
+        except IOError as details:
+            win32ui.MessageBox("Error - could not save file\r\n\r\n%s" % details)
+            return 0
+        win32ui.SetStatusText("Ready")
+        return 1
+
+
+class WindowOutputFrame(window.MDIChildWnd):
+    def __init__(self, wnd=None):
+        window.MDIChildWnd.__init__(self, wnd)
+        self.HookMessage(self.OnSizeMove, win32con.WM_SIZE)
+        self.HookMessage(self.OnSizeMove, win32con.WM_MOVE)
+
+    def LoadFrame(self, idResource, style, wndParent, context):
+        self.template = context.template
+        return self._obj_.LoadFrame(idResource, style, wndParent, context)
+
+    def PreCreateWindow(self, cc):
+        cc = self._obj_.PreCreateWindow(cc)
+        if (
+            self.template.defSize
+            and self.template.defSize[0] != self.template.defSize[1]
+        ):
+            rect = app.RectToCreateStructRect(self.template.defSize)
+            cc = cc[0], cc[1], cc[2], cc[3], rect, cc[5], cc[6], cc[7], cc[8]
+        return cc
+
+    def OnSizeMove(self, msg):
+        # so recreate maintains position.
+        # Need to map coordinates from the
+        # frame windows first child.
+        mdiClient = self.GetParent()
+        self.template.defSize = mdiClient.ScreenToClient(self.GetWindowRect())
+
+    def OnDestroy(self, message):
+        self.template.OnFrameDestroy(self)
+        return 1
+
+
+class WindowOutputViewImpl:
+    def __init__(self):
+        self.patErrorMessage = re.compile('\W*File "(.*)", line ([0-9]+)')
+        self.template = self.GetDocument().GetDocTemplate()
+
+    def HookHandlers(self):
+        # Hook for the right-click menu.
+        self.HookMessage(self.OnRClick, win32con.WM_RBUTTONDOWN)
+
+    def OnDestroy(self, msg):
+        self.template.OnViewDestroy(self)
+
+    def OnInitialUpdate(self):
+        self.RestoreKillBuffer()
+        self.SetSel(-2)  # end of buffer
+
+    def GetRightMenuItems(self):
+        ret = []
+        flags = win32con.MF_STRING | win32con.MF_ENABLED
+        ret.append((flags, win32ui.ID_EDIT_COPY, "&Copy"))
+        ret.append((flags, win32ui.ID_EDIT_SELECT_ALL, "&Select all"))
+        return ret
+
+    #
+    # Windows command handlers, virtuals, etc.
+    #
+    def OnRClick(self, params):
+        paramsList = self.GetRightMenuItems()
+        menu = win32ui.CreatePopupMenu()
+        for appendParams in paramsList:
+            if type(appendParams) != type(()):
+                appendParams = (appendParams,)
+            menu.AppendMenu(*appendParams)
+        menu.TrackPopupMenu(params[5])  # track at mouse position.
+        return 0
+
+    # as this is often used as an output window, exeptions will often
+    # be printed.  Therefore, we support this functionality at this level.
+    # Returns TRUE if the current line is an error message line, and will
+    # jump to it.  FALSE if no error (and no action taken)
+    def HandleSpecialLine(self):
+        from . import scriptutils
+
+        line = self.GetLine()
+        if line[:11] == "com_error: ":
+            # An OLE Exception - pull apart the exception
+            # and try and locate a help file.
+            try:
+                import win32api, win32con
+
+                det = eval(line[line.find(":") + 1 :].strip())
+                win32ui.SetStatusText("Opening help file on OLE error...")
+                from . import help
+
+                help.OpenHelpFile(det[2][3], win32con.HELP_CONTEXT, det[2][4])
+                return 1
+            except win32api.error as details:
+                win32ui.SetStatusText(
+                    "The help file could not be opened - %s" % details.strerror
+                )
+                return 1
+            except:
+                win32ui.SetStatusText(
+                    "Line is a COM error, but no WinHelp details can be parsed"
+                )
+        # Look for a Python traceback.
+        matchResult = self.patErrorMessage.match(line)
+        if matchResult is None:
+            # No match - try the previous line
+            lineNo = self.LineFromChar()
+            if lineNo > 0:
+                line = self.GetLine(lineNo - 1)
+                matchResult = self.patErrorMessage.match(line)
+        if matchResult is not None:
+            # we have an error line.
+            fileName = matchResult.group(1)
+            if fileName[0] == "<":
+                win32ui.SetStatusText("Can not load this file")
+                return 1  # still was an error message.
+            else:
+                lineNoString = matchResult.group(2)
+                # Attempt to locate the file (in case it is a relative spec)
+                fileNameSpec = fileName
+                fileName = scriptutils.LocatePythonFile(fileName)
+                if fileName is None:
+                    # Dont force update, so it replaces the idle prompt.
+                    win32ui.SetStatusText(
+                        "Cant locate the file '%s'" % (fileNameSpec), 0
+                    )
+                    return 1
+
+                win32ui.SetStatusText(
+                    "Jumping to line " + lineNoString + " of file " + fileName, 1
+                )
+                if not scriptutils.JumpToDocument(fileName, int(lineNoString)):
+                    win32ui.SetStatusText("Could not open %s" % fileName)
+                    return 1  # still was an error message.
+                return 1
+        return 0  # not an error line
+
+    def write(self, msg):
+        return self.template.write(msg)
+
+    def writelines(self, lines):
+        for line in lines:
+            self.write(line)
+
+    def flush(self):
+        self.template.flush()
+
+
+class WindowOutputViewRTF(docview.RichEditView, WindowOutputViewImpl):
+    def __init__(self, doc):
+        docview.RichEditView.__init__(self, doc)
+        WindowOutputViewImpl.__init__(self)
+
+    def OnInitialUpdate(self):
+        WindowOutputViewImpl.OnInitialUpdate(self)
+        return docview.RichEditView.OnInitialUpdate(self)
+
+    def OnDestroy(self, msg):
+        WindowOutputViewImpl.OnDestroy(self, msg)
+        docview.RichEditView.OnDestroy(self, msg)
+
+    def HookHandlers(self):
+        WindowOutputViewImpl.HookHandlers(self)
+        # Hook for finding and locating error messages
+        self.HookMessage(self.OnLDoubleClick, win32con.WM_LBUTTONDBLCLK)
+
+    # 		docview.RichEditView.HookHandlers(self)
+
+    def OnLDoubleClick(self, params):
+        if self.HandleSpecialLine():
+            return 0  # dont pass on
+        return 1  # pass it on by default.
+
+    def RestoreKillBuffer(self):
+        if len(self.template.killBuffer):
+            self.StreamIn(win32con.SF_RTF, self._StreamRTFIn)
+            self.template.killBuffer = []
+
+    def SaveKillBuffer(self):
+        self.StreamOut(win32con.SF_RTFNOOBJS, self._StreamRTFOut)
+
+    def _StreamRTFOut(self, data):
+        self.template.killBuffer.append(data)
+        return 1  # keep em coming!
+
+    def _StreamRTFIn(self, bytes):
+        try:
+            item = self.template.killBuffer[0]
+            self.template.killBuffer.remove(item)
+            if bytes < len(item):
+                print("Warning - output buffer not big enough!")
+            return item
+        except IndexError:
+            return None
+
+    def dowrite(self, str):
+        self.SetSel(-2)
+        self.ReplaceSel(str)
+
+
+import pywin.scintilla.view
+
+
+class WindowOutputViewScintilla(
+    pywin.scintilla.view.CScintillaView, WindowOutputViewImpl
+):
+    def __init__(self, doc):
+        pywin.scintilla.view.CScintillaView.__init__(self, doc)
+        WindowOutputViewImpl.__init__(self)
+
+    def OnInitialUpdate(self):
+        pywin.scintilla.view.CScintillaView.OnInitialUpdate(self)
+        self.SCISetMarginWidth(3)
+        WindowOutputViewImpl.OnInitialUpdate(self)
+
+    def OnDestroy(self, msg):
+        WindowOutputViewImpl.OnDestroy(self, msg)
+        pywin.scintilla.view.CScintillaView.OnDestroy(self, msg)
+
+    def HookHandlers(self):
+        WindowOutputViewImpl.HookHandlers(self)
+        pywin.scintilla.view.CScintillaView.HookHandlers(self)
+        self.GetParent().HookNotify(
+            self.OnScintillaDoubleClick, scintillacon.SCN_DOUBLECLICK
+        )
+
+    ##		self.HookMessage(self.OnLDoubleClick,win32con.WM_LBUTTONDBLCLK)
+
+    def OnScintillaDoubleClick(self, std, extra):
+        self.HandleSpecialLine()
+
+    ##	def OnLDoubleClick(self,params):
+    ##			return 0	# never dont pass on
+
+    def RestoreKillBuffer(self):
+        assert len(self.template.killBuffer) in [0, 1], "Unexpected killbuffer contents"
+        if self.template.killBuffer:
+            self.SCIAddText(self.template.killBuffer[0])
+        self.template.killBuffer = []
+
+    def SaveKillBuffer(self):
+        self.template.killBuffer = [self.GetTextRange(0, -1)]
+
+    def dowrite(self, str):
+        end = self.GetTextLength()
+        atEnd = end == self.GetSel()[0]
+        self.SCIInsertText(str, end)
+        if atEnd:
+            self.SetSel(self.GetTextLength())
+
+    def SetWordWrap(self, bWrapOn=1):
+        if bWrapOn:
+            wrap_mode = scintillacon.SC_WRAP_WORD
+        else:
+            wrap_mode = scintillacon.SC_WRAP_NONE
+        self.SCISetWrapMode(wrap_mode)
+
+    def _MakeColorizer(self):
+        return None  # No colorizer for me!
+
+
+WindowOutputView = WindowOutputViewScintilla
+# The WindowOutput class is actually an MFC template.  This is a conventient way of
+# making sure that my state can exist beyond the life of the windows themselves.
+# This is primarily to support the functionality of a WindowOutput window automatically
+# being recreated if necessary when written to.
+class WindowOutput(docview.DocTemplate):
+    """Looks like a general Output Window - text can be written by the 'write' method.
+    Will auto-create itself on first write, and also on next write after being closed"""
+
+    softspace = 1
+
+    def __init__(
+        self,
+        title=None,
+        defSize=None,
+        queueing=flags.WQ_LINE,
+        bAutoRestore=1,
+        style=None,
+        makeDoc=None,
+        makeFrame=None,
+        makeView=None,
+    ):
+        """init the output window -
+        Params
+        title=None -- What is the title of the window
+        defSize=None -- What is the default size for the window - if this
+                        is a string, the size will be loaded from the ini file.
+        queueing = flags.WQ_LINE -- When should output be written
+        bAutoRestore=1 -- Should a minimized window be restored.
+        style -- Style for Window, or None for default.
+        makeDoc, makeFrame, makeView -- Classes for frame, view and window respectively.
+        """
+        if makeDoc is None:
+            makeDoc = WindowOutputDocument
+        if makeFrame is None:
+            makeFrame = WindowOutputFrame
+        if makeView is None:
+            makeView = WindowOutputViewScintilla
+        docview.DocTemplate.__init__(
+            self, win32ui.IDR_PYTHONTYPE, makeDoc, makeFrame, makeView
+        )
+        self.SetDocStrings("\nOutput\n\nText Documents (*.txt)\n.txt\n\n\n")
+        win32ui.GetApp().AddDocTemplate(self)
+        self.writeQueueing = queueing
+        self.errorCantRecreate = 0
+        self.killBuffer = []
+        self.style = style
+        self.bAutoRestore = bAutoRestore
+        self.title = title
+        self.bCreating = 0
+        self.interruptCount = 0
+        if type(defSize) == type(""):  # is a string - maintain size pos from ini file.
+            self.iniSizeSection = defSize
+            self.defSize = app.LoadWindowSize(defSize)
+            self.loadedSize = self.defSize
+        else:
+            self.iniSizeSection = None
+            self.defSize = defSize
+        self.currentView = None
+        self.outputQueue = queue.Queue(-1)
+        self.mainThreadId = win32api.GetCurrentThreadId()
+        self.idleHandlerSet = 0
+        self.SetIdleHandler()
+
+    def __del__(self):
+        self.Close()
+
+    def Create(self, title=None, style=None):
+        self.bCreating = 1
+        if title:
+            self.title = title
+        if style:
+            self.style = style
+        doc = self.OpenDocumentFile()
+        if doc is None:
+            return
+        self.currentView = doc.GetFirstView()
+        self.bCreating = 0
+        if self.title:
+            doc.SetTitle(self.title)
+
+    def Close(self):
+        self.RemoveIdleHandler()
+        try:
+            parent = self.currentView.GetParent()
+        except (AttributeError, win32ui.error):  # Already closed
+            return
+        parent.DestroyWindow()
+
+    def SetTitle(self, title):
+        self.title = title
+        if self.currentView:
+            self.currentView.GetDocument().SetTitle(self.title)
+
+    def OnViewDestroy(self, view):
+        self.currentView.SaveKillBuffer()
+        self.currentView = None
+
+    def OnFrameDestroy(self, frame):
+        if self.iniSizeSection:
+            # use GetWindowPlacement(), as it works even when min'd or max'd
+            newSize = frame.GetWindowPlacement()[4]
+            if self.loadedSize != newSize:
+                app.SaveWindowSize(self.iniSizeSection, newSize)
+
+    def SetIdleHandler(self):
+        if not self.idleHandlerSet:
+            debug("Idle handler set\n")
+            win32ui.GetApp().AddIdleHandler(self.QueueIdleHandler)
+            self.idleHandlerSet = 1
+
+    def RemoveIdleHandler(self):
+        if self.idleHandlerSet:
+            debug("Idle handler reset\n")
+            if win32ui.GetApp().DeleteIdleHandler(self.QueueIdleHandler) == 0:
+                debug("Error deleting idle handler\n")
+            self.idleHandlerSet = 0
+
+    def RecreateWindow(self):
+        if self.errorCantRecreate:
+            debug("Error = not trying again")
+            return 0
+        try:
+            # This will fail if app shutting down
+            win32ui.GetMainFrame().GetSafeHwnd()
+            self.Create()
+            return 1
+        except (win32ui.error, AttributeError):
+            self.errorCantRecreate = 1
+            debug("Winout can not recreate the Window!\n")
+            return 0
+
+    # this handles the idle message, and does the printing.
+    def QueueIdleHandler(self, handler, count):
+        try:
+            bEmpty = self.QueueFlush(20)
+            # If the queue is empty, then we are back to idle and restart interrupt logic.
+            if bEmpty:
+                self.interruptCount = 0
+        except KeyboardInterrupt:
+            # First interrupt since idle we just pass on.
+            # later ones we dump the queue and give up.
+            self.interruptCount = self.interruptCount + 1
+            if self.interruptCount > 1:
+                # Drop the queue quickly as the user is already annoyed :-)
+                self.outputQueue = queue.Queue(-1)
+                print("Interrupted.")
+                bEmpty = 1
+            else:
+                raise  # re-raise the error so the users exception filters up.
+        return not bEmpty  # More to do if not empty.
+
+    # Returns true if the Window needs to be recreated.
+    def NeedRecreateWindow(self):
+        try:
+            if self.currentView is not None and self.currentView.IsWindow():
+                return 0
+        except (
+            win32ui.error,
+            AttributeError,
+        ):  # Attribute error if the win32ui object has died.
+            pass
+        return 1
+
+    # Returns true if the Window is OK (either cos it was, or because it was recreated
+    def CheckRecreateWindow(self):
+        if self.bCreating:
+            return 1
+        if not self.NeedRecreateWindow():
+            return 1
+        if self.bAutoRestore:
+            if self.RecreateWindow():
+                return 1
+        return 0
+
+    def QueueFlush(self, max=None):
+        # Returns true if the queue is empty after the flush
+        # 		debug("Queueflush - %d, %d\n" % (max, self.outputQueue.qsize()))
+        if self.bCreating:
+            return 1
+        items = []
+        rc = 0
+        while max is None or max > 0:
+            try:
+                item = self.outputQueue.get_nowait()
+                items.append(item)
+            except queue.Empty:
+                rc = 1
+                break
+            if max is not None:
+                max = max - 1
+        if len(items) != 0:
+            if not self.CheckRecreateWindow():
+                debug(":Recreate failed!\n")
+                return 1  # In trouble - so say we have nothing to do.
+            win32ui.PumpWaitingMessages()  # Pump paint messages
+            self.currentView.dowrite("".join(items))
+        return rc
+
+    def HandleOutput(self, message):
+        # 		debug("QueueOutput on thread %d, flags %d with '%s'...\n" % (win32api.GetCurrentThreadId(), self.writeQueueing, message ))
+        self.outputQueue.put(message)
+        if win32api.GetCurrentThreadId() != self.mainThreadId:
+            pass
+        # 			debug("not my thread - ignoring queue options!\n")
+        elif self.writeQueueing == flags.WQ_LINE:
+            pos = message.rfind("\n")
+            if pos >= 0:
+                # 				debug("Line queueing - forcing flush\n")
+                self.QueueFlush()
+                return
+        elif self.writeQueueing == flags.WQ_NONE:
+            # 			debug("WQ_NONE - flushing!\n")
+            self.QueueFlush()
+            return
+        # Let our idle handler get it - wake it up
+        try:
+            win32ui.GetMainFrame().PostMessage(
+                win32con.WM_USER
+            )  # Kick main thread off.
+        except win32ui.error:
+            # This can happen as the app is shutting down, so we send it to the C++ debugger
+            win32api.OutputDebugString(message)
+
+    # delegate certain fns to my view.
+    def writelines(self, lines):
+        for line in lines:
+            self.write(line)
+
+    def write(self, message):
+        self.HandleOutput(message)
+
+    def flush(self):
+        self.QueueFlush()
+
+    def HandleSpecialLine(self):
+        self.currentView.HandleSpecialLine()
+
+
+def RTFWindowOutput(*args, **kw):
+    kw["makeView"] = WindowOutputViewRTF
+    return WindowOutput(*args, **kw)
+
+
+def thread_test(o):
+    for i in range(5):
+        o.write("Hi from thread %d\n" % (win32api.GetCurrentThreadId()))
+        win32api.Sleep(100)
+
+
+def test():
+    w = WindowOutput(queueing=flags.WQ_IDLE)
+    w.write("First bit of text\n")
+    import _thread
+
+    for i in range(5):
+        w.write("Hello from the main thread\n")
+        _thread.start_new(thread_test, (w,))
+    for i in range(2):
+        w.write("Hello from the main thread\n")
+        win32api.Sleep(50)
+    return w
+
+
+if __name__ == "__main__":
+    test()

.venv/Lib/site-packages/pythonwin/pywin/idle/AutoExpand.py

@@ -0,0 +1,96 @@
+import string
+import re
+
+###$ event <<expand-word>>
+###$ win <Alt-slash>
+###$ unix <Alt-slash>
+
+
+class AutoExpand:
+
+    keydefs = {
+        "<<expand-word>>": ["<Alt-slash>"],
+    }
+
+    unix_keydefs = {
+        "<<expand-word>>": ["<Meta-slash>"],
+    }
+
+    menudefs = [
+        (
+            "edit",
+            [
+                ("E_xpand word", "<<expand-word>>"),
+            ],
+        ),
+    ]
+
+    wordchars = string.ascii_letters + string.digits + "_"
+
+    def __init__(self, editwin):
+        self.text = editwin.text
+        self.text.wordlist = None  # XXX what is this?
+        self.state = None
+
+    def expand_word_event(self, event):
+        curinsert = self.text.index("insert")
+        curline = self.text.get("insert linestart", "insert lineend")
+        if not self.state:
+            words = self.getwords()
+            index = 0
+        else:
+            words, index, insert, line = self.state
+            if insert != curinsert or line != curline:
+                words = self.getwords()
+                index = 0
+        if not words:
+            self.text.bell()
+            return "break"
+        word = self.getprevword()
+        self.text.delete("insert - %d chars" % len(word), "insert")
+        newword = words[index]
+        index = (index + 1) % len(words)
+        if index == 0:
+            self.text.bell()  # Warn we cycled around
+        self.text.insert("insert", newword)
+        curinsert = self.text.index("insert")
+        curline = self.text.get("insert linestart", "insert lineend")
+        self.state = words, index, curinsert, curline
+        return "break"
+
+    def getwords(self):
+        word = self.getprevword()
+        if not word:
+            return []
+        before = self.text.get("1.0", "insert wordstart")
+        wbefore = re.findall(r"\b" + word + r"\w+\b", before)
+        del before
+        after = self.text.get("insert wordend", "end")
+        wafter = re.findall(r"\b" + word + r"\w+\b", after)
+        del after
+        if not wbefore and not wafter:
+            return []
+        words = []
+        dict = {}
+        # search backwards through words before
+        wbefore.reverse()
+        for w in wbefore:
+            if dict.get(w):
+                continue
+            words.append(w)
+            dict[w] = w
+        # search onwards through words after
+        for w in wafter:
+            if dict.get(w):
+                continue
+            words.append(w)
+            dict[w] = w
+        words.append(word)
+        return words
+
+    def getprevword(self):
+        line = self.text.get("insert linestart", "insert")
+        i = len(line)
+        while i > 0 and line[i - 1] in self.wordchars:
+            i = i - 1
+        return line[i:]

.venv/Lib/site-packages/pythonwin/pywin/idle/AutoIndent.py

@@ -0,0 +1,547 @@
+import sys
+import string, tokenize
+from . import PyParse
+from pywin import default_scintilla_encoding
+
+if sys.version_info < (3,):
+    # in py2k, tokenize() takes a 'token eater' callback, while
+    # generate_tokens is a generator that works with str objects.
+    token_generator = tokenize.generate_tokens
+else:
+    # in py3k tokenize() is the generator working with 'byte' objects, and
+    # token_generator is the 'undocumented b/w compat' function that
+    # theoretically works with str objects - but actually seems to fail)
+    token_generator = tokenize.tokenize
+
+
+class AutoIndent:
+
+    menudefs = [
+        (
+            "edit",
+            [
+                None,
+                ("_Indent region", "<<indent-region>>"),
+                ("_Dedent region", "<<dedent-region>>"),
+                ("Comment _out region", "<<comment-region>>"),
+                ("U_ncomment region", "<<uncomment-region>>"),
+                ("Tabify region", "<<tabify-region>>"),
+                ("Untabify region", "<<untabify-region>>"),
+                ("Toggle tabs", "<<toggle-tabs>>"),
+                ("New indent width", "<<change-indentwidth>>"),
+            ],
+        ),
+    ]
+
+    keydefs = {
+        "<<smart-backspace>>": ["<Key-BackSpace>"],
+        "<<newline-and-indent>>": ["<Key-Return>", "<KP_Enter>"],
+        "<<smart-indent>>": ["<Key-Tab>"],
+    }
+
+    windows_keydefs = {
+        "<<indent-region>>": ["<Control-bracketright>"],
+        "<<dedent-region>>": ["<Control-bracketleft>"],
+        "<<comment-region>>": ["<Alt-Key-3>"],
+        "<<uncomment-region>>": ["<Alt-Key-4>"],
+        "<<tabify-region>>": ["<Alt-Key-5>"],
+        "<<untabify-region>>": ["<Alt-Key-6>"],
+        "<<toggle-tabs>>": ["<Alt-Key-t>"],
+        "<<change-indentwidth>>": ["<Alt-Key-u>"],
+    }
+
+    unix_keydefs = {
+        "<<indent-region>>": [
+            "<Alt-bracketright>",
+            "<Meta-bracketright>",
+            "<Control-bracketright>",
+        ],
+        "<<dedent-region>>": [
+            "<Alt-bracketleft>",
+            "<Meta-bracketleft>",
+            "<Control-bracketleft>",
+        ],
+        "<<comment-region>>": ["<Alt-Key-3>", "<Meta-Key-3>"],
+        "<<uncomment-region>>": ["<Alt-Key-4>", "<Meta-Key-4>"],
+        "<<tabify-region>>": ["<Alt-Key-5>", "<Meta-Key-5>"],
+        "<<untabify-region>>": ["<Alt-Key-6>", "<Meta-Key-6>"],
+        "<<toggle-tabs>>": ["<Alt-Key-t>"],
+        "<<change-indentwidth>>": ["<Alt-Key-u>"],
+    }
+
+    # usetabs true  -> literal tab characters are used by indent and
+    #                  dedent cmds, possibly mixed with spaces if
+    #                  indentwidth is not a multiple of tabwidth
+    #         false -> tab characters are converted to spaces by indent
+    #                  and dedent cmds, and ditto TAB keystrokes
+    # indentwidth is the number of characters per logical indent level.
+    # tabwidth is the display width of a literal tab character.
+    # CAUTION:  telling Tk to use anything other than its default
+    # tab setting causes it to use an entirely different tabbing algorithm,
+    # treating tab stops as fixed distances from the left margin.
+    # Nobody expects this, so for now tabwidth should never be changed.
+    usetabs = 1
+    indentwidth = 4
+    tabwidth = 8  # for IDLE use, must remain 8 until Tk is fixed
+
+    # If context_use_ps1 is true, parsing searches back for a ps1 line;
+    # else searches for a popular (if, def, ...) Python stmt.
+    context_use_ps1 = 0
+
+    # When searching backwards for a reliable place to begin parsing,
+    # first start num_context_lines[0] lines back, then
+    # num_context_lines[1] lines back if that didn't work, and so on.
+    # The last value should be huge (larger than the # of lines in a
+    # conceivable file).
+    # Making the initial values larger slows things down more often.
+    num_context_lines = 50, 500, 5000000
+
+    def __init__(self, editwin):
+        self.editwin = editwin
+        self.text = editwin.text
+
+    def config(self, **options):
+        for key, value in options.items():
+            if key == "usetabs":
+                self.usetabs = value
+            elif key == "indentwidth":
+                self.indentwidth = value
+            elif key == "tabwidth":
+                self.tabwidth = value
+            elif key == "context_use_ps1":
+                self.context_use_ps1 = value
+            else:
+                raise KeyError("bad option name: %s" % repr(key))
+
+    # If ispythonsource and guess are true, guess a good value for
+    # indentwidth based on file content (if possible), and if
+    # indentwidth != tabwidth set usetabs false.
+    # In any case, adjust the Text widget's view of what a tab
+    # character means.
+
+    def set_indentation_params(self, ispythonsource, guess=1):
+        if guess and ispythonsource:
+            i = self.guess_indent()
+            if 2 <= i <= 8:
+                self.indentwidth = i
+            if self.indentwidth != self.tabwidth:
+                self.usetabs = 0
+
+        self.editwin.set_tabwidth(self.tabwidth)
+
+    def smart_backspace_event(self, event):
+        text = self.text
+        first, last = self.editwin.get_selection_indices()
+        if first and last:
+            text.delete(first, last)
+            text.mark_set("insert", first)
+            return "break"
+        # Delete whitespace left, until hitting a real char or closest
+        # preceding virtual tab stop.
+        chars = text.get("insert linestart", "insert")
+        if chars == "":
+            if text.compare("insert", ">", "1.0"):
+                # easy: delete preceding newline
+                text.delete("insert-1c")
+            else:
+                text.bell()  # at start of buffer
+            return "break"
+        if chars[-1] not in " \t":
+            # easy: delete preceding real char
+            text.delete("insert-1c")
+            return "break"
+        # Ick.  It may require *inserting* spaces if we back up over a
+        # tab character!  This is written to be clear, not fast.
+        have = len(chars.expandtabs(self.tabwidth))
+        assert have > 0
+        want = int((have - 1) / self.indentwidth) * self.indentwidth
+        ncharsdeleted = 0
+        while 1:
+            chars = chars[:-1]
+            ncharsdeleted = ncharsdeleted + 1
+            have = len(chars.expandtabs(self.tabwidth))
+            if have <= want or chars[-1] not in " \t":
+                break
+        text.undo_block_start()
+        text.delete("insert-%dc" % ncharsdeleted, "insert")
+        if have < want:
+            text.insert("insert", " " * (want - have))
+        text.undo_block_stop()
+        return "break"
+
+    def smart_indent_event(self, event):
+        # if intraline selection:
+        #     delete it
+        # elif multiline selection:
+        #     do indent-region & return
+        # indent one level
+        text = self.text
+        first, last = self.editwin.get_selection_indices()
+        text.undo_block_start()
+        try:
+            if first and last:
+                if index2line(first) != index2line(last):
+                    return self.indent_region_event(event)
+                text.delete(first, last)
+                text.mark_set("insert", first)
+            prefix = text.get("insert linestart", "insert")
+            raw, effective = classifyws(prefix, self.tabwidth)
+            if raw == len(prefix):
+                # only whitespace to the left
+                self.reindent_to(effective + self.indentwidth)
+            else:
+                if self.usetabs:
+                    pad = "\t"
+                else:
+                    effective = len(prefix.expandtabs(self.tabwidth))
+                    n = self.indentwidth
+                    pad = " " * (n - effective % n)
+                text.insert("insert", pad)
+            text.see("insert")
+            return "break"
+        finally:
+            text.undo_block_stop()
+
+    def newline_and_indent_event(self, event):
+        text = self.text
+        first, last = self.editwin.get_selection_indices()
+        text.undo_block_start()
+        try:
+            if first and last:
+                text.delete(first, last)
+                text.mark_set("insert", first)
+            line = text.get("insert linestart", "insert")
+            i, n = 0, len(line)
+            while i < n and line[i] in " \t":
+                i = i + 1
+            if i == n:
+                # the cursor is in or at leading indentation; just inject
+                # an empty line at the start and strip space from current line
+                text.delete("insert - %d chars" % i, "insert")
+                text.insert("insert linestart", "\n")
+                return "break"
+            indent = line[:i]
+            # strip whitespace before insert point
+            i = 0
+            while line and line[-1] in " \t":
+                line = line[:-1]
+                i = i + 1
+            if i:
+                text.delete("insert - %d chars" % i, "insert")
+            # strip whitespace after insert point
+            while text.get("insert") in " \t":
+                text.delete("insert")
+            # start new line
+            text.insert("insert", "\n")
+
+            # adjust indentation for continuations and block
+            # open/close first need to find the last stmt
+            lno = index2line(text.index("insert"))
+            y = PyParse.Parser(self.indentwidth, self.tabwidth)
+            for context in self.num_context_lines:
+                startat = max(lno - context, 1)
+                startatindex = repr(startat) + ".0"
+                rawtext = text.get(startatindex, "insert")
+                y.set_str(rawtext)
+                bod = y.find_good_parse_start(
+                    self.context_use_ps1, self._build_char_in_string_func(startatindex)
+                )
+                if bod is not None or startat == 1:
+                    break
+            y.set_lo(bod or 0)
+            c = y.get_continuation_type()
+            if c != PyParse.C_NONE:
+                # The current stmt hasn't ended yet.
+                if c == PyParse.C_STRING:
+                    # inside a string; just mimic the current indent
+                    text.insert("insert", indent)
+                elif c == PyParse.C_BRACKET:
+                    # line up with the first (if any) element of the
+                    # last open bracket structure; else indent one
+                    # level beyond the indent of the line with the
+                    # last open bracket
+                    self.reindent_to(y.compute_bracket_indent())
+                elif c == PyParse.C_BACKSLASH:
+                    # if more than one line in this stmt already, just
+                    # mimic the current indent; else if initial line
+                    # has a start on an assignment stmt, indent to
+                    # beyond leftmost =; else to beyond first chunk of
+                    # non-whitespace on initial line
+                    if y.get_num_lines_in_stmt() > 1:
+                        text.insert("insert", indent)
+                    else:
+                        self.reindent_to(y.compute_backslash_indent())
+                else:
+                    assert 0, "bogus continuation type " + repr(c)
+                return "break"
+
+            # This line starts a brand new stmt; indent relative to
+            # indentation of initial line of closest preceding
+            # interesting stmt.
+            indent = y.get_base_indent_string()
+            text.insert("insert", indent)
+            if y.is_block_opener():
+                self.smart_indent_event(event)
+            elif indent and y.is_block_closer():
+                self.smart_backspace_event(event)
+            return "break"
+        finally:
+            text.see("insert")
+            text.undo_block_stop()
+
+    auto_indent = newline_and_indent_event
+
+    # Our editwin provides a is_char_in_string function that works
+    # with a Tk text index, but PyParse only knows about offsets into
+    # a string. This builds a function for PyParse that accepts an
+    # offset.
+
+    def _build_char_in_string_func(self, startindex):
+        def inner(offset, _startindex=startindex, _icis=self.editwin.is_char_in_string):
+            return _icis(_startindex + "+%dc" % offset)
+
+        return inner
+
+    def indent_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        for pos in range(len(lines)):
+            line = lines[pos]
+            if line:
+                raw, effective = classifyws(line, self.tabwidth)
+                effective = effective + self.indentwidth
+                lines[pos] = self._make_blanks(effective) + line[raw:]
+        self.set_region(head, tail, chars, lines)
+        return "break"
+
+    def dedent_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        for pos in range(len(lines)):
+            line = lines[pos]
+            if line:
+                raw, effective = classifyws(line, self.tabwidth)
+                effective = max(effective - self.indentwidth, 0)
+                lines[pos] = self._make_blanks(effective) + line[raw:]
+        self.set_region(head, tail, chars, lines)
+        return "break"
+
+    def comment_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        for pos in range(len(lines) - 1):
+            line = lines[pos]
+            lines[pos] = "##" + line
+        self.set_region(head, tail, chars, lines)
+
+    def uncomment_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        for pos in range(len(lines)):
+            line = lines[pos]
+            if not line:
+                continue
+            if line[:2] == "##":
+                line = line[2:]
+            elif line[:1] == "#":
+                line = line[1:]
+            lines[pos] = line
+        self.set_region(head, tail, chars, lines)
+
+    def tabify_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        tabwidth = self._asktabwidth()
+        for pos in range(len(lines)):
+            line = lines[pos]
+            if line:
+                raw, effective = classifyws(line, tabwidth)
+                ntabs, nspaces = divmod(effective, tabwidth)
+                lines[pos] = "\t" * ntabs + " " * nspaces + line[raw:]
+        self.set_region(head, tail, chars, lines)
+
+    def untabify_region_event(self, event):
+        head, tail, chars, lines = self.get_region()
+        tabwidth = self._asktabwidth()
+        for pos in range(len(lines)):
+            lines[pos] = lines[pos].expandtabs(tabwidth)
+        self.set_region(head, tail, chars, lines)
+
+    def toggle_tabs_event(self, event):
+        if self.editwin.askyesno(
+            "Toggle tabs",
+            "Turn tabs " + ("on", "off")[self.usetabs] + "?",
+            parent=self.text,
+        ):
+            self.usetabs = not self.usetabs
+        return "break"
+
+    # XXX this isn't bound to anything -- see class tabwidth comments
+    def change_tabwidth_event(self, event):
+        new = self._asktabwidth()
+        if new != self.tabwidth:
+            self.tabwidth = new
+            self.set_indentation_params(0, guess=0)
+        return "break"
+
+    def change_indentwidth_event(self, event):
+        new = self.editwin.askinteger(
+            "Indent width",
+            "New indent width (1-16)",
+            parent=self.text,
+            initialvalue=self.indentwidth,
+            minvalue=1,
+            maxvalue=16,
+        )
+        if new and new != self.indentwidth:
+            self.indentwidth = new
+        return "break"
+
+    def get_region(self):
+        text = self.text
+        first, last = self.editwin.get_selection_indices()
+        if first and last:
+            head = text.index(first + " linestart")
+            tail = text.index(last + "-1c lineend +1c")
+        else:
+            head = text.index("insert linestart")
+            tail = text.index("insert lineend +1c")
+        chars = text.get(head, tail)
+        lines = chars.split("\n")
+        return head, tail, chars, lines
+
+    def set_region(self, head, tail, chars, lines):
+        text = self.text
+        newchars = "\n".join(lines)
+        if newchars == chars:
+            text.bell()
+            return
+        text.tag_remove("sel", "1.0", "end")
+        text.mark_set("insert", head)
+        text.undo_block_start()
+        text.delete(head, tail)
+        text.insert(head, newchars)
+        text.undo_block_stop()
+        text.tag_add("sel", head, "insert")
+
+    # Make string that displays as n leading blanks.
+
+    def _make_blanks(self, n):
+        if self.usetabs:
+            ntabs, nspaces = divmod(n, self.tabwidth)
+            return "\t" * ntabs + " " * nspaces
+        else:
+            return " " * n
+
+    # Delete from beginning of line to insert point, then reinsert
+    # column logical (meaning use tabs if appropriate) spaces.
+
+    def reindent_to(self, column):
+        text = self.text
+        text.undo_block_start()
+        if text.compare("insert linestart", "!=", "insert"):
+            text.delete("insert linestart", "insert")
+        if column:
+            text.insert("insert", self._make_blanks(column))
+        text.undo_block_stop()
+
+    def _asktabwidth(self):
+        return (
+            self.editwin.askinteger(
+                "Tab width",
+                "Spaces per tab?",
+                parent=self.text,
+                initialvalue=self.tabwidth,
+                minvalue=1,
+                maxvalue=16,
+            )
+            or self.tabwidth
+        )
+
+    # Guess indentwidth from text content.
+    # Return guessed indentwidth.  This should not be believed unless
+    # it's in a reasonable range (e.g., it will be 0 if no indented
+    # blocks are found).
+
+    def guess_indent(self):
+        opener, indented = IndentSearcher(self.text, self.tabwidth).run()
+        if opener and indented:
+            raw, indentsmall = classifyws(opener, self.tabwidth)
+            raw, indentlarge = classifyws(indented, self.tabwidth)
+        else:
+            indentsmall = indentlarge = 0
+        return indentlarge - indentsmall
+
+
+# "line.col" -> line, as an int
+def index2line(index):
+    return int(float(index))
+
+
+# Look at the leading whitespace in s.
+# Return pair (# of leading ws characters,
+#              effective # of leading blanks after expanding
+#              tabs to width tabwidth)
+
+
+def classifyws(s, tabwidth):
+    raw = effective = 0
+    for ch in s:
+        if ch == " ":
+            raw = raw + 1
+            effective = effective + 1
+        elif ch == "\t":
+            raw = raw + 1
+            effective = (effective // tabwidth + 1) * tabwidth
+        else:
+            break
+    return raw, effective
+
+
+class IndentSearcher:
+
+    # .run() chews over the Text widget, looking for a block opener
+    # and the stmt following it.  Returns a pair,
+    #     (line containing block opener, line containing stmt)
+    # Either or both may be None.
+
+    def __init__(self, text, tabwidth):
+        self.text = text
+        self.tabwidth = tabwidth
+        self.i = self.finished = 0
+        self.blkopenline = self.indentedline = None
+
+    def readline(self):
+        if self.finished:
+            val = ""
+        else:
+            i = self.i = self.i + 1
+            mark = repr(i) + ".0"
+            if self.text.compare(mark, ">=", "end"):
+                val = ""
+            else:
+                val = self.text.get(mark, mark + " lineend+1c")
+        # hrm - not sure this is correct in py3k - the source code may have
+        # an encoding declared, but the data will *always* be in
+        # default_scintilla_encoding - so if anyone looks at the encoding decl
+        # in the source they will be wrong.  I think.  Maybe.  Or something...
+        return val.encode(default_scintilla_encoding)
+
+    def run(self):
+        OPENERS = ("class", "def", "for", "if", "try", "while")
+        INDENT = tokenize.INDENT
+        NAME = tokenize.NAME
+
+        save_tabsize = tokenize.tabsize
+        tokenize.tabsize = self.tabwidth
+        try:
+            try:
+                for (typ, token, start, end, line) in token_generator(self.readline):
+                    if typ == NAME and token in OPENERS:
+                        self.blkopenline = line
+                    elif typ == INDENT and self.blkopenline:
+                        self.indentedline = line
+                        break
+
+            except (tokenize.TokenError, IndentationError):
+                # since we cut off the tokenizer early, we can trigger
+                # spurious errors
+                pass
+        finally:
+            tokenize.tabsize = save_tabsize
+        return self.blkopenline, self.indentedline

.venv/Lib/site-packages/pythonwin/pywin/idle/CallTips.py

@@ -0,0 +1,223 @@
+# CallTips.py - An IDLE extension that provides "Call Tips" - ie, a floating window that
+# displays parameter information as you open parens.
+
+import string
+import sys
+import inspect
+import traceback
+
+
+class CallTips:
+
+    menudefs = []
+
+    keydefs = {
+        "<<paren-open>>": ["<Key-parenleft>"],
+        "<<paren-close>>": ["<Key-parenright>"],
+        "<<check-calltip-cancel>>": ["<KeyRelease>"],
+        "<<calltip-cancel>>": ["<ButtonPress>", "<Key-Escape>"],
+    }
+
+    windows_keydefs = {}
+
+    unix_keydefs = {}
+
+    def __init__(self, editwin):
+        self.editwin = editwin
+        self.text = editwin.text
+        self.calltip = None
+        if hasattr(self.text, "make_calltip_window"):
+            self._make_calltip_window = self.text.make_calltip_window
+        else:
+            self._make_calltip_window = self._make_tk_calltip_window
+
+    def close(self):
+        self._make_calltip_window = None
+
+    # Makes a Tk based calltip window.  Used by IDLE, but not Pythonwin.
+    # See __init__ above for how this is used.
+    def _make_tk_calltip_window(self):
+        import CallTipWindow
+
+        return CallTipWindow.CallTip(self.text)
+
+    def _remove_calltip_window(self):
+        if self.calltip:
+            self.calltip.hidetip()
+            self.calltip = None
+
+    def paren_open_event(self, event):
+        self._remove_calltip_window()
+        arg_text = get_arg_text(self.get_object_at_cursor())
+        if arg_text:
+            self.calltip_start = self.text.index("insert")
+            self.calltip = self._make_calltip_window()
+            self.calltip.showtip(arg_text)
+        return ""  # so the event is handled normally.
+
+    def paren_close_event(self, event):
+        # Now just hides, but later we should check if other
+        # paren'd expressions remain open.
+        self._remove_calltip_window()
+        return ""  # so the event is handled normally.
+
+    def check_calltip_cancel_event(self, event):
+        if self.calltip:
+            # If we have moved before the start of the calltip,
+            # or off the calltip line, then cancel the tip.
+            # (Later need to be smarter about multi-line, etc)
+            if self.text.compare(
+                "insert", "<=", self.calltip_start
+            ) or self.text.compare("insert", ">", self.calltip_start + " lineend"):
+                self._remove_calltip_window()
+        return ""  # so the event is handled normally.
+
+    def calltip_cancel_event(self, event):
+        self._remove_calltip_window()
+        return ""  # so the event is handled normally.
+
+    def get_object_at_cursor(
+        self,
+        wordchars="._"
+        + string.ascii_uppercase
+        + string.ascii_lowercase
+        + string.digits,
+    ):
+        # XXX - This needs to be moved to a better place
+        # so the "." attribute lookup code can also use it.
+        text = self.text
+        chars = text.get("insert linestart", "insert")
+        i = len(chars)
+        while i and chars[i - 1] in wordchars:
+            i = i - 1
+        word = chars[i:]
+        if word:
+            # How is this for a hack!
+            import sys, __main__
+
+            namespace = sys.modules.copy()
+            namespace.update(__main__.__dict__)
+            try:
+                return eval(word, namespace)
+            except:
+                pass
+        return None  # Can't find an object.
+
+
+def _find_constructor(class_ob):
+    # Given a class object, return a function object used for the
+    # constructor (ie, __init__() ) or None if we can't find one.
+    try:
+        return class_ob.__init__
+    except AttributeError:
+        for base in class_ob.__bases__:
+            rc = _find_constructor(base)
+            if rc is not None:
+                return rc
+    return None
+
+
+def get_arg_text(ob):
+    # Get a string describing the arguments for the given object.
+    argText = ""
+    if ob is not None:
+        argOffset = 0
+        if inspect.isclass(ob):
+            # Look for the highest __init__ in the class chain.
+            fob = _find_constructor(ob)
+            if fob is None:
+                fob = lambda: None
+        else:
+            fob = ob
+        if inspect.isfunction(fob) or inspect.ismethod(fob):
+            try:
+                # py3k has a 'getfullargspec' which can handle py3k specific things.
+                arg_getter = getattr(inspect, "getfullargspec", inspect.getargspec)
+                argText = inspect.formatargspec(*arg_getter(fob))
+            except:
+                print("Failed to format the args")
+                traceback.print_exc()
+        # See if we can use the docstring
+        if hasattr(ob, "__doc__"):
+            doc = ob.__doc__
+            try:
+                doc = doc.strip()
+                pos = doc.find("\n")
+            except AttributeError:
+                ## New style classes may have __doc__ slot without actually
+                ## having a string assigned to it
+                pass
+            else:
+                if pos < 0 or pos > 70:
+                    pos = 70
+                if argText:
+                    argText = argText + "\n"
+                argText = argText + doc[:pos]
+
+    return argText
+
+
+#################################################
+#
+# Test code
+#
+if __name__ == "__main__":
+
+    def t1():
+        "()"
+
+    def t2(a, b=None):
+        "(a, b=None)"
+
+    def t3(a, *args):
+        "(a, *args)"
+
+    def t4(*args):
+        "(*args)"
+
+    def t5(a, *args):
+        "(a, *args)"
+
+    def t6(a, b=None, *args, **kw):
+        "(a, b=None, *args, **kw)"
+
+    class TC:
+        "(self, a=None, *b)"
+
+        def __init__(self, a=None, *b):
+            "(self, a=None, *b)"
+
+        def t1(self):
+            "(self)"
+
+        def t2(self, a, b=None):
+            "(self, a, b=None)"
+
+        def t3(self, a, *args):
+            "(self, a, *args)"
+
+        def t4(self, *args):
+            "(self, *args)"
+
+        def t5(self, a, *args):
+            "(self, a, *args)"
+
+        def t6(self, a, b=None, *args, **kw):
+            "(self, a, b=None, *args, **kw)"
+
+    def test(tests):
+        failed = []
+        for t in tests:
+            expected = t.__doc__ + "\n" + t.__doc__
+            if get_arg_text(t) != expected:
+                failed.append(t)
+                print(
+                    "%s - expected %s, but got %s"
+                    % (t, repr(expected), repr(get_arg_text(t)))
+                )
+        print("%d of %d tests failed" % (len(failed), len(tests)))
+
+    tc = TC()
+    tests = t1, t2, t3, t4, t5, t6, TC, tc.t1, tc.t2, tc.t3, tc.t4, tc.t5, tc.t6
+
+    test(tests)

.venv/Lib/site-packages/pythonwin/pywin/idle/FormatParagraph.py

@@ -0,0 +1,168 @@
+# Extension to format a paragraph
+
+# Does basic, standard text formatting, and also understands Python
+# comment blocks.  Thus, for editing Python source code, this
+# extension is really only suitable for reformatting these comment
+# blocks or triple-quoted strings.
+
+# Known problems with comment reformatting:
+# * If there is a selection marked, and the first line of the
+#   selection is not complete, the block will probably not be detected
+#   as comments, and will have the normal "text formatting" rules
+#   applied.
+# * If a comment block has leading whitespace that mixes tabs and
+#   spaces, they will not be considered part of the same block.
+# * Fancy comments, like this bulleted list, arent handled :-)
+
+import string
+import re
+
+
+class FormatParagraph:
+
+    menudefs = [
+        (
+            "edit",
+            [
+                ("Format Paragraph", "<<format-paragraph>>"),
+            ],
+        )
+    ]
+
+    keydefs = {
+        "<<format-paragraph>>": ["<Alt-q>"],
+    }
+
+    unix_keydefs = {
+        "<<format-paragraph>>": ["<Meta-q>"],
+    }
+
+    def __init__(self, editwin):
+        self.editwin = editwin
+
+    def close(self):
+        self.editwin = None
+
+    def format_paragraph_event(self, event):
+        text = self.editwin.text
+        first, last = self.editwin.get_selection_indices()
+        if first and last:
+            data = text.get(first, last)
+            comment_header = ""
+        else:
+            first, last, comment_header, data = find_paragraph(
+                text, text.index("insert")
+            )
+        if comment_header:
+            # Reformat the comment lines - convert to text sans header.
+            lines = data.split("\n")
+            lines = map(lambda st, l=len(comment_header): st[l:], lines)
+            data = "\n".join(lines)
+            # Reformat to 70 chars or a 20 char width, whichever is greater.
+            format_width = max(70 - len(comment_header), 20)
+            newdata = reformat_paragraph(data, format_width)
+            # re-split and re-insert the comment header.
+            newdata = newdata.split("\n")
+            # If the block ends in a \n, we dont want the comment
+            # prefix inserted after it. (Im not sure it makes sense to
+            # reformat a comment block that isnt made of complete
+            # lines, but whatever!)  Can't think of a clean soltution,
+            # so we hack away
+            block_suffix = ""
+            if not newdata[-1]:
+                block_suffix = "\n"
+                newdata = newdata[:-1]
+            builder = lambda item, prefix=comment_header: prefix + item
+            newdata = "\n".join([builder(d) for d in newdata]) + block_suffix
+        else:
+            # Just a normal text format
+            newdata = reformat_paragraph(data)
+        text.tag_remove("sel", "1.0", "end")
+        if newdata != data:
+            text.mark_set("insert", first)
+            text.undo_block_start()
+            text.delete(first, last)
+            text.insert(first, newdata)
+            text.undo_block_stop()
+        else:
+            text.mark_set("insert", last)
+        text.see("insert")
+
+
+def find_paragraph(text, mark):
+    lineno, col = list(map(int, mark.split(".")))
+    line = text.get("%d.0" % lineno, "%d.0 lineend" % lineno)
+    while text.compare("%d.0" % lineno, "<", "end") and is_all_white(line):
+        lineno = lineno + 1
+        line = text.get("%d.0" % lineno, "%d.0 lineend" % lineno)
+    first_lineno = lineno
+    comment_header = get_comment_header(line)
+    comment_header_len = len(comment_header)
+    while get_comment_header(line) == comment_header and not is_all_white(
+        line[comment_header_len:]
+    ):
+        lineno = lineno + 1
+        line = text.get("%d.0" % lineno, "%d.0 lineend" % lineno)
+    last = "%d.0" % lineno
+    # Search back to beginning of paragraph
+    lineno = first_lineno - 1
+    line = text.get("%d.0" % lineno, "%d.0 lineend" % lineno)
+    while (
+        lineno > 0
+        and get_comment_header(line) == comment_header
+        and not is_all_white(line[comment_header_len:])
+    ):
+        lineno = lineno - 1
+        line = text.get("%d.0" % lineno, "%d.0 lineend" % lineno)
+    first = "%d.0" % (lineno + 1)
+    return first, last, comment_header, text.get(first, last)
+
+
+def reformat_paragraph(data, limit=70):
+    lines = data.split("\n")
+    i = 0
+    n = len(lines)
+    while i < n and is_all_white(lines[i]):
+        i = i + 1
+    if i >= n:
+        return data
+    indent1 = get_indent(lines[i])
+    if i + 1 < n and not is_all_white(lines[i + 1]):
+        indent2 = get_indent(lines[i + 1])
+    else:
+        indent2 = indent1
+    new = lines[:i]
+    partial = indent1
+    while i < n and not is_all_white(lines[i]):
+        # XXX Should take double space after period (etc.) into account
+        words = re.split("(\s+)", lines[i])
+        for j in range(0, len(words), 2):
+            word = words[j]
+            if not word:
+                continue  # Can happen when line ends in whitespace
+            if len((partial + word).expandtabs()) > limit and partial != indent1:
+                new.append(partial.rstrip())
+                partial = indent2
+            partial = partial + word + " "
+            if j + 1 < len(words) and words[j + 1] != " ":
+                partial = partial + " "
+        i = i + 1
+    new.append(partial.rstrip())
+    # XXX Should reformat remaining paragraphs as well
+    new.extend(lines[i:])
+    return "\n".join(new)
+
+
+def is_all_white(line):
+    return re.match(r"^\s*$", line) is not None
+
+
+def get_indent(line):
+    return re.match(r"^(\s*)", line).group()
+
+
+def get_comment_header(line):
+    m = re.match(r"^(\s*#*)", line)
+    if m is None:
+        return ""
+    return m.group(1)

.venv/Lib/site-packages/pythonwin/pywin/idle/IdleHistory.py

@@ -0,0 +1,90 @@
+import string
+
+
+class History:
+    def __init__(self, text, output_sep="\n"):
+        self.text = text
+        self.history = []
+        self.history_prefix = None
+        self.history_pointer = None
+        self.output_sep = output_sep
+        text.bind("<<history-previous>>", self.history_prev)
+        text.bind("<<history-next>>", self.history_next)
+
+    def history_next(self, event):
+        self.history_do(0)
+        return "break"
+
+    def history_prev(self, event):
+        self.history_do(1)
+        return "break"
+
+    def _get_source(self, start, end):
+        # Get source code from start index to end index.  Lines in the
+        # text control may be separated by sys.ps2 .
+        lines = self.text.get(start, end).split(self.output_sep)
+        return "\n".join(lines)
+
+    def _put_source(self, where, source):
+        output = self.output_sep.join(source.split("\n"))
+        self.text.insert(where, output)
+
+    def history_do(self, reverse):
+        nhist = len(self.history)
+        pointer = self.history_pointer
+        prefix = self.history_prefix
+        if pointer is not None and prefix is not None:
+            if (
+                self.text.compare("insert", "!=", "end-1c")
+                or self._get_source("iomark", "end-1c") != self.history[pointer]
+            ):
+                pointer = prefix = None
+        if pointer is None or prefix is None:
+            prefix = self._get_source("iomark", "end-1c")
+            if reverse:
+                pointer = nhist
+            else:
+                pointer = -1
+        nprefix = len(prefix)
+        while 1:
+            if reverse:
+                pointer = pointer - 1
+            else:
+                pointer = pointer + 1
+            if pointer < 0 or pointer >= nhist:
+                self.text.bell()
+                if self._get_source("iomark", "end-1c") != prefix:
+                    self.text.delete("iomark", "end-1c")
+                    self._put_source("iomark", prefix)
+                pointer = prefix = None
+                break
+            item = self.history[pointer]
+            if item[:nprefix] == prefix and len(item) > nprefix:
+                self.text.delete("iomark", "end-1c")
+                self._put_source("iomark", item)
+                break
+        self.text.mark_set("insert", "end-1c")
+        self.text.see("insert")
+        self.text.tag_remove("sel", "1.0", "end")
+        self.history_pointer = pointer
+        self.history_prefix = prefix
+
+    def history_store(self, source):
+        source = source.strip()
+        if len(source) > 2:
+            # avoid duplicates
+            try:
+                self.history.remove(source)
+            except ValueError:
+                pass
+            self.history.append(source)
+        self.history_pointer = None
+        self.history_prefix = None
+
+    def recall(self, s):
+        s = s.strip()
+        self.text.tag_remove("sel", "1.0", "end")
+        self.text.delete("iomark", "end-1c")
+        self.text.mark_set("insert", "end-1c")
+        self.text.insert("insert", s)
+        self.text.see("insert")

.venv/Lib/site-packages/pythonwin/pywin/idle/PyParse.py

@@ -0,0 +1,591 @@
+import string
+import re
+import sys
+
+# Reason last stmt is continued (or C_NONE if it's not).
+C_NONE, C_BACKSLASH, C_STRING, C_BRACKET = list(range(4))
+
+if 0:  # for throwaway debugging output
+
+    def dump(*stuff):
+        sys.__stdout__.write(" ".join(map(str, stuff)) + "\n")
+
+
+# Find what looks like the start of a popular stmt.
+
+_synchre = re.compile(
+    r"""
+    ^
+    [ \t]*
+    (?: if
+    |   for
+    |   while
+    |   else
+    |   def
+    |   return
+    |   assert
+    |   break
+    |   class
+    |   continue
+    |   elif
+    |   try
+    |   except
+    |   raise
+    |   import
+    )
+    \b
+""",
+    re.VERBOSE | re.MULTILINE,
+).search
+
+# Match blank line or non-indenting comment line.
+
+_junkre = re.compile(
+    r"""
+    [ \t]*
+    (?: \# \S .* )?
+    \n
+""",
+    re.VERBOSE,
+).match
+
+# Match any flavor of string; the terminating quote is optional
+# so that we're robust in the face of incomplete program text.
+
+_match_stringre = re.compile(
+    r"""
+    \""" [^"\\]* (?:
+                     (?: \\. | "(?!"") )
+                     [^"\\]*
+                 )*
+    (?: \""" )?
+
+|   " [^"\\\n]* (?: \\. [^"\\\n]* )* "?
+
+|   ''' [^'\\]* (?:
+                   (?: \\. | '(?!'') )
+                   [^'\\]*
+                )*
+    (?: ''' )?
+
+|   ' [^'\\\n]* (?: \\. [^'\\\n]* )* '?
+""",
+    re.VERBOSE | re.DOTALL,
+).match
+
+# Match a line that starts with something interesting;
+# used to find the first item of a bracket structure.
+
+_itemre = re.compile(
+    r"""
+    [ \t]*
+    [^\s#\\]    # if we match, m.end()-1 is the interesting char
+""",
+    re.VERBOSE,
+).match
+
+# Match start of stmts that should be followed by a dedent.
+
+_closere = re.compile(
+    r"""
+    \s*
+    (?: return
+    |   break
+    |   continue
+    |   raise
+    |   pass
+    )
+    \b
+""",
+    re.VERBOSE,
+).match
+
+# Chew up non-special chars as quickly as possible.  If match is
+# successful, m.end() less 1 is the index of the last boring char
+# matched.  If match is unsuccessful, the string starts with an
+# interesting char.
+
+_chew_ordinaryre = re.compile(
+    r"""
+    [^[\](){}#'"\\]+
+""",
+    re.VERBOSE,
+).match
+
+# Build translation table to map uninteresting chars to "x", open
+# brackets to "(", and close brackets to ")".
+
+_tran = ["x"] * 256
+for ch in "({[":
+    _tran[ord(ch)] = "("
+for ch in ")}]":
+    _tran[ord(ch)] = ")"
+for ch in "\"'\\\n#":
+    _tran[ord(ch)] = ch
+# We are called with unicode strings, and str.translate is one of the few
+# py2k functions which can't 'do the right thing' - so take care to ensure
+# _tran is full of unicode...
+_tran = "".join(_tran)
+del ch
+
+
+class Parser:
+    def __init__(self, indentwidth, tabwidth):
+        self.indentwidth = indentwidth
+        self.tabwidth = tabwidth
+
+    def set_str(self, str):
+        assert len(str) == 0 or str[-1] == "\n", "Oops - have str %r" % (str,)
+        self.str = str
+        self.study_level = 0
+
+    # Return index of a good place to begin parsing, as close to the
+    # end of the string as possible.  This will be the start of some
+    # popular stmt like "if" or "def".  Return None if none found:
+    # the caller should pass more prior context then, if possible, or
+    # if not (the entire program text up until the point of interest
+    # has already been tried) pass 0 to set_lo.
+    #
+    # This will be reliable iff given a reliable is_char_in_string
+    # function, meaning that when it says "no", it's absolutely
+    # guaranteed that the char is not in a string.
+    #
+    # Ack, hack: in the shell window this kills us, because there's
+    # no way to tell the differences between output, >>> etc and
+    # user input.  Indeed, IDLE's first output line makes the rest
+    # look like it's in an unclosed paren!:
+    # Python 1.5.2 (#0, Apr 13 1999, ...
+
+    def find_good_parse_start(self, use_ps1, is_char_in_string=None):
+        str, pos = self.str, None
+        if use_ps1:
+            # shell window
+            ps1 = "\n" + sys.ps1
+            i = str.rfind(ps1)
+            if i >= 0:
+                pos = i + len(ps1)
+                # make it look like there's a newline instead
+                # of ps1 at the start -- hacking here once avoids
+                # repeated hackery later
+                self.str = str[: pos - 1] + "\n" + str[pos:]
+            return pos
+
+        # File window -- real work.
+        if not is_char_in_string:
+            # no clue -- make the caller pass everything
+            return None
+
+        # Peek back from the end for a good place to start,
+        # but don't try too often; pos will be left None, or
+        # bumped to a legitimate synch point.
+        limit = len(str)
+        for tries in range(5):
+            i = str.rfind(":\n", 0, limit)
+            if i < 0:
+                break
+            i = str.rfind("\n", 0, i) + 1  # start of colon line
+            m = _synchre(str, i, limit)
+            if m and not is_char_in_string(m.start()):
+                pos = m.start()
+                break
+            limit = i
+        if pos is None:
+            # Nothing looks like a block-opener, or stuff does
+            # but is_char_in_string keeps returning true; most likely
+            # we're in or near a giant string, the colorizer hasn't
+            # caught up enough to be helpful, or there simply *aren't*
+            # any interesting stmts.  In any of these cases we're
+            # going to have to parse the whole thing to be sure, so
+            # give it one last try from the start, but stop wasting
+            # time here regardless of the outcome.
+            m = _synchre(str)
+            if m and not is_char_in_string(m.start()):
+                pos = m.start()
+            return pos
+
+        # Peeking back worked; look forward until _synchre no longer
+        # matches.
+        i = pos + 1
+        while 1:
+            m = _synchre(str, i)
+            if m:
+                s, i = m.span()
+                if not is_char_in_string(s):
+                    pos = s
+            else:
+                break
+        return pos
+
+    # Throw away the start of the string.  Intended to be called with
+    # find_good_parse_start's result.
+
+    def set_lo(self, lo):
+        assert lo == 0 or self.str[lo - 1] == "\n"
+        if lo > 0:
+            self.str = self.str[lo:]
+
+    # As quickly as humanly possible <wink>, find the line numbers (0-
+    # based) of the non-continuation lines.
+    # Creates self.{goodlines, continuation}.
+
+    def _study1(self):
+        if self.study_level >= 1:
+            return
+        self.study_level = 1
+
+        # Map all uninteresting characters to "x", all open brackets
+        # to "(", all close brackets to ")", then collapse runs of
+        # uninteresting characters.  This can cut the number of chars
+        # by a factor of 10-40, and so greatly speed the following loop.
+        str = self.str
+        str = str.translate(_tran)
+        str = str.replace("xxxxxxxx", "x")
+        str = str.replace("xxxx", "x")
+        str = str.replace("xx", "x")
+        str = str.replace("xx", "x")
+        str = str.replace("\nx", "\n")
+        # note that replacing x\n with \n would be incorrect, because
+        # x may be preceded by a backslash
+
+        # March over the squashed version of the program, accumulating
+        # the line numbers of non-continued stmts, and determining
+        # whether & why the last stmt is a continuation.
+        continuation = C_NONE
+        level = lno = 0  # level is nesting level; lno is line number
+        self.goodlines = goodlines = [0]
+        push_good = goodlines.append
+        i, n = 0, len(str)
+        while i < n:
+            ch = str[i]
+            i = i + 1
+
+            # cases are checked in decreasing order of frequency
+            if ch == "x":
+                continue
+
+            if ch == "\n":
+                lno = lno + 1
+                if level == 0:
+                    push_good(lno)
+                    # else we're in an unclosed bracket structure
+                continue
+
+            if ch == "(":
+                level = level + 1
+                continue
+
+            if ch == ")":
+                if level:
+                    level = level - 1
+                    # else the program is invalid, but we can't complain
+                continue
+
+            if ch == '"' or ch == "'":
+                # consume the string
+                quote = ch
+                if str[i - 1 : i + 2] == quote * 3:
+                    quote = quote * 3
+                w = len(quote) - 1
+                i = i + w
+                while i < n:
+                    ch = str[i]
+                    i = i + 1
+
+                    if ch == "x":
+                        continue
+
+                    if str[i - 1 : i + w] == quote:
+                        i = i + w
+                        break
+
+                    if ch == "\n":
+                        lno = lno + 1
+                        if w == 0:
+                            # unterminated single-quoted string
+                            if level == 0:
+                                push_good(lno)
+                            break
+                        continue
+
+                    if ch == "\\":
+                        assert i < n
+                        if str[i] == "\n":
+                            lno = lno + 1
+                        i = i + 1
+                        continue
+
+                    # else comment char or paren inside string
+
+                else:
+                    # didn't break out of the loop, so we're still
+                    # inside a string
+                    continuation = C_STRING
+                continue  # with outer loop
+
+            if ch == "#":
+                # consume the comment
+                i = str.find("\n", i)
+                assert i >= 0
+                continue
+
+            assert ch == "\\"
+            assert i < n
+            if str[i] == "\n":
+                lno = lno + 1
+                if i + 1 == n:
+                    continuation = C_BACKSLASH
+            i = i + 1
+
+        # The last stmt may be continued for all 3 reasons.
+        # String continuation takes precedence over bracket
+        # continuation, which beats backslash continuation.
+        if continuation != C_STRING and level > 0:
+            continuation = C_BRACKET
+        self.continuation = continuation
+
+        # Push the final line number as a sentinel value, regardless of
+        # whether it's continued.
+        assert (continuation == C_NONE) == (goodlines[-1] == lno)
+        if goodlines[-1] != lno:
+            push_good(lno)
+
+    def get_continuation_type(self):
+        self._study1()
+        return self.continuation
+
+    # study1 was sufficient to determine the continuation status,
+    # but doing more requires looking at every character.  study2
+    # does this for the last interesting statement in the block.
+    # Creates:
+    #     self.stmt_start, stmt_end
+    #         slice indices of last interesting stmt
+    #     self.lastch
+    #         last non-whitespace character before optional trailing
+    #         comment
+    #     self.lastopenbracketpos
+    #         if continuation is C_BRACKET, index of last open bracket
+
+    def _study2(self):
+        _ws = string.whitespace
+        if self.study_level >= 2:
+            return
+        self._study1()
+        self.study_level = 2
+
+        # Set p and q to slice indices of last interesting stmt.
+        str, goodlines = self.str, self.goodlines
+        i = len(goodlines) - 1
+        p = len(str)  # index of newest line
+        while i:
+            assert p
+            # p is the index of the stmt at line number goodlines[i].
+            # Move p back to the stmt at line number goodlines[i-1].
+            q = p
+            for nothing in range(goodlines[i - 1], goodlines[i]):
+                # tricky: sets p to 0 if no preceding newline
+                p = str.rfind("\n", 0, p - 1) + 1
+            # The stmt str[p:q] isn't a continuation, but may be blank
+            # or a non-indenting comment line.
+            if _junkre(str, p):
+                i = i - 1
+            else:
+                break
+        if i == 0:
+            # nothing but junk!
+            assert p == 0
+            q = p
+        self.stmt_start, self.stmt_end = p, q
+
+        # Analyze this stmt, to find the last open bracket (if any)
+        # and last interesting character (if any).
+        lastch = ""
+        stack = []  # stack of open bracket indices
+        push_stack = stack.append
+        while p < q:
+            # suck up all except ()[]{}'"#\\
+            m = _chew_ordinaryre(str, p, q)
+            if m:
+                # we skipped at least one boring char
+                newp = m.end()
+                # back up over totally boring whitespace
+                i = newp - 1  # index of last boring char
+                while i >= p and str[i] in " \t\n":
+                    i = i - 1
+                if i >= p:
+                    lastch = str[i]
+                p = newp
+                if p >= q:
+                    break
+
+            ch = str[p]
+
+            if ch in "([{":
+                push_stack(p)
+                lastch = ch
+                p = p + 1
+                continue
+
+            if ch in ")]}":
+                if stack:
+                    del stack[-1]
+                lastch = ch
+                p = p + 1
+                continue
+
+            if ch == '"' or ch == "'":
+                # consume string
+                # Note that study1 did this with a Python loop, but
+                # we use a regexp here; the reason is speed in both
+                # cases; the string may be huge, but study1 pre-squashed
+                # strings to a couple of characters per line.  study1
+                # also needed to keep track of newlines, and we don't
+                # have to.
+                lastch = ch
+                p = _match_stringre(str, p, q).end()
+                continue
+
+            if ch == "#":
+                # consume comment and trailing newline
+                p = str.find("\n", p, q) + 1
+                assert p > 0
+                continue
+
+            assert ch == "\\"
+            p = p + 1  # beyond backslash
+            assert p < q
+            if str[p] != "\n":
+                # the program is invalid, but can't complain
+                lastch = ch + str[p]
+            p = p + 1  # beyond escaped char
+
+        # end while p < q:
+
+        self.lastch = lastch
+        if stack:
+            self.lastopenbracketpos = stack[-1]
+
+    # Assuming continuation is C_BRACKET, return the number
+    # of spaces the next line should be indented.
+
+    def compute_bracket_indent(self):
+        self._study2()
+        assert self.continuation == C_BRACKET
+        j = self.lastopenbracketpos
+        str = self.str
+        n = len(str)
+        origi = i = str.rfind("\n", 0, j) + 1
+        j = j + 1  # one beyond open bracket
+        # find first list item; set i to start of its line
+        while j < n:
+            m = _itemre(str, j)
+            if m:
+                j = m.end() - 1  # index of first interesting char
+                extra = 0
+                break
+            else:
+                # this line is junk; advance to next line
+                i = j = str.find("\n", j) + 1
+        else:
+            # nothing interesting follows the bracket;
+            # reproduce the bracket line's indentation + a level
+            j = i = origi
+            while str[j] in " \t":
+                j = j + 1
+            extra = self.indentwidth
+        return len(str[i:j].expandtabs(self.tabwidth)) + extra
+
+    # Return number of physical lines in last stmt (whether or not
+    # it's an interesting stmt!  this is intended to be called when
+    # continuation is C_BACKSLASH).
+
+    def get_num_lines_in_stmt(self):
+        self._study1()
+        goodlines = self.goodlines
+        return goodlines[-1] - goodlines[-2]
+
+    # Assuming continuation is C_BACKSLASH, return the number of spaces
+    # the next line should be indented.  Also assuming the new line is
+    # the first one following the initial line of the stmt.
+
+    def compute_backslash_indent(self):
+        self._study2()
+        assert self.continuation == C_BACKSLASH
+        str = self.str
+        i = self.stmt_start
+        while str[i] in " \t":
+            i = i + 1
+        startpos = i
+
+        # See whether the initial line starts an assignment stmt; i.e.,
+        # look for an = operator
+        endpos = str.find("\n", startpos) + 1
+        found = level = 0
+        while i < endpos:
+            ch = str[i]
+            if ch in "([{":
+                level = level + 1
+                i = i + 1
+            elif ch in ")]}":
+                if level:
+                    level = level - 1
+                i = i + 1
+            elif ch == '"' or ch == "'":
+                i = _match_stringre(str, i, endpos).end()
+            elif ch == "#":
+                break
+            elif (
+                level == 0
+                and ch == "="
+                and (i == 0 or str[i - 1] not in "=<>!")
+                and str[i + 1] != "="
+            ):
+                found = 1
+                break
+            else:
+                i = i + 1
+
+        if found:
+            # found a legit =, but it may be the last interesting
+            # thing on the line
+            i = i + 1  # move beyond the =
+            found = re.match(r"\s*\\", str[i:endpos]) is None
+
+        if not found:
+            # oh well ... settle for moving beyond the first chunk
+            # of non-whitespace chars
+            i = startpos
+            while str[i] not in " \t\n":
+                i = i + 1
+
+        return len(str[self.stmt_start : i].expandtabs(self.tabwidth)) + 1
+
+    # Return the leading whitespace on the initial line of the last
+    # interesting stmt.
+
+    def get_base_indent_string(self):
+        self._study2()
+        i, n = self.stmt_start, self.stmt_end
+        j = i
+        str = self.str
+        while j < n and str[j] in " \t":
+            j = j + 1
+        return str[i:j]
+
+    # Did the last interesting stmt open a block?
+
+    def is_block_opener(self):
+        self._study2()
+        return self.lastch == ":"
+
+    # Did the last interesting stmt close a block?
+
+    def is_block_closer(self):
+        self._study2()
+        return _closere(self.str, self.stmt_start) is not None
+
+    # index of last open bracket ({[, or None if none
+    lastopenbracketpos = None
+
+    def get_last_open_bracket_pos(self):
+        self._study2()
+        return self.lastopenbracketpos

.venv/Lib/site-packages/pythonwin/pywin/idle/__init__.py

@@ -0,0 +1 @@
+# This file denotes the directory as a Python package.

.venv/Lib/site-packages/pythonwin/pywin/mfc/activex.py

@@ -0,0 +1,84 @@
+"""Support for ActiveX control hosting in Pythonwin.
+"""
+import win32ui, win32uiole
+from . import window
+
+# XXX - we are still "classic style" classes in py2x, so we need can't yet
+# use 'type()' everywhere - revisit soon, as py2x will move to new-style too...
+try:
+    from types import ClassType as new_type
+except ImportError:
+    new_type = type  # py3k
+
+
+class Control(window.Wnd):
+    """An ActiveX control base class.  A new class must be derived from both
+    this class and the Events class.  See the demos for more details.
+    """
+
+    def __init__(self):
+        self.__dict__["_dispobj_"] = None
+        window.Wnd.__init__(self)
+
+    def _GetControlCLSID(self):
+        return self.CLSID
+
+    def _GetDispatchClass(self):
+        return self.default_interface
+
+    def _GetEventMap(self):
+        return self.default_source._dispid_to_func_
+
+    def CreateControl(self, windowTitle, style, rect, parent, id, lic_string=None):
+        clsid = str(self._GetControlCLSID())
+        self.__dict__["_obj_"] = win32ui.CreateControl(
+            clsid, windowTitle, style, rect, parent, id, None, False, lic_string
+        )
+        klass = self._GetDispatchClass()
+        dispobj = klass(win32uiole.GetIDispatchForWindow(self._obj_))
+        self.HookOleEvents()
+        self.__dict__["_dispobj_"] = dispobj
+
+    def HookOleEvents(self):
+        dict = self._GetEventMap()
+        for dispid, methodName in dict.items():
+            if hasattr(self, methodName):
+                self._obj_.HookOleEvent(getattr(self, methodName), dispid)
+
+    def __getattr__(self, attr):
+        # Delegate attributes to the windows and the Dispatch object for this class
+        try:
+            return window.Wnd.__getattr__(self, attr)
+        except AttributeError:
+            pass
+        return getattr(self._dispobj_, attr)
+
+    def __setattr__(self, attr, value):
+        if hasattr(self.__dict__, attr):
+            self.__dict__[attr] = value
+            return
+        try:
+            if self._dispobj_:
+                self._dispobj_.__setattr__(attr, value)
+                return
+        except AttributeError:
+            pass
+        self.__dict__[attr] = value
+
+
+def MakeControlClass(controlClass, name=None):
+    """Given a CoClass in a generated .py file, this function will return a Class
+    object which can be used as an OCX control.
+
+    This function is used when you do not want to handle any events from the OCX
+    control.  If you need events, then you should derive a class from both the
+    activex.Control class and the CoClass
+    """
+    if name is None:
+        name = controlClass.__name__
+    return new_type("OCX" + name, (Control, controlClass), {})
+
+
+def MakeControlInstance(controlClass, name=None):
+    """As for MakeControlClass(), but returns an instance of the class."""
+    return MakeControlClass(controlClass, name)()

.venv/Lib/site-packages/pythonwin/pywin/mfc/afxres.py

@@ -0,0 +1,501 @@
+# Generated by h2py from stdin
+TCS_MULTILINE = 0x0200
+CBRS_ALIGN_LEFT = 0x1000
+CBRS_ALIGN_TOP = 0x2000
+CBRS_ALIGN_RIGHT = 0x4000
+CBRS_ALIGN_BOTTOM = 0x8000
+CBRS_ALIGN_ANY = 0xF000
+CBRS_BORDER_LEFT = 0x0100
+CBRS_BORDER_TOP = 0x0200
+CBRS_BORDER_RIGHT = 0x0400
+CBRS_BORDER_BOTTOM = 0x0800
+CBRS_BORDER_ANY = 0x0F00
+CBRS_TOOLTIPS = 0x0010
+CBRS_FLYBY = 0x0020
+CBRS_FLOAT_MULTI = 0x0040
+CBRS_BORDER_3D = 0x0080
+CBRS_HIDE_INPLACE = 0x0008
+CBRS_SIZE_DYNAMIC = 0x0004
+CBRS_SIZE_FIXED = 0x0002
+CBRS_FLOATING = 0x0001
+CBRS_GRIPPER = 0x00400000
+CBRS_ORIENT_HORZ = CBRS_ALIGN_TOP | CBRS_ALIGN_BOTTOM
+CBRS_ORIENT_VERT = CBRS_ALIGN_LEFT | CBRS_ALIGN_RIGHT
+CBRS_ORIENT_ANY = CBRS_ORIENT_HORZ | CBRS_ORIENT_VERT
+CBRS_ALL = 0xFFFF
+CBRS_NOALIGN = 0x00000000
+CBRS_LEFT = CBRS_ALIGN_LEFT | CBRS_BORDER_RIGHT
+CBRS_TOP = CBRS_ALIGN_TOP | CBRS_BORDER_BOTTOM
+CBRS_RIGHT = CBRS_ALIGN_RIGHT | CBRS_BORDER_LEFT
+CBRS_BOTTOM = CBRS_ALIGN_BOTTOM | CBRS_BORDER_TOP
+SBPS_NORMAL = 0x0000
+SBPS_NOBORDERS = 0x0100
+SBPS_POPOUT = 0x0200
+SBPS_OWNERDRAW = 0x1000
+SBPS_DISABLED = 0x04000000
+SBPS_STRETCH = 0x08000000
+ID_INDICATOR_EXT = 0xE700
+ID_INDICATOR_CAPS = 0xE701
+ID_INDICATOR_NUM = 0xE702
+ID_INDICATOR_SCRL = 0xE703
+ID_INDICATOR_OVR = 0xE704
+ID_INDICATOR_REC = 0xE705
+ID_INDICATOR_KANA = 0xE706
+ID_SEPARATOR = 0
+AFX_IDW_CONTROLBAR_FIRST = 0xE800
+AFX_IDW_CONTROLBAR_LAST = 0xE8FF
+AFX_IDW_TOOLBAR = 0xE800
+AFX_IDW_STATUS_BAR = 0xE801
+AFX_IDW_PREVIEW_BAR = 0xE802
+AFX_IDW_RESIZE_BAR = 0xE803
+AFX_IDW_DOCKBAR_TOP = 0xE81B
+AFX_IDW_DOCKBAR_LEFT = 0xE81C
+AFX_IDW_DOCKBAR_RIGHT = 0xE81D
+AFX_IDW_DOCKBAR_BOTTOM = 0xE81E
+AFX_IDW_DOCKBAR_FLOAT = 0xE81F
+
+
+def AFX_CONTROLBAR_MASK(nIDC):
+    return 1 << (nIDC - AFX_IDW_CONTROLBAR_FIRST)
+
+
+AFX_IDW_PANE_FIRST = 0xE900
+AFX_IDW_PANE_LAST = 0xE9FF
+AFX_IDW_HSCROLL_FIRST = 0xEA00
+AFX_IDW_VSCROLL_FIRST = 0xEA10
+AFX_IDW_SIZE_BOX = 0xEA20
+AFX_IDW_PANE_SAVE = 0xEA21
+AFX_IDS_APP_TITLE = 0xE000
+AFX_IDS_IDLEMESSAGE = 0xE001
+AFX_IDS_HELPMODEMESSAGE = 0xE002
+AFX_IDS_APP_TITLE_EMBEDDING = 0xE003
+AFX_IDS_COMPANY_NAME = 0xE004
+AFX_IDS_OBJ_TITLE_INPLACE = 0xE005
+ID_FILE_NEW = 0xE100
+ID_FILE_OPEN = 0xE101
+ID_FILE_CLOSE = 0xE102
+ID_FILE_SAVE = 0xE103
+ID_FILE_SAVE_AS = 0xE104
+ID_FILE_PAGE_SETUP = 0xE105
+ID_FILE_PRINT_SETUP = 0xE106
+ID_FILE_PRINT = 0xE107
+ID_FILE_PRINT_DIRECT = 0xE108
+ID_FILE_PRINT_PREVIEW = 0xE109
+ID_FILE_UPDATE = 0xE10A
+ID_FILE_SAVE_COPY_AS = 0xE10B
+ID_FILE_SEND_MAIL = 0xE10C
+ID_FILE_MRU_FIRST = 0xE110
+ID_FILE_MRU_FILE1 = 0xE110
+ID_FILE_MRU_FILE2 = 0xE111
+ID_FILE_MRU_FILE3 = 0xE112
+ID_FILE_MRU_FILE4 = 0xE113
+ID_FILE_MRU_FILE5 = 0xE114
+ID_FILE_MRU_FILE6 = 0xE115
+ID_FILE_MRU_FILE7 = 0xE116
+ID_FILE_MRU_FILE8 = 0xE117
+ID_FILE_MRU_FILE9 = 0xE118
+ID_FILE_MRU_FILE10 = 0xE119
+ID_FILE_MRU_FILE11 = 0xE11A
+ID_FILE_MRU_FILE12 = 0xE11B
+ID_FILE_MRU_FILE13 = 0xE11C
+ID_FILE_MRU_FILE14 = 0xE11D
+ID_FILE_MRU_FILE15 = 0xE11E
+ID_FILE_MRU_FILE16 = 0xE11F
+ID_FILE_MRU_LAST = 0xE11F
+ID_EDIT_CLEAR = 0xE120
+ID_EDIT_CLEAR_ALL = 0xE121
+ID_EDIT_COPY = 0xE122
+ID_EDIT_CUT = 0xE123
+ID_EDIT_FIND = 0xE124
+ID_EDIT_PASTE = 0xE125
+ID_EDIT_PASTE_LINK = 0xE126
+ID_EDIT_PASTE_SPECIAL = 0xE127
+ID_EDIT_REPEAT = 0xE128
+ID_EDIT_REPLACE = 0xE129
+ID_EDIT_SELECT_ALL = 0xE12A
+ID_EDIT_UNDO = 0xE12B
+ID_EDIT_REDO = 0xE12C
+ID_WINDOW_NEW = 0xE130
+ID_WINDOW_ARRANGE = 0xE131
+ID_WINDOW_CASCADE = 0xE132
+ID_WINDOW_TILE_HORZ = 0xE133
+ID_WINDOW_TILE_VERT = 0xE134
+ID_WINDOW_SPLIT = 0xE135
+AFX_IDM_WINDOW_FIRST = 0xE130
+AFX_IDM_WINDOW_LAST = 0xE13F
+AFX_IDM_FIRST_MDICHILD = 0xFF00
+ID_APP_ABOUT = 0xE140
+ID_APP_EXIT = 0xE141
+ID_HELP_INDEX = 0xE142
+ID_HELP_FINDER = 0xE143
+ID_HELP_USING = 0xE144
+ID_CONTEXT_HELP = 0xE145
+ID_HELP = 0xE146
+ID_DEFAULT_HELP = 0xE147
+ID_NEXT_PANE = 0xE150
+ID_PREV_PANE = 0xE151
+ID_FORMAT_FONT = 0xE160
+ID_OLE_INSERT_NEW = 0xE200
+ID_OLE_EDIT_LINKS = 0xE201
+ID_OLE_EDIT_CONVERT = 0xE202
+ID_OLE_EDIT_CHANGE_ICON = 0xE203
+ID_OLE_EDIT_PROPERTIES = 0xE204
+ID_OLE_VERB_FIRST = 0xE210
+ID_OLE_VERB_LAST = 0xE21F
+AFX_ID_PREVIEW_CLOSE = 0xE300
+AFX_ID_PREVIEW_NUMPAGE = 0xE301
+AFX_ID_PREVIEW_NEXT = 0xE302
+AFX_ID_PREVIEW_PREV = 0xE303
+AFX_ID_PREVIEW_PRINT = 0xE304
+AFX_ID_PREVIEW_ZOOMIN = 0xE305
+AFX_ID_PREVIEW_ZOOMOUT = 0xE306
+ID_VIEW_TOOLBAR = 0xE800
+ID_VIEW_STATUS_BAR = 0xE801
+ID_RECORD_FIRST = 0xE900
+ID_RECORD_LAST = 0xE901
+ID_RECORD_NEXT = 0xE902
+ID_RECORD_PREV = 0xE903
+IDC_STATIC = -1
+AFX_IDS_SCFIRST = 0xEF00
+AFX_IDS_SCSIZE = 0xEF00
+AFX_IDS_SCMOVE = 0xEF01
+AFX_IDS_SCMINIMIZE = 0xEF02
+AFX_IDS_SCMAXIMIZE = 0xEF03
+AFX_IDS_SCNEXTWINDOW = 0xEF04
+AFX_IDS_SCPREVWINDOW = 0xEF05
+AFX_IDS_SCCLOSE = 0xEF06
+AFX_IDS_SCRESTORE = 0xEF12
+AFX_IDS_SCTASKLIST = 0xEF13
+AFX_IDS_MDICHILD = 0xEF1F
+AFX_IDS_DESKACCESSORY = 0xEFDA
+AFX_IDS_OPENFILE = 0xF000
+AFX_IDS_SAVEFILE = 0xF001
+AFX_IDS_ALLFILTER = 0xF002
+AFX_IDS_UNTITLED = 0xF003
+AFX_IDS_SAVEFILECOPY = 0xF004
+AFX_IDS_PREVIEW_CLOSE = 0xF005
+AFX_IDS_UNNAMED_FILE = 0xF006
+AFX_IDS_ABOUT = 0xF010
+AFX_IDS_HIDE = 0xF011
+AFX_IDP_NO_ERROR_AVAILABLE = 0xF020
+AFX_IDS_NOT_SUPPORTED_EXCEPTION = 0xF021
+AFX_IDS_RESOURCE_EXCEPTION = 0xF022
+AFX_IDS_MEMORY_EXCEPTION = 0xF023
+AFX_IDS_USER_EXCEPTION = 0xF024
+AFX_IDS_PRINTONPORT = 0xF040
+AFX_IDS_ONEPAGE = 0xF041
+AFX_IDS_TWOPAGE = 0xF042
+AFX_IDS_PRINTPAGENUM = 0xF043
+AFX_IDS_PREVIEWPAGEDESC = 0xF044
+AFX_IDS_PRINTDEFAULTEXT = 0xF045
+AFX_IDS_PRINTDEFAULT = 0xF046
+AFX_IDS_PRINTFILTER = 0xF047
+AFX_IDS_PRINTCAPTION = 0xF048
+AFX_IDS_PRINTTOFILE = 0xF049
+AFX_IDS_OBJECT_MENUITEM = 0xF080
+AFX_IDS_EDIT_VERB = 0xF081
+AFX_IDS_ACTIVATE_VERB = 0xF082
+AFX_IDS_CHANGE_LINK = 0xF083
+AFX_IDS_AUTO = 0xF084
+AFX_IDS_MANUAL = 0xF085
+AFX_IDS_FROZEN = 0xF086
+AFX_IDS_ALL_FILES = 0xF087
+AFX_IDS_SAVE_MENU = 0xF088
+AFX_IDS_UPDATE_MENU = 0xF089
+AFX_IDS_SAVE_AS_MENU = 0xF08A
+AFX_IDS_SAVE_COPY_AS_MENU = 0xF08B
+AFX_IDS_EXIT_MENU = 0xF08C
+AFX_IDS_UPDATING_ITEMS = 0xF08D
+AFX_IDS_METAFILE_FORMAT = 0xF08E
+AFX_IDS_DIB_FORMAT = 0xF08F
+AFX_IDS_BITMAP_FORMAT = 0xF090
+AFX_IDS_LINKSOURCE_FORMAT = 0xF091
+AFX_IDS_EMBED_FORMAT = 0xF092
+AFX_IDS_PASTELINKEDTYPE = 0xF094
+AFX_IDS_UNKNOWNTYPE = 0xF095
+AFX_IDS_RTF_FORMAT = 0xF096
+AFX_IDS_TEXT_FORMAT = 0xF097
+AFX_IDS_INVALID_CURRENCY = 0xF098
+AFX_IDS_INVALID_DATETIME = 0xF099
+AFX_IDS_INVALID_DATETIMESPAN = 0xF09A
+AFX_IDP_INVALID_FILENAME = 0xF100
+AFX_IDP_FAILED_TO_OPEN_DOC = 0xF101
+AFX_IDP_FAILED_TO_SAVE_DOC = 0xF102
+AFX_IDP_ASK_TO_SAVE = 0xF103
+AFX_IDP_FAILED_TO_CREATE_DOC = 0xF104
+AFX_IDP_FILE_TOO_LARGE = 0xF105
+AFX_IDP_FAILED_TO_START_PRINT = 0xF106
+AFX_IDP_FAILED_TO_LAUNCH_HELP = 0xF107
+AFX_IDP_INTERNAL_FAILURE = 0xF108
+AFX_IDP_COMMAND_FAILURE = 0xF109
+AFX_IDP_FAILED_MEMORY_ALLOC = 0xF10A
+AFX_IDP_PARSE_INT = 0xF110
+AFX_IDP_PARSE_REAL = 0xF111
+AFX_IDP_PARSE_INT_RANGE = 0xF112
+AFX_IDP_PARSE_REAL_RANGE = 0xF113
+AFX_IDP_PARSE_STRING_SIZE = 0xF114
+AFX_IDP_PARSE_RADIO_BUTTON = 0xF115
+AFX_IDP_PARSE_BYTE = 0xF116
+AFX_IDP_PARSE_UINT = 0xF117
+AFX_IDP_PARSE_DATETIME = 0xF118
+AFX_IDP_PARSE_CURRENCY = 0xF119
+AFX_IDP_FAILED_INVALID_FORMAT = 0xF120
+AFX_IDP_FAILED_INVALID_PATH = 0xF121
+AFX_IDP_FAILED_DISK_FULL = 0xF122
+AFX_IDP_FAILED_ACCESS_READ = 0xF123
+AFX_IDP_FAILED_ACCESS_WRITE = 0xF124
+AFX_IDP_FAILED_IO_ERROR_READ = 0xF125
+AFX_IDP_FAILED_IO_ERROR_WRITE = 0xF126
+AFX_IDP_STATIC_OBJECT = 0xF180
+AFX_IDP_FAILED_TO_CONNECT = 0xF181
+AFX_IDP_SERVER_BUSY = 0xF182
+AFX_IDP_BAD_VERB = 0xF183
+AFX_IDP_FAILED_TO_NOTIFY = 0xF185
+AFX_IDP_FAILED_TO_LAUNCH = 0xF186
+AFX_IDP_ASK_TO_UPDATE = 0xF187
+AFX_IDP_FAILED_TO_UPDATE = 0xF188
+AFX_IDP_FAILED_TO_REGISTER = 0xF189
+AFX_IDP_FAILED_TO_AUTO_REGISTER = 0xF18A
+AFX_IDP_FAILED_TO_CONVERT = 0xF18B
+AFX_IDP_GET_NOT_SUPPORTED = 0xF18C
+AFX_IDP_SET_NOT_SUPPORTED = 0xF18D
+AFX_IDP_ASK_TO_DISCARD = 0xF18E
+AFX_IDP_FAILED_TO_CREATE = 0xF18F
+AFX_IDP_FAILED_MAPI_LOAD = 0xF190
+AFX_IDP_INVALID_MAPI_DLL = 0xF191
+AFX_IDP_FAILED_MAPI_SEND = 0xF192
+AFX_IDP_FILE_NONE = 0xF1A0
+AFX_IDP_FILE_GENERIC = 0xF1A1
+AFX_IDP_FILE_NOT_FOUND = 0xF1A2
+AFX_IDP_FILE_BAD_PATH = 0xF1A3
+AFX_IDP_FILE_TOO_MANY_OPEN = 0xF1A4
+AFX_IDP_FILE_ACCESS_DENIED = 0xF1A5
+AFX_IDP_FILE_INVALID_FILE = 0xF1A6
+AFX_IDP_FILE_REMOVE_CURRENT = 0xF1A7
+AFX_IDP_FILE_DIR_FULL = 0xF1A8
+AFX_IDP_FILE_BAD_SEEK = 0xF1A9
+AFX_IDP_FILE_HARD_IO = 0xF1AA
+AFX_IDP_FILE_SHARING = 0xF1AB
+AFX_IDP_FILE_LOCKING = 0xF1AC
+AFX_IDP_FILE_DISKFULL = 0xF1AD
+AFX_IDP_FILE_EOF = 0xF1AE
+AFX_IDP_ARCH_NONE = 0xF1B0
+AFX_IDP_ARCH_GENERIC = 0xF1B1
+AFX_IDP_ARCH_READONLY = 0xF1B2
+AFX_IDP_ARCH_ENDOFFILE = 0xF1B3
+AFX_IDP_ARCH_WRITEONLY = 0xF1B4
+AFX_IDP_ARCH_BADINDEX = 0xF1B5
+AFX_IDP_ARCH_BADCLASS = 0xF1B6
+AFX_IDP_ARCH_BADSCHEMA = 0xF1B7
+AFX_IDS_OCC_SCALEUNITS_PIXELS = 0xF1C0
+AFX_IDS_STATUS_FONT = 0xF230
+AFX_IDS_TOOLTIP_FONT = 0xF231
+AFX_IDS_UNICODE_FONT = 0xF232
+AFX_IDS_MINI_FONT = 0xF233
+AFX_IDP_SQL_FIRST = 0xF280
+AFX_IDP_SQL_CONNECT_FAIL = 0xF281
+AFX_IDP_SQL_RECORDSET_FORWARD_ONLY = 0xF282
+AFX_IDP_SQL_EMPTY_COLUMN_LIST = 0xF283
+AFX_IDP_SQL_FIELD_SCHEMA_MISMATCH = 0xF284
+AFX_IDP_SQL_ILLEGAL_MODE = 0xF285
+AFX_IDP_SQL_MULTIPLE_ROWS_AFFECTED = 0xF286
+AFX_IDP_SQL_NO_CURRENT_RECORD = 0xF287
+AFX_IDP_SQL_NO_ROWS_AFFECTED = 0xF288
+AFX_IDP_SQL_RECORDSET_READONLY = 0xF289
+AFX_IDP_SQL_SQL_NO_TOTAL = 0xF28A
+AFX_IDP_SQL_ODBC_LOAD_FAILED = 0xF28B
+AFX_IDP_SQL_DYNASET_NOT_SUPPORTED = 0xF28C
+AFX_IDP_SQL_SNAPSHOT_NOT_SUPPORTED = 0xF28D
+AFX_IDP_SQL_API_CONFORMANCE = 0xF28E
+AFX_IDP_SQL_SQL_CONFORMANCE = 0xF28F
+AFX_IDP_SQL_NO_DATA_FOUND = 0xF290
+AFX_IDP_SQL_ROW_UPDATE_NOT_SUPPORTED = 0xF291
+AFX_IDP_SQL_ODBC_V2_REQUIRED = 0xF292
+AFX_IDP_SQL_NO_POSITIONED_UPDATES = 0xF293
+AFX_IDP_SQL_LOCK_MODE_NOT_SUPPORTED = 0xF294
+AFX_IDP_SQL_DATA_TRUNCATED = 0xF295
+AFX_IDP_SQL_ROW_FETCH = 0xF296
+AFX_IDP_SQL_INCORRECT_ODBC = 0xF297
+AFX_IDP_SQL_UPDATE_DELETE_FAILED = 0xF298
+AFX_IDP_SQL_DYNAMIC_CURSOR_NOT_SUPPORTED = 0xF299
+AFX_IDP_DAO_FIRST = 0xF2A0
+AFX_IDP_DAO_ENGINE_INITIALIZATION = 0xF2A0
+AFX_IDP_DAO_DFX_BIND = 0xF2A1
+AFX_IDP_DAO_OBJECT_NOT_OPEN = 0xF2A2
+AFX_IDP_DAO_ROWTOOSHORT = 0xF2A3
+AFX_IDP_DAO_BADBINDINFO = 0xF2A4
+AFX_IDP_DAO_COLUMNUNAVAILABLE = 0xF2A5
+AFX_IDC_LISTBOX = 100
+AFX_IDC_CHANGE = 101
+AFX_IDC_PRINT_DOCNAME = 201
+AFX_IDC_PRINT_PRINTERNAME = 202
+AFX_IDC_PRINT_PORTNAME = 203
+AFX_IDC_PRINT_PAGENUM = 204
+ID_APPLY_NOW = 0x3021
+ID_WIZBACK = 0x3023
+ID_WIZNEXT = 0x3024
+ID_WIZFINISH = 0x3025
+AFX_IDC_TAB_CONTROL = 0x3020
+AFX_IDD_FILEOPEN = 28676
+AFX_IDD_FILESAVE = 28677
+AFX_IDD_FONT = 28678
+AFX_IDD_COLOR = 28679
+AFX_IDD_PRINT = 28680
+AFX_IDD_PRINTSETUP = 28681
+AFX_IDD_FIND = 28682
+AFX_IDD_REPLACE = 28683
+AFX_IDD_NEWTYPEDLG = 30721
+AFX_IDD_PRINTDLG = 30722
+AFX_IDD_PREVIEW_TOOLBAR = 30723
+AFX_IDD_PREVIEW_SHORTTOOLBAR = 30731
+AFX_IDD_INSERTOBJECT = 30724
+AFX_IDD_CHANGEICON = 30725
+AFX_IDD_CONVERT = 30726
+AFX_IDD_PASTESPECIAL = 30727
+AFX_IDD_EDITLINKS = 30728
+AFX_IDD_FILEBROWSE = 30729
+AFX_IDD_BUSY = 30730
+AFX_IDD_OBJECTPROPERTIES = 30732
+AFX_IDD_CHANGESOURCE = 30733
+AFX_IDC_CONTEXTHELP = 30977
+AFX_IDC_MAGNIFY = 30978
+AFX_IDC_SMALLARROWS = 30979
+AFX_IDC_HSPLITBAR = 30980
+AFX_IDC_VSPLITBAR = 30981
+AFX_IDC_NODROPCRSR = 30982
+AFX_IDC_TRACKNWSE = 30983
+AFX_IDC_TRACKNESW = 30984
+AFX_IDC_TRACKNS = 30985
+AFX_IDC_TRACKWE = 30986
+AFX_IDC_TRACK4WAY = 30987
+AFX_IDC_MOVE4WAY = 30988
+AFX_IDB_MINIFRAME_MENU = 30994
+AFX_IDB_CHECKLISTBOX_NT = 30995
+AFX_IDB_CHECKLISTBOX_95 = 30996
+AFX_IDR_PREVIEW_ACCEL = 30997
+AFX_IDI_STD_MDIFRAME = 31233
+AFX_IDI_STD_FRAME = 31234
+AFX_IDC_FONTPROP = 1000
+AFX_IDC_FONTNAMES = 1001
+AFX_IDC_FONTSTYLES = 1002
+AFX_IDC_FONTSIZES = 1003
+AFX_IDC_STRIKEOUT = 1004
+AFX_IDC_UNDERLINE = 1005
+AFX_IDC_SAMPLEBOX = 1006
+AFX_IDC_COLOR_BLACK = 1100
+AFX_IDC_COLOR_WHITE = 1101
+AFX_IDC_COLOR_RED = 1102
+AFX_IDC_COLOR_GREEN = 1103
+AFX_IDC_COLOR_BLUE = 1104
+AFX_IDC_COLOR_YELLOW = 1105
+AFX_IDC_COLOR_MAGENTA = 1106
+AFX_IDC_COLOR_CYAN = 1107
+AFX_IDC_COLOR_GRAY = 1108
+AFX_IDC_COLOR_LIGHTGRAY = 1109
+AFX_IDC_COLOR_DARKRED = 1110
+AFX_IDC_COLOR_DARKGREEN = 1111
+AFX_IDC_COLOR_DARKBLUE = 1112
+AFX_IDC_COLOR_LIGHTBROWN = 1113
+AFX_IDC_COLOR_DARKMAGENTA = 1114
+AFX_IDC_COLOR_DARKCYAN = 1115
+AFX_IDC_COLORPROP = 1116
+AFX_IDC_SYSTEMCOLORS = 1117
+AFX_IDC_PROPNAME = 1201
+AFX_IDC_PICTURE = 1202
+AFX_IDC_BROWSE = 1203
+AFX_IDC_CLEAR = 1204
+AFX_IDD_PROPPAGE_COLOR = 32257
+AFX_IDD_PROPPAGE_FONT = 32258
+AFX_IDD_PROPPAGE_PICTURE = 32259
+AFX_IDB_TRUETYPE = 32384
+AFX_IDS_PROPPAGE_UNKNOWN = 0xFE01
+AFX_IDS_COLOR_DESKTOP = 0xFE04
+AFX_IDS_COLOR_APPWORKSPACE = 0xFE05
+AFX_IDS_COLOR_WNDBACKGND = 0xFE06
+AFX_IDS_COLOR_WNDTEXT = 0xFE07
+AFX_IDS_COLOR_MENUBAR = 0xFE08
+AFX_IDS_COLOR_MENUTEXT = 0xFE09
+AFX_IDS_COLOR_ACTIVEBAR = 0xFE0A
+AFX_IDS_COLOR_INACTIVEBAR = 0xFE0B
+AFX_IDS_COLOR_ACTIVETEXT = 0xFE0C
+AFX_IDS_COLOR_INACTIVETEXT = 0xFE0D
+AFX_IDS_COLOR_ACTIVEBORDER = 0xFE0E
+AFX_IDS_COLOR_INACTIVEBORDER = 0xFE0F
+AFX_IDS_COLOR_WNDFRAME = 0xFE10
+AFX_IDS_COLOR_SCROLLBARS = 0xFE11
+AFX_IDS_COLOR_BTNFACE = 0xFE12
+AFX_IDS_COLOR_BTNSHADOW = 0xFE13
+AFX_IDS_COLOR_BTNTEXT = 0xFE14
+AFX_IDS_COLOR_BTNHIGHLIGHT = 0xFE15
+AFX_IDS_COLOR_DISABLEDTEXT = 0xFE16
+AFX_IDS_COLOR_HIGHLIGHT = 0xFE17
+AFX_IDS_COLOR_HIGHLIGHTTEXT = 0xFE18
+AFX_IDS_REGULAR = 0xFE19
+AFX_IDS_BOLD = 0xFE1A
+AFX_IDS_ITALIC = 0xFE1B
+AFX_IDS_BOLDITALIC = 0xFE1C
+AFX_IDS_SAMPLETEXT = 0xFE1D
+AFX_IDS_DISPLAYSTRING_FONT = 0xFE1E
+AFX_IDS_DISPLAYSTRING_COLOR = 0xFE1F
+AFX_IDS_DISPLAYSTRING_PICTURE = 0xFE20
+AFX_IDS_PICTUREFILTER = 0xFE21
+AFX_IDS_PICTYPE_UNKNOWN = 0xFE22
+AFX_IDS_PICTYPE_NONE = 0xFE23
+AFX_IDS_PICTYPE_BITMAP = 0xFE24
+AFX_IDS_PICTYPE_METAFILE = 0xFE25
+AFX_IDS_PICTYPE_ICON = 0xFE26
+AFX_IDS_COLOR_PPG = 0xFE28
+AFX_IDS_COLOR_PPG_CAPTION = 0xFE29
+AFX_IDS_FONT_PPG = 0xFE2A
+AFX_IDS_FONT_PPG_CAPTION = 0xFE2B
+AFX_IDS_PICTURE_PPG = 0xFE2C
+AFX_IDS_PICTURE_PPG_CAPTION = 0xFE2D
+AFX_IDS_PICTUREBROWSETITLE = 0xFE30
+AFX_IDS_BORDERSTYLE_0 = 0xFE31
+AFX_IDS_BORDERSTYLE_1 = 0xFE32
+AFX_IDS_VERB_EDIT = 0xFE40
+AFX_IDS_VERB_PROPERTIES = 0xFE41
+AFX_IDP_PICTURECANTOPEN = 0xFE83
+AFX_IDP_PICTURECANTLOAD = 0xFE84
+AFX_IDP_PICTURETOOLARGE = 0xFE85
+AFX_IDP_PICTUREREADFAILED = 0xFE86
+AFX_IDP_E_ILLEGALFUNCTIONCALL = 0xFEA0
+AFX_IDP_E_OVERFLOW = 0xFEA1
+AFX_IDP_E_OUTOFMEMORY = 0xFEA2
+AFX_IDP_E_DIVISIONBYZERO = 0xFEA3
+AFX_IDP_E_OUTOFSTRINGSPACE = 0xFEA4
+AFX_IDP_E_OUTOFSTACKSPACE = 0xFEA5
+AFX_IDP_E_BADFILENAMEORNUMBER = 0xFEA6
+AFX_IDP_E_FILENOTFOUND = 0xFEA7
+AFX_IDP_E_BADFILEMODE = 0xFEA8
+AFX_IDP_E_FILEALREADYOPEN = 0xFEA9
+AFX_IDP_E_DEVICEIOERROR = 0xFEAA
+AFX_IDP_E_FILEALREADYEXISTS = 0xFEAB
+AFX_IDP_E_BADRECORDLENGTH = 0xFEAC
+AFX_IDP_E_DISKFULL = 0xFEAD
+AFX_IDP_E_BADRECORDNUMBER = 0xFEAE
+AFX_IDP_E_BADFILENAME = 0xFEAF
+AFX_IDP_E_TOOMANYFILES = 0xFEB0
+AFX_IDP_E_DEVICEUNAVAILABLE = 0xFEB1
+AFX_IDP_E_PERMISSIONDENIED = 0xFEB2
+AFX_IDP_E_DISKNOTREADY = 0xFEB3
+AFX_IDP_E_PATHFILEACCESSERROR = 0xFEB4
+AFX_IDP_E_PATHNOTFOUND = 0xFEB5
+AFX_IDP_E_INVALIDPATTERNSTRING = 0xFEB6
+AFX_IDP_E_INVALIDUSEOFNULL = 0xFEB7
+AFX_IDP_E_INVALIDFILEFORMAT = 0xFEB8
+AFX_IDP_E_INVALIDPROPERTYVALUE = 0xFEB9
+AFX_IDP_E_INVALIDPROPERTYARRAYINDEX = 0xFEBA
+AFX_IDP_E_SETNOTSUPPORTEDATRUNTIME = 0xFEBB
+AFX_IDP_E_SETNOTSUPPORTED = 0xFEBC
+AFX_IDP_E_NEEDPROPERTYARRAYINDEX = 0xFEBD
+AFX_IDP_E_SETNOTPERMITTED = 0xFEBE
+AFX_IDP_E_GETNOTSUPPORTEDATRUNTIME = 0xFEBF
+AFX_IDP_E_GETNOTSUPPORTED = 0xFEC0
+AFX_IDP_E_PROPERTYNOTFOUND = 0xFEC1
+AFX_IDP_E_INVALIDCLIPBOARDFORMAT = 0xFEC2
+AFX_IDP_E_INVALIDPICTURE = 0xFEC3
+AFX_IDP_E_PRINTERERROR = 0xFEC4
+AFX_IDP_E_CANTSAVEFILETOTEMP = 0xFEC5
+AFX_IDP_E_SEARCHTEXTNOTFOUND = 0xFEC6
+AFX_IDP_E_REPLACEMENTSTOOLONG = 0xFEC7

.venv/Lib/site-packages/pythonwin/pywin/mfc/dialog.py

@@ -0,0 +1,278 @@
+""" \
+Base class for Dialogs.  Also contains a few useful utility functions
+"""
+# dialog.py
+# Python class for Dialog Boxes in PythonWin.
+
+import win32ui
+import win32con
+
+# sob - 2to3 doesn't see this as a relative import :(
+from pywin.mfc import window
+
+
+def dllFromDll(dllid):
+    "given a 'dll' (maybe a dll, filename, etc), return a DLL object"
+    if dllid == None:
+        return None
+    elif type("") == type(dllid):
+        return win32ui.LoadLibrary(dllid)
+    else:
+        try:
+            dllid.GetFileName()
+        except AttributeError:
+            raise TypeError("DLL parameter must be None, a filename or a dll object")
+        return dllid
+
+
+class Dialog(window.Wnd):
+    "Base class for a dialog"
+
+    def __init__(self, id, dllid=None):
+        """id is the resource ID, or a template
+        dllid may be None, a dll object, or a string with a dll name"""
+        # must take a reference to the DLL until InitDialog.
+        self.dll = dllFromDll(dllid)
+        if type(id) == type([]):  # a template
+            dlg = win32ui.CreateDialogIndirect(id)
+        else:
+            dlg = win32ui.CreateDialog(id, self.dll)
+        window.Wnd.__init__(self, dlg)
+        self.HookCommands()
+        self.bHaveInit = None
+
+    def HookCommands(self):
+        pass
+
+    def OnAttachedObjectDeath(self):
+        self.data = self._obj_.data
+        window.Wnd.OnAttachedObjectDeath(self)
+
+    # provide virtuals.
+    def OnOK(self):
+        self._obj_.OnOK()
+
+    def OnCancel(self):
+        self._obj_.OnCancel()
+
+    def OnInitDialog(self):
+        self.bHaveInit = 1
+        if self._obj_.data:
+            self._obj_.UpdateData(0)
+        return 1  # I did NOT set focus to a child window.
+
+    def OnDestroy(self, msg):
+        self.dll = None  # theoretically not needed if object destructs normally.
+
+    # DDX support
+    def AddDDX(self, *args):
+        self._obj_.datalist.append(args)
+
+    # Make a dialog object look like a dictionary for the DDX support
+    def __bool__(self):
+        return True
+
+    def __len__(self):
+        return len(self.data)
+
+    def __getitem__(self, key):
+        return self.data[key]
+
+    def __setitem__(self, key, item):
+        self._obj_.data[key] = item  # self.UpdateData(0)
+
+    def keys(self):
+        return list(self.data.keys())
+
+    def items(self):
+        return list(self.data.items())
+
+    def values(self):
+        return list(self.data.values())
+
+    # XXX - needs py3k work!
+    def has_key(self, key):
+        return key in self.data
+
+
+class PrintDialog(Dialog):
+    "Base class for a print dialog"
+
+    def __init__(
+        self,
+        pInfo,
+        dlgID,
+        printSetupOnly=0,
+        flags=(
+            win32ui.PD_ALLPAGES
+            | win32ui.PD_USEDEVMODECOPIES
+            | win32ui.PD_NOPAGENUMS
+            | win32ui.PD_HIDEPRINTTOFILE
+            | win32ui.PD_NOSELECTION
+        ),
+        parent=None,
+        dllid=None,
+    ):
+        self.dll = dllFromDll(dllid)
+        if type(dlgID) == type([]):  # a template
+            raise TypeError("dlgID parameter must be an integer resource ID")
+        dlg = win32ui.CreatePrintDialog(dlgID, printSetupOnly, flags, parent, self.dll)
+        window.Wnd.__init__(self, dlg)
+        self.HookCommands()
+        self.bHaveInit = None
+        self.pInfo = pInfo
+        # init values (if PrintSetup is called, values still available)
+        flags = pInfo.GetFlags()
+        self["toFile"] = flags & win32ui.PD_PRINTTOFILE != 0
+        self["direct"] = pInfo.GetDirect()
+        self["preview"] = pInfo.GetPreview()
+        self["continuePrinting"] = pInfo.GetContinuePrinting()
+        self["curPage"] = pInfo.GetCurPage()
+        self["numPreviewPages"] = pInfo.GetNumPreviewPages()
+        self["userData"] = pInfo.GetUserData()
+        self["draw"] = pInfo.GetDraw()
+        self["pageDesc"] = pInfo.GetPageDesc()
+        self["minPage"] = pInfo.GetMinPage()
+        self["maxPage"] = pInfo.GetMaxPage()
+        self["offsetPage"] = pInfo.GetOffsetPage()
+        self["fromPage"] = pInfo.GetFromPage()
+        self["toPage"] = pInfo.GetToPage()
+        # these values updated after OnOK
+        self["copies"] = 0
+        self["deviceName"] = ""
+        self["driverName"] = ""
+        self["printAll"] = 0
+        self["printCollate"] = 0
+        self["printRange"] = 0
+        self["printSelection"] = 0
+
+    def OnInitDialog(self):
+        self.pInfo.CreatePrinterDC()  # This also sets the hDC of the pInfo structure.
+        return self._obj_.OnInitDialog()
+
+    def OnCancel(self):
+        del self.pInfo
+
+    def OnOK(self):
+        """DoModal has finished. Can now access the users choices"""
+        self._obj_.OnOK()
+        pInfo = self.pInfo
+        # user values
+        flags = pInfo.GetFlags()
+        self["toFile"] = flags & win32ui.PD_PRINTTOFILE != 0
+        self["direct"] = pInfo.GetDirect()
+        self["preview"] = pInfo.GetPreview()
+        self["continuePrinting"] = pInfo.GetContinuePrinting()
+        self["curPage"] = pInfo.GetCurPage()
+        self["numPreviewPages"] = pInfo.GetNumPreviewPages()
+        self["userData"] = pInfo.GetUserData()
+        self["draw"] = pInfo.GetDraw()
+        self["pageDesc"] = pInfo.GetPageDesc()
+        self["minPage"] = pInfo.GetMinPage()
+        self["maxPage"] = pInfo.GetMaxPage()
+        self["offsetPage"] = pInfo.GetOffsetPage()
+        self["fromPage"] = pInfo.GetFromPage()
+        self["toPage"] = pInfo.GetToPage()
+        self["copies"] = pInfo.GetCopies()
+        self["deviceName"] = pInfo.GetDeviceName()
+        self["driverName"] = pInfo.GetDriverName()
+        self["printAll"] = pInfo.PrintAll()
+        self["printCollate"] = pInfo.PrintCollate()
+        self["printRange"] = pInfo.PrintRange()
+        self["printSelection"] = pInfo.PrintSelection()
+        del self.pInfo
+
+
+class PropertyPage(Dialog):
+    "Base class for a Property Page"
+
+    def __init__(self, id, dllid=None, caption=0):
+        """id is the resource ID
+        dllid may be None, a dll object, or a string with a dll name"""
+
+        self.dll = dllFromDll(dllid)
+        if self.dll:
+            oldRes = win32ui.SetResource(self.dll)
+        if type(id) == type([]):
+            dlg = win32ui.CreatePropertyPageIndirect(id)
+        else:
+            dlg = win32ui.CreatePropertyPage(id, caption)
+        if self.dll:
+            win32ui.SetResource(oldRes)
+        # dont call dialog init!
+        window.Wnd.__init__(self, dlg)
+        self.HookCommands()
+
+
+class PropertySheet(window.Wnd):
+    def __init__(self, caption, dll=None, pageList=None):  # parent=None, style,etc):
+        "Initialize a property sheet.  pageList is a list of ID's"
+        # must take a reference to the DLL until InitDialog.
+        self.dll = dllFromDll(dll)
+        self.sheet = win32ui.CreatePropertySheet(caption)
+        window.Wnd.__init__(self, self.sheet)
+        if not pageList is None:
+            self.AddPage(pageList)
+
+    def OnInitDialog(self):
+        return self._obj_.OnInitDialog()
+
+    def DoModal(self):
+        if self.dll:
+            oldRes = win32ui.SetResource(self.dll)
+        rc = self.sheet.DoModal()
+        if self.dll:
+            win32ui.SetResource(oldRes)
+        return rc
+
+    def AddPage(self, pages):
+        if self.dll:
+            oldRes = win32ui.SetResource(self.dll)
+        try:  # try list style access
+            pages[0]
+            isSeq = 1
+        except (TypeError, KeyError):
+            isSeq = 0
+        if isSeq:
+            for page in pages:
+                self.DoAddSinglePage(page)
+        else:
+            self.DoAddSinglePage(pages)
+        if self.dll:
+            win32ui.SetResource(oldRes)
+
+    def DoAddSinglePage(self, page):
+        "Page may be page, or int ID. Assumes DLL setup"
+        if type(page) == type(0):
+            self.sheet.AddPage(win32ui.CreatePropertyPage(page))
+        else:
+            self.sheet.AddPage(page)
+
+
+# define some app utility functions.
+def GetSimpleInput(prompt, defValue="", title=None):
+    """displays a dialog, and returns a string, or None if cancelled.
+    args prompt, defValue='', title=main frames title"""
+    # uses a simple dialog to return a string object.
+    if title is None:
+        title = win32ui.GetMainFrame().GetWindowText()
+    # 2to3 insists on converting 'Dialog.__init__' to 'tkinter.dialog...'
+    DlgBaseClass = Dialog
+
+    class DlgSimpleInput(DlgBaseClass):
+        def __init__(self, prompt, defValue, title):
+            self.title = title
+            DlgBaseClass.__init__(self, win32ui.IDD_SIMPLE_INPUT)
+            self.AddDDX(win32ui.IDC_EDIT1, "result")
+            self.AddDDX(win32ui.IDC_PROMPT1, "prompt")
+            self._obj_.data["result"] = defValue
+            self._obj_.data["prompt"] = prompt
+
+        def OnInitDialog(self):
+            self.SetWindowText(self.title)
+            return DlgBaseClass.OnInitDialog(self)
+
+    dlg = DlgSimpleInput(prompt, defValue, title)
+    if dlg.DoModal() != win32con.IDOK:
+        return None
+    return dlg["result"]

.venv/Lib/site-packages/pythonwin/pywin/mfc/docview.py

@@ -0,0 +1,152 @@
+# document and view classes for MFC.
+import win32ui
+import win32con
+from . import object
+from . import window
+
+
+class View(window.Wnd):
+    def __init__(self, initobj):
+        window.Wnd.__init__(self, initobj)
+
+    def OnInitialUpdate(self):
+        pass
+
+
+# Simple control based views.
+class CtrlView(View):
+    def __init__(self, doc, wndclass, style=0):
+        View.__init__(self, win32ui.CreateCtrlView(doc, wndclass, style))
+
+
+class EditView(CtrlView):
+    def __init__(self, doc):
+        View.__init__(self, win32ui.CreateEditView(doc))
+
+
+class RichEditView(CtrlView):
+    def __init__(self, doc):
+        View.__init__(self, win32ui.CreateRichEditView(doc))
+
+
+class ListView(CtrlView):
+    def __init__(self, doc):
+        View.__init__(self, win32ui.CreateListView(doc))
+
+
+class TreeView(CtrlView):
+    def __init__(self, doc):
+        View.__init__(self, win32ui.CreateTreeView(doc))
+
+
+# Other more advanced views.
+class ScrollView(View):
+    def __init__(self, doc):
+        View.__init__(self, win32ui.CreateView(doc))
+
+
+class FormView(View):
+    def __init__(self, doc, id):
+        View.__init__(self, win32ui.CreateFormView(doc, id))
+
+
+class Document(object.CmdTarget):
+    def __init__(self, template, docobj=None):
+        if docobj is None:
+            docobj = template.DoCreateDoc()
+        object.CmdTarget.__init__(self, docobj)
+
+
+class RichEditDoc(object.CmdTarget):
+    def __init__(self, template):
+        object.CmdTarget.__init__(self, template.DoCreateRichEditDoc())
+
+
+class CreateContext:
+    "A transient base class used as a CreateContext"
+
+    def __init__(self, template, doc=None):
+        self.template = template
+        self.doc = doc
+
+    def __del__(self):
+        self.close()
+
+    def close(self):
+        self.doc = None
+        self.template = None
+
+
+class DocTemplate(object.CmdTarget):
+    def __init__(
+        self, resourceId=None, MakeDocument=None, MakeFrame=None, MakeView=None
+    ):
+        if resourceId is None:
+            resourceId = win32ui.IDR_PYTHONTYPE
+        object.CmdTarget.__init__(self, self._CreateDocTemplate(resourceId))
+        self.MakeDocument = MakeDocument
+        self.MakeFrame = MakeFrame
+        self.MakeView = MakeView
+        self._SetupSharedMenu_()
+
+    def _SetupSharedMenu_(self):
+        pass  # to be overridden by each "app"
+
+    def _CreateDocTemplate(self, resourceId):
+        return win32ui.CreateDocTemplate(resourceId)
+
+    def __del__(self):
+        object.CmdTarget.__del__(self)
+
+    def CreateCreateContext(self, doc=None):
+        return CreateContext(self, doc)
+
+    def CreateNewFrame(self, doc):
+        makeFrame = self.MakeFrame
+        if makeFrame is None:
+            makeFrame = window.MDIChildWnd
+        wnd = makeFrame()
+        context = self.CreateCreateContext(doc)
+        wnd.LoadFrame(
+            self.GetResourceID(), -1, None, context
+        )  # triggers OnCreateClient...
+        return wnd
+
+    def CreateNewDocument(self):
+        makeDocument = self.MakeDocument
+        if makeDocument is None:
+            makeDocument = Document
+        return makeDocument(self)
+
+    def CreateView(self, frame, context):
+        makeView = self.MakeView
+        if makeView is None:
+            makeView = EditView
+        view = makeView(context.doc)
+        view.CreateWindow(frame)
+
+
+class RichEditDocTemplate(DocTemplate):
+    def __init__(
+        self, resourceId=None, MakeDocument=None, MakeFrame=None, MakeView=None
+    ):
+        if MakeView is None:
+            MakeView = RichEditView
+        if MakeDocument is None:
+            MakeDocument = RichEditDoc
+        DocTemplate.__init__(self, resourceId, MakeDocument, MakeFrame, MakeView)
+
+    def _CreateDocTemplate(self, resourceId):
+        return win32ui.CreateRichEditDocTemplate(resourceId)
+
+
+def t():
+    class FormTemplate(DocTemplate):
+        def CreateView(self, frame, context):
+            makeView = self.MakeView
+            # 			view = FormView(context.doc, win32ui.IDD_PROPDEMO1)
+            view = ListView(context.doc)
+            view.CreateWindow(frame)
+
+    t = FormTemplate()
+    return t.OpenDocumentFile(None)

.venv/Lib/site-packages/pythonwin/pywin/mfc/object.py

@@ -0,0 +1,66 @@
+# MFC base classes.
+import sys
+import win32ui
+
+
+class Object:
+    def __init__(self, initObj=None):
+        self.__dict__["_obj_"] = initObj
+        # 		self._obj_ = initObj
+        if initObj is not None:
+            initObj.AttachObject(self)
+
+    def __del__(self):
+        self.close()
+
+    def __getattr__(
+        self, attr
+    ):  # Make this object look like the underlying win32ui one.
+        # During cleanup __dict__ is not available, causing recursive death.
+        if not attr.startswith("__"):
+            try:
+                o = self.__dict__["_obj_"]
+                if o is not None:
+                    return getattr(o, attr)
+                # Only raise this error for non "internal" names -
+                # Python may be calling __len__, __nonzero__, etc, so
+                # we dont want this exception
+                if attr[0] != "_" and attr[-1] != "_":
+                    raise win32ui.error("The MFC object has died.")
+            except KeyError:
+                # No _obj_ at all - dont report MFC object died when there isnt one!
+                pass
+        raise AttributeError(attr)
+
+    def OnAttachedObjectDeath(self):
+        # 		print "object", self.__class__.__name__, "dieing"
+        self._obj_ = None
+
+    def close(self):
+        if "_obj_" in self.__dict__:
+            if self._obj_ is not None:
+                self._obj_.AttachObject(None)
+                self._obj_ = None
+
+
+class CmdTarget(Object):
+    def __init__(self, initObj):
+        Object.__init__(self, initObj)
+
+    def HookNotifyRange(self, handler, firstID, lastID):
+        oldhandlers = []
+        for i in range(firstID, lastID + 1):
+            oldhandlers.append(self.HookNotify(handler, i))
+        return oldhandlers
+
+    def HookCommandRange(self, handler, firstID, lastID):
+        oldhandlers = []
+        for i in range(firstID, lastID + 1):
+            oldhandlers.append(self.HookCommand(handler, i))
+        return oldhandlers
+
+    def HookCommandUpdateRange(self, handler, firstID, lastID):
+        oldhandlers = []
+        for i in range(firstID, lastID + 1):
+            oldhandlers.append(self.HookCommandUpdate(handler, i))
+        return oldhandlers

.venv/Lib/site-packages/pythonwin/pywin/mfc/thread.py

@@ -0,0 +1,24 @@
+# Thread and application objects
+
+from . import object
+import win32ui
+
+
+class WinThread(object.CmdTarget):
+    def __init__(self, initObj=None):
+        if initObj is None:
+            initObj = win32ui.CreateThread()
+        object.CmdTarget.__init__(self, initObj)
+
+    def InitInstance(self):
+        pass  # Default None/0 return indicates success for InitInstance()
+
+    def ExitInstance(self):
+        pass
+
+
+class WinApp(WinThread):
+    def __init__(self, initApp=None):
+        if initApp is None:
+            initApp = win32ui.GetApp()
+        WinThread.__init__(self, initApp)

.venv/Lib/site-packages/pythonwin/pywin/mfc/window.py

@@ -0,0 +1,49 @@
+# The MFCish window classes.
+from . import object
+import win32ui
+import win32con
+
+
+class Wnd(object.CmdTarget):
+    def __init__(self, initobj=None):
+        object.CmdTarget.__init__(self, initobj)
+        if self._obj_:
+            self._obj_.HookMessage(self.OnDestroy, win32con.WM_DESTROY)
+
+    def OnDestroy(self, msg):
+        pass
+
+
+# NOTE NOTE - This facility is currently disabled in Pythonwin!!!!!
+# Note - to process all messages for your window, add the following method
+# to a derived class.  This code provides default message handling (ie, is
+# identical, except presumably in speed, as if the method did not exist at
+# all, so presumably will be modified to test for specific messages to be
+# useful!
+# 	def WindowProc(self, msg, wParam, lParam):
+# 		rc, lResult = self._obj_.OnWndMsg(msg, wParam, lParam)
+# 		if not rc: lResult = self._obj_.DefWindowProc(msg, wParam, lParam)
+# 		return lResult
+
+
+class FrameWnd(Wnd):
+    def __init__(self, wnd):
+        Wnd.__init__(self, wnd)
+
+
+class MDIChildWnd(FrameWnd):
+    def __init__(self, wnd=None):
+        if wnd is None:
+            wnd = win32ui.CreateMDIChild()
+        FrameWnd.__init__(self, wnd)
+
+    def OnCreateClient(self, cp, context):
+        if context is not None and context.template is not None:
+            context.template.CreateView(self, context)
+
+
+class MDIFrameWnd(FrameWnd):
+    def __init__(self, wnd=None):
+        if wnd is None:
+            wnd = win32ui.CreateMDIFrame()
+        FrameWnd.__init__(self, wnd)

.venv/Lib/site-packages/pythonwin/pywin/scintilla/IDLEenvironment.py

@@ -0,0 +1,596 @@
+# Code that allows Pythonwin to pretend it is IDLE
+# (at least as far as most IDLE extensions are concerned)
+
+import string
+import win32api
+import win32ui
+import win32con
+import sys
+
+from pywin.mfc.dialog import GetSimpleInput
+from pywin import default_scintilla_encoding
+
+wordchars = string.ascii_uppercase + string.ascii_lowercase + string.digits
+
+
+class TextError(Exception):  # When a TclError would normally be raised.
+    pass
+
+
+class EmptyRange(Exception):  # Internally raised.
+    pass
+
+
+def GetIDLEModule(module):
+    try:
+        # First get it from Pythonwin it is exists.
+        modname = "pywin.idle." + module
+        __import__(modname)
+    except ImportError as details:
+        msg = (
+            "The IDLE extension '%s' can not be located.\r\n\r\n"
+            "Please correct the installation and restart the"
+            " application.\r\n\r\n%s" % (module, details)
+        )
+        win32ui.MessageBox(msg)
+        return None
+    mod = sys.modules[modname]
+    mod.TclError = TextError  # A hack that can go soon!
+    return mod
+
+
+# A class that is injected into the IDLE auto-indent extension.
+# It allows for decent performance when opening a new file,
+# as auto-indent uses the tokenizer module to determine indents.
+# The default AutoIndent readline method works OK, but it goes through
+# this layer of Tk index indirection for every single line.  For large files
+# without indents (and even small files with indents :-) it was pretty slow!
+def fast_readline(self):
+    if self.finished:
+        val = ""
+    else:
+        if "_scint_lines" not in self.__dict__:
+            # XXX - note - assumes this is only called once the file is loaded!
+            self._scint_lines = self.text.edit.GetTextRange().split("\n")
+        sl = self._scint_lines
+        i = self.i = self.i + 1
+        if i >= len(sl):
+            val = ""
+        else:
+            val = sl[i] + "\n"
+    return val.encode(default_scintilla_encoding)
+
+
+try:
+    GetIDLEModule("AutoIndent").IndentSearcher.readline = fast_readline
+except AttributeError:  # GetIDLEModule may return None
+    pass
+
+# A class that attempts to emulate an IDLE editor window.
+# Construct with a Pythonwin view.
+class IDLEEditorWindow:
+    def __init__(self, edit):
+        self.edit = edit
+        self.text = TkText(edit)
+        self.extensions = {}
+        self.extension_menus = {}
+
+    def close(self):
+        self.edit = self.text = None
+        self.extension_menus = None
+        try:
+            for ext in self.extensions.values():
+                closer = getattr(ext, "close", None)
+                if closer is not None:
+                    closer()
+        finally:
+            self.extensions = {}
+
+    def IDLEExtension(self, extension):
+        ext = self.extensions.get(extension)
+        if ext is not None:
+            return ext
+        mod = GetIDLEModule(extension)
+        if mod is None:
+            return None
+        klass = getattr(mod, extension)
+        ext = self.extensions[extension] = klass(self)
+        # Find and bind all the events defined in the extension.
+        events = [item for item in dir(klass) if item[-6:] == "_event"]
+        for event in events:
+            name = "<<%s>>" % (event[:-6].replace("_", "-"),)
+            self.edit.bindings.bind(name, getattr(ext, event))
+        return ext
+
+    def GetMenuItems(self, menu_name):
+        # Get all menu items for the menu name (eg, "edit")
+        bindings = self.edit.bindings
+        ret = []
+        for ext in self.extensions.values():
+            menudefs = getattr(ext, "menudefs", [])
+            for name, items in menudefs:
+                if name == menu_name:
+                    for text, event in [item for item in items if item is not None]:
+                        text = text.replace("&", "&&")
+                        text = text.replace("_", "&")
+                        ret.append((text, event))
+        return ret
+
+    ######################################################################
+    # The IDLE "Virtual UI" methods that are exposed to the IDLE extensions.
+    #
+    def askinteger(
+        self, caption, prompt, parent=None, initialvalue=0, minvalue=None, maxvalue=None
+    ):
+        while 1:
+            rc = GetSimpleInput(prompt, str(initialvalue), caption)
+            if rc is None:
+                return 0  # Correct "cancel" semantics?
+            err = None
+            try:
+                rc = int(rc)
+            except ValueError:
+                err = "Please enter an integer"
+            if not err and minvalue is not None and rc < minvalue:
+                err = "Please enter an integer greater then or equal to %s" % (
+                    minvalue,
+                )
+            if not err and maxvalue is not None and rc > maxvalue:
+                err = "Please enter an integer less then or equal to %s" % (maxvalue,)
+            if err:
+                win32ui.MessageBox(err, caption, win32con.MB_OK)
+                continue
+            return rc
+
+    def askyesno(self, caption, prompt, parent=None):
+        return win32ui.MessageBox(prompt, caption, win32con.MB_YESNO) == win32con.IDYES
+
+    ######################################################################
+    # The IDLE "Virtual Text Widget" methods that are exposed to the IDLE extensions.
+    #
+
+    # Is character at text_index in a Python string?  Return 0 for
+    # "guaranteed no", true for anything else.
+    def is_char_in_string(self, text_index):
+        # A helper for the code analyser - we need internal knowledge of
+        # the colorizer to get this information
+        # This assumes the colorizer has got to this point!
+        text_index = self.text._getoffset(text_index)
+        c = self.text.edit._GetColorizer()
+        if c and c.GetStringStyle(text_index) is None:
+            return 0
+        return 1
+
+    # If a selection is defined in the text widget, return
+    # (start, end) as Tkinter text indices, otherwise return
+    # (None, None)
+    def get_selection_indices(self):
+        try:
+            first = self.text.index("sel.first")
+            last = self.text.index("sel.last")
+            return first, last
+        except TextError:
+            return None, None
+
+    def set_tabwidth(self, width):
+        self.edit.SCISetTabWidth(width)
+
+    def get_tabwidth(self):
+        return self.edit.GetTabWidth()
+
+
+# A class providing the generic "Call Tips" interface
+class CallTips:
+    def __init__(self, edit):
+        self.edit = edit
+
+    def showtip(self, tip_text):
+        self.edit.SCICallTipShow(tip_text)
+
+    def hidetip(self):
+        self.edit.SCICallTipCancel()
+
+
+########################################
+#
+# Helpers for the TkText emulation.
+def TkOffsetToIndex(offset, edit):
+    lineoff = 0
+    # May be 1 > actual end if we pretended there was a trailing '\n'
+    offset = min(offset, edit.GetTextLength())
+    line = edit.LineFromChar(offset)
+    lineIndex = edit.LineIndex(line)
+    return "%d.%d" % (line + 1, offset - lineIndex)
+
+
+def _NextTok(str, pos):
+    # Returns (token, endPos)
+    end = len(str)
+    if pos >= end:
+        return None, 0
+    while pos < end and str[pos] in string.whitespace:
+        pos = pos + 1
+    # Special case for +-
+    if str[pos] in "+-":
+        return str[pos], pos + 1
+    # Digits also a special case.
+    endPos = pos
+    while endPos < end and str[endPos] in string.digits + ".":
+        endPos = endPos + 1
+    if pos != endPos:
+        return str[pos:endPos], endPos
+    endPos = pos
+    while endPos < end and str[endPos] not in string.whitespace + string.digits + "+-":
+        endPos = endPos + 1
+    if pos != endPos:
+        return str[pos:endPos], endPos
+    return None, 0
+
+
+def TkIndexToOffset(bm, edit, marks):
+    base, nextTokPos = _NextTok(bm, 0)
+    if base is None:
+        raise ValueError("Empty bookmark ID!")
+    if base.find(".") > 0:
+        try:
+            line, col = base.split(".", 2)
+            if col == "first" or col == "last":
+                # Tag name
+                if line != "sel":
+                    raise ValueError("Tags arent here!")
+                sel = edit.GetSel()
+                if sel[0] == sel[1]:
+                    raise EmptyRange
+                if col == "first":
+                    pos = sel[0]
+                else:
+                    pos = sel[1]
+            else:
+                # Lines are 1 based for tkinter
+                line = int(line) - 1
+                if line > edit.GetLineCount():
+                    pos = edit.GetTextLength() + 1
+                else:
+                    pos = edit.LineIndex(line)
+                    if pos == -1:
+                        pos = edit.GetTextLength()
+                    pos = pos + int(col)
+        except (ValueError, IndexError):
+            raise ValueError("Unexpected literal in '%s'" % base)
+    elif base == "insert":
+        pos = edit.GetSel()[0]
+    elif base == "end":
+        pos = edit.GetTextLength()
+        # Pretend there is a trailing '\n' if necessary
+        if pos and edit.SCIGetCharAt(pos - 1) != "\n":
+            pos = pos + 1
+    else:
+        try:
+            pos = marks[base]
+        except KeyError:
+            raise ValueError("Unsupported base offset or undefined mark '%s'" % base)
+
+    while 1:
+        word, nextTokPos = _NextTok(bm, nextTokPos)
+        if word is None:
+            break
+        if word in ["+", "-"]:
+            num, nextTokPos = _NextTok(bm, nextTokPos)
+            if num is None:
+                raise ValueError("+/- operator needs 2 args")
+            what, nextTokPos = _NextTok(bm, nextTokPos)
+            if what is None:
+                raise ValueError("+/- operator needs 2 args")
+            if what[0] != "c":
+                raise ValueError("+/- only supports chars")
+            if word == "+":
+                pos = pos + int(num)
+            else:
+                pos = pos - int(num)
+        elif word == "wordstart":
+            while pos > 0 and edit.SCIGetCharAt(pos - 1) in wordchars:
+                pos = pos - 1
+        elif word == "wordend":
+            end = edit.GetTextLength()
+            while pos < end and edit.SCIGetCharAt(pos) in wordchars:
+                pos = pos + 1
+        elif word == "linestart":
+            while pos > 0 and edit.SCIGetCharAt(pos - 1) not in "\n\r":
+                pos = pos - 1
+        elif word == "lineend":
+            end = edit.GetTextLength()
+            while pos < end and edit.SCIGetCharAt(pos) not in "\n\r":
+                pos = pos + 1
+        else:
+            raise ValueError("Unsupported relative offset '%s'" % word)
+    return max(pos, 0)  # Tkinter is tollerant of -ve indexes - we aren't
+
+
+# A class that resembles an IDLE (ie, a Tk) text widget.
+# Construct with an edit object (eg, an editor view)
+class TkText:
+    def __init__(self, edit):
+        self.calltips = None
+        self.edit = edit
+        self.marks = {}
+
+    ##	def __getattr__(self, attr):
+    ##		if attr=="tk": return self # So text.tk.call works.
+    ##		if attr=="master": return None # ditto!
+    ##		raise AttributeError, attr
+    ##	def __getitem__(self, item):
+    ##		if item=="tabs":
+    ##			size = self.edit.GetTabWidth()
+    ##			if size==8: return "" # Tk default
+    ##			return size # correct semantics?
+    ##		elif item=="font": # Used for measurements we dont need to do!
+    ##			return "Dont know the font"
+    ##		raise IndexError, "Invalid index '%s'" % item
+    def make_calltip_window(self):
+        if self.calltips is None:
+            self.calltips = CallTips(self.edit)
+        return self.calltips
+
+    def _getoffset(self, index):
+        return TkIndexToOffset(index, self.edit, self.marks)
+
+    def _getindex(self, off):
+        return TkOffsetToIndex(off, self.edit)
+
+    def _fix_indexes(self, start, end):
+        # first some magic to handle skipping over utf8 extended chars.
+        while start > 0 and ord(self.edit.SCIGetCharAt(start)) & 0xC0 == 0x80:
+            start -= 1
+        while (
+            end < self.edit.GetTextLength()
+            and ord(self.edit.SCIGetCharAt(end)) & 0xC0 == 0x80
+        ):
+            end += 1
+        # now handling fixing \r\n->\n disparities...
+        if (
+            start > 0
+            and self.edit.SCIGetCharAt(start) == "\n"
+            and self.edit.SCIGetCharAt(start - 1) == "\r"
+        ):
+            start = start - 1
+        if (
+            end < self.edit.GetTextLength()
+            and self.edit.SCIGetCharAt(end - 1) == "\r"
+            and self.edit.SCIGetCharAt(end) == "\n"
+        ):
+            end = end + 1
+        return start, end
+
+    ##	def get_tab_width(self):
+    ##		return self.edit.GetTabWidth()
+    ##	def call(self, *rest):
+    ##		# Crap to support Tk measurement hacks for tab widths
+    ##		if rest[0] != "font" or rest[1] != "measure":
+    ##			raise ValueError, "Unsupport call type"
+    ##		return len(rest[5])
+    ##	def configure(self, **kw):
+    ##		for name, val in kw.items():
+    ##			if name=="tabs":
+    ##				self.edit.SCISetTabWidth(int(val))
+    ##			else:
+    ##				raise ValueError, "Unsupported configuration item %s" % kw
+    def bind(self, binding, handler):
+        self.edit.bindings.bind(binding, handler)
+
+    def get(self, start, end=None):
+        try:
+            start = self._getoffset(start)
+            if end is None:
+                end = start + 1
+            else:
+                end = self._getoffset(end)
+        except EmptyRange:
+            return ""
+        # Simple semantic checks to conform to the Tk text interface
+        if end <= start:
+            return ""
+        max = self.edit.GetTextLength()
+        checkEnd = 0
+        if end > max:
+            end = max
+            checkEnd = 1
+        start, end = self._fix_indexes(start, end)
+        ret = self.edit.GetTextRange(start, end)
+        # pretend a trailing '\n' exists if necessary.
+        if checkEnd and (not ret or ret[-1] != "\n"):
+            ret = ret + "\n"
+        return ret.replace("\r", "")
+
+    def index(self, spec):
+        try:
+            return self._getindex(self._getoffset(spec))
+        except EmptyRange:
+            return ""
+
+    def insert(self, pos, text):
+        try:
+            pos = self._getoffset(pos)
+        except EmptyRange:
+            raise TextError("Empty range")
+        self.edit.SetSel((pos, pos))
+        # IDLE only deals with "\n" - we will be nicer
+
+        bits = text.split("\n")
+        self.edit.SCIAddText(bits[0])
+        for bit in bits[1:]:
+            self.edit.SCINewline()
+            self.edit.SCIAddText(bit)
+
+    def delete(self, start, end=None):
+        try:
+            start = self._getoffset(start)
+            if end is not None:
+                end = self._getoffset(end)
+        except EmptyRange:
+            raise TextError("Empty range")
+        # If end is specified and == start, then we must delete nothing.
+        if start == end:
+            return
+        # If end is not specified, delete one char
+        if end is None:
+            end = start + 1
+        else:
+            # Tk says not to delete in this case, but our control would.
+            if end < start:
+                return
+        if start == self.edit.GetTextLength():
+            return  # Nothing to delete.
+        old = self.edit.GetSel()[0]  # Lose a selection
+        # Hack for partial '\r\n' and UTF-8 char removal
+        start, end = self._fix_indexes(start, end)
+        self.edit.SetSel((start, end))
+        self.edit.Clear()
+        if old >= start and old < end:
+            old = start
+        elif old >= end:
+            old = old - (end - start)
+        self.edit.SetSel(old)
+
+    def bell(self):
+        win32api.MessageBeep()
+
+    def see(self, pos):
+        # Most commands we use in Scintilla actually force the selection
+        # to be seen, making this unnecessary.
+        pass
+
+    def mark_set(self, name, pos):
+        try:
+            pos = self._getoffset(pos)
+        except EmptyRange:
+            raise TextError("Empty range '%s'" % pos)
+        if name == "insert":
+            self.edit.SetSel(pos)
+        else:
+            self.marks[name] = pos
+
+    def tag_add(self, name, start, end):
+        if name != "sel":
+            raise ValueError("Only sel tag is supported")
+        try:
+            start = self._getoffset(start)
+            end = self._getoffset(end)
+        except EmptyRange:
+            raise TextError("Empty range")
+        self.edit.SetSel(start, end)
+
+    def tag_remove(self, name, start, end):
+        if name != "sel" or start != "1.0" or end != "end":
+            raise ValueError("Cant remove this tag")
+        # Turn the sel into a cursor
+        self.edit.SetSel(self.edit.GetSel()[0])
+
+    def compare(self, i1, op, i2):
+        try:
+            i1 = self._getoffset(i1)
+        except EmptyRange:
+            i1 = ""
+        try:
+            i2 = self._getoffset(i2)
+        except EmptyRange:
+            i2 = ""
+        return eval("%d%s%d" % (i1, op, i2))
+
+    def undo_block_start(self):
+        self.edit.SCIBeginUndoAction()
+
+    def undo_block_stop(self):
+        self.edit.SCIEndUndoAction()
+
+
+######################################################################
+#
+# Test related code.
+#
+######################################################################
+def TestCheck(index, edit, expected=None):
+    rc = TkIndexToOffset(index, edit, {})
+    if rc != expected:
+        print("ERROR: Index", index, ", expected", expected, "but got", rc)
+
+
+def TestGet(fr, to, t, expected):
+    got = t.get(fr, to)
+    if got != expected:
+        print(
+            "ERROR: get(%s, %s) expected %s, but got %s"
+            % (repr(fr), repr(to), repr(expected), repr(got))
+        )
+
+
+def test():
+    import pywin.framework.editor
+
+    d = pywin.framework.editor.editorTemplate.OpenDocumentFile(None)
+    e = d.GetFirstView()
+    t = TkText(e)
+    e.SCIAddText("hi there how\nare you today\r\nI hope you are well")
+    e.SetSel((4, 4))
+
+    skip = """
+	TestCheck("insert", e, 4)
+	TestCheck("insert wordstart", e, 3)
+	TestCheck("insert wordend", e, 8)
+	TestCheck("insert linestart", e, 0)
+	TestCheck("insert lineend", e, 12)
+	TestCheck("insert + 4 chars", e, 8)
+	TestCheck("insert +4c", e, 8)
+	TestCheck("insert - 2 chars", e, 2)
+	TestCheck("insert -2c", e, 2)
+	TestCheck("insert-2c", e, 2)
+	TestCheck("insert-2 c", e, 2)
+	TestCheck("insert- 2c", e, 2)
+	TestCheck("1.1", e, 1)
+	TestCheck("1.0", e, 0)
+	TestCheck("2.0", e, 13)
+	try:
+		TestCheck("sel.first", e, 0)
+		print "*** sel.first worked with an empty selection"
+	except TextError:
+		pass
+	e.SetSel((4,5))
+	TestCheck("sel.first- 2c", e, 2)
+	TestCheck("sel.last- 2c", e, 3)
+	"""
+    # Check EOL semantics
+    e.SetSel((4, 4))
+    TestGet("insert lineend", "insert lineend +1c", t, "\n")
+    e.SetSel((20, 20))
+    TestGet("insert lineend", "insert lineend +1c", t, "\n")
+    e.SetSel((35, 35))
+    TestGet("insert lineend", "insert lineend +1c", t, "\n")
+
+
+class IDLEWrapper:
+    def __init__(self, control):
+        self.text = control
+
+
+def IDLETest(extension):
+    import sys, os
+
+    modname = "pywin.idle." + extension
+    __import__(modname)
+    mod = sys.modules[modname]
+    mod.TclError = TextError
+    klass = getattr(mod, extension)
+
+    # Create a new Scintilla Window.
+    import pywin.framework.editor
+
+    d = pywin.framework.editor.editorTemplate.OpenDocumentFile(None)
+    v = d.GetFirstView()
+    fname = os.path.splitext(__file__)[0] + ".py"
+    v.SCIAddText(open(fname).read())
+    d.SetModifiedFlag(0)
+    r = klass(IDLEWrapper(TkText(v)))
+    return r
+
+
+if __name__ == "__main__":
+    test()

.venv/Lib/site-packages/pythonwin/pywin/scintilla/__init__.py

@@ -0,0 +1 @@
+# package init.

.venv/Lib/site-packages/pythonwin/pywin/scintilla/bindings.py

@@ -0,0 +1,179 @@
+from . import IDLEenvironment
+import string
+import win32ui
+import win32api
+import win32con
+from . import keycodes
+import sys
+import traceback
+
+HANDLER_ARGS_GUESS = 0
+HANDLER_ARGS_NATIVE = 1
+HANDLER_ARGS_IDLE = 2
+HANDLER_ARGS_EXTENSION = 3
+
+next_id = 5000
+
+event_to_commands = {}  # dict of integer IDs to event names.
+command_to_events = {}  # dict of event names to int IDs
+
+
+def assign_command_id(event, id=0):
+    global next_id
+    if id == 0:
+        id = event_to_commands.get(event, 0)
+        if id == 0:
+            id = next_id
+            next_id = next_id + 1
+        # Only map the ones we allocated - specified ones are assumed to have a handler
+        command_to_events[id] = event
+    event_to_commands[event] = id
+    return id
+
+
+class SendCommandHandler:
+    def __init__(self, cmd):
+        self.cmd = cmd
+
+    def __call__(self, *args):
+        win32ui.GetMainFrame().SendMessage(win32con.WM_COMMAND, self.cmd)
+
+
+class Binding:
+    def __init__(self, handler, handler_args_type):
+        self.handler = handler
+        self.handler_args_type = handler_args_type
+
+
+class BindingsManager:
+    def __init__(self, parent_view):
+        self.parent_view = parent_view
+        self.bindings = {}  # dict of Binding instances.
+        self.keymap = {}
+
+    def prepare_configure(self):
+        self.keymap = {}
+
+    def complete_configure(self):
+        for id in command_to_events.keys():
+            self.parent_view.HookCommand(self._OnCommand, id)
+
+    def close(self):
+        self.parent_view = self.bindings = self.keymap = None
+
+    def report_error(self, problem):
+        try:
+            win32ui.SetStatusText(problem, 1)
+        except win32ui.error:
+            # No status bar!
+            print(problem)
+
+    def update_keymap(self, keymap):
+        self.keymap.update(keymap)
+
+    def bind(self, event, handler, handler_args_type=HANDLER_ARGS_GUESS, cid=0):
+        if handler is None:
+            handler = SendCommandHandler(cid)
+        self.bindings[event] = self._new_binding(handler, handler_args_type)
+        self.bind_command(event, cid)
+
+    def bind_command(self, event, id=0):
+        "Binds an event to a Windows control/command ID"
+        id = assign_command_id(event, id)
+        return id
+
+    def get_command_id(self, event):
+        id = event_to_commands.get(event)
+        if id is None:
+            # See if we even have an event of that name!?
+            if event not in self.bindings:
+                return None
+            id = self.bind_command(event)
+        return id
+
+    def _OnCommand(self, id, code):
+        event = command_to_events.get(id)
+        if event is None:
+            self.report_error("No event associated with event ID %d" % id)
+            return 1
+        return self.fire(event)
+
+    def _new_binding(self, event, handler_args_type):
+        return Binding(event, handler_args_type)
+
+    def _get_IDLE_handler(self, ext, handler):
+        try:
+            instance = self.parent_view.idle.IDLEExtension(ext)
+            name = handler.replace("-", "_") + "_event"
+            return getattr(instance, name)
+        except (ImportError, AttributeError):
+            msg = "Can not find event '%s' in IDLE extension '%s'" % (handler, ext)
+            self.report_error(msg)
+            return None
+
+    def fire(self, event, event_param=None):
+        # Fire the specified event.  Result is native Pythonwin result
+        # (ie, 1==pass one, 0 or None==handled)
+
+        # First look up the event directly - if there, we are set.
+        binding = self.bindings.get(event)
+        if binding is None:
+            # If possible, find it!
+            # A native method name
+            handler = getattr(self.parent_view, event + "Event", None)
+            if handler is None:
+                # Can't decide if I should report an error??
+                self.report_error("The event name '%s' can not be found." % event)
+                # Either way, just let the default handlers grab it.
+                return 1
+            binding = self._new_binding(handler, HANDLER_ARGS_NATIVE)
+            # Cache it.
+            self.bindings[event] = binding
+
+        handler_args_type = binding.handler_args_type
+        # Now actually fire it.
+        if handler_args_type == HANDLER_ARGS_GUESS:
+            # Can't be native, as natives are never added with "guess".
+            # Must be extension or IDLE.
+            if event[0] == "<":
+                handler_args_type = HANDLER_ARGS_IDLE
+            else:
+                handler_args_type = HANDLER_ARGS_EXTENSION
+        try:
+            if handler_args_type == HANDLER_ARGS_EXTENSION:
+                args = self.parent_view.idle, event_param
+            else:
+                args = (event_param,)
+            rc = binding.handler(*args)
+            if handler_args_type == HANDLER_ARGS_IDLE:
+                # Convert to our return code.
+                if rc in [None, "break"]:
+                    rc = 0
+                else:
+                    rc = 1
+        except:
+            message = "Firing event '%s' failed." % event
+            print(message)
+            traceback.print_exc()
+            self.report_error(message)
+            rc = 1  # Let any default handlers have a go!
+        return rc
+
+    def fire_key_event(self, msg):
+        key = msg[2]
+        keyState = 0
+        if win32api.GetKeyState(win32con.VK_CONTROL) & 0x8000:
+            keyState = (
+                keyState | win32con.RIGHT_CTRL_PRESSED | win32con.LEFT_CTRL_PRESSED
+            )
+        if win32api.GetKeyState(win32con.VK_SHIFT) & 0x8000:
+            keyState = keyState | win32con.SHIFT_PRESSED
+        if win32api.GetKeyState(win32con.VK_MENU) & 0x8000:
+            keyState = keyState | win32con.LEFT_ALT_PRESSED | win32con.RIGHT_ALT_PRESSED
+        keyinfo = key, keyState
+        # Special hacks for the dead-char key on non-US keyboards.
+        # (XXX - which do not work :-(
+        event = self.keymap.get(keyinfo)
+        if event is None:
+            return 1
+        return self.fire(event, None)

.venv/Lib/site-packages/pythonwin/pywin/scintilla/config.py

@@ -0,0 +1,361 @@
+# config.py - deals with loading configuration information.
+
+# Loads config data from a .cfg file.  Also caches the compiled
+# data back into a .cfc file.
+
+# If you are wondering how to avoid needing .cfg files (eg,
+# if you are freezing Pythonwin etc) I suggest you create a
+# .py file, and put the config info in a docstring.  Then
+# pass a CStringIO file (rather than a filename) to the
+# config manager.
+import sys
+import string
+from . import keycodes
+import marshal
+import stat
+import os
+import types
+import traceback
+import pywin
+import glob
+import importlib.util
+
+import win32api
+
+debugging = 0
+if debugging:
+    import win32traceutil  # Some trace statements fire before the interactive window is open.
+
+    def trace(*args):
+        sys.stderr.write(" ".join(map(str, args)) + "\n")
+
+else:
+    trace = lambda *args: None
+
+compiled_config_version = 3
+
+
+def split_line(line, lineno):
+    comment_pos = line.find("#")
+    if comment_pos >= 0:
+        line = line[:comment_pos]
+    sep_pos = line.rfind("=")
+    if sep_pos == -1:
+        if line.strip():
+            print("Warning: Line %d: %s is an invalid entry" % (lineno, repr(line)))
+            return None, None
+        return "", ""
+    return line[:sep_pos].strip(), line[sep_pos + 1 :].strip()
+
+
+def get_section_header(line):
+    # Returns the section if the line is a section header, else None
+    if line[0] == "[":
+        end = line.find("]")
+        if end == -1:
+            end = len(line)
+        rc = line[1:end].lower()
+        try:
+            i = rc.index(":")
+            return rc[:i], rc[i + 1 :]
+        except ValueError:
+            return rc, ""
+    return None, None
+
+
+def find_config_file(f):
+    return os.path.join(pywin.__path__[0], f + ".cfg")
+
+
+def find_config_files():
+    return [
+        os.path.split(x)[1]
+        for x in [
+            os.path.splitext(x)[0]
+            for x in glob.glob(os.path.join(pywin.__path__[0], "*.cfg"))
+        ]
+    ]
+
+
+class ConfigManager:
+    def __init__(self, f):
+        self.filename = "unknown"
+        self.last_error = None
+        self.key_to_events = {}
+        if hasattr(f, "readline"):
+            fp = f
+            self.filename = "<config string>"
+            compiled_name = None
+        else:
+            try:
+                f = find_config_file(f)
+                src_stat = os.stat(f)
+            except os.error:
+                self.report_error("Config file '%s' not found" % f)
+                return
+            self.filename = f
+            self.basename = os.path.basename(f)
+            trace("Loading configuration", self.basename)
+            compiled_name = os.path.splitext(f)[0] + ".cfc"
+            try:
+                cf = open(compiled_name, "rb")
+                try:
+                    ver = marshal.load(cf)
+                    ok = compiled_config_version == ver
+                    if ok:
+                        kblayoutname = marshal.load(cf)
+                        magic = marshal.load(cf)
+                        size = marshal.load(cf)
+                        mtime = marshal.load(cf)
+                        if (
+                            magic == importlib.util.MAGIC_NUMBER
+                            and win32api.GetKeyboardLayoutName() == kblayoutname
+                            and src_stat[stat.ST_MTIME] == mtime
+                            and src_stat[stat.ST_SIZE] == size
+                        ):
+                            self.cache = marshal.load(cf)
+                            trace("Configuration loaded cached", compiled_name)
+                            return  # We are ready to roll!
+                finally:
+                    cf.close()
+            except (os.error, IOError, EOFError):
+                pass
+            fp = open(f)
+        self.cache = {}
+        lineno = 1
+        line = fp.readline()
+        while line:
+            # Skip to the next section (maybe already there!)
+            section, subsection = get_section_header(line)
+            while line and section is None:
+                line = fp.readline()
+                if not line:
+                    break
+                lineno = lineno + 1
+                section, subsection = get_section_header(line)
+            if not line:
+                break
+
+            if section == "keys":
+                line, lineno = self._load_keys(subsection, fp, lineno)
+            elif section == "extensions":
+                line, lineno = self._load_extensions(subsection, fp, lineno)
+            elif section == "idle extensions":
+                line, lineno = self._load_idle_extensions(subsection, fp, lineno)
+            elif section == "general":
+                line, lineno = self._load_general(subsection, fp, lineno)
+            else:
+                self.report_error(
+                    "Unrecognised section header '%s:%s'" % (section, subsection)
+                )
+                line = fp.readline()
+                lineno = lineno + 1
+        # Check critical data.
+        if not self.cache.get("keys"):
+            self.report_error("No keyboard definitions were loaded")
+        if not self.last_error and compiled_name:
+            try:
+                cf = open(compiled_name, "wb")
+                marshal.dump(compiled_config_version, cf)
+                marshal.dump(win32api.GetKeyboardLayoutName(), cf)
+                marshal.dump(importlib.util.MAGIC_NUMBER, cf)
+                marshal.dump(src_stat[stat.ST_SIZE], cf)
+                marshal.dump(src_stat[stat.ST_MTIME], cf)
+                marshal.dump(self.cache, cf)
+                cf.close()
+            except (IOError, EOFError):
+                pass  # Ignore errors - may be read only.
+
+    def configure(self, editor, subsections=None):
+        # Execute the extension code, and find any events.
+        # First, we "recursively" connect any we are based on.
+        if subsections is None:
+            subsections = []
+        subsections = [""] + subsections
+        general = self.get_data("general")
+        if general:
+            parents = general.get("based on", [])
+            for parent in parents:
+                trace("Configuration based on", parent, "- loading.")
+                parent = self.__class__(parent)
+                parent.configure(editor, subsections)
+                if parent.last_error:
+                    self.report_error(parent.last_error)
+
+        bindings = editor.bindings
+        codeob = self.get_data("extension code")
+        if codeob is not None:
+            ns = {}
+            try:
+                exec(codeob, ns)
+            except:
+                traceback.print_exc()
+                self.report_error("Executing extension code failed")
+                ns = None
+            if ns:
+                num = 0
+                for name, func in list(ns.items()):
+                    if type(func) == types.FunctionType and name[:1] != "_":
+                        bindings.bind(name, func)
+                        num = num + 1
+                trace("Configuration Extension code loaded", num, "events")
+        # Load the idle extensions
+        for subsection in subsections:
+            for ext in self.get_data("idle extensions", {}).get(subsection, []):
+                try:
+                    editor.idle.IDLEExtension(ext)
+                    trace("Loaded IDLE extension", ext)
+                except:
+                    self.report_error("Can not load the IDLE extension '%s'" % ext)
+
+        # Now bind up the key-map (remembering a reverse map
+        subsection_keymap = self.get_data("keys")
+        num_bound = 0
+        for subsection in subsections:
+            keymap = subsection_keymap.get(subsection, {})
+            bindings.update_keymap(keymap)
+            num_bound = num_bound + len(keymap)
+        trace("Configuration bound", num_bound, "keys")
+
+    def get_key_binding(self, event, subsections=None):
+        if subsections is None:
+            subsections = []
+        subsections = [""] + subsections
+
+        subsection_keymap = self.get_data("keys")
+        for subsection in subsections:
+            map = self.key_to_events.get(subsection)
+            if map is None:  # Build it
+                map = {}
+                keymap = subsection_keymap.get(subsection, {})
+                for key_info, map_event in list(keymap.items()):
+                    map[map_event] = key_info
+                self.key_to_events[subsection] = map
+
+            info = map.get(event)
+            if info is not None:
+                return keycodes.make_key_name(info[0], info[1])
+        return None
+
+    def report_error(self, msg):
+        self.last_error = msg
+        print("Error in %s: %s" % (self.filename, msg))
+
+    def report_warning(self, msg):
+        print("Warning in %s: %s" % (self.filename, msg))
+
+    def _readline(self, fp, lineno, bStripComments=1):
+        line = fp.readline()
+        lineno = lineno + 1
+        if line:
+            bBreak = (
+                get_section_header(line)[0] is not None
+            )  # A new section is starting
+            if bStripComments and not bBreak:
+                pos = line.find("#")
+                if pos >= 0:
+                    line = line[:pos] + "\n"
+        else:
+            bBreak = 1
+        return line, lineno, bBreak
+
+    def get_data(self, name, default=None):
+        return self.cache.get(name, default)
+
+    def _save_data(self, name, data):
+        self.cache[name] = data
+        return data
+
+    def _load_general(self, sub_section, fp, lineno):
+        map = {}
+        while 1:
+            line, lineno, bBreak = self._readline(fp, lineno)
+            if bBreak:
+                break
+
+            key, val = split_line(line, lineno)
+            if not key:
+                continue
+            key = key.lower()
+            l = map.get(key, [])
+            l.append(val)
+            map[key] = l
+        self._save_data("general", map)
+        return line, lineno
+
+    def _load_keys(self, sub_section, fp, lineno):
+        # Builds a nested dictionary of
+        # (scancode, flags) = event_name
+        main_map = self.get_data("keys", {})
+        map = main_map.get(sub_section, {})
+        while 1:
+            line, lineno, bBreak = self._readline(fp, lineno)
+            if bBreak:
+                break
+
+            key, event = split_line(line, lineno)
+            if not event:
+                continue
+            sc, flag = keycodes.parse_key_name(key)
+            if sc is None:
+                self.report_warning("Line %d: Invalid key name '%s'" % (lineno, key))
+            else:
+                map[sc, flag] = event
+        main_map[sub_section] = map
+        self._save_data("keys", main_map)
+        return line, lineno
+
+    def _load_extensions(self, sub_section, fp, lineno):
+        start_lineno = lineno
+        lines = []
+        while 1:
+            line, lineno, bBreak = self._readline(fp, lineno, 0)
+            if bBreak:
+                break
+            lines.append(line)
+        try:
+            c = compile(
+                "\n" * start_lineno + "".join(lines),  # produces correct tracebacks
+                self.filename,
+                "exec",
+            )
+            self._save_data("extension code", c)
+        except SyntaxError as details:
+            errlineno = details.lineno + start_lineno
+            # Should handle syntax errors better here, and offset the lineno.
+            self.report_error(
+                "Compiling extension code failed:\r\nFile: %s\r\nLine %d\r\n%s"
+                % (details.filename, errlineno, details.msg)
+            )
+        return line, lineno
+
+    def _load_idle_extensions(self, sub_section, fp, lineno):
+        extension_map = self.get_data("idle extensions")
+        if extension_map is None:
+            extension_map = {}
+        extensions = []
+        while 1:
+            line, lineno, bBreak = self._readline(fp, lineno)
+            if bBreak:
+                break
+            line = line.strip()
+            if line:
+                extensions.append(line)
+        extension_map[sub_section] = extensions
+        self._save_data("idle extensions", extension_map)
+        return line, lineno
+
+
+def test():
+    import time
+
+    start = time.clock()
+    f = "default"
+    cm = ConfigManager(f)
+    map = cm.get_data("keys")
+    took = time.clock() - start
+    print("Loaded %s items in %.4f secs" % (len(map), took))
+
+
+if __name__ == "__main__":
+    test()